From 5d3c63cac688aaf841ced93588e400736f838521 Mon Sep 17 00:00:00 2001 From: Martin Buchholz Date: Tue, 1 Jul 2014 13:29:24 -0700 Subject: [PATCH 01/61] 8043780: Use open(O_CLOEXEC) instead of fcntl(FD_CLOEXEC) Use open(O_CLOEXEC) where available; fall back to FD_CLOEXEC when necessary Reviewed-by: rasbold, dholmes --- hotspot/src/os/linux/vm/os_linux.cpp | 64 +++++++++++++++++----------- 1 file changed, 39 insertions(+), 25 deletions(-) diff --git a/hotspot/src/os/linux/vm/os_linux.cpp b/hotspot/src/os/linux/vm/os_linux.cpp index 3e5dc4066d5..186d5a811a6 100644 --- a/hotspot/src/os/linux/vm/os_linux.cpp +++ b/hotspot/src/os/linux/vm/os_linux.cpp @@ -5103,9 +5103,38 @@ int os::open(const char *path, int oflag, int mode) { errno = ENAMETOOLONG; return -1; } - int fd; - fd = ::open64(path, oflag, mode); + // All file descriptors that are opened in the Java process and not + // specifically destined for a subprocess should have the close-on-exec + // flag set. If we don't set it, then careless 3rd party native code + // might fork and exec without closing all appropriate file descriptors + // (e.g. as we do in closeDescriptors in UNIXProcess.c), and this in + // turn might: + // + // - cause end-of-file to fail to be detected on some file + // descriptors, resulting in mysterious hangs, or + // + // - might cause an fopen in the subprocess to fail on a system + // suffering from bug 1085341. + // + // (Yes, the default setting of the close-on-exec flag is a Unix + // design flaw) + // + // See: + // 1085341: 32-bit stdio routines should support file descriptors >255 + // 4843136: (process) pipe file descriptor from Runtime.exec not being closed + // 6339493: (process) Runtime.exec does not close all file descriptors on Solaris 9 + // + // Modern Linux kernels (after 2.6.23 2007) support O_CLOEXEC with open(). + // O_CLOEXEC is preferable to using FD_CLOEXEC on an open file descriptor + // because it saves a system call and removes a small window where the flag + // is unset. On ancient Linux kernels the O_CLOEXEC flag will be ignored + // and we fall back to using FD_CLOEXEC (see below). +#ifdef O_CLOEXEC + oflag |= O_CLOEXEC; +#endif + + int fd = ::open64(path, oflag, mode); if (fd == -1) return -1; //If the open succeeded, the file might still be a directory @@ -5126,32 +5155,17 @@ int os::open(const char *path, int oflag, int mode) { } } - // All file descriptors that are opened in the JVM and not - // specifically destined for a subprocess should have the - // close-on-exec flag set. If we don't set it, then careless 3rd - // party native code might fork and exec without closing all - // appropriate file descriptors (e.g. as we do in closeDescriptors in - // UNIXProcess.c), and this in turn might: - // - // - cause end-of-file to fail to be detected on some file - // descriptors, resulting in mysterious hangs, or - // - // - might cause an fopen in the subprocess to fail on a system - // suffering from bug 1085341. - // - // (Yes, the default setting of the close-on-exec flag is a Unix - // design flaw) - // - // See: - // 1085341: 32-bit stdio routines should support file descriptors >255 - // 4843136: (process) pipe file descriptor from Runtime.exec not being closed - // 6339493: (process) Runtime.exec does not close all file descriptors on Solaris 9 - // #ifdef FD_CLOEXEC - { + // Validate that the use of the O_CLOEXEC flag on open above worked. + // With recent kernels, we will perform this check exactly once. + static sig_atomic_t O_CLOEXEC_is_known_to_work = 0; + if (!O_CLOEXEC_is_known_to_work) { int flags = ::fcntl(fd, F_GETFD); if (flags != -1) { - ::fcntl(fd, F_SETFD, flags | FD_CLOEXEC); + if ((flags & FD_CLOEXEC) != 0) + O_CLOEXEC_is_known_to_work = 1; + else + ::fcntl(fd, F_SETFD, flags | FD_CLOEXEC); } } #endif From a87b3d13df46de7b812e13deb2f01723f1007b1b Mon Sep 17 00:00:00 2001 From: Tobias Hartmann Date: Thu, 16 Oct 2014 12:57:04 +0200 Subject: [PATCH 02/61] 8059846: InstanceKlass should use MutexLockerEx to acquire OsrList_lock Replace explicit locking of OsrList_lock by a MutexLockerEx instantiation. Reviewed-by: kvn, anoll, drchase, dholmes, dlong, coleenp --- hotspot/src/share/vm/oops/instanceKlass.cpp | 32 +++++++++------------ 1 file changed, 13 insertions(+), 19 deletions(-) diff --git a/hotspot/src/share/vm/oops/instanceKlass.cpp b/hotspot/src/share/vm/oops/instanceKlass.cpp index 8ea08cd54c7..38c2c8727d6 100644 --- a/hotspot/src/share/vm/oops/instanceKlass.cpp +++ b/hotspot/src/share/vm/oops/instanceKlass.cpp @@ -2779,19 +2779,18 @@ void InstanceKlass::adjust_default_methods(Method** old_methods, Method** new_me // On-stack replacement stuff void InstanceKlass::add_osr_nmethod(nmethod* n) { // only one compilation can be active - NEEDS_CLEANUP - // This is a short non-blocking critical region, so the no safepoint check is ok. - OsrList_lock->lock_without_safepoint_check(); - assert(n->is_osr_method(), "wrong kind of nmethod"); - n->set_osr_link(osr_nmethods_head()); - set_osr_nmethods_head(n); - // Raise the highest osr level if necessary - if (TieredCompilation) { - Method* m = n->method(); - m->set_highest_osr_comp_level(MAX2(m->highest_osr_comp_level(), n->comp_level())); + { + // This is a short non-blocking critical region, so the no safepoint check is ok. + MutexLockerEx ml(OsrList_lock, Mutex::_no_safepoint_check_flag); + assert(n->is_osr_method(), "wrong kind of nmethod"); + n->set_osr_link(osr_nmethods_head()); + set_osr_nmethods_head(n); + // Raise the highest osr level if necessary + if (TieredCompilation) { + Method* m = n->method(); + m->set_highest_osr_comp_level(MAX2(m->highest_osr_comp_level(), n->comp_level())); + } } - // Remember to unlock again - OsrList_lock->unlock(); // Get rid of the osr methods for the same bci that have lower levels. if (TieredCompilation) { @@ -2807,7 +2806,7 @@ void InstanceKlass::add_osr_nmethod(nmethod* n) { void InstanceKlass::remove_osr_nmethod(nmethod* n) { // This is a short non-blocking critical region, so the no safepoint check is ok. - OsrList_lock->lock_without_safepoint_check(); + MutexLockerEx ml(OsrList_lock, Mutex::_no_safepoint_check_flag); assert(n->is_osr_method(), "wrong kind of nmethod"); nmethod* last = NULL; nmethod* cur = osr_nmethods_head(); @@ -2844,13 +2843,11 @@ void InstanceKlass::remove_osr_nmethod(nmethod* n) { } m->set_highest_osr_comp_level(max_level); } - // Remember to unlock again - OsrList_lock->unlock(); } nmethod* InstanceKlass::lookup_osr_nmethod(const Method* m, int bci, int comp_level, bool match_level) const { // This is a short non-blocking critical region, so the no safepoint check is ok. - OsrList_lock->lock_without_safepoint_check(); + MutexLockerEx ml(OsrList_lock, Mutex::_no_safepoint_check_flag); nmethod* osr = osr_nmethods_head(); nmethod* best = NULL; while (osr != NULL) { @@ -2866,14 +2863,12 @@ nmethod* InstanceKlass::lookup_osr_nmethod(const Method* m, int bci, int comp_le if (match_level) { if (osr->comp_level() == comp_level) { // Found a match - return it. - OsrList_lock->unlock(); return osr; } } else { if (best == NULL || (osr->comp_level() > best->comp_level())) { if (osr->comp_level() == CompLevel_highest_tier) { // Found the best possible - return it. - OsrList_lock->unlock(); return osr; } best = osr; @@ -2882,7 +2877,6 @@ nmethod* InstanceKlass::lookup_osr_nmethod(const Method* m, int bci, int comp_le } osr = osr->osr_link(); } - OsrList_lock->unlock(); if (best != NULL && best->comp_level() >= comp_level && match_level == false) { return best; } From bdd3c3df3a7ab4c1683392771fadb307d74d97ba Mon Sep 17 00:00:00 2001 From: Tobias Hartmann Date: Fri, 17 Oct 2014 08:56:07 +0200 Subject: [PATCH 03/61] 8060196: 'CodeHeap is full' warning suggests to increase wrong code heap size Fixed 'CodeHeap is full' warning to output the right CodeHeapSize flag. Reviewed-by: kvn, anoll --- hotspot/src/share/vm/code/codeCache.cpp | 21 ++++++++++++++++++--- hotspot/src/share/vm/code/codeCache.hpp | 2 ++ 2 files changed, 20 insertions(+), 3 deletions(-) diff --git a/hotspot/src/share/vm/code/codeCache.cpp b/hotspot/src/share/vm/code/codeCache.cpp index b21604f8549..2b8845a6d65 100644 --- a/hotspot/src/share/vm/code/codeCache.cpp +++ b/hotspot/src/share/vm/code/codeCache.cpp @@ -267,6 +267,22 @@ bool CodeCache::heap_available(int code_blob_type) { } } +const char* CodeCache::get_code_heap_flag_name(int code_blob_type) { + switch(code_blob_type) { + case CodeBlobType::NonNMethod: + return "NonNMethodCodeHeapSize"; + break; + case CodeBlobType::MethodNonProfiled: + return "NonProfiledCodeHeapSize"; + break; + case CodeBlobType::MethodProfiled: + return "ProfiledCodeHeapSize"; + break; + } + ShouldNotReachHere(); + return NULL; +} + void CodeCache::add_heap(ReservedSpace rs, const char* name, size_t size_initial, int code_blob_type) { // Check if heap is needed if (!heap_available(code_blob_type)) { @@ -1011,9 +1027,8 @@ void CodeCache::report_codemem_full(int code_blob_type, bool print) { // Not yet reported for this heap, report heap->report_full(); if (SegmentedCodeCache) { - warning("%s is full. Compiler has been disabled.", CodeCache::get_code_heap_name(code_blob_type)); - warning("Try increasing the code heap size using -XX:%s=", - (code_blob_type == CodeBlobType::MethodNonProfiled) ? "NonProfiledCodeHeapSize" : "ProfiledCodeHeapSize"); + warning("%s is full. Compiler has been disabled.", get_code_heap_name(code_blob_type)); + warning("Try increasing the code heap size using -XX:%s=", get_code_heap_flag_name(code_blob_type)); } else { warning("CodeCache is full. Compiler has been disabled."); warning("Try increasing the code cache size using -XX:ReservedCodeCacheSize="); diff --git a/hotspot/src/share/vm/code/codeCache.hpp b/hotspot/src/share/vm/code/codeCache.hpp index 87fc1e8e839..b8b119c3b86 100644 --- a/hotspot/src/share/vm/code/codeCache.hpp +++ b/hotspot/src/share/vm/code/codeCache.hpp @@ -100,6 +100,8 @@ class CodeCache : AllStatic { static void add_heap(ReservedSpace rs, const char* name, size_t size_initial, int code_blob_type); static CodeHeap* get_code_heap(CodeBlob* cb); // Returns the CodeHeap for the given CodeBlob static CodeHeap* get_code_heap(int code_blob_type); // Returns the CodeHeap for the given CodeBlobType + // Returns the name of the VM option to set the size of the corresponding CodeHeap + static const char* get_code_heap_flag_name(int code_blob_type); static bool heap_available(int code_blob_type); // Returns true if an own CodeHeap for the given CodeBlobType is available static ReservedCodeSpace reserve_heap_memory(size_t size); // Reserves one continuous chunk of memory for the CodeHeaps From 415f2cd0750f703d9533e821b1a0cebf51709511 Mon Sep 17 00:00:00 2001 From: Tobias Hartmann Date: Fri, 17 Oct 2014 10:04:45 +0200 Subject: [PATCH 04/61] 8060454: [TESTBUG] Whitebox tests fail with -XX:CompileThreshold=100 Move the call to 'waitAndDeoptimize' from the warmup methods to the osr triggering methods to make sure that no non-osr compilation is in the queue after warmup. Reviewed-by: kvn --- .../whitebox/CompilerWhiteBoxTest.java | 21 ++++++++++++++----- 1 file changed, 16 insertions(+), 5 deletions(-) diff --git a/hotspot/test/compiler/whitebox/CompilerWhiteBoxTest.java b/hotspot/test/compiler/whitebox/CompilerWhiteBoxTest.java index f1a23314703..a39a079e355 100644 --- a/hotspot/test/compiler/whitebox/CompilerWhiteBoxTest.java +++ b/hotspot/test/compiler/whitebox/CompilerWhiteBoxTest.java @@ -530,7 +530,7 @@ enum SimpleTestCase implements CompilerWhiteBoxTest.TestCase { * @param e Executable * @throws Exception */ - private static void waitAndDeoptimize(Executable e) throws Exception { + private static void waitAndDeoptimize(Executable e) { CompilerWhiteBoxTest.waitBackgroundCompilation(e); if (WhiteBox.getWhiteBox().isMethodQueuedForCompilation(e)) { throw new RuntimeException(e + " must not be in queue"); @@ -554,8 +554,6 @@ enum SimpleTestCase implements CompilerWhiteBoxTest.TestCase { for (long i = 0; i < CompilerWhiteBoxTest.OSR_WARMUP; ++i) { result += (int)m.invoke(helper, 1); } - // Deoptimize non-osr versions - waitAndDeoptimize(m); return result; } @@ -573,8 +571,6 @@ enum SimpleTestCase implements CompilerWhiteBoxTest.TestCase { for (long i = 0; i < CompilerWhiteBoxTest.OSR_WARMUP; ++i) { result += c.newInstance(null, 1).hashCode(); } - // Deoptimize non-osr versions - waitAndDeoptimize(c); return result; } @@ -623,6 +619,11 @@ enum SimpleTestCase implements CompilerWhiteBoxTest.TestCase { } private static int osrStaticMethod(long limit) { + if (limit != 1) { + // Make sure there is no compiled version after warmup + waitAndDeoptimize(OSR_STATIC); + } + // Trigger osr compilation int result = 0; for (long i = 0; i < limit; ++i) { result += staticMethod(); @@ -631,6 +632,11 @@ enum SimpleTestCase implements CompilerWhiteBoxTest.TestCase { } private int osrMethod(long limit) { + if (limit != 1) { + // Make sure there is no compiled version after warmup + waitAndDeoptimize(OSR_METHOD); + } + // Trigger osr compilation int result = 0; for (long i = 0; i < limit; ++i) { result += method(); @@ -647,6 +653,11 @@ enum SimpleTestCase implements CompilerWhiteBoxTest.TestCase { // for OSR constructor test case private Helper(Object o, long limit) { + if (limit != 1) { + // Make sure there is no compiled version after warmup + waitAndDeoptimize(OSR_CONSTRUCTOR); + } + // Trigger osr compilation int result = 0; for (long i = 0; i < limit; ++i) { result += method(); From 44d1787a26bcaab1a85d7a4c54f4dd6c341e72de Mon Sep 17 00:00:00 2001 From: Vladimir Kozlov Date: Fri, 17 Oct 2014 15:35:25 -0700 Subject: [PATCH 05/61] 8059139: It should be possible to explicitly disable usage of TZCNT instr w/ -XX:-UseBMI1Instructions Reviewed-by: iveresov --- hotspot/src/cpu/x86/vm/vm_version_x86.cpp | 9 +++++++-- 1 file changed, 7 insertions(+), 2 deletions(-) diff --git a/hotspot/src/cpu/x86/vm/vm_version_x86.cpp b/hotspot/src/cpu/x86/vm/vm_version_x86.cpp index e73f93c705f..8d575c2d4bd 100644 --- a/hotspot/src/cpu/x86/vm/vm_version_x86.cpp +++ b/hotspot/src/cpu/x86/vm/vm_version_x86.cpp @@ -865,14 +865,19 @@ void VM_Version::get_processor_features() { if (supports_bmi1()) { // tzcnt does not require VEX prefix if (FLAG_IS_DEFAULT(UseCountTrailingZerosInstruction)) { - UseCountTrailingZerosInstruction = true; + if (!UseBMI1Instructions && !FLAG_IS_DEFAULT(UseBMI1Instructions)) { + // Don't use tzcnt if BMI1 is switched off on command line. + UseCountTrailingZerosInstruction = false; + } else { + UseCountTrailingZerosInstruction = true; + } } } else if (UseCountTrailingZerosInstruction) { warning("tzcnt instruction is not available on this CPU"); FLAG_SET_DEFAULT(UseCountTrailingZerosInstruction, false); } - // BMI instructions use an encoding with VEX prefix. + // BMI instructions (except tzcnt) use an encoding with VEX prefix. // VEX prefix is generated only when AVX > 0. if (supports_bmi1() && supports_avx()) { if (FLAG_IS_DEFAULT(UseBMI1Instructions)) { From da37592acbe89eac39ebb5af1e25f2a80bee629c Mon Sep 17 00:00:00 2001 From: Vladimir Kozlov Date: Tue, 21 Oct 2014 12:37:48 -0700 Subject: [PATCH 06/61] 8061563: Typo in test/compiler/exceptions/CatchInlineExceptions.java Fix typo Reviewed-by: iveresov --- hotspot/test/compiler/exceptions/CatchInlineExceptions.java | 2 +- 1 file changed, 1 insertion(+), 1 deletion(-) diff --git a/hotspot/test/compiler/exceptions/CatchInlineExceptions.java b/hotspot/test/compiler/exceptions/CatchInlineExceptions.java index 01be927cf7b..64e986f55c0 100644 --- a/hotspot/test/compiler/exceptions/CatchInlineExceptions.java +++ b/hotspot/test/compiler/exceptions/CatchInlineExceptions.java @@ -70,7 +70,7 @@ public class CatchInlineExceptions { if (counter1 != 0) { throw new RuntimeException("Failed: counter1(" + counter1 + ") != 0"); } - if (counter2 != counter) { + if (counter2 != counter0) { throw new RuntimeException("Failed: counter2(" + counter2 + ") != counter0(" + counter0 + ")"); } if (counter2 != counter) { From 7b42cc8306d1b52212341cbe06b02e5a15c783bf Mon Sep 17 00:00:00 2001 From: Igor Veresov Date: Thu, 23 Oct 2014 09:41:59 -1000 Subject: [PATCH 07/61] 8047383: SIGBUS in C2 compiled method weblogic.wsee.jaxws.framework.jaxrpc.EnvironmentFactory$SimulatedWsdlDefinitions. Do not rematerialize constant table loads in PhaseAggressiveCoalesce::insert_copies() Reviewed-by: kvn --- hotspot/src/share/vm/opto/coalesce.cpp | 12 +++++++----- 1 file changed, 7 insertions(+), 5 deletions(-) diff --git a/hotspot/src/share/vm/opto/coalesce.cpp b/hotspot/src/share/vm/opto/coalesce.cpp index 57a20bcb638..1e8af4e27ee 100644 --- a/hotspot/src/share/vm/opto/coalesce.cpp +++ b/hotspot/src/share/vm/opto/coalesce.cpp @@ -281,9 +281,11 @@ void PhaseAggressiveCoalesce::insert_copies( Matcher &matcher ) { Block *pred = _phc._cfg.get_block_for_node(b->pred(j)); Node *copy; assert(!m->is_Con() || m->is_Mach(), "all Con must be Mach"); - // Rematerialize constants instead of copying them - if( m->is_Mach() && m->as_Mach()->is_Con() && - m->as_Mach()->rematerialize() ) { + // Rematerialize constants instead of copying them. + // We do this only for immediate constants, we avoid constant table loads + // because that will unsafely extend the live range of the constant table base. + if (m->is_Mach() && m->as_Mach()->is_Con() && !m->as_Mach()->is_MachConstant() && + m->as_Mach()->rematerialize()) { copy = m->clone(); // Insert the copy in the predecessor basic block pred->add_inst(copy); @@ -317,8 +319,8 @@ void PhaseAggressiveCoalesce::insert_copies( Matcher &matcher ) { assert(!m->is_Con() || m->is_Mach(), "all Con must be Mach"); // At this point it is unsafe to extend live ranges (6550579). // Rematerialize only constants as we do for Phi above. - if(m->is_Mach() && m->as_Mach()->is_Con() && - m->as_Mach()->rematerialize()) { + if (m->is_Mach() && m->as_Mach()->is_Con() && !m->as_Mach()->is_MachConstant() && + m->as_Mach()->rematerialize()) { copy = m->clone(); // Insert the copy in the basic block, just before us b->insert_node(copy, l++); From 009e923e04efaafb7b8183914f3d66a67958189e Mon Sep 17 00:00:00 2001 From: Tobias Hartmann Date: Fri, 24 Oct 2014 08:22:33 +0200 Subject: [PATCH 08/61] 8061443: Whitebox get*VMFlag() methods fail with develop flags in product builds Changed 'get*VMFlag' to return all flags. Added methods 'isLockedVMFlag' and 'isConstantVMFlag' and adapted tests. Reviewed-by: kvn, dholmes, sla --- hotspot/src/share/vm/prims/whitebox.cpp | 24 ++++++++- hotspot/src/share/vm/runtime/globals.cpp | 28 +++++----- hotspot/src/share/vm/runtime/globals.hpp | 28 +++++----- .../whitebox/sun/hotspot/WhiteBox.java | 2 + .../whitebox/vm_flags/BooleanTest.java | 2 + .../whitebox/vm_flags/IntxTest.java | 2 + .../whitebox/vm_flags/StringTest.java | 2 + .../whitebox/vm_flags/UintxTest.java | 2 + .../whitebox/vm_flags/VmFlagTest.java | 53 +++++++++++++------ 9 files changed, 97 insertions(+), 46 deletions(-) diff --git a/hotspot/src/share/vm/prims/whitebox.cpp b/hotspot/src/share/vm/prims/whitebox.cpp index 89b9807c4ca..5ea1b11e28a 100644 --- a/hotspot/src/share/vm/prims/whitebox.cpp +++ b/hotspot/src/share/vm/prims/whitebox.cpp @@ -566,13 +566,13 @@ WB_ENTRY(void, WB_ClearMethodState(JNIEnv* env, jobject o, jobject method)) WB_END template -static bool GetVMFlag(JavaThread* thread, JNIEnv* env, jstring name, T* value, bool (*TAt)(const char*, T*)) { +static bool GetVMFlag(JavaThread* thread, JNIEnv* env, jstring name, T* value, bool (*TAt)(const char*, T*, bool, bool)) { if (name == NULL) { return false; } ThreadToNativeFromVM ttnfv(thread); // can't be in VM when we call JNI const char* flag_name = env->GetStringUTFChars(name, NULL); - bool result = (*TAt)(flag_name, value); + bool result = (*TAt)(flag_name, value, true, true); env->ReleaseStringUTFChars(name, flag_name); return result; } @@ -619,6 +619,24 @@ static jobject doubleBox(JavaThread* thread, JNIEnv* env, jdouble value) { return box(thread, env, vmSymbols::java_lang_Double(), vmSymbols::Double_valueOf_signature(), value); } +static Flag* getVMFlag(JavaThread* thread, JNIEnv* env, jstring name) { + ThreadToNativeFromVM ttnfv(thread); // can't be in VM when we call JNI + const char* flag_name = env->GetStringUTFChars(name, NULL); + Flag* result = Flag::find_flag(flag_name, strlen(flag_name), true, true); + env->ReleaseStringUTFChars(name, flag_name); + return result; +} + +WB_ENTRY(jboolean, WB_IsConstantVMFlag(JNIEnv* env, jobject o, jstring name)) + Flag* flag = getVMFlag(thread, env, name); + return (flag != NULL) && flag->is_constant_in_binary(); +WB_END + +WB_ENTRY(jboolean, WB_IsLockedVMFlag(JNIEnv* env, jobject o, jstring name)) + Flag* flag = getVMFlag(thread, env, name); + return (flag != NULL) && !(flag->is_unlocked() || flag->is_unlocker()); +WB_END + WB_ENTRY(jobject, WB_GetBooleanVMFlag(JNIEnv* env, jobject o, jstring name)) bool result; if (GetVMFlag (thread, env, name, &result, &CommandLineFlags::boolAt)) { @@ -1018,6 +1036,8 @@ static JNINativeMethod methods[] = { CC"(Ljava/lang/reflect/Executable;II)Z", (void*)&WB_EnqueueMethodForCompilation}, {CC"clearMethodState", CC"(Ljava/lang/reflect/Executable;)V", (void*)&WB_ClearMethodState}, + {CC"isConstantVMFlag", CC"(Ljava/lang/String;)Z", (void*)&WB_IsConstantVMFlag}, + {CC"isLockedVMFlag", CC"(Ljava/lang/String;)Z", (void*)&WB_IsLockedVMFlag}, {CC"setBooleanVMFlag", CC"(Ljava/lang/String;Z)V",(void*)&WB_SetBooleanVMFlag}, {CC"setIntxVMFlag", CC"(Ljava/lang/String;J)V",(void*)&WB_SetIntxVMFlag}, {CC"setUintxVMFlag", CC"(Ljava/lang/String;J)V",(void*)&WB_SetUintxVMFlag}, diff --git a/hotspot/src/share/vm/runtime/globals.cpp b/hotspot/src/share/vm/runtime/globals.cpp index c5564c913c9..81bf15d0f0c 100644 --- a/hotspot/src/share/vm/runtime/globals.cpp +++ b/hotspot/src/share/vm/runtime/globals.cpp @@ -634,8 +634,8 @@ static void trace_flag_changed(const char* name, const T old_value, const T new_ e.commit(); } -bool CommandLineFlags::boolAt(const char* name, size_t len, bool* value) { - Flag* result = Flag::find_flag(name, len); +bool CommandLineFlags::boolAt(const char* name, size_t len, bool* value, bool allow_locked, bool return_flag) { + Flag* result = Flag::find_flag(name, len, allow_locked, return_flag); if (result == NULL) return false; if (!result->is_bool()) return false; *value = result->get_bool(); @@ -662,8 +662,8 @@ void CommandLineFlagsEx::boolAtPut(CommandLineFlagWithType flag, bool value, Fla faddr->set_origin(origin); } -bool CommandLineFlags::intxAt(const char* name, size_t len, intx* value) { - Flag* result = Flag::find_flag(name, len); +bool CommandLineFlags::intxAt(const char* name, size_t len, intx* value, bool allow_locked, bool return_flag) { + Flag* result = Flag::find_flag(name, len, allow_locked, return_flag); if (result == NULL) return false; if (!result->is_intx()) return false; *value = result->get_intx(); @@ -690,8 +690,8 @@ void CommandLineFlagsEx::intxAtPut(CommandLineFlagWithType flag, intx value, Fla faddr->set_origin(origin); } -bool CommandLineFlags::uintxAt(const char* name, size_t len, uintx* value) { - Flag* result = Flag::find_flag(name, len); +bool CommandLineFlags::uintxAt(const char* name, size_t len, uintx* value, bool allow_locked, bool return_flag) { + Flag* result = Flag::find_flag(name, len, allow_locked, return_flag); if (result == NULL) return false; if (!result->is_uintx()) return false; *value = result->get_uintx(); @@ -718,8 +718,8 @@ void CommandLineFlagsEx::uintxAtPut(CommandLineFlagWithType flag, uintx value, F faddr->set_origin(origin); } -bool CommandLineFlags::uint64_tAt(const char* name, size_t len, uint64_t* value) { - Flag* result = Flag::find_flag(name, len); +bool CommandLineFlags::uint64_tAt(const char* name, size_t len, uint64_t* value, bool allow_locked, bool return_flag) { + Flag* result = Flag::find_flag(name, len, allow_locked, return_flag); if (result == NULL) return false; if (!result->is_uint64_t()) return false; *value = result->get_uint64_t(); @@ -746,8 +746,8 @@ void CommandLineFlagsEx::uint64_tAtPut(CommandLineFlagWithType flag, uint64_t va faddr->set_origin(origin); } -bool CommandLineFlags::size_tAt(const char* name, size_t len, size_t* value) { - Flag* result = Flag::find_flag(name, len); +bool CommandLineFlags::size_tAt(const char* name, size_t len, size_t* value, bool allow_locked, bool return_flag) { + Flag* result = Flag::find_flag(name, len, allow_locked, return_flag); if (result == NULL) return false; if (!result->is_size_t()) return false; *value = result->get_size_t(); @@ -774,8 +774,8 @@ void CommandLineFlagsEx::size_tAtPut(CommandLineFlagWithType flag, size_t value, faddr->set_origin(origin); } -bool CommandLineFlags::doubleAt(const char* name, size_t len, double* value) { - Flag* result = Flag::find_flag(name, len); +bool CommandLineFlags::doubleAt(const char* name, size_t len, double* value, bool allow_locked, bool return_flag) { + Flag* result = Flag::find_flag(name, len, allow_locked, return_flag); if (result == NULL) return false; if (!result->is_double()) return false; *value = result->get_double(); @@ -802,8 +802,8 @@ void CommandLineFlagsEx::doubleAtPut(CommandLineFlagWithType flag, double value, faddr->set_origin(origin); } -bool CommandLineFlags::ccstrAt(const char* name, size_t len, ccstr* value) { - Flag* result = Flag::find_flag(name, len); +bool CommandLineFlags::ccstrAt(const char* name, size_t len, ccstr* value, bool allow_locked, bool return_flag) { + Flag* result = Flag::find_flag(name, len, allow_locked, return_flag); if (result == NULL) return false; if (!result->is_ccstr()) return false; *value = result->get_ccstr(); diff --git a/hotspot/src/share/vm/runtime/globals.hpp b/hotspot/src/share/vm/runtime/globals.hpp index bbab0184627..f219767d9ab 100644 --- a/hotspot/src/share/vm/runtime/globals.hpp +++ b/hotspot/src/share/vm/runtime/globals.hpp @@ -379,38 +379,38 @@ class SizeTFlagSetting { class CommandLineFlags { public: - static bool boolAt(const char* name, size_t len, bool* value); - static bool boolAt(const char* name, bool* value) { return boolAt(name, strlen(name), value); } + static bool boolAt(const char* name, size_t len, bool* value, bool allow_locked = false, bool return_flag = false); + static bool boolAt(const char* name, bool* value, bool allow_locked = false, bool return_flag = false) { return boolAt(name, strlen(name), value, allow_locked, return_flag); } static bool boolAtPut(const char* name, size_t len, bool* value, Flag::Flags origin); static bool boolAtPut(const char* name, bool* value, Flag::Flags origin) { return boolAtPut(name, strlen(name), value, origin); } - static bool intxAt(const char* name, size_t len, intx* value); - static bool intxAt(const char* name, intx* value) { return intxAt(name, strlen(name), value); } + static bool intxAt(const char* name, size_t len, intx* value, bool allow_locked = false, bool return_flag = false); + static bool intxAt(const char* name, intx* value, bool allow_locked = false, bool return_flag = false) { return intxAt(name, strlen(name), value, allow_locked, return_flag); } static bool intxAtPut(const char* name, size_t len, intx* value, Flag::Flags origin); static bool intxAtPut(const char* name, intx* value, Flag::Flags origin) { return intxAtPut(name, strlen(name), value, origin); } - static bool uintxAt(const char* name, size_t len, uintx* value); - static bool uintxAt(const char* name, uintx* value) { return uintxAt(name, strlen(name), value); } + static bool uintxAt(const char* name, size_t len, uintx* value, bool allow_locked = false, bool return_flag = false); + static bool uintxAt(const char* name, uintx* value, bool allow_locked = false, bool return_flag = false) { return uintxAt(name, strlen(name), value, allow_locked, return_flag); } static bool uintxAtPut(const char* name, size_t len, uintx* value, Flag::Flags origin); static bool uintxAtPut(const char* name, uintx* value, Flag::Flags origin) { return uintxAtPut(name, strlen(name), value, origin); } - static bool size_tAt(const char* name, size_t len, size_t* value); - static bool size_tAt(const char* name, size_t* value) { return size_tAt(name, strlen(name), value); } + static bool size_tAt(const char* name, size_t len, size_t* value, bool allow_locked = false, bool return_flag = false); + static bool size_tAt(const char* name, size_t* value, bool allow_locked = false, bool return_flag = false) { return size_tAt(name, strlen(name), value, allow_locked, return_flag); } static bool size_tAtPut(const char* name, size_t len, size_t* value, Flag::Flags origin); static bool size_tAtPut(const char* name, size_t* value, Flag::Flags origin) { return size_tAtPut(name, strlen(name), value, origin); } - static bool uint64_tAt(const char* name, size_t len, uint64_t* value); - static bool uint64_tAt(const char* name, uint64_t* value) { return uint64_tAt(name, strlen(name), value); } + static bool uint64_tAt(const char* name, size_t len, uint64_t* value, bool allow_locked = false, bool return_flag = false); + static bool uint64_tAt(const char* name, uint64_t* value, bool allow_locked = false, bool return_flag = false) { return uint64_tAt(name, strlen(name), value, allow_locked, return_flag); } static bool uint64_tAtPut(const char* name, size_t len, uint64_t* value, Flag::Flags origin); static bool uint64_tAtPut(const char* name, uint64_t* value, Flag::Flags origin) { return uint64_tAtPut(name, strlen(name), value, origin); } - static bool doubleAt(const char* name, size_t len, double* value); - static bool doubleAt(const char* name, double* value) { return doubleAt(name, strlen(name), value); } + static bool doubleAt(const char* name, size_t len, double* value, bool allow_locked = false, bool return_flag = false); + static bool doubleAt(const char* name, double* value, bool allow_locked = false, bool return_flag = false) { return doubleAt(name, strlen(name), value, allow_locked, return_flag); } static bool doubleAtPut(const char* name, size_t len, double* value, Flag::Flags origin); static bool doubleAtPut(const char* name, double* value, Flag::Flags origin) { return doubleAtPut(name, strlen(name), value, origin); } - static bool ccstrAt(const char* name, size_t len, ccstr* value); - static bool ccstrAt(const char* name, ccstr* value) { return ccstrAt(name, strlen(name), value); } + static bool ccstrAt(const char* name, size_t len, ccstr* value, bool allow_locked = false, bool return_flag = false); + static bool ccstrAt(const char* name, ccstr* value, bool allow_locked = false, bool return_flag = false) { return ccstrAt(name, strlen(name), value, allow_locked, return_flag); } // Contract: Flag will make private copy of the incoming value. // Outgoing value is always malloc-ed, and caller MUST call free. static bool ccstrAtPut(const char* name, size_t len, ccstr* value, Flag::Flags origin); diff --git a/hotspot/test/testlibrary/whitebox/sun/hotspot/WhiteBox.java b/hotspot/test/testlibrary/whitebox/sun/hotspot/WhiteBox.java index 228d1ddb319..0d4975d6dae 100644 --- a/hotspot/test/testlibrary/whitebox/sun/hotspot/WhiteBox.java +++ b/hotspot/test/testlibrary/whitebox/sun/hotspot/WhiteBox.java @@ -179,6 +179,8 @@ public class WhiteBox { public native void printRegionInfo(int context); // VM flags + public native boolean isConstantVMFlag(String name); + public native boolean isLockedVMFlag(String name); public native void setBooleanVMFlag(String name, boolean value); public native void setIntxVMFlag(String name, long value); public native void setUintxVMFlag(String name, long value); diff --git a/hotspot/test/testlibrary_tests/whitebox/vm_flags/BooleanTest.java b/hotspot/test/testlibrary_tests/whitebox/vm_flags/BooleanTest.java index ae068f8867a..1da1728877d 100644 --- a/hotspot/test/testlibrary_tests/whitebox/vm_flags/BooleanTest.java +++ b/hotspot/test/testlibrary_tests/whitebox/vm_flags/BooleanTest.java @@ -43,6 +43,7 @@ public class BooleanTest { private static final Boolean[] TESTS = {true, false, true, true, false}; private static final String TEST_NAME = "BooleanTest"; private static final String FLAG_NAME = "PrintCompilation"; + private static final String FLAG_DEBUG_NAME = "SafepointALot"; private static final String METHOD = TEST_NAME + "::method"; private static final String METHOD1 = METHOD + "1"; private static final String METHOD2 = METHOD + "2"; @@ -54,6 +55,7 @@ public class BooleanTest { VmFlagTest.WHITE_BOX::getBooleanVMFlag); testFunctional(false); testFunctional(true); + VmFlagTest.runTest(FLAG_DEBUG_NAME, VmFlagTest.WHITE_BOX::getBooleanVMFlag); } else { boolean value = Boolean.valueOf(args[0]); method1(); diff --git a/hotspot/test/testlibrary_tests/whitebox/vm_flags/IntxTest.java b/hotspot/test/testlibrary_tests/whitebox/vm_flags/IntxTest.java index 3b957eff084..9acdd31dd8b 100644 --- a/hotspot/test/testlibrary_tests/whitebox/vm_flags/IntxTest.java +++ b/hotspot/test/testlibrary_tests/whitebox/vm_flags/IntxTest.java @@ -35,6 +35,7 @@ public class IntxTest { private static final String FLAG_NAME = "OnStackReplacePercentage"; + private static final String FLAG_DEBUG_NAME = "InlineFrequencyCount"; private static final Long[] TESTS = {0L, 100L, -1L, (long) Integer.MAX_VALUE, (long) Integer.MIN_VALUE}; @@ -42,6 +43,7 @@ public class IntxTest { VmFlagTest.runTest(FLAG_NAME, TESTS, VmFlagTest.WHITE_BOX::setIntxVMFlag, VmFlagTest.WHITE_BOX::getIntxVMFlag); + VmFlagTest.runTest(FLAG_DEBUG_NAME, VmFlagTest.WHITE_BOX::getIntxVMFlag); } } diff --git a/hotspot/test/testlibrary_tests/whitebox/vm_flags/StringTest.java b/hotspot/test/testlibrary_tests/whitebox/vm_flags/StringTest.java index 77a02d3d2d4..e613df85b78 100644 --- a/hotspot/test/testlibrary_tests/whitebox/vm_flags/StringTest.java +++ b/hotspot/test/testlibrary_tests/whitebox/vm_flags/StringTest.java @@ -35,12 +35,14 @@ public class StringTest { private static final String FLAG_NAME = "CompileOnly"; + private static final String FLAG_DEBUG_NAME = "SuppressErrorAt"; private static final String[] TESTS = {"StringTest::*", ""}; public static void main(String[] args) throws Exception { VmFlagTest.runTest(FLAG_NAME, TESTS, VmFlagTest.WHITE_BOX::setStringVMFlag, VmFlagTest.WHITE_BOX::getStringVMFlag); + VmFlagTest.runTest(FLAG_DEBUG_NAME, VmFlagTest.WHITE_BOX::getStringVMFlag); } } diff --git a/hotspot/test/testlibrary_tests/whitebox/vm_flags/UintxTest.java b/hotspot/test/testlibrary_tests/whitebox/vm_flags/UintxTest.java index 40eb85f868f..bdb1f647209 100644 --- a/hotspot/test/testlibrary_tests/whitebox/vm_flags/UintxTest.java +++ b/hotspot/test/testlibrary_tests/whitebox/vm_flags/UintxTest.java @@ -36,6 +36,7 @@ import com.oracle.java.testlibrary.Platform; public class UintxTest { private static final String FLAG_NAME = "VerifyGCStartAt"; + private static final String FLAG_DEBUG_NAME = "CodeCacheMinimumUseSpace"; private static final Long[] TESTS = {0L, 100L, (long) Integer.MAX_VALUE, (1L << 32L) - 1L, 1L << 32L}; private static final Long[] EXPECTED_64 = TESTS; @@ -47,6 +48,7 @@ public class UintxTest { Platform.is64bit() ? EXPECTED_64 : EXPECTED_32, VmFlagTest.WHITE_BOX::setUintxVMFlag, VmFlagTest.WHITE_BOX::getUintxVMFlag); + VmFlagTest.runTest(FLAG_DEBUG_NAME, VmFlagTest.WHITE_BOX::getUintxVMFlag); } } diff --git a/hotspot/test/testlibrary_tests/whitebox/vm_flags/VmFlagTest.java b/hotspot/test/testlibrary_tests/whitebox/vm_flags/VmFlagTest.java index 6c98889e6ae..e2d15630c04 100644 --- a/hotspot/test/testlibrary_tests/whitebox/vm_flags/VmFlagTest.java +++ b/hotspot/test/testlibrary_tests/whitebox/vm_flags/VmFlagTest.java @@ -37,16 +37,18 @@ public final class VmFlagTest { private final BiConsumer test; private final BiConsumer set; private final Function get; + private final boolean isPositive; protected VmFlagTest(String flagName, BiConsumer set, Function get, boolean isPositive) { this.flagName = flagName; this.set = set; this.get = get; + this.isPositive = isPositive; if (isPositive) { - test = this::testPositive; + test = this::testWritePositive; } else { - test = this::testNegative; + test = this::testWriteNegative; } } @@ -63,6 +65,10 @@ public final class VmFlagTest { runTest(existentFlag, tests, tests, set, get); } + protected static void runTest(String existentFlag, Function get) { + runTest(existentFlag, null, null, null, get); + } + protected static void runTest(String existentFlag, T[] tests, T[] results, BiConsumer set, Function get) { if (existentFlag != null) { @@ -72,13 +78,23 @@ public final class VmFlagTest { } public final void test(T[] tests, T[] results) { - Asserts.assertEQ(tests.length, results.length, "[TESTBUG] tests.length != results.length"); - for (int i = 0, n = tests.length ; i < n; ++i) { - test.accept(tests[i], results[i]); + if (isPositive) { + testRead(); + } + if (tests != null) { + Asserts.assertEQ(tests.length, results.length, "[TESTBUG] tests.length != results.length"); + for (int i = 0, n = tests.length ; i < n; ++i) { + test.accept(tests[i], results[i]); + } } } protected String getVMOptionAsString() { + if (WHITE_BOX.isConstantVMFlag(flagName) || WHITE_BOX.isLockedVMFlag(flagName)) { + // JMM cannot access debug flags in product builds or locked flags, + // use whitebox methods to get such flags value. + return asString(getValue()); + } HotSpotDiagnosticMXBean diagnostic = ManagementFactoryHelper.getDiagnosticMXBean(); VMOption tmp; @@ -90,18 +106,24 @@ public final class VmFlagTest { return tmp == null ? null : tmp.getValue(); } - private void testPositive(T value, T expected) { - String oldValue = getVMOptionAsString(); - Asserts.assertEQ(oldValue, asString(getValue())); - Asserts.assertEQ(oldValue, asString(WHITE_BOX.getVMFlag(flagName))); - setNewValue(value); - String newValue = getVMOptionAsString(); - Asserts.assertEQ(newValue, asString(expected)); - Asserts.assertEQ(newValue, asString(getValue())); - Asserts.assertEQ(newValue, asString(WHITE_BOX.getVMFlag(flagName))); + private String testRead() { + String value = getVMOptionAsString(); + Asserts.assertNotNull(value); + Asserts.assertEQ(value, asString(getValue())); + Asserts.assertEQ(value, asString(WHITE_BOX.getVMFlag(flagName))); + return value; } - private void testNegative(T value, T expected) { + private void testWritePositive(T value, T expected) { + setNewValue(value); + String newValue = testRead(); + Asserts.assertEQ(newValue, asString(expected)); + } + + private void testWriteNegative(T value, T expected) { + // Should always return false for non-existing flags + Asserts.assertFalse(WHITE_BOX.isConstantVMFlag(flagName)); + Asserts.assertFalse(WHITE_BOX.isLockedVMFlag(flagName)); String oldValue = getVMOptionAsString(); Asserts.assertEQ(oldValue, asString(getValue())); Asserts.assertEQ(oldValue, asString(WHITE_BOX.getVMFlag(flagName))); @@ -114,4 +136,3 @@ public final class VmFlagTest { return value == null ? null : "" + value; } } - From 7d0337349b15fb66a599f552368a1bbebcd5c8e9 Mon Sep 17 00:00:00 2001 From: Tobias Hartmann Date: Fri, 24 Oct 2014 08:27:39 +0200 Subject: [PATCH 09/61] 8060479: [TESTBUG] compiler/codecache/CheckSegmentedCodeCache.java test fails with product build Added check for product build and compute minimum code cache size accordingly. Reviewed-by: kvn, iignatyev --- .../codecache/CheckSegmentedCodeCache.java | 15 ++++++++++++--- 1 file changed, 12 insertions(+), 3 deletions(-) diff --git a/hotspot/test/compiler/codecache/CheckSegmentedCodeCache.java b/hotspot/test/compiler/codecache/CheckSegmentedCodeCache.java index 06330d840b6..9784b4835a3 100644 --- a/hotspot/test/compiler/codecache/CheckSegmentedCodeCache.java +++ b/hotspot/test/compiler/codecache/CheckSegmentedCodeCache.java @@ -22,15 +22,20 @@ */ import com.oracle.java.testlibrary.*; +import sun.hotspot.WhiteBox; /* * @test CheckSegmentedCodeCache * @bug 8015774 + * @library /testlibrary /testlibrary/whitebox * @summary "Checks VM options related to the segmented code cache" - * @library /testlibrary - * @run main/othervm CheckSegmentedCodeCache + * @build CheckSegmentedCodeCache + * @run main ClassFileInstaller sun.hotspot.WhiteBox + * sun.hotspot.WhiteBox$WhiteBoxPermission + * @run main/othervm -Xbootclasspath/a:. -XX:+UnlockDiagnosticVMOptions -XX:+WhiteBoxAPI CheckSegmentedCodeCache */ public class CheckSegmentedCodeCache { + private static final WhiteBox WHITE_BOX = WhiteBox.getWhiteBox(); // Code heap names private static final String NON_METHOD = "CodeHeap 'non-nmethods'"; private static final String PROFILED = "CodeHeap 'profiled nmethods'"; @@ -133,8 +138,12 @@ public class CheckSegmentedCodeCache { failsWith(pb, "Invalid code heap sizes"); // Fails if not enough space for VM internal code + long minUseSpace = WHITE_BOX.getUintxVMFlag("CodeCacheMinimumUseSpace"); + long minFreeSpace = WHITE_BOX.getUintxVMFlag("CodeCacheMinimumFreeSpace"); + // minimum size: (CodeCacheMinimumUseSpace DEBUG_ONLY(* 3)) + CodeCacheMinimumFreeSpace + long minSize = (Platform.isDebugBuild() ? 3 : 1) * minUseSpace + minFreeSpace; pb = ProcessTools.createJavaProcessBuilder("-XX:+SegmentedCodeCache", - "-XX:ReservedCodeCacheSize=1700K", + "-XX:ReservedCodeCacheSize=" + minSize, "-XX:InitialCodeCacheSize=100K"); failsWith(pb, "Not enough space in non-nmethod code heap to run VM"); } From 2597d484c63e321a58ceb6a369f7881308b00570 Mon Sep 17 00:00:00 2001 From: Tobias Hartmann Date: Fri, 24 Oct 2014 08:35:29 +0200 Subject: [PATCH 10/61] 8061486: [TESTBUG] compiler/whitebox/ tests fail : must be osr_compiled (reappeared in nightlies) Call warmup code from OSR triggering method to make sure no non-OSR compilation is triggered in the loop. Reviewed-by: kvn --- .../whitebox/CompilerWhiteBoxTest.java | 142 +++++++++--------- 1 file changed, 71 insertions(+), 71 deletions(-) diff --git a/hotspot/test/compiler/whitebox/CompilerWhiteBoxTest.java b/hotspot/test/compiler/whitebox/CompilerWhiteBoxTest.java index a39a079e355..86eb174b6d8 100644 --- a/hotspot/test/compiler/whitebox/CompilerWhiteBoxTest.java +++ b/hotspot/test/compiler/whitebox/CompilerWhiteBoxTest.java @@ -73,8 +73,6 @@ public abstract class CompilerWhiteBoxTest { protected static final int THRESHOLD; /** invocation count to trigger OSR compilation */ protected static final long BACKEDGE_THRESHOLD; - /** invocation count to warm up method before triggering OSR compilation */ - protected static final long OSR_WARMUP = 2000; /** Value of {@code java.vm.info} (interpreted|mixed|comp mode) */ protected static final String MODE = System.getProperty("java.vm.info"); @@ -498,8 +496,7 @@ enum SimpleTestCase implements CompilerWhiteBoxTest.TestCase { = new Callable() { @Override public Integer call() throws Exception { - int result = warmup(OSR_CONSTRUCTOR); - return result + new Helper(null, CompilerWhiteBoxTest.BACKEDGE_THRESHOLD).hashCode(); + return new Helper(null, CompilerWhiteBoxTest.BACKEDGE_THRESHOLD).hashCode(); } }; @@ -509,8 +506,7 @@ enum SimpleTestCase implements CompilerWhiteBoxTest.TestCase { @Override public Integer call() throws Exception { - int result = warmup(OSR_METHOD); - return result + helper.osrMethod(CompilerWhiteBoxTest.BACKEDGE_THRESHOLD); + return helper.osrMethod(CompilerWhiteBoxTest.BACKEDGE_THRESHOLD); } }; @@ -518,62 +514,10 @@ enum SimpleTestCase implements CompilerWhiteBoxTest.TestCase { = new Callable() { @Override public Integer call() throws Exception { - int result = warmup(OSR_STATIC); - return result + osrStaticMethod(CompilerWhiteBoxTest.BACKEDGE_THRESHOLD); + return osrStaticMethod(CompilerWhiteBoxTest.BACKEDGE_THRESHOLD); } }; - /** - * Deoptimizes all non-osr versions of the given executable after - * compilation finished. - * - * @param e Executable - * @throws Exception - */ - private static void waitAndDeoptimize(Executable e) { - CompilerWhiteBoxTest.waitBackgroundCompilation(e); - if (WhiteBox.getWhiteBox().isMethodQueuedForCompilation(e)) { - throw new RuntimeException(e + " must not be in queue"); - } - // Deoptimize non-osr versions of executable - WhiteBox.getWhiteBox().deoptimizeMethod(e, false); - } - - /** - * Executes the method multiple times to make sure we have - * enough profiling information before triggering an OSR - * compilation. Otherwise the C2 compiler may add uncommon traps. - * - * @param m Method to be executed - * @return Number of times the method was executed - * @throws Exception - */ - private static int warmup(Method m) throws Exception { - Helper helper = new Helper(); - int result = 0; - for (long i = 0; i < CompilerWhiteBoxTest.OSR_WARMUP; ++i) { - result += (int)m.invoke(helper, 1); - } - return result; - } - - /** - * Executes the constructor multiple times to make sure we - * have enough profiling information before triggering an OSR - * compilation. Otherwise the C2 compiler may add uncommon traps. - * - * @param c Constructor to be executed - * @return Number of times the constructor was executed - * @throws Exception - */ - private static int warmup(Constructor c) throws Exception { - int result = 0; - for (long i = 0; i < CompilerWhiteBoxTest.OSR_WARMUP; ++i) { - result += c.newInstance(null, 1).hashCode(); - } - return result; - } - private static final Constructor CONSTRUCTOR; private static final Constructor OSR_CONSTRUCTOR; private static final Method METHOD; @@ -618,26 +562,83 @@ enum SimpleTestCase implements CompilerWhiteBoxTest.TestCase { return 42; } - private static int osrStaticMethod(long limit) { + /** + * Deoptimizes all non-osr versions of the given executable after + * compilation finished. + * + * @param e Executable + * @throws Exception + */ + private static void waitAndDeoptimize(Executable e) { + CompilerWhiteBoxTest.waitBackgroundCompilation(e); + if (WhiteBox.getWhiteBox().isMethodQueuedForCompilation(e)) { + throw new RuntimeException(e + " must not be in queue"); + } + // Deoptimize non-osr versions of executable + WhiteBox.getWhiteBox().deoptimizeMethod(e, false); + } + + /** + * Executes the method multiple times to make sure we have + * enough profiling information before triggering an OSR + * compilation. Otherwise the C2 compiler may add uncommon traps. + * + * @param m Method to be executed + * @return Number of times the method was executed + * @throws Exception + */ + private static int warmup(Method m) throws Exception { + waitAndDeoptimize(m); + Helper helper = new Helper(); + int result = 0; + for (long i = 0; i < CompilerWhiteBoxTest.THRESHOLD; ++i) { + result += (int)m.invoke(helper, 1); + } + // Wait to make sure OSR compilation is not blocked by + // non-OSR compilation in the compile queue + CompilerWhiteBoxTest.waitBackgroundCompilation(m); + return result; + } + + /** + * Executes the constructor multiple times to make sure we + * have enough profiling information before triggering an OSR + * compilation. Otherwise the C2 compiler may add uncommon traps. + * + * @param c Constructor to be executed + * @return Number of times the constructor was executed + * @throws Exception + */ + private static int warmup(Constructor c) throws Exception { + waitAndDeoptimize(c); + int result = 0; + for (long i = 0; i < CompilerWhiteBoxTest.THRESHOLD; ++i) { + result += c.newInstance(null, 1).hashCode(); + } + // Wait to make sure OSR compilation is not blocked by + // non-OSR compilation in the compile queue + CompilerWhiteBoxTest.waitBackgroundCompilation(c); + return result; + } + + private static int osrStaticMethod(long limit) throws Exception { + int result = 0; if (limit != 1) { - // Make sure there is no compiled version after warmup - waitAndDeoptimize(OSR_STATIC); + result = warmup(OSR_STATIC); } // Trigger osr compilation - int result = 0; for (long i = 0; i < limit; ++i) { result += staticMethod(); } return result; } - private int osrMethod(long limit) { + private int osrMethod(long limit) throws Exception { + int result = 0; if (limit != 1) { - // Make sure there is no compiled version after warmup - waitAndDeoptimize(OSR_METHOD); + result = warmup(OSR_METHOD); } // Trigger osr compilation - int result = 0; for (long i = 0; i < limit; ++i) { result += method(); } @@ -652,13 +653,12 @@ enum SimpleTestCase implements CompilerWhiteBoxTest.TestCase { } // for OSR constructor test case - private Helper(Object o, long limit) { + private Helper(Object o, long limit) throws Exception { + int result = 0; if (limit != 1) { - // Make sure there is no compiled version after warmup - waitAndDeoptimize(OSR_CONSTRUCTOR); + result = warmup(OSR_CONSTRUCTOR); } // Trigger osr compilation - int result = 0; for (long i = 0; i < limit; ++i) { result += method(); } From 6520320d1aaf6d1052cda95dd6783dec51262bc9 Mon Sep 17 00:00:00 2001 From: Albert Noll Date: Fri, 24 Oct 2014 14:25:46 +0200 Subject: [PATCH 11/61] 8046809: vm/mlvm/meth/stress/compiler/deoptimize CodeCache is full Use separate sweeper thread; enables more aggressive sweeping. Reviewed-by: kvn, jrose --- hotspot/src/share/vm/ci/ciEnv.cpp | 3 +- hotspot/src/share/vm/code/codeBlob.cpp | 18 +- hotspot/src/share/vm/code/codeBlob.hpp | 2 +- hotspot/src/share/vm/code/codeCache.cpp | 58 ++--- hotspot/src/share/vm/code/codeCache.hpp | 21 +- hotspot/src/share/vm/code/nmethod.cpp | 5 +- hotspot/src/share/vm/code/vtableStubs.cpp | 1 - .../src/share/vm/compiler/compileBroker.cpp | 126 +++++------ .../src/share/vm/compiler/compileBroker.hpp | 6 +- .../vm/interpreter/interpreterRuntime.cpp | 1 - hotspot/src/share/vm/memory/heap.cpp | 22 +- hotspot/src/share/vm/memory/heap.hpp | 6 +- hotspot/src/share/vm/opto/compile.cpp | 1 - hotspot/src/share/vm/opto/output.cpp | 3 - hotspot/src/share/vm/prims/methodHandles.cpp | 35 +-- hotspot/src/share/vm/prims/methodHandles.hpp | 2 +- hotspot/src/share/vm/runtime/arguments.cpp | 21 +- hotspot/src/share/vm/runtime/globals.hpp | 14 +- hotspot/src/share/vm/runtime/mutexLocker.cpp | 4 +- hotspot/src/share/vm/runtime/mutexLocker.hpp | 2 +- .../src/share/vm/runtime/sharedRuntime.cpp | 5 - hotspot/src/share/vm/runtime/sweeper.cpp | 205 ++++++++++-------- hotspot/src/share/vm/runtime/sweeper.hpp | 14 +- hotspot/src/share/vm/runtime/thread.cpp | 14 +- hotspot/src/share/vm/runtime/thread.hpp | 39 ++-- .../src/share/vm/runtime/vm_operations.cpp | 3 + .../src/share/vm/runtime/vm_operations.hpp | 8 + hotspot/src/share/vm/trace/trace.xml | 1 - .../startup/SmallCodeCacheStartup.java | 12 +- .../gc/g1/TestHumongousCodeCacheRoots.java | 1 - 30 files changed, 319 insertions(+), 334 deletions(-) diff --git a/hotspot/src/share/vm/ci/ciEnv.cpp b/hotspot/src/share/vm/ci/ciEnv.cpp index 98179f46fdf..ec16b8da1ee 100644 --- a/hotspot/src/share/vm/ci/ciEnv.cpp +++ b/hotspot/src/share/vm/ci/ciEnv.cpp @@ -1093,9 +1093,8 @@ void ciEnv::register_method(ciMethod* target, // JVMTI -- compiled method notification (must be done outside lock) nm->post_compiled_method_load_event(); } else { - // The CodeCache is full. Print out warning and disable compilation. + // The CodeCache is full. record_failure("code cache is full"); - CompileBroker::handle_full_code_cache(CodeCache::get_code_blob_type(comp_level)); } } diff --git a/hotspot/src/share/vm/code/codeBlob.cpp b/hotspot/src/share/vm/code/codeBlob.cpp index 780111b0aa7..98b7ec0f23c 100644 --- a/hotspot/src/share/vm/code/codeBlob.cpp +++ b/hotspot/src/share/vm/code/codeBlob.cpp @@ -229,8 +229,8 @@ BufferBlob* BufferBlob::create(const char* name, CodeBuffer* cb) { return blob; } -void* BufferBlob::operator new(size_t s, unsigned size, bool is_critical) throw() { - return CodeCache::allocate(size, CodeBlobType::NonNMethod, is_critical); +void* BufferBlob::operator new(size_t s, unsigned size) throw() { + return CodeCache::allocate(size, CodeBlobType::NonNMethod); } void BufferBlob::free(BufferBlob *blob) { @@ -260,10 +260,7 @@ AdapterBlob* AdapterBlob::create(CodeBuffer* cb) { unsigned int size = allocation_size(cb, sizeof(AdapterBlob)); { MutexLockerEx mu(CodeCache_lock, Mutex::_no_safepoint_check_flag); - // The parameter 'true' indicates a critical memory allocation. - // This means that CodeCacheMinimumFreeSpace is used, if necessary - const bool is_critical = true; - blob = new (size, is_critical) AdapterBlob(size, cb); + blob = new (size) AdapterBlob(size, cb); } // Track memory usage statistic after releasing CodeCache_lock MemoryService::track_code_cache_memory_usage(); @@ -285,10 +282,7 @@ MethodHandlesAdapterBlob* MethodHandlesAdapterBlob::create(int buffer_size) { size += round_to(buffer_size, oopSize); { MutexLockerEx mu(CodeCache_lock, Mutex::_no_safepoint_check_flag); - // The parameter 'true' indicates a critical memory allocation. - // This means that CodeCacheMinimumFreeSpace is used, if necessary - const bool is_critical = true; - blob = new (size, is_critical) MethodHandlesAdapterBlob(size); + blob = new (size) MethodHandlesAdapterBlob(size); } // Track memory usage statistic after releasing CodeCache_lock MemoryService::track_code_cache_memory_usage(); @@ -336,14 +330,14 @@ RuntimeStub* RuntimeStub::new_runtime_stub(const char* stub_name, void* RuntimeStub::operator new(size_t s, unsigned size) throw() { - void* p = CodeCache::allocate(size, CodeBlobType::NonNMethod, true); + void* p = CodeCache::allocate(size, CodeBlobType::NonNMethod); if (!p) fatal("Initial size of CodeCache is too small"); return p; } // operator new shared by all singletons: void* SingletonBlob::operator new(size_t s, unsigned size) throw() { - void* p = CodeCache::allocate(size, CodeBlobType::NonNMethod, true); + void* p = CodeCache::allocate(size, CodeBlobType::NonNMethod); if (!p) fatal("Initial size of CodeCache is too small"); return p; } diff --git a/hotspot/src/share/vm/code/codeBlob.hpp b/hotspot/src/share/vm/code/codeBlob.hpp index 88d86eb5995..2c066788657 100644 --- a/hotspot/src/share/vm/code/codeBlob.hpp +++ b/hotspot/src/share/vm/code/codeBlob.hpp @@ -221,7 +221,7 @@ class BufferBlob: public CodeBlob { BufferBlob(const char* name, int size); BufferBlob(const char* name, int size, CodeBuffer* cb); - void* operator new(size_t s, unsigned size, bool is_critical = false) throw(); + void* operator new(size_t s, unsigned size) throw(); public: // Creation diff --git a/hotspot/src/share/vm/code/codeCache.cpp b/hotspot/src/share/vm/code/codeCache.cpp index 2b8845a6d65..4876a40111d 100644 --- a/hotspot/src/share/vm/code/codeCache.cpp +++ b/hotspot/src/share/vm/code/codeCache.cpp @@ -44,6 +44,7 @@ #include "runtime/icache.hpp" #include "runtime/java.hpp" #include "runtime/mutexLocker.hpp" +#include "runtime/sweeper.hpp" #include "runtime/compilationPolicy.hpp" #include "services/memoryService.hpp" #include "trace/tracing.hpp" @@ -192,16 +193,16 @@ void CodeCache::initialize_heaps() { } // Make sure we have enough space for VM internal code - uint min_code_cache_size = (CodeCacheMinimumUseSpace DEBUG_ONLY(* 3)) + CodeCacheMinimumFreeSpace; + uint min_code_cache_size = CodeCacheMinimumUseSpace DEBUG_ONLY(* 3); if (NonNMethodCodeHeapSize < (min_code_cache_size + code_buffers_size)) { vm_exit_during_initialization("Not enough space in non-nmethod code heap to run VM."); } guarantee(NonProfiledCodeHeapSize + ProfiledCodeHeapSize + NonNMethodCodeHeapSize <= ReservedCodeCacheSize, "Size check"); // Align reserved sizes of CodeHeaps - size_t non_method_size = ReservedCodeSpace::allocation_align_size_up(NonNMethodCodeHeapSize); - size_t profiled_size = ReservedCodeSpace::allocation_align_size_up(ProfiledCodeHeapSize); - size_t non_profiled_size = ReservedCodeSpace::allocation_align_size_up(NonProfiledCodeHeapSize); + size_t non_method_size = ReservedCodeSpace::allocation_align_size_up(NonNMethodCodeHeapSize); + size_t profiled_size = ReservedCodeSpace::allocation_align_size_up(ProfiledCodeHeapSize); + size_t non_profiled_size = ReservedCodeSpace::allocation_align_size_up(NonProfiledCodeHeapSize); // Compute initial sizes of CodeHeaps size_t init_non_method_size = MIN2(InitialCodeCacheSize, non_method_size); @@ -348,14 +349,18 @@ CodeBlob* CodeCache::next_blob(CodeBlob* cb) { return next_blob(get_code_heap(cb), cb); } -CodeBlob* CodeCache::allocate(int size, int code_blob_type, bool is_critical) { - // Do not seize the CodeCache lock here--if the caller has not - // already done so, we are going to lose bigtime, since the code - // cache will contain a garbage CodeBlob until the caller can - // run the constructor for the CodeBlob subclass he is busy - // instantiating. +/** + * Do not seize the CodeCache lock here--if the caller has not + * already done so, we are going to lose bigtime, since the code + * cache will contain a garbage CodeBlob until the caller can + * run the constructor for the CodeBlob subclass he is busy + * instantiating. + */ +CodeBlob* CodeCache::allocate(int size, int code_blob_type) { + // Possibly wakes up the sweeper thread. + NMethodSweeper::notify(code_blob_type); assert_locked_or_safepoint(CodeCache_lock); - assert(size > 0, "allocation request must be reasonable"); + assert(size > 0, err_msg_res("Code cache allocation request must be > 0 but is %d", size)); if (size <= 0) { return NULL; } @@ -366,14 +371,18 @@ CodeBlob* CodeCache::allocate(int size, int code_blob_type, bool is_critical) { assert(heap != NULL, "heap is null"); while (true) { - cb = (CodeBlob*)heap->allocate(size, is_critical); + cb = (CodeBlob*)heap->allocate(size); if (cb != NULL) break; if (!heap->expand_by(CodeCacheExpansionSize)) { // Expansion failed if (SegmentedCodeCache && (code_blob_type == CodeBlobType::NonNMethod)) { - // Fallback solution: Store non-nmethod code in the non-profiled code heap - return allocate(size, CodeBlobType::MethodNonProfiled, is_critical); + // Fallback solution: Store non-nmethod code in the non-profiled code heap. + // Note that at in the sweeper, we check the reverse_free_ratio of the non-profiled + // code heap and force stack scanning if less than 10% if the code heap are free. + return allocate(size, CodeBlobType::MethodNonProfiled); } + MutexUnlockerEx mu(CodeCache_lock, Mutex::_no_safepoint_check_flag); + CompileBroker::handle_full_code_cache(code_blob_type); return NULL; } if (PrintCodeCacheExtension) { @@ -770,19 +779,6 @@ size_t CodeCache::max_capacity() { return max_cap; } -/** - * Returns true if a CodeHeap is full and sets code_blob_type accordingly. - */ -bool CodeCache::is_full(int* code_blob_type) { - FOR_ALL_HEAPS(heap) { - if ((*heap)->unallocated_capacity() < CodeCacheMinimumFreeSpace) { - *code_blob_type = (*heap)->code_blob_type(); - return true; - } - } - return false; -} - /** * Returns the reverse free ratio. E.g., if 25% (1/4) of the code heap * is free, reverse_free_ratio() returns 4. @@ -792,9 +788,13 @@ double CodeCache::reverse_free_ratio(int code_blob_type) { if (heap == NULL) { return 0; } - double unallocated_capacity = (double)(heap->unallocated_capacity() - CodeCacheMinimumFreeSpace); + + double unallocated_capacity = MAX2((double)heap->unallocated_capacity(), 1.0); // Avoid division by 0; double max_capacity = (double)heap->max_capacity(); - return max_capacity / unallocated_capacity; + double result = max_capacity / unallocated_capacity; + assert (max_capacity >= unallocated_capacity, "Must be"); + assert (result >= 1.0, err_msg_res("reverse_free_ratio must be at least 1. It is %f", result)); + return result; } size_t CodeCache::bytes_allocated_in_freelists() { diff --git a/hotspot/src/share/vm/code/codeCache.hpp b/hotspot/src/share/vm/code/codeCache.hpp index b8b119c3b86..fd7fb286c31 100644 --- a/hotspot/src/share/vm/code/codeCache.hpp +++ b/hotspot/src/share/vm/code/codeCache.hpp @@ -120,16 +120,16 @@ class CodeCache : AllStatic { static void initialize(); // Allocation/administration - static CodeBlob* allocate(int size, int code_blob_type, bool is_critical = false); // allocates a new CodeBlob - static void commit(CodeBlob* cb); // called when the allocated CodeBlob has been filled - static int alignment_unit(); // guaranteed alignment of all CodeBlobs - static int alignment_offset(); // guaranteed offset of first CodeBlob byte within alignment unit (i.e., allocation header) - static void free(CodeBlob* cb); // frees a CodeBlob - static bool contains(void *p); // returns whether p is included - static void blobs_do(void f(CodeBlob* cb)); // iterates over all CodeBlobs - static void blobs_do(CodeBlobClosure* f); // iterates over all CodeBlobs - static void nmethods_do(void f(nmethod* nm)); // iterates over all nmethods - static void alive_nmethods_do(void f(nmethod* nm)); // iterates over all alive nmethods + static CodeBlob* allocate(int size, int code_blob_type); // allocates a new CodeBlob + static void commit(CodeBlob* cb); // called when the allocated CodeBlob has been filled + static int alignment_unit(); // guaranteed alignment of all CodeBlobs + static int alignment_offset(); // guaranteed offset of first CodeBlob byte within alignment unit (i.e., allocation header) + static void free(CodeBlob* cb); // frees a CodeBlob + static bool contains(void *p); // returns whether p is included + static void blobs_do(void f(CodeBlob* cb)); // iterates over all CodeBlobs + static void blobs_do(CodeBlobClosure* f); // iterates over all CodeBlobs + static void nmethods_do(void f(nmethod* nm)); // iterates over all nmethods + static void alive_nmethods_do(void f(nmethod* nm)); // iterates over all alive nmethods // Lookup static CodeBlob* find_blob(void* start); // Returns the CodeBlob containing the given address @@ -182,7 +182,6 @@ class CodeCache : AllStatic { static size_t unallocated_capacity(); static size_t max_capacity(); - static bool is_full(int* code_blob_type); static double reverse_free_ratio(int code_blob_type); static bool needs_cache_clean() { return _needs_cache_clean; } diff --git a/hotspot/src/share/vm/code/nmethod.cpp b/hotspot/src/share/vm/code/nmethod.cpp index 7804712fb87..03456870130 100644 --- a/hotspot/src/share/vm/code/nmethod.cpp +++ b/hotspot/src/share/vm/code/nmethod.cpp @@ -804,10 +804,7 @@ nmethod::nmethod( #endif // def HAVE_DTRACE_H void* nmethod::operator new(size_t size, int nmethod_size, int comp_level) throw () { - // With a SegmentedCodeCache, nmethods are allocated on separate heaps and therefore do not share memory - // with critical CodeBlobs. We define the allocation as critical to make sure all code heap memory is used. - bool is_critical = SegmentedCodeCache; - return CodeCache::allocate(nmethod_size, CodeCache::get_code_blob_type(comp_level), is_critical); + return CodeCache::allocate(nmethod_size, CodeCache::get_code_blob_type(comp_level)); } nmethod::nmethod( diff --git a/hotspot/src/share/vm/code/vtableStubs.cpp b/hotspot/src/share/vm/code/vtableStubs.cpp index f4b0f20652c..c6262988265 100644 --- a/hotspot/src/share/vm/code/vtableStubs.cpp +++ b/hotspot/src/share/vm/code/vtableStubs.cpp @@ -63,7 +63,6 @@ void* VtableStub::operator new(size_t size, int code_size) throw() { // If changing the name, update the other file accordingly. BufferBlob* blob = BufferBlob::create("vtable chunks", bytes); if (blob == NULL) { - CompileBroker::handle_full_code_cache(CodeBlobType::NonNMethod); return NULL; } _chunk = blob->content_begin(); diff --git a/hotspot/src/share/vm/compiler/compileBroker.cpp b/hotspot/src/share/vm/compiler/compileBroker.cpp index 1eccfde6fd0..1c26cbb8f77 100644 --- a/hotspot/src/share/vm/compiler/compileBroker.cpp +++ b/hotspot/src/share/vm/compiler/compileBroker.cpp @@ -156,8 +156,6 @@ long CompileBroker::_peak_compilation_time = 0; CompileQueue* CompileBroker::_c2_compile_queue = NULL; CompileQueue* CompileBroker::_c1_compile_queue = NULL; -GrowableArray* CompileBroker::_compiler_threads = NULL; - class CompilationLog : public StringEventLog { public: @@ -649,13 +647,10 @@ void CompileQueue::free_all() { lock()->notify_all(); } -// ------------------------------------------------------------------ -// CompileQueue::get -// -// Get the next CompileTask from a CompileQueue +/** + * Get the next CompileTask from a CompileQueue + */ CompileTask* CompileQueue::get() { - NMethodSweeper::possibly_sweep(); - MutexLocker locker(lock()); // If _first is NULL we have no more compile jobs. There are two reasons for // having no compile jobs: First, we compiled everything we wanted. Second, @@ -668,35 +663,16 @@ CompileTask* CompileQueue::get() { return NULL; } - if (UseCodeCacheFlushing && !CompileBroker::should_compile_new_jobs()) { - // Wait a certain amount of time to possibly do another sweep. - // We must wait until stack scanning has happened so that we can - // transition a method's state from 'not_entrant' to 'zombie'. - long wait_time = NmethodSweepCheckInterval * 1000; - if (FLAG_IS_DEFAULT(NmethodSweepCheckInterval)) { - // Only one thread at a time can do sweeping. Scale the - // wait time according to the number of compiler threads. - // As a result, the next sweep is likely to happen every 100ms - // with an arbitrary number of threads that do sweeping. - wait_time = 100 * CICompilerCount; - } - bool timeout = lock()->wait(!Mutex::_no_safepoint_check_flag, wait_time); - if (timeout) { - MutexUnlocker ul(lock()); - NMethodSweeper::possibly_sweep(); - } - } else { - // If there are no compilation tasks and we can compile new jobs - // (i.e., there is enough free space in the code cache) there is - // no need to invoke the sweeper. As a result, the hotness of methods - // remains unchanged. This behavior is desired, since we want to keep - // the stable state, i.e., we do not want to evict methods from the - // code cache if it is unnecessary. - // We need a timed wait here, since compiler threads can exit if compilation - // is disabled forever. We use 5 seconds wait time; the exiting of compiler threads - // is not critical and we do not want idle compiler threads to wake up too often. - lock()->wait(!Mutex::_no_safepoint_check_flag, 5*1000); - } + // If there are no compilation tasks and we can compile new jobs + // (i.e., there is enough free space in the code cache) there is + // no need to invoke the sweeper. As a result, the hotness of methods + // remains unchanged. This behavior is desired, since we want to keep + // the stable state, i.e., we do not want to evict methods from the + // code cache if it is unnecessary. + // We need a timed wait here, since compiler threads can exit if compilation + // is disabled forever. We use 5 seconds wait time; the exiting of compiler threads + // is not critical and we do not want idle compiler threads to wake up too often. + lock()->wait(!Mutex::_no_safepoint_check_flag, 5*1000); } if (CompileBroker::is_compilation_disabled_forever()) { @@ -886,8 +862,8 @@ void CompileBroker::compilation_init() { _compilers[1] = new SharkCompiler(); #endif // SHARK - // Start the CompilerThreads - init_compiler_threads(c1_count, c2_count); + // Start the compiler thread(s) and the sweeper thread + init_compiler_sweeper_threads(c1_count, c2_count); // totalTime performance counter is always created as it is required // by the implementation of java.lang.management.CompilationMBean. { @@ -991,13 +967,10 @@ void CompileBroker::compilation_init() { } -CompilerThread* CompileBroker::make_compiler_thread(const char* name, CompileQueue* queue, CompilerCounters* counters, - AbstractCompiler* comp, TRAPS) { - CompilerThread* compiler_thread = NULL; - - Klass* k = - SystemDictionary::resolve_or_fail(vmSymbols::java_lang_Thread(), - true, CHECK_0); +JavaThread* CompileBroker::make_thread(const char* name, CompileQueue* queue, CompilerCounters* counters, + AbstractCompiler* comp, bool compiler_thread, TRAPS) { + JavaThread* thread = NULL; + Klass* k = SystemDictionary::resolve_or_fail(vmSymbols::java_lang_Thread(), true, CHECK_0); instanceKlassHandle klass (THREAD, k); instanceHandle thread_oop = klass->allocate_instance_handle(CHECK_0); Handle string = java_lang_String::create_from_str(name, CHECK_0); @@ -1015,7 +988,11 @@ CompilerThread* CompileBroker::make_compiler_thread(const char* name, CompileQue { MutexLocker mu(Threads_lock, THREAD); - compiler_thread = new CompilerThread(queue, counters); + if (compiler_thread) { + thread = new CompilerThread(queue, counters); + } else { + thread = new CodeCacheSweeperThread(); + } // At this point the new CompilerThread data-races with this startup // thread (which I believe is the primoridal thread and NOT the VM // thread). This means Java bytecodes being executed at startup can @@ -1028,12 +1005,12 @@ CompilerThread* CompileBroker::make_compiler_thread(const char* name, CompileQue // in that case. However, since this must work and we do not allow // exceptions anyway, check and abort if this fails. - if (compiler_thread == NULL || compiler_thread->osthread() == NULL){ + if (thread == NULL || thread->osthread() == NULL) { vm_exit_during_initialization("java.lang.OutOfMemoryError", os::native_thread_creation_failed_msg()); } - java_lang_Thread::set_thread(thread_oop(), compiler_thread); + java_lang_Thread::set_thread(thread_oop(), thread); // Note that this only sets the JavaThread _priority field, which by // definition is limited to Java priorities and not OS priorities. @@ -1054,24 +1031,26 @@ CompilerThread* CompileBroker::make_compiler_thread(const char* name, CompileQue native_prio = os::java_to_os_priority[NearMaxPriority]; } } - os::set_native_priority(compiler_thread, native_prio); + os::set_native_priority(thread, native_prio); java_lang_Thread::set_daemon(thread_oop()); - compiler_thread->set_threadObj(thread_oop()); - compiler_thread->set_compiler(comp); - Threads::add(compiler_thread); - Thread::start(compiler_thread); + thread->set_threadObj(thread_oop()); + if (compiler_thread) { + thread->as_CompilerThread()->set_compiler(comp); + } + Threads::add(thread); + Thread::start(thread); } // Let go of Threads_lock before yielding os::naked_yield(); // make sure that the compiler thread is started early (especially helpful on SOLARIS) - return compiler_thread; + return thread; } -void CompileBroker::init_compiler_threads(int c1_compiler_count, int c2_compiler_count) { +void CompileBroker::init_compiler_sweeper_threads(int c1_compiler_count, int c2_compiler_count) { EXCEPTION_MARK; #if !defined(ZERO) && !defined(SHARK) assert(c2_compiler_count > 0 || c1_compiler_count > 0, "No compilers?"); @@ -1088,17 +1067,14 @@ void CompileBroker::init_compiler_threads(int c1_compiler_count, int c2_compiler int compiler_count = c1_compiler_count + c2_compiler_count; - _compiler_threads = - new (ResourceObj::C_HEAP, mtCompiler) GrowableArray(compiler_count, true); - char name_buffer[256]; + const bool compiler_thread = true; for (int i = 0; i < c2_compiler_count; i++) { // Create a name for our thread. sprintf(name_buffer, "C2 CompilerThread%d", i); CompilerCounters* counters = new CompilerCounters("compilerThread", i, CHECK); // Shark and C2 - CompilerThread* new_thread = make_compiler_thread(name_buffer, _c2_compile_queue, counters, _compilers[1], CHECK); - _compiler_threads->append(new_thread); + make_thread(name_buffer, _c2_compile_queue, counters, _compilers[1], compiler_thread, CHECK); } for (int i = c2_compiler_count; i < compiler_count; i++) { @@ -1106,13 +1082,17 @@ void CompileBroker::init_compiler_threads(int c1_compiler_count, int c2_compiler sprintf(name_buffer, "C1 CompilerThread%d", i); CompilerCounters* counters = new CompilerCounters("compilerThread", i, CHECK); // C1 - CompilerThread* new_thread = make_compiler_thread(name_buffer, _c1_compile_queue, counters, _compilers[0], CHECK); - _compiler_threads->append(new_thread); + make_thread(name_buffer, _c1_compile_queue, counters, _compilers[0], compiler_thread, CHECK); } if (UsePerfData) { PerfDataManager::create_constant(SUN_CI, "threads", PerfData::U_Bytes, compiler_count, CHECK); } + + if (MethodFlushing) { + // Initialize the sweeper thread + make_thread("Sweeper thread", NULL, NULL, NULL, false, CHECK); + } } @@ -1759,13 +1739,6 @@ void CompileBroker::compiler_thread_loop() { // We need this HandleMark to avoid leaking VM handles. HandleMark hm(thread); - // Check if the CodeCache is full - int code_blob_type = 0; - if (CodeCache::is_full(&code_blob_type)) { - // The CodeHeap for code_blob_type is really full - handle_full_code_cache(code_blob_type); - } - CompileTask* task = queue->get(); if (task == NULL) { continue; @@ -1773,8 +1746,9 @@ void CompileBroker::compiler_thread_loop() { // Give compiler threads an extra quanta. They tend to be bursty and // this helps the compiler to finish up the job. - if( CompilerThreadHintNoPreempt ) + if (CompilerThreadHintNoPreempt) { os::hint_no_preempt(); + } // trace per thread time and compile statistics CompilerCounters* counters = ((CompilerThread*)thread)->counters(); @@ -2074,8 +2048,10 @@ void CompileBroker::invoke_compiler_on_method(CompileTask* task) { } /** - * The CodeCache is full. Print out warning and disable compilation - * or try code cache cleaning so compilation can continue later. + * The CodeCache is full. Print warning and disable compilation. + * Schedule code cache cleaning so compilation can continue later. + * This function needs to be called only from CodeCache::allocate(), + * since we currently handle a full code cache uniformly. */ void CompileBroker::handle_full_code_cache(int code_blob_type) { UseInterpreter = true; @@ -2107,10 +2083,6 @@ void CompileBroker::handle_full_code_cache(int code_blob_type) { if (CompileBroker::set_should_compile_new_jobs(CompileBroker::stop_compilation)) { NMethodSweeper::log_sweep("disable_compiler"); } - // Switch to 'vm_state'. This ensures that possibly_sweep() can be called - // without having to consider the state in which the current thread is. - ThreadInVMfromUnknown in_vm; - NMethodSweeper::possibly_sweep(); } else { disable_compilation_forever(); } diff --git a/hotspot/src/share/vm/compiler/compileBroker.hpp b/hotspot/src/share/vm/compiler/compileBroker.hpp index c199cb1480d..e5d3d6e7629 100644 --- a/hotspot/src/share/vm/compiler/compileBroker.hpp +++ b/hotspot/src/share/vm/compiler/compileBroker.hpp @@ -290,8 +290,6 @@ class CompileBroker: AllStatic { static CompileQueue* _c2_compile_queue; static CompileQueue* _c1_compile_queue; - static GrowableArray* _compiler_threads; - // performance counters static PerfCounter* _perf_total_compilation; static PerfCounter* _perf_native_compilation; @@ -339,8 +337,8 @@ class CompileBroker: AllStatic { static volatile jint _print_compilation_warning; - static CompilerThread* make_compiler_thread(const char* name, CompileQueue* queue, CompilerCounters* counters, AbstractCompiler* comp, TRAPS); - static void init_compiler_threads(int c1_compiler_count, int c2_compiler_count); + static JavaThread* make_thread(const char* name, CompileQueue* queue, CompilerCounters* counters, AbstractCompiler* comp, bool compiler_thread, TRAPS); + static void init_compiler_sweeper_threads(int c1_compiler_count, int c2_compiler_count); static bool compilation_is_complete (methodHandle method, int osr_bci, int comp_level); static bool compilation_is_prohibited(methodHandle method, int osr_bci, int comp_level); static bool is_compile_blocking(); diff --git a/hotspot/src/share/vm/interpreter/interpreterRuntime.cpp b/hotspot/src/share/vm/interpreter/interpreterRuntime.cpp index 124b1d1e3fc..53be23d848b 100644 --- a/hotspot/src/share/vm/interpreter/interpreterRuntime.cpp +++ b/hotspot/src/share/vm/interpreter/interpreterRuntime.cpp @@ -1077,7 +1077,6 @@ IRT_END address SignatureHandlerLibrary::set_handler_blob() { BufferBlob* handler_blob = BufferBlob::create("native signature handlers", blob_size); if (handler_blob == NULL) { - CompileBroker::handle_full_code_cache(CodeBlobType::NonNMethod); return NULL; } address handler = handler_blob->code_begin(); diff --git a/hotspot/src/share/vm/memory/heap.cpp b/hotspot/src/share/vm/memory/heap.cpp index 096c212a703..5ba099e78e8 100644 --- a/hotspot/src/share/vm/memory/heap.cpp +++ b/hotspot/src/share/vm/memory/heap.cpp @@ -171,13 +171,13 @@ void CodeHeap::clear() { } -void* CodeHeap::allocate(size_t instance_size, bool is_critical) { +void* CodeHeap::allocate(size_t instance_size) { size_t number_of_segments = size_to_segments(instance_size + header_size()); assert(segments_to_size(number_of_segments) >= sizeof(FreeBlock), "not enough room for FreeList"); // First check if we can satisfy request from freelist NOT_PRODUCT(verify()); - HeapBlock* block = search_freelist(number_of_segments, is_critical); + HeapBlock* block = search_freelist(number_of_segments); NOT_PRODUCT(verify()); if (block != NULL) { @@ -191,15 +191,6 @@ void* CodeHeap::allocate(size_t instance_size, bool is_critical) { // Ensure minimum size for allocation to the heap. number_of_segments = MAX2((int)CodeCacheMinBlockLength, (int)number_of_segments); - if (!is_critical) { - // Make sure the allocation fits in the unallocated heap without using - // the CodeCacheMimimumFreeSpace that is reserved for critical allocations. - if (segments_to_size(number_of_segments) > (heap_unallocated_capacity() - CodeCacheMinimumFreeSpace)) { - // Fail allocation - return NULL; - } - } - if (_next_segment + number_of_segments <= _number_of_committed_segments) { mark_segmap_as_used(_next_segment, _next_segment + number_of_segments); HeapBlock* b = block_at(_next_segment); @@ -427,24 +418,17 @@ void CodeHeap::add_to_freelist(HeapBlock* a) { * Search freelist for an entry on the list with the best fit. * @return NULL, if no one was found */ -FreeBlock* CodeHeap::search_freelist(size_t length, bool is_critical) { +FreeBlock* CodeHeap::search_freelist(size_t length) { FreeBlock* found_block = NULL; FreeBlock* found_prev = NULL; size_t found_length = 0; FreeBlock* prev = NULL; FreeBlock* cur = _freelist; - const size_t critical_boundary = (size_t)high_boundary() - CodeCacheMinimumFreeSpace; // Search for first block that fits while(cur != NULL) { if (cur->length() >= length) { - // Non critical allocations are not allowed to use the last part of the code heap. - // Make sure the end of the allocation doesn't cross into the last part of the code heap. - if (!is_critical && (((size_t)cur + length) > critical_boundary)) { - // The freelist is sorted by address - if one fails, all consecutive will also fail. - break; - } // Remember block, its previous element, and its length found_block = cur; found_prev = prev; diff --git a/hotspot/src/share/vm/memory/heap.hpp b/hotspot/src/share/vm/memory/heap.hpp index c4150787768..4fdbeabbfc3 100644 --- a/hotspot/src/share/vm/memory/heap.hpp +++ b/hotspot/src/share/vm/memory/heap.hpp @@ -120,7 +120,7 @@ class CodeHeap : public CHeapObj { // Toplevel freelist management void add_to_freelist(HeapBlock* b); - FreeBlock* search_freelist(size_t length, bool is_critical); + FreeBlock* search_freelist(size_t length); // Iteration helpers void* next_free(HeapBlock* b) const; @@ -140,8 +140,8 @@ class CodeHeap : public CHeapObj { bool expand_by(size_t size); // expands committed memory by size // Memory allocation - void* allocate (size_t size, bool is_critical); // allocates a block of size or returns NULL - void deallocate(void* p); // deallocates a block + void* allocate (size_t size); // Allocate 'size' bytes in the code cache or return NULL + void deallocate(void* p); // Deallocate memory // Attributes char* low_boundary() const { return _memory.low_boundary (); } diff --git a/hotspot/src/share/vm/opto/compile.cpp b/hotspot/src/share/vm/opto/compile.cpp index 6304ff2686b..ec74d5ef4a1 100644 --- a/hotspot/src/share/vm/opto/compile.cpp +++ b/hotspot/src/share/vm/opto/compile.cpp @@ -535,7 +535,6 @@ void Compile::init_scratch_buffer_blob(int const_size) { if (scratch_buffer_blob() == NULL) { // Let CompilerBroker disable further compilations. record_failure("Not enough space for scratch buffer in CodeCache"); - CompileBroker::handle_full_code_cache(CodeBlobType::NonNMethod); return; } } diff --git a/hotspot/src/share/vm/opto/output.cpp b/hotspot/src/share/vm/opto/output.cpp index 165e187b964..6284abde6e2 100644 --- a/hotspot/src/share/vm/opto/output.cpp +++ b/hotspot/src/share/vm/opto/output.cpp @@ -1166,7 +1166,6 @@ CodeBuffer* Compile::init_buffer(uint* blk_starts) { // Have we run out of code space? if ((cb->blob() == NULL) || (!CompileBroker::should_compile_new_jobs())) { C->record_failure("CodeCache is full"); - CompileBroker::handle_full_code_cache(CodeBlobType::NonNMethod); return NULL; } // Configure the code buffer. @@ -1491,7 +1490,6 @@ void Compile::fill_buffer(CodeBuffer* cb, uint* blk_starts) { cb->insts()->maybe_expand_to_ensure_remaining(MAX_inst_size); if ((cb->blob() == NULL) || (!CompileBroker::should_compile_new_jobs())) { C->record_failure("CodeCache is full"); - CompileBroker::handle_full_code_cache(CodeBlobType::NonNMethod); return; } @@ -1648,7 +1646,6 @@ void Compile::fill_buffer(CodeBuffer* cb, uint* blk_starts) { // One last check for failed CodeBuffer::expand: if ((cb->blob() == NULL) || (!CompileBroker::should_compile_new_jobs())) { C->record_failure("CodeCache is full"); - CompileBroker::handle_full_code_cache(CodeBlobType::NonNMethod); return; } diff --git a/hotspot/src/share/vm/prims/methodHandles.cpp b/hotspot/src/share/vm/prims/methodHandles.cpp index 8053a3c9763..8013a1329a8 100644 --- a/hotspot/src/share/vm/prims/methodHandles.cpp +++ b/hotspot/src/share/vm/prims/methodHandles.cpp @@ -36,6 +36,7 @@ #include "runtime/reflection.hpp" #include "runtime/signature.hpp" #include "runtime/stubRoutines.hpp" +#include "utilities/exceptions.hpp" /* @@ -55,26 +56,30 @@ bool MethodHandles::_enabled = false; // set true after successful native linkage MethodHandlesAdapterBlob* MethodHandles::_adapter_code = NULL; -//------------------------------------------------------------------------------ -// MethodHandles::generate_adapters -// -void MethodHandles::generate_adapters() { - if (SystemDictionary::MethodHandle_klass() == NULL) return; + +/** + * Generates method handle adapters. Returns 'false' if memory allocation + * failed and true otherwise. + */ +bool MethodHandles::generate_adapters() { + if (SystemDictionary::MethodHandle_klass() == NULL) { + return true; + } assert(_adapter_code == NULL, "generate only once"); ResourceMark rm; TraceTime timer("MethodHandles adapters generation", TraceStartupTime); _adapter_code = MethodHandlesAdapterBlob::create(adapter_code_size); - if (_adapter_code == NULL) - vm_exit_out_of_memory(adapter_code_size, OOM_MALLOC_ERROR, - "CodeCache: no room for MethodHandles adapters"); - { - CodeBuffer code(_adapter_code); - MethodHandlesAdapterGenerator g(&code); - g.generate(); - code.log_section_sizes("MethodHandlesAdapterBlob"); + if (_adapter_code == NULL) { + return false; } + + CodeBuffer code(_adapter_code); + MethodHandlesAdapterGenerator g(&code); + g.generate(); + code.log_section_sizes("MethodHandlesAdapterBlob"); + return true; } //------------------------------------------------------------------------------ @@ -1401,7 +1406,9 @@ JVM_ENTRY(void, JVM_RegisterMethodHandleMethods(JNIEnv *env, jclass MHN_class)) } if (enable_MH) { - MethodHandles::generate_adapters(); + if (MethodHandles::generate_adapters() == false) { + THROW_MSG(vmSymbols::java_lang_VirtualMachineError(), "Out of space in CodeCache for method handle adapters"); + } MethodHandles::set_enabled(true); } } diff --git a/hotspot/src/share/vm/prims/methodHandles.hpp b/hotspot/src/share/vm/prims/methodHandles.hpp index 323cd823664..4084d6c7d8b 100644 --- a/hotspot/src/share/vm/prims/methodHandles.hpp +++ b/hotspot/src/share/vm/prims/methodHandles.hpp @@ -69,7 +69,7 @@ class MethodHandles: AllStatic { enum { _suppress_defc = 1, _suppress_name = 2, _suppress_type = 4 }; // Generate MethodHandles adapters. - static void generate_adapters(); + static bool generate_adapters(); // Called from MethodHandlesAdapterGenerator. static address generate_method_handle_interpreter_entry(MacroAssembler* _masm, vmIntrinsics::ID iid); diff --git a/hotspot/src/share/vm/runtime/arguments.cpp b/hotspot/src/share/vm/runtime/arguments.cpp index d62d286e18c..1907f54d8fc 100644 --- a/hotspot/src/share/vm/runtime/arguments.cpp +++ b/hotspot/src/share/vm/runtime/arguments.cpp @@ -306,6 +306,9 @@ static ObsoleteFlag obsolete_jvm_flags[] = { { "ReflectionWrapResolutionErrors",JDK_Version::jdk(9), JDK_Version::jdk(10) }, { "VerifyReflectionBytecodes", JDK_Version::jdk(9), JDK_Version::jdk(10) }, { "AutoShutdownNMT", JDK_Version::jdk(9), JDK_Version::jdk(10) }, + { "NmethodSweepFraction", JDK_Version::jdk(9), JDK_Version::jdk(10) }, + { "NmethodSweepCheckInterval", JDK_Version::jdk(9), JDK_Version::jdk(10) }, + { "CodeCacheMinimumFreeSpace", JDK_Version::jdk(9), JDK_Version::jdk(10) }, #ifndef ZERO { "UseFastAccessorMethods", JDK_Version::jdk(9), JDK_Version::jdk(10) }, { "UseFastEmptyMethods", JDK_Version::jdk(9), JDK_Version::jdk(10) }, @@ -2528,7 +2531,7 @@ bool Arguments::check_vm_args_consistency() { // Check lower bounds of the code cache // Template Interpreter code is approximately 3X larger in debug builds. - uint min_code_cache_size = (CodeCacheMinimumUseSpace DEBUG_ONLY(* 3)) + CodeCacheMinimumFreeSpace; + uint min_code_cache_size = CodeCacheMinimumUseSpace DEBUG_ONLY(* 3); if (InitialCodeCacheSize < (uintx)os::vm_page_size()) { jio_fprintf(defaultStream::error_stream(), "Invalid InitialCodeCacheSize=%dK. Must be at least %dK.\n", InitialCodeCacheSize/K, @@ -2564,10 +2567,11 @@ bool Arguments::check_vm_args_consistency() { status = false; } - status &= verify_interval(NmethodSweepFraction, 1, ReservedCodeCacheSize/K, "NmethodSweepFraction"); status &= verify_interval(NmethodSweepActivity, 0, 2000, "NmethodSweepActivity"); status &= verify_interval(CodeCacheMinBlockLength, 1, 100, "CodeCacheMinBlockLength"); status &= verify_interval(CodeCacheSegmentSize, 1, 1024, "CodeCacheSegmentSize"); + status &= verify_interval(StartAggressiveSweepingAt, 0, 100, "StartAggressiveSweepingAt"); + int min_number_of_compiler_threads = get_min_number_of_compiler_threads(); // The default CICompilerCount's value is CI_COMPILER_COUNT. @@ -3985,12 +3989,6 @@ jint Arguments::apply_ergo() { #endif #endif - // Set NmethodSweepFraction after the size of the code cache is adapted (in case of tiered) - if (FLAG_IS_DEFAULT(NmethodSweepFraction)) { - FLAG_SET_DEFAULT(NmethodSweepFraction, 1 + ReservedCodeCacheSize / (16 * M)); - } - - // Set heap size based on available physical memory set_heap_size(); @@ -4058,13 +4056,6 @@ jint Arguments::apply_ergo() { } #ifndef PRODUCT - if (CompileTheWorld) { - // Force NmethodSweeper to sweep whole CodeCache each time. - if (FLAG_IS_DEFAULT(NmethodSweepFraction)) { - NmethodSweepFraction = 1; - } - } - if (!LogVMOutput && FLAG_IS_DEFAULT(LogVMOutput)) { if (use_vm_log()) { LogVMOutput = true; diff --git a/hotspot/src/share/vm/runtime/globals.hpp b/hotspot/src/share/vm/runtime/globals.hpp index f219767d9ab..e14b51baa1f 100644 --- a/hotspot/src/share/vm/runtime/globals.hpp +++ b/hotspot/src/share/vm/runtime/globals.hpp @@ -2984,12 +2984,6 @@ class CommandLineFlags { product(intx, SafepointTimeoutDelay, 10000, \ "Delay in milliseconds for option SafepointTimeout") \ \ - product(intx, NmethodSweepFraction, 16, \ - "Number of invocations of sweeper to cover all nmethods") \ - \ - product(intx, NmethodSweepCheckInterval, 5, \ - "Compilers wake up every n seconds to possibly sweep nmethods") \ - \ product(intx, NmethodSweepActivity, 10, \ "Removes cold nmethods from code cache if > 0. Higher values " \ "result in more aggressive sweeping") \ @@ -3378,9 +3372,6 @@ class CommandLineFlags { product_pd(uintx, NonNMethodCodeHeapSize, \ "Size of code heap with non-nmethods (in bytes)") \ \ - product(uintx, CodeCacheMinimumFreeSpace, 500*K, \ - "When less than X space left, we stop compiling") \ - \ product_pd(uintx, CodeCacheExpansionSize, \ "Code cache expansion size (in bytes)") \ \ @@ -3393,6 +3384,11 @@ class CommandLineFlags { product(bool, UseCodeCacheFlushing, true, \ "Remove cold/old nmethods from the code cache") \ \ + product(uintx, StartAggressiveSweepingAt, 10, \ + "Start aggressive sweeping if X[%] of the code cache is free." \ + "Segmented code cache: X[%] of the non-profiled heap." \ + "Non-segmented code cache: X[%] of the total code cache") \ + \ /* interpreter debugging */ \ develop(intx, BinarySwitchThreshold, 5, \ "Minimal number of lookupswitch entries for rewriting to binary " \ diff --git a/hotspot/src/share/vm/runtime/mutexLocker.cpp b/hotspot/src/share/vm/runtime/mutexLocker.cpp index 5cbbbeb3828..25a897a142f 100644 --- a/hotspot/src/share/vm/runtime/mutexLocker.cpp +++ b/hotspot/src/share/vm/runtime/mutexLocker.cpp @@ -61,7 +61,7 @@ Mutex* SymbolTable_lock = NULL; Mutex* StringTable_lock = NULL; Monitor* StringDedupQueue_lock = NULL; Mutex* StringDedupTable_lock = NULL; -Mutex* CodeCache_lock = NULL; +Monitor* CodeCache_lock = NULL; Mutex* MethodData_lock = NULL; Mutex* RetData_lock = NULL; Monitor* VMOperationQueue_lock = NULL; @@ -205,7 +205,7 @@ void mutex_init() { } def(ParGCRareEvent_lock , Mutex , leaf , true ); def(DerivedPointerTableGC_lock , Mutex, leaf, true ); - def(CodeCache_lock , Mutex , special, true ); + def(CodeCache_lock , Monitor, special, true ); def(Interrupt_lock , Monitor, special, true ); // used for interrupt processing def(RawMonitor_lock , Mutex, special, true ); def(OopMapCacheAlloc_lock , Mutex, leaf, true ); // used for oop_map_cache allocation. diff --git a/hotspot/src/share/vm/runtime/mutexLocker.hpp b/hotspot/src/share/vm/runtime/mutexLocker.hpp index ab027291d30..94d8adec813 100644 --- a/hotspot/src/share/vm/runtime/mutexLocker.hpp +++ b/hotspot/src/share/vm/runtime/mutexLocker.hpp @@ -53,7 +53,7 @@ extern Mutex* SymbolTable_lock; // a lock on the symbol table extern Mutex* StringTable_lock; // a lock on the interned string table extern Monitor* StringDedupQueue_lock; // a lock on the string deduplication queue extern Mutex* StringDedupTable_lock; // a lock on the string deduplication table -extern Mutex* CodeCache_lock; // a lock on the CodeCache, rank is special, use MutexLockerEx +extern Monitor* CodeCache_lock; // a lock on the CodeCache, rank is special, use MutexLockerEx extern Mutex* MethodData_lock; // a lock on installation of method data extern Mutex* RetData_lock; // a lock on installation of RetData inside method data extern Mutex* DerivedPointerTableGC_lock; // a lock to protect the derived pointer table diff --git a/hotspot/src/share/vm/runtime/sharedRuntime.cpp b/hotspot/src/share/vm/runtime/sharedRuntime.cpp index 7c47c6f2656..344c2a61f3e 100644 --- a/hotspot/src/share/vm/runtime/sharedRuntime.cpp +++ b/hotspot/src/share/vm/runtime/sharedRuntime.cpp @@ -2421,8 +2421,6 @@ AdapterHandlerEntry* AdapterHandlerLibrary::get_adapter(methodHandle method) { // CodeCache is full, disable compilation // Ought to log this but compile log is only per compile thread // and we're some non descript Java thread. - MutexUnlocker mu(AdapterHandlerLibrary_lock); - CompileBroker::handle_full_code_cache(CodeBlobType::NonNMethod); return NULL; // Out of CodeCache space } entry->relocate(new_adapter->content_begin()); @@ -2594,9 +2592,6 @@ void AdapterHandlerLibrary::create_native_wrapper(methodHandle method) { CompileTask::print_compilation(tty, nm, method->is_static() ? "(static)" : ""); } nm->post_compiled_method_load_event(); - } else { - // CodeCache is full, disable compilation - CompileBroker::handle_full_code_cache(CodeBlobType::MethodNonProfiled); } } diff --git a/hotspot/src/share/vm/runtime/sweeper.cpp b/hotspot/src/share/vm/runtime/sweeper.cpp index cecb8ff08a1..1f70b6edc20 100644 --- a/hotspot/src/share/vm/runtime/sweeper.cpp +++ b/hotspot/src/share/vm/runtime/sweeper.cpp @@ -52,7 +52,6 @@ PRAGMA_FORMAT_MUTE_WARNINGS_FOR_GCC class SweeperRecord { public: int traversal; - int invocation; int compile_id; long traversal_mark; int state; @@ -62,10 +61,9 @@ class SweeperRecord { int line; void print() { - tty->print_cr("traversal = %d invocation = %d compile_id = %d %s uep = " PTR_FORMAT " vep = " + tty->print_cr("traversal = %d compile_id = %d %s uep = " PTR_FORMAT " vep = " PTR_FORMAT " state = %d traversal_mark %d line = %d", traversal, - invocation, compile_id, kind == NULL ? "" : kind, uep, @@ -117,7 +115,6 @@ void NMethodSweeper::record_sweep(nmethod* nm, int line) { if (_records != NULL) { _records[_sweep_index].traversal = _traversals; _records[_sweep_index].traversal_mark = nm->_stack_traversal_mark; - _records[_sweep_index].invocation = _sweep_fractions_left; _records[_sweep_index].compile_id = nm->compile_id(); _records[_sweep_index].kind = nm->compile_kind(); _records[_sweep_index].state = nm->_state; @@ -127,6 +124,14 @@ void NMethodSweeper::record_sweep(nmethod* nm, int line) { _sweep_index = (_sweep_index + 1) % SweeperLogEntries; } } + +void NMethodSweeper::init_sweeper_log() { + if (LogSweeper && _records == NULL) { + // Create the ring buffer for the logging code + _records = NEW_C_HEAP_ARRAY(SweeperRecord, SweeperLogEntries, mtGC); + memset(_records, 0, sizeof(SweeperRecord) * SweeperLogEntries); + } +} #else #define SWEEP(nm) #endif @@ -142,8 +147,6 @@ int NMethodSweeper::_zombified_count = 0; // Nof. nmethods int NMethodSweeper::_marked_for_reclamation_count = 0; // Nof. nmethods marked for reclaim in current sweep volatile bool NMethodSweeper::_should_sweep = true; // Indicates if we should invoke the sweeper -volatile int NMethodSweeper::_sweep_fractions_left = 0; // Nof. invocations left until we are completed with this pass -volatile int NMethodSweeper::_sweep_started = 0; // Flag to control conc sweeper volatile int NMethodSweeper::_bytes_changed = 0; // Counts the total nmethod size if the nmethod changed from: // 1) alive -> not_entrant // 2) not_entrant -> zombie @@ -190,13 +193,15 @@ int NMethodSweeper::hotness_counter_reset_val() { } return _hotness_counter_reset_val; } -bool NMethodSweeper::sweep_in_progress() { - return !_current.end(); +bool NMethodSweeper::wait_for_stack_scanning() { + return _current.end(); } -// Scans the stacks of all Java threads and marks activations of not-entrant methods. -// No need to synchronize access, since 'mark_active_nmethods' is always executed at a -// safepoint. +/** + * Scans the stacks of all Java threads and marks activations of not-entrant methods. + * No need to synchronize access, since 'mark_active_nmethods' is always executed at a + * safepoint. + */ void NMethodSweeper::mark_active_nmethods() { assert(SafepointSynchronize::is_at_safepoint(), "must be executed at a safepoint"); // If we do not want to reclaim not-entrant or zombie methods there is no need @@ -210,9 +215,8 @@ void NMethodSweeper::mark_active_nmethods() { // Check for restart assert(CodeCache::find_blob_unsafe(_current.method()) == _current.method(), "Sweeper nmethod cached state invalid"); - if (!sweep_in_progress()) { + if (wait_for_stack_scanning()) { _seen = 0; - _sweep_fractions_left = NmethodSweepFraction; _current = NMethodIterator(); // Initialize to first nmethod _current.next(); @@ -231,6 +235,64 @@ void NMethodSweeper::mark_active_nmethods() { OrderAccess::storestore(); } + +/** + * This function triggers a VM operation that does stack scanning of active + * methods. Stack scanning is mandatory for the sweeper to make progress. + */ +void NMethodSweeper::do_stack_scanning() { + assert(!CodeCache_lock->owned_by_self(), "just checking"); + if (wait_for_stack_scanning()) { + VM_MarkActiveNMethods op; + VMThread::execute(&op); + _should_sweep = true; + } +} + +void NMethodSweeper::sweeper_loop() { + bool timeout; + while (true) { + { + ThreadBlockInVM tbivm(JavaThread::current()); + MutexLockerEx waiter(CodeCache_lock, Mutex::_no_safepoint_check_flag); + const long wait_time = 60*60*24 * 1000; + timeout = CodeCache_lock->wait(Mutex::_no_safepoint_check_flag, wait_time); + } + if (!timeout) { + possibly_sweep(); + } + } +} + +/** + * Wakes up the sweeper thread to possibly sweep. + */ +void NMethodSweeper::notify(int code_blob_type) { + // Makes sure that we do not invoke the sweeper too often during startup. + double start_threshold = 100.0 / (double)StartAggressiveSweepingAt; + double aggressive_sweep_threshold = MIN2(start_threshold, 1.1); + if (CodeCache::reverse_free_ratio(code_blob_type) >= aggressive_sweep_threshold) { + assert_locked_or_safepoint(CodeCache_lock); + CodeCache_lock->notify(); + } +} + +/** + * Handle a safepoint request + */ +void NMethodSweeper::handle_safepoint_request() { + if (SafepointSynchronize::is_synchronizing()) { + if (PrintMethodFlushing && Verbose) { + tty->print_cr("### Sweep at %d out of %d, yielding to safepoint", _seen, CodeCache::nof_nmethods()); + } + MutexUnlockerEx mu(CodeCache_lock, Mutex::_no_safepoint_check_flag); + + JavaThread* thread = JavaThread::current(); + ThreadBlockInVM tbivm(thread); + thread->java_suspend_self(); + } +} + /** * This function invokes the sweeper if at least one of the three conditions is met: * (1) The code cache is getting full @@ -239,11 +301,6 @@ void NMethodSweeper::mark_active_nmethods() { */ void NMethodSweeper::possibly_sweep() { assert(JavaThread::current()->thread_state() == _thread_in_vm, "must run in vm mode"); - // Only compiler threads are allowed to sweep - if (!MethodFlushing || !sweep_in_progress() || !Thread::current()->is_Compiler_thread()) { - return; - } - // If there was no state change while nmethod sweeping, 'should_sweep' will be false. // This is one of the two places where should_sweep can be set to true. The general // idea is as follows: If there is enough free space in the code cache, there is no @@ -280,46 +337,37 @@ void NMethodSweeper::possibly_sweep() { } } - if (_should_sweep && _sweep_fractions_left > 0) { - // Only one thread at a time will sweep - jint old = Atomic::cmpxchg( 1, &_sweep_started, 0 ); - if (old != 0) { - return; - } -#ifdef ASSERT - if (LogSweeper && _records == NULL) { - // Create the ring buffer for the logging code - _records = NEW_C_HEAP_ARRAY(SweeperRecord, SweeperLogEntries, mtGC); - memset(_records, 0, sizeof(SweeperRecord) * SweeperLogEntries); - } -#endif + // Force stack scanning if there is only 10% free space in the code cache. + // We force stack scanning only non-profiled code heap gets full, since critical + // allocation go to the non-profiled heap and we must be make sure that there is + // enough space. + double free_percent = 1 / CodeCache::reverse_free_ratio(CodeBlobType::MethodNonProfiled) * 100; + if (free_percent <= StartAggressiveSweepingAt) { + do_stack_scanning(); + } - if (_sweep_fractions_left > 0) { - sweep_code_cache(); - _sweep_fractions_left--; - } + if (_should_sweep) { + init_sweeper_log(); + sweep_code_cache(); + } - // We are done with sweeping the code cache once. - if (_sweep_fractions_left == 0) { - _total_nof_code_cache_sweeps++; - _last_sweep = _time_counter; - // Reset flag; temporarily disables sweeper - _should_sweep = false; - // If there was enough state change, 'possibly_enable_sweeper()' - // sets '_should_sweep' to true - possibly_enable_sweeper(); - // Reset _bytes_changed only if there was enough state change. _bytes_changed - // can further increase by calls to 'report_state_change'. - if (_should_sweep) { - _bytes_changed = 0; - } - } - // Release work, because another compiler thread could continue. - OrderAccess::release_store((int*)&_sweep_started, 0); + // We are done with sweeping the code cache once. + _total_nof_code_cache_sweeps++; + _last_sweep = _time_counter; + // Reset flag; temporarily disables sweeper + _should_sweep = false; + // If there was enough state change, 'possibly_enable_sweeper()' + // sets '_should_sweep' to true + possibly_enable_sweeper(); + // Reset _bytes_changed only if there was enough state change. _bytes_changed + // can further increase by calls to 'report_state_change'. + if (_should_sweep) { + _bytes_changed = 0; } } void NMethodSweeper::sweep_code_cache() { + ResourceMark rm; Ticks sweep_start_counter = Ticks::now(); _flushed_count = 0; @@ -327,25 +375,10 @@ void NMethodSweeper::sweep_code_cache() { _marked_for_reclamation_count = 0; if (PrintMethodFlushing && Verbose) { - tty->print_cr("### Sweep at %d out of %d. Invocations left: %d", _seen, CodeCache::nof_nmethods(), _sweep_fractions_left); + tty->print_cr("### Sweep at %d out of %d", _seen, CodeCache::nof_nmethods()); } - if (!CompileBroker::should_compile_new_jobs()) { - // If we have turned off compilations we might as well do full sweeps - // in order to reach the clean state faster. Otherwise the sleeping compiler - // threads will slow down sweeping. - _sweep_fractions_left = 1; - } - - // We want to visit all nmethods after NmethodSweepFraction - // invocations so divide the remaining number of nmethods by the - // remaining number of invocations. This is only an estimate since - // the number of nmethods changes during the sweep so the final - // stage must iterate until it there are no more nmethods. - int todo = (CodeCache::nof_nmethods() - _seen) / _sweep_fractions_left; int swept_count = 0; - - assert(!SafepointSynchronize::is_at_safepoint(), "should not be in safepoint when we get here"); assert(!CodeCache_lock->owned_by_self(), "just checking"); @@ -354,19 +387,9 @@ void NMethodSweeper::sweep_code_cache() { MutexLockerEx mu(CodeCache_lock, Mutex::_no_safepoint_check_flag); // The last invocation iterates until there are no more nmethods - while ((swept_count < todo || _sweep_fractions_left == 1) && !_current.end()) { + while (!_current.end()) { swept_count++; - if (SafepointSynchronize::is_synchronizing()) { // Safepoint request - if (PrintMethodFlushing && Verbose) { - tty->print_cr("### Sweep at %d out of %d, invocation: %d, yielding to safepoint", _seen, CodeCache::nof_nmethods(), _sweep_fractions_left); - } - MutexUnlockerEx mu(CodeCache_lock, Mutex::_no_safepoint_check_flag); - - assert(Thread::current()->is_Java_thread(), "should be java thread"); - JavaThread* thread = (JavaThread*)Thread::current(); - ThreadBlockInVM tbivm(thread); - thread->java_suspend_self(); - } + handle_safepoint_request(); // Since we will give up the CodeCache_lock, always skip ahead // to the next nmethod. Other blobs can be deleted by other // threads but nmethods are only reclaimed by the sweeper. @@ -382,7 +405,7 @@ void NMethodSweeper::sweep_code_cache() { } } - assert(_sweep_fractions_left > 1 || _current.end(), "must have scanned the whole cache"); + assert(_current.end(), "must have scanned the whole cache"); const Ticks sweep_end_counter = Ticks::now(); const Tickspan sweep_time = sweep_end_counter - sweep_start_counter; @@ -397,7 +420,6 @@ void NMethodSweeper::sweep_code_cache() { event.set_starttime(sweep_start_counter); event.set_endtime(sweep_end_counter); event.set_sweepIndex(_traversals); - event.set_sweepFractionIndex(NmethodSweepFraction - _sweep_fractions_left + 1); event.set_sweptCount(swept_count); event.set_flushedCount(_flushed_count); event.set_markedCount(_marked_for_reclamation_count); @@ -407,15 +429,12 @@ void NMethodSweeper::sweep_code_cache() { #ifdef ASSERT if(PrintMethodFlushing) { - tty->print_cr("### sweeper: sweep time(%d): " - INT64_FORMAT, _sweep_fractions_left, (jlong)sweep_time.value()); + tty->print_cr("### sweeper: sweep time(%d): ", (jlong)sweep_time.value()); } #endif - if (_sweep_fractions_left == 1) { - _peak_sweep_time = MAX2(_peak_sweep_time, _total_time_this_sweep); - log_sweep("finished"); - } + _peak_sweep_time = MAX2(_peak_sweep_time, _total_time_this_sweep); + log_sweep("finished"); // Sweeper is the only case where memory is released, check here if it // is time to restart the compiler. Only checking if there is a certain @@ -459,10 +478,12 @@ void NMethodSweeper::possibly_enable_sweeper() { class NMethodMarker: public StackObj { private: - CompilerThread* _thread; + CodeCacheSweeperThread* _thread; public: NMethodMarker(nmethod* nm) { - _thread = CompilerThread::current(); + JavaThread* current = JavaThread::current(); + assert (current->is_Code_cache_sweeper_thread(), "Must be"); + _thread = (CodeCacheSweeperThread*)JavaThread::current(); if (!nm->is_zombie() && !nm->is_unloaded()) { // Only expose live nmethods for scanning _thread->set_scanned_nmethod(nm); @@ -473,7 +494,7 @@ class NMethodMarker: public StackObj { } }; -void NMethodSweeper::release_nmethod(nmethod *nm) { +void NMethodSweeper::release_nmethod(nmethod* nm) { // Clean up any CompiledICHolders { ResourceMark rm; @@ -490,7 +511,7 @@ void NMethodSweeper::release_nmethod(nmethod *nm) { nm->flush(); } -int NMethodSweeper::process_nmethod(nmethod *nm) { +int NMethodSweeper::process_nmethod(nmethod* nm) { assert(!CodeCache_lock->owned_by_self(), "just checking"); int freed_memory = 0; diff --git a/hotspot/src/share/vm/runtime/sweeper.hpp b/hotspot/src/share/vm/runtime/sweeper.hpp index 82b1a279c2a..2da9425390e 100644 --- a/hotspot/src/share/vm/runtime/sweeper.hpp +++ b/hotspot/src/share/vm/runtime/sweeper.hpp @@ -49,9 +49,7 @@ // remove the nmethod, all inline caches (IC) that point to the the nmethod must be // cleared. After that, the nmethod can be evicted from the code cache. Each nmethod's // state change happens during separate sweeps. It may take at least 3 sweeps before an -// nmethod's space is freed. Sweeping is currently done by compiler threads between -// compilations or at least each 5 sec (NmethodSweepCheckInterval) when the code cache -// is full. +// nmethod's space is freed. class NMethodSweeper : public AllStatic { static long _traversals; // Stack scan count, also sweep ID. @@ -64,7 +62,6 @@ class NMethodSweeper : public AllStatic { static int _zombified_count; // Nof. nmethods made zombie in current sweep static int _marked_for_reclamation_count; // Nof. nmethods marked for reclaim in current sweep - static volatile int _sweep_fractions_left; // Nof. invocations left until we are completed with this pass static volatile int _sweep_started; // Flag to control conc sweeper static volatile bool _should_sweep; // Indicates if we should invoke the sweeper static volatile int _bytes_changed; // Counts the total nmethod size if the nmethod changed from: @@ -85,8 +82,12 @@ class NMethodSweeper : public AllStatic { static int process_nmethod(nmethod *nm); static void release_nmethod(nmethod* nm); - static bool sweep_in_progress(); + static void init_sweeper_log() NOT_DEBUG_RETURN; + static bool wait_for_stack_scanning(); static void sweep_code_cache(); + static void handle_safepoint_request(); + static void do_stack_scanning(); + static void possibly_sweep(); public: static long traversal_count() { return _traversals; } @@ -106,7 +107,8 @@ class NMethodSweeper : public AllStatic { #endif static void mark_active_nmethods(); // Invoked at the end of each safepoint - static void possibly_sweep(); // Compiler threads call this to sweep + static void sweeper_loop(); + static void notify(int code_blob_type); // Possibly start the sweeper thread. static int hotness_counter_reset_val(); static void report_state_change(nmethod* nm); diff --git a/hotspot/src/share/vm/runtime/thread.cpp b/hotspot/src/share/vm/runtime/thread.cpp index a522867da21..471f9e1eeda 100644 --- a/hotspot/src/share/vm/runtime/thread.cpp +++ b/hotspot/src/share/vm/runtime/thread.cpp @@ -66,6 +66,7 @@ #include "runtime/sharedRuntime.hpp" #include "runtime/statSampler.hpp" #include "runtime/stubRoutines.hpp" +#include "runtime/sweeper.hpp" #include "runtime/task.hpp" #include "runtime/thread.inline.hpp" #include "runtime/threadCritical.hpp" @@ -1551,6 +1552,7 @@ void JavaThread::block_if_vm_exited() { // Remove this ifdef when C1 is ported to the compiler interface. static void compiler_thread_entry(JavaThread* thread, TRAPS); +static void sweeper_thread_entry(JavaThread* thread, TRAPS); JavaThread::JavaThread(ThreadFunction entry_point, size_t stack_sz) : Thread() @@ -3170,6 +3172,10 @@ static void compiler_thread_entry(JavaThread* thread, TRAPS) { CompileBroker::compiler_thread_loop(); } +static void sweeper_thread_entry(JavaThread* thread, TRAPS) { + NMethodSweeper::sweeper_loop(); +} + // Create a CompilerThread CompilerThread::CompilerThread(CompileQueue* queue, CompilerCounters* counters) @@ -3180,7 +3186,6 @@ CompilerThread::CompilerThread(CompileQueue* queue, _queue = queue; _counters = counters; _buffer_blob = NULL; - _scanned_nmethod = NULL; _compiler = NULL; #ifndef PRODUCT @@ -3188,7 +3193,12 @@ CompilerThread::CompilerThread(CompileQueue* queue, #endif } -void CompilerThread::oops_do(OopClosure* f, CLDClosure* cld_f, CodeBlobClosure* cf) { +// Create sweeper thread +CodeCacheSweeperThread::CodeCacheSweeperThread() +: JavaThread(&sweeper_thread_entry) { + _scanned_nmethod = NULL; +} +void CodeCacheSweeperThread::oops_do(OopClosure* f, CLDClosure* cld_f, CodeBlobClosure* cf) { JavaThread::oops_do(f, cld_f, cf); if (_scanned_nmethod != NULL && cf != NULL) { // Safepoints can occur when the sweeper is scanning an nmethod so diff --git a/hotspot/src/share/vm/runtime/thread.hpp b/hotspot/src/share/vm/runtime/thread.hpp index 79f25e889ee..7bec298b95d 100644 --- a/hotspot/src/share/vm/runtime/thread.hpp +++ b/hotspot/src/share/vm/runtime/thread.hpp @@ -305,6 +305,7 @@ class Thread: public ThreadShadow { virtual bool is_VM_thread() const { return false; } virtual bool is_Java_thread() const { return false; } virtual bool is_Compiler_thread() const { return false; } + virtual bool is_Code_cache_sweeper_thread() const { return false; } virtual bool is_hidden_from_external_view() const { return false; } virtual bool is_jvmti_agent_thread() const { return false; } // True iff the thread can perform GC operations at a safepoint. @@ -1746,6 +1747,24 @@ inline CompilerThread* JavaThread::as_CompilerThread() { return (CompilerThread*)this; } +// Dedicated thread to sweep the code cache +class CodeCacheSweeperThread : public JavaThread { + nmethod* _scanned_nmethod; // nmethod being scanned by the sweeper + public: + CodeCacheSweeperThread(); + // Track the nmethod currently being scanned by the sweeper + void set_scanned_nmethod(nmethod* nm) { + assert(_scanned_nmethod == NULL || nm == NULL, "should reset to NULL before writing a new value"); + _scanned_nmethod = nm; + } + + bool is_Code_cache_sweeper_thread() const { return true; } + // GC support + // Apply "f->do_oop" to all root oops in "this". + // Apply "cf->do_code_blob" (if !NULL) to all code blobs active in frames + void oops_do(OopClosure* f, CLDClosure* cld_f, CodeBlobClosure* cf); +}; + // A thread used for Compilation. class CompilerThread : public JavaThread { friend class VMStructs; @@ -1758,7 +1777,6 @@ class CompilerThread : public JavaThread { CompileQueue* _queue; BufferBlob* _buffer_blob; - nmethod* _scanned_nmethod; // nmethod being scanned by the sweeper AbstractCompiler* _compiler; public: @@ -1792,28 +1810,17 @@ class CompilerThread : public JavaThread { _log = log; } - // GC support - // Apply "f->do_oop" to all root oops in "this". - // Apply "cf->do_code_blob" (if !NULL) to all code blobs active in frames - void oops_do(OopClosure* f, CLDClosure* cld_f, CodeBlobClosure* cf); - #ifndef PRODUCT private: IdealGraphPrinter *_ideal_graph_printer; public: - IdealGraphPrinter *ideal_graph_printer() { return _ideal_graph_printer; } - void set_ideal_graph_printer(IdealGraphPrinter *n) { _ideal_graph_printer = n; } + IdealGraphPrinter *ideal_graph_printer() { return _ideal_graph_printer; } + void set_ideal_graph_printer(IdealGraphPrinter *n) { _ideal_graph_printer = n; } #endif // Get/set the thread's current task - CompileTask* task() { return _task; } - void set_task(CompileTask* task) { _task = task; } - - // Track the nmethod currently being scanned by the sweeper - void set_scanned_nmethod(nmethod* nm) { - assert(_scanned_nmethod == NULL || nm == NULL, "should reset to NULL before writing a new value"); - _scanned_nmethod = nm; - } + CompileTask* task() { return _task; } + void set_task(CompileTask* task) { _task = task; } }; inline CompilerThread* CompilerThread::current() { diff --git a/hotspot/src/share/vm/runtime/vm_operations.cpp b/hotspot/src/share/vm/runtime/vm_operations.cpp index da07423db81..efacdc7c610 100644 --- a/hotspot/src/share/vm/runtime/vm_operations.cpp +++ b/hotspot/src/share/vm/runtime/vm_operations.cpp @@ -111,6 +111,9 @@ void VM_Deoptimize::doit() { CodeCache::make_marked_nmethods_zombies(); } +void VM_MarkActiveNMethods::doit() { + NMethodSweeper::mark_active_nmethods(); +} VM_DeoptimizeFrame::VM_DeoptimizeFrame(JavaThread* thread, intptr_t* id) { _thread = thread; diff --git a/hotspot/src/share/vm/runtime/vm_operations.hpp b/hotspot/src/share/vm/runtime/vm_operations.hpp index b5a1532338e..c8b4a3855fc 100644 --- a/hotspot/src/share/vm/runtime/vm_operations.hpp +++ b/hotspot/src/share/vm/runtime/vm_operations.hpp @@ -100,6 +100,7 @@ template(RotateGCLog) \ template(WhiteBoxOperation) \ template(ClassLoaderStatsOperation) \ + template(MarkActiveNMethods) \ template(PrintCompileQueue) \ template(PrintCodeList) \ template(PrintCodeCache) \ @@ -252,6 +253,13 @@ class VM_Deoptimize: public VM_Operation { bool allow_nested_vm_operations() const { return true; } }; +class VM_MarkActiveNMethods: public VM_Operation { + public: + VM_MarkActiveNMethods() {} + VMOp_Type type() const { return VMOp_MarkActiveNMethods; } + void doit(); + bool allow_nested_vm_operations() const { return true; } +}; // Deopt helper that can deoptimize frames in threads other than the // current thread. Only used through Deoptimization::deoptimize_frame. diff --git a/hotspot/src/share/vm/trace/trace.xml b/hotspot/src/share/vm/trace/trace.xml index 9ffc764599b..120d27f4d4d 100644 --- a/hotspot/src/share/vm/trace/trace.xml +++ b/hotspot/src/share/vm/trace/trace.xml @@ -383,7 +383,6 @@ Declares a structure type that can be used in other events. - diff --git a/hotspot/test/compiler/startup/SmallCodeCacheStartup.java b/hotspot/test/compiler/startup/SmallCodeCacheStartup.java index 5db43673fa8..72583df8502 100644 --- a/hotspot/test/compiler/startup/SmallCodeCacheStartup.java +++ b/hotspot/test/compiler/startup/SmallCodeCacheStartup.java @@ -27,10 +27,20 @@ * @summary Test ensures that there is no crash if there is not enough ReservedCodeacacheSize * to initialize all compiler threads. The option -Xcomp gives the VM more time to * to trigger the old bug. - * @run main/othervm -XX:ReservedCodeCacheSize=3m -XX:CICompilerCount=64 -Xcomp SmallCodeCacheStartup + * @library /testlibrary */ +import com.oracle.java.testlibrary.*; + public class SmallCodeCacheStartup { public static void main(String[] args) throws Exception { + try { + ProcessBuilder pb = ProcessTools.createJavaProcessBuilder("-XX:ReservedCodeCacheSize=3m", + "-XX:CICompilerCount=64", + "-Xcomp", + "SmallCodeCacheStartup"); + pb.start(); + } catch (VirtualMachineError e) {} + System.out.println("TEST PASSED"); } } diff --git a/hotspot/test/gc/g1/TestHumongousCodeCacheRoots.java b/hotspot/test/gc/g1/TestHumongousCodeCacheRoots.java index 122597aea64..d234cf81dfb 100644 --- a/hotspot/test/gc/g1/TestHumongousCodeCacheRoots.java +++ b/hotspot/test/gc/g1/TestHumongousCodeCacheRoots.java @@ -135,7 +135,6 @@ public class TestHumongousCodeCacheRoots { "-XX:+UnlockDiagnosticVMOptions", "-XX:InitiatingHeapOccupancyPercent=1", // strong code root marking "-XX:+G1VerifyHeapRegionCodeRoots", "-XX:+VerifyAfterGC", // make sure that verification is run - "-XX:NmethodSweepFraction=1", "-XX:NmethodSweepCheckInterval=1", // make the code cache sweep more predictable }; runTest("-client", baseArguments); runTest("-server", baseArguments); From 83181efbeb075e51846f911b46bbdb0353a720c4 Mon Sep 17 00:00:00 2001 From: Vladimir Ivanov Date: Fri, 24 Oct 2014 09:13:12 -0700 Subject: [PATCH 12/61] 8058847: C2: EliminateAutoBox regression after 8042786 Reviewed-by: kvn, roland --- hotspot/src/share/vm/opto/memnode.cpp | 10 +++ .../EliminateAutoBox/UnsignedLoads.java | 63 +++++++++++++++++++ 2 files changed, 73 insertions(+) create mode 100644 hotspot/test/compiler/EliminateAutoBox/UnsignedLoads.java diff --git a/hotspot/src/share/vm/opto/memnode.cpp b/hotspot/src/share/vm/opto/memnode.cpp index 3d8271dc92a..8ed5154f7be 100644 --- a/hotspot/src/share/vm/opto/memnode.cpp +++ b/hotspot/src/share/vm/opto/memnode.cpp @@ -1257,6 +1257,16 @@ Node* LoadNode::eliminate_autobox(PhaseGVN* phase) { result = new ConvI2LNode(phase->transform(result)); } #endif + // Boxing/unboxing can be done from signed & unsigned loads (e.g. LoadUB -> ... -> LoadB pair). + // Need to preserve unboxing load type if it is unsigned. + switch(this->Opcode()) { + case Op_LoadUB: + result = new AndINode(phase->transform(result), phase->intcon(0xFF)); + break; + case Op_LoadUS: + result = new AndINode(phase->transform(result), phase->intcon(0xFFFF)); + break; + } return result; } } diff --git a/hotspot/test/compiler/EliminateAutoBox/UnsignedLoads.java b/hotspot/test/compiler/EliminateAutoBox/UnsignedLoads.java new file mode 100644 index 00000000000..982c5f7beb1 --- /dev/null +++ b/hotspot/test/compiler/EliminateAutoBox/UnsignedLoads.java @@ -0,0 +1,63 @@ +/* + * Copyright (c) 2014, Oracle and/or its affiliates. All rights reserved. + * DO NOT ALTER OR REMOVE COPYRIGHT NOTICES OR THIS FILE HEADER. + * + * This code is free software; you can redistribute it and/or modify it + * under the terms of the GNU General Public License version 2 only, as + * published by the Free Software Foundation. Oracle designates this + * particular file as subject to the "Classpath" exception as provided + * by Oracle in the LICENSE file that accompanied this code. + * + * This code is distributed in the hope that it will be useful, but WITHOUT + * ANY WARRANTY; without even the implied warranty of MERCHANTABILITY or + * FITNESS FOR A PARTICULAR PURPOSE. See the GNU General Public License + * version 2 for more details (a copy is included in the LICENSE file that + * accompanied this code). + * + * You should have received a copy of the GNU General Public License version + * 2 along with this work; if not, write to the Free Software Foundation, + * Inc., 51 Franklin St, Fifth Floor, Boston, MA 02110-1301 USA. + * + * Please contact Oracle, 500 Oracle Parkway, Redwood Shores, CA 94065 USA + * or visit www.oracle.com if you need additional information or have any + * questions. + */ + +/* + * @test + * @library /testlibrary + * @run main/othervm -Xbatch -XX:+EliminateAutoBox + * -XX:CompileOnly=::valueOf,::byteValue,::shortValue,::testUnsignedByte,::testUnsignedShort + * UnsignedLoads + */ +import static com.oracle.java.testlibrary.Asserts.assertEQ; + +public class UnsignedLoads { + public static int testUnsignedByte() { + byte[] bytes = new byte[] {-1}; + int res = 0; + for (int i = 0; i < 100000; i++) { + for (Byte b : bytes) { + res = b & 0xff; + } + } + return res; + } + + public static int testUnsignedShort() { + int res = 0; + short[] shorts = new short[] {-1}; + for (int i = 0; i < 100000; i++) { + for (Short s : shorts) { + res = s & 0xffff; + } + } + return res; + } + + public static void main(String[] args) { + assertEQ(testUnsignedByte(), 255); + assertEQ(testUnsignedShort(), 65535); + System.out.println("TEST PASSED"); + } +} From 916697af2c7d3b67e7769831ed7bba29211c4c67 Mon Sep 17 00:00:00 2001 From: Vladimir Ivanov Date: Fri, 24 Oct 2014 09:14:41 -0700 Subject: [PATCH 13/61] 8036748: assert(_base == Int) failed: Not an Int w/ -XX:+TraceIterativeGVN Reviewed-by: kvn, roland --- hotspot/src/share/vm/opto/callnode.cpp | 3 +- .../compiler/debug/TraceIterativeGVN.java | 39 +++++++++++++++++++ 2 files changed, 41 insertions(+), 1 deletion(-) create mode 100644 hotspot/test/compiler/debug/TraceIterativeGVN.java diff --git a/hotspot/src/share/vm/opto/callnode.cpp b/hotspot/src/share/vm/opto/callnode.cpp index ccf23118bb3..619b37260b5 100644 --- a/hotspot/src/share/vm/opto/callnode.cpp +++ b/hotspot/src/share/vm/opto/callnode.cpp @@ -939,7 +939,8 @@ int CallStaticJavaNode::extract_uncommon_trap_request(const Node* call) { #ifndef PRODUCT if (!(call->req() > TypeFunc::Parms && call->in(TypeFunc::Parms) != NULL && - call->in(TypeFunc::Parms)->is_Con())) { + call->in(TypeFunc::Parms)->is_Con() && + call->in(TypeFunc::Parms)->bottom_type()->isa_int())) { assert(in_dump() != 0, "OK if dumping"); tty->print("[bad uncommon trap]"); return 0; diff --git a/hotspot/test/compiler/debug/TraceIterativeGVN.java b/hotspot/test/compiler/debug/TraceIterativeGVN.java new file mode 100644 index 00000000000..7d98dd660b9 --- /dev/null +++ b/hotspot/test/compiler/debug/TraceIterativeGVN.java @@ -0,0 +1,39 @@ +/* + * Copyright (c) 2014, Oracle and/or its affiliates. All rights reserved. + * DO NOT ALTER OR REMOVE COPYRIGHT NOTICES OR THIS FILE HEADER. + * + * This code is free software; you can redistribute it and/or modify it + * under the terms of the GNU General Public License version 2 only, as + * published by the Free Software Foundation. Oracle designates this + * particular file as subject to the "Classpath" exception as provided + * by Oracle in the LICENSE file that accompanied this code. + * + * This code is distributed in the hope that it will be useful, but WITHOUT + * ANY WARRANTY; without even the implied warranty of MERCHANTABILITY or + * FITNESS FOR A PARTICULAR PURPOSE. See the GNU General Public License + * version 2 for more details (a copy is included in the LICENSE file that + * accompanied this code). + * + * You should have received a copy of the GNU General Public License version + * 2 along with this work; if not, write to the Free Software Foundation, + * Inc., 51 Franklin St, Fifth Floor, Boston, MA 02110-1301 USA. + * + * Please contact Oracle, 500 Oracle Parkway, Redwood Shores, CA 94065 USA + * or visit www.oracle.com if you need additional information or have any + * questions. + */ + +/* + * @test + * @run main/othervm -Xbatch -XX:-TieredCompilation + * -XX:+IgnoreUnrecognizedVMOptions -XX:+TraceIterativeGVN + * TraceIterativeGVN + */ +public class TraceIterativeGVN { + public static void main(String[] args) { + for (int i = 0; i < 100_000; i++) { + Byte.valueOf((byte)0); + } + System.out.println("TEST PASSED"); + } +} From db334facfc30b18884a323f1af6908bb52fa2f71 Mon Sep 17 00:00:00 2001 From: Sergei Kovalev Date: Fri, 24 Oct 2014 09:17:32 -0700 Subject: [PATCH 14/61] 8028481: [TESTBUG] compiler/jsr292/CreatesInterfaceDotEqualsCallInfo.java should be in needs_nashorn test group Reviewed-by: vlivanov, kvn --- hotspot/test/TEST.groups | 15 +++++++++++++-- 1 file changed, 13 insertions(+), 2 deletions(-) diff --git a/hotspot/test/TEST.groups b/hotspot/test/TEST.groups index 0b65e906df7..01cd4dbcecb 100644 --- a/hotspot/test/TEST.groups +++ b/hotspot/test/TEST.groups @@ -198,7 +198,8 @@ compact2_minimal = \ # Tests that require compact2 API's # -needs_compact2 = +needs_compact2 = \ + compiler/jsr292/CreatesInterfaceDotEqualsCallInfo.java # All tests that run on the most minimal configuration: Minimal VM on Compact 1 compact1_minimal = \ @@ -479,7 +480,6 @@ hotspot_compiler_3 = \ compiler/intrinsics/unsafe/UnsafeGetAddressTest.java \ compiler/jsr292/ConcurrentClassLoadingTest.java \ compiler/jsr292/CreatesInterfaceDotEqualsCallInfo.java \ - compiler/jsr292/CreatesInterfaceDotEqualsCallInfo.java \ compiler/loopopts/TestLogSum.java \ compiler/macronodes/TestEliminateAllocationPhi.java \ compiler/membars/TestMemBarAcquire.java \ @@ -602,3 +602,14 @@ hotspot_all = \ :hotspot_gc \ :hotspot_runtime \ :hotspot_serviceability + +#All tests that depends on nashorn extension. +# +needs_nashorn = \ + compiler/jsr292/CreatesInterfaceDotEqualsCallInfo.java + +#All tests that do not depends on nashorn extension +# +not_needs_nashorn = \ + :jdk \ + -:needs_nashorh From c620214d183fb41a97ab9261df856a41ff60bb2c Mon Sep 17 00:00:00 2001 From: Vladimir Kozlov Date: Fri, 24 Oct 2014 10:28:19 -0700 Subject: [PATCH 15/61] 8041984: CompilerThread seems to occupy all CPU in a very rare situation Add new timeout checks to EA. Reviewed-by: iveresov, drchase --- hotspot/src/share/vm/opto/c2_globals.hpp | 3 + hotspot/src/share/vm/opto/escape.cpp | 74 +++++++++++++++------- hotspot/src/share/vm/opto/escape.hpp | 78 ++++++++++++++++-------- 3 files changed, 106 insertions(+), 49 deletions(-) diff --git a/hotspot/src/share/vm/opto/c2_globals.hpp b/hotspot/src/share/vm/opto/c2_globals.hpp index 4c7c92a7809..a49f31641dc 100644 --- a/hotspot/src/share/vm/opto/c2_globals.hpp +++ b/hotspot/src/share/vm/opto/c2_globals.hpp @@ -476,6 +476,9 @@ product(bool, DoEscapeAnalysis, true, \ "Perform escape analysis") \ \ + product(double, EscapeAnalysisTimeout, 20. DEBUG_ONLY(+40.), \ + "Abort EA when it reaches time limit (in sec)") \ + \ develop(bool, ExitEscapeAnalysisOnTimeout, true, \ "Exit or throw assert in EA when it reaches time limit") \ \ diff --git a/hotspot/src/share/vm/opto/escape.cpp b/hotspot/src/share/vm/opto/escape.cpp index 2e454a70f88..9f09b62d761 100644 --- a/hotspot/src/share/vm/opto/escape.cpp +++ b/hotspot/src/share/vm/opto/escape.cpp @@ -38,6 +38,8 @@ ConnectionGraph::ConnectionGraph(Compile * C, PhaseIterGVN *igvn) : _nodes(C->comp_arena(), C->unique(), C->unique(), NULL), + _in_worklist(C->comp_arena()), + _next_pidx(0), _collecting(true), _verify(false), _compile(C), @@ -125,13 +127,19 @@ bool ConnectionGraph::compute_escape() { if (C->root() != NULL) { ideal_nodes.push(C->root()); } + // Processed ideal nodes are unique on ideal_nodes list + // but several ideal nodes are mapped to the phantom_obj. + // To avoid duplicated entries on the following worklists + // add the phantom_obj only once to them. + ptnodes_worklist.append(phantom_obj); + java_objects_worklist.append(phantom_obj); for( uint next = 0; next < ideal_nodes.size(); ++next ) { Node* n = ideal_nodes.at(next); // Create PointsTo nodes and add them to Connection Graph. Called // only once per ideal node since ideal_nodes is Unique_Node list. add_node_to_connection_graph(n, &delayed_worklist); PointsToNode* ptn = ptnode_adr(n->_idx); - if (ptn != NULL) { + if (ptn != NULL && ptn != phantom_obj) { ptnodes_worklist.append(ptn); if (ptn->is_JavaObject()) { java_objects_worklist.append(ptn->as_JavaObject()); @@ -415,7 +423,7 @@ void ConnectionGraph::add_node_to_connection_graph(Node *n, Unique_Node_List *de } case Op_CreateEx: { // assume that all exception objects globally escape - add_java_object(n, PointsToNode::GlobalEscape); + map_ideal_node(n, phantom_obj); break; } case Op_LoadKlass: @@ -1074,13 +1082,8 @@ bool ConnectionGraph::complete_connection_graph( // on graph complexity. Observed 8 passes in jvm2008 compiler.compiler. // Set limit to 20 to catch situation when something did go wrong and // bailout Escape Analysis. - // Also limit build time to 30 sec (60 in debug VM). + // Also limit build time to 20 sec (60 in debug VM), EscapeAnalysisTimeout flag. #define CG_BUILD_ITER_LIMIT 20 -#ifdef ASSERT -#define CG_BUILD_TIME_LIMIT 60.0 -#else -#define CG_BUILD_TIME_LIMIT 30.0 -#endif // Propagate GlobalEscape and ArgEscape escape states and check that // we still have non-escaping objects. The method pushs on _worklist @@ -1091,12 +1094,13 @@ bool ConnectionGraph::complete_connection_graph( // Now propagate references to all JavaObject nodes. int java_objects_length = java_objects_worklist.length(); elapsedTimer time; + bool timeout = false; int new_edges = 1; int iterations = 0; do { while ((new_edges > 0) && - (iterations++ < CG_BUILD_ITER_LIMIT) && - (time.seconds() < CG_BUILD_TIME_LIMIT)) { + (iterations++ < CG_BUILD_ITER_LIMIT)) { + double start_time = time.seconds(); time.start(); new_edges = 0; // Propagate references to phantom_object for nodes pushed on _worklist @@ -1105,7 +1109,26 @@ bool ConnectionGraph::complete_connection_graph( for (int next = 0; next < java_objects_length; ++next) { JavaObjectNode* ptn = java_objects_worklist.at(next); new_edges += add_java_object_edges(ptn, true); + +#define SAMPLE_SIZE 4 + if ((next % SAMPLE_SIZE) == 0) { + // Each 4 iterations calculate how much time it will take + // to complete graph construction. + time.stop(); + double stop_time = time.seconds(); + double time_per_iter = (stop_time - start_time) / (double)SAMPLE_SIZE; + double time_until_end = time_per_iter * (double)(java_objects_length - next); + if ((start_time + time_until_end) >= EscapeAnalysisTimeout) { + timeout = true; + break; // Timeout + } + start_time = stop_time; + time.start(); + } +#undef SAMPLE_SIZE + } + if (timeout) break; if (new_edges > 0) { // Update escape states on each iteration if graph was updated. if (!find_non_escaped_objects(ptnodes_worklist, non_escaped_worklist)) { @@ -1113,9 +1136,12 @@ bool ConnectionGraph::complete_connection_graph( } } time.stop(); + if (time.seconds() >= EscapeAnalysisTimeout) { + timeout = true; + break; + } } - if ((iterations < CG_BUILD_ITER_LIMIT) && - (time.seconds() < CG_BUILD_TIME_LIMIT)) { + if ((iterations < CG_BUILD_ITER_LIMIT) && !timeout) { time.start(); // Find fields which have unknown value. int fields_length = oop_fields_worklist.length(); @@ -1128,18 +1154,21 @@ bool ConnectionGraph::complete_connection_graph( } } time.stop(); + if (time.seconds() >= EscapeAnalysisTimeout) { + timeout = true; + break; + } } else { new_edges = 0; // Bailout } } while (new_edges > 0); // Bailout if passed limits. - if ((iterations >= CG_BUILD_ITER_LIMIT) || - (time.seconds() >= CG_BUILD_TIME_LIMIT)) { + if ((iterations >= CG_BUILD_ITER_LIMIT) || timeout) { Compile* C = _compile; if (C->log() != NULL) { C->log()->begin_elem("connectionGraph_bailout reason='reached "); - C->log()->text("%s", (iterations >= CG_BUILD_ITER_LIMIT) ? "iterations" : "time"); + C->log()->text("%s", timeout ? "time" : "iterations"); C->log()->end_elem(" limit'"); } assert(ExitEscapeAnalysisOnTimeout, err_msg_res("infinite EA connection graph build (%f sec, %d iterations) with %d nodes and worklist size %d", @@ -1156,7 +1185,6 @@ bool ConnectionGraph::complete_connection_graph( #endif #undef CG_BUILD_ITER_LIMIT -#undef CG_BUILD_TIME_LIMIT // Find fields initialized by NULL for non-escaping Allocations. int non_escaped_length = non_escaped_worklist.length(); @@ -1280,8 +1308,8 @@ int ConnectionGraph::add_java_object_edges(JavaObjectNode* jobj, bool populate_w } } } - while(_worklist.length() > 0) { - PointsToNode* use = _worklist.pop(); + for (int l = 0; l < _worklist.length(); l++) { + PointsToNode* use = _worklist.at(l); if (PointsToNode::is_base_use(use)) { // Add reference from jobj to field and from field to jobj (field's base). use = PointsToNode::get_use_node(use)->as_Field(); @@ -1328,6 +1356,8 @@ int ConnectionGraph::add_java_object_edges(JavaObjectNode* jobj, bool populate_w add_field_uses_to_worklist(use->as_Field()); } } + _worklist.clear(); + _in_worklist.Reset(); return new_edges; } @@ -1906,7 +1936,7 @@ void ConnectionGraph::add_local_var(Node *n, PointsToNode::EscapeState es) { return; } Compile* C = _compile; - ptadr = new (C->comp_arena()) LocalVarNode(C, n, es); + ptadr = new (C->comp_arena()) LocalVarNode(this, n, es); _nodes.at_put(n->_idx, ptadr); } @@ -1917,7 +1947,7 @@ void ConnectionGraph::add_java_object(Node *n, PointsToNode::EscapeState es) { return; } Compile* C = _compile; - ptadr = new (C->comp_arena()) JavaObjectNode(C, n, es); + ptadr = new (C->comp_arena()) JavaObjectNode(this, n, es); _nodes.at_put(n->_idx, ptadr); } @@ -1933,7 +1963,7 @@ void ConnectionGraph::add_field(Node *n, PointsToNode::EscapeState es, int offse es = PointsToNode::GlobalEscape; } Compile* C = _compile; - FieldNode* field = new (C->comp_arena()) FieldNode(C, n, es, offset, is_oop); + FieldNode* field = new (C->comp_arena()) FieldNode(this, n, es, offset, is_oop); _nodes.at_put(n->_idx, field); } @@ -1947,7 +1977,7 @@ void ConnectionGraph::add_arraycopy(Node *n, PointsToNode::EscapeState es, return; } Compile* C = _compile; - ptadr = new (C->comp_arena()) ArraycopyNode(C, n, es); + ptadr = new (C->comp_arena()) ArraycopyNode(this, n, es); _nodes.at_put(n->_idx, ptadr); // Add edge from arraycopy node to source object. (void)add_edge(ptadr, src); diff --git a/hotspot/src/share/vm/opto/escape.hpp b/hotspot/src/share/vm/opto/escape.hpp index 78447f03062..89a0d44a358 100644 --- a/hotspot/src/share/vm/opto/escape.hpp +++ b/hotspot/src/share/vm/opto/escape.hpp @@ -125,6 +125,8 @@ class LocalVarNode; class FieldNode; class ArraycopyNode; +class ConnectionGraph; + // ConnectionGraph nodes class PointsToNode : public ResourceObj { GrowableArray _edges; // List of nodes this node points to @@ -137,6 +139,7 @@ class PointsToNode : public ResourceObj { Node* const _node; // Ideal node corresponding to this PointsTo node. const int _idx; // Cached ideal node's _idx + const uint _pidx; // Index of this node public: typedef enum { @@ -165,17 +168,9 @@ public: } NodeFlags; - PointsToNode(Compile *C, Node* n, EscapeState es, NodeType type): - _edges(C->comp_arena(), 2, 0, NULL), - _uses (C->comp_arena(), 2, 0, NULL), - _node(n), - _idx(n->_idx), - _type((u1)type), - _escape((u1)es), - _fields_escape((u1)es), - _flags(ScalarReplaceable) { - assert(n != NULL && es != UnknownEscape, "sanity"); - } + inline PointsToNode(ConnectionGraph* CG, Node* n, EscapeState es, NodeType type); + + uint pidx() const { return _pidx; } Node* ideal_node() const { return _node; } int idx() const { return _idx; } @@ -243,14 +238,14 @@ public: class LocalVarNode: public PointsToNode { public: - LocalVarNode(Compile *C, Node* n, EscapeState es): - PointsToNode(C, n, es, LocalVar) {} + LocalVarNode(ConnectionGraph *CG, Node* n, EscapeState es): + PointsToNode(CG, n, es, LocalVar) {} }; class JavaObjectNode: public PointsToNode { public: - JavaObjectNode(Compile *C, Node* n, EscapeState es): - PointsToNode(C, n, es, JavaObject) { + JavaObjectNode(ConnectionGraph *CG, Node* n, EscapeState es): + PointsToNode(CG, n, es, JavaObject) { if (es > NoEscape) set_scalar_replaceable(false); } @@ -262,8 +257,8 @@ class FieldNode: public PointsToNode { const bool _is_oop; // Field points to object bool _has_unknown_base; // Has phantom_object base public: - FieldNode(Compile *C, Node* n, EscapeState es, int offs, bool is_oop): - PointsToNode(C, n, es, Field), + FieldNode(ConnectionGraph *CG, Node* n, EscapeState es, int offs, bool is_oop): + PointsToNode(CG, n, es, Field), _offset(offs), _is_oop(is_oop), _has_unknown_base(false) {} @@ -284,8 +279,8 @@ public: class ArraycopyNode: public PointsToNode { public: - ArraycopyNode(Compile *C, Node* n, EscapeState es): - PointsToNode(C, n, es, Arraycopy) {} + ArraycopyNode(ConnectionGraph *CG, Node* n, EscapeState es): + PointsToNode(CG, n, es, Arraycopy) {} }; // Iterators for PointsTo node's edges: @@ -323,11 +318,14 @@ public: class ConnectionGraph: public ResourceObj { + friend class PointsToNode; private: GrowableArray _nodes; // Map from ideal nodes to // ConnectionGraph nodes. GrowableArray _worklist; // Nodes to be processed + VectorSet _in_worklist; + uint _next_pidx; bool _collecting; // Indicates whether escape information // is still being collected. If false, @@ -353,6 +351,8 @@ private: } uint nodes_size() const { return _nodes.length(); } + uint next_pidx() { return _next_pidx++; } + // Add nodes to ConnectionGraph. void add_local_var(Node* n, PointsToNode::EscapeState es); void add_java_object(Node* n, PointsToNode::EscapeState es); @@ -396,15 +396,26 @@ private: int add_java_object_edges(JavaObjectNode* jobj, bool populate_worklist); // Put node on worklist if it is (or was) not there. - void add_to_worklist(PointsToNode* pt) { - _worklist.push(pt); - return; + inline void add_to_worklist(PointsToNode* pt) { + PointsToNode* ptf = pt; + uint pidx_bias = 0; + if (PointsToNode::is_base_use(pt)) { + // Create a separate entry in _in_worklist for a marked base edge + // because _worklist may have an entry for a normal edge pointing + // to the same node. To separate them use _next_pidx as bias. + ptf = PointsToNode::get_use_node(pt)->as_Field(); + pidx_bias = _next_pidx; + } + if (!_in_worklist.test_set(ptf->pidx() + pidx_bias)) { + _worklist.append(pt); + } } // Put on worklist all uses of this node. - void add_uses_to_worklist(PointsToNode* pt) { - for (UseIterator i(pt); i.has_next(); i.next()) - _worklist.push(i.get()); + inline void add_uses_to_worklist(PointsToNode* pt) { + for (UseIterator i(pt); i.has_next(); i.next()) { + add_to_worklist(i.get()); + } } // Put on worklist all field's uses and related field nodes. @@ -517,8 +528,8 @@ private: } // Helper functions bool is_oop_field(Node* n, int offset, bool* unsafe); - static Node* get_addp_base(Node *addp); - static Node* find_second_addp(Node* addp, Node* n); + static Node* get_addp_base(Node *addp); + static Node* find_second_addp(Node* addp, Node* n); // offset of a field reference int address_offset(Node* adr, PhaseTransform *phase); @@ -587,4 +598,17 @@ public: #endif }; +inline PointsToNode::PointsToNode(ConnectionGraph *CG, Node* n, EscapeState es, NodeType type): + _edges(CG->_compile->comp_arena(), 2, 0, NULL), + _uses (CG->_compile->comp_arena(), 2, 0, NULL), + _node(n), + _idx(n->_idx), + _pidx(CG->next_pidx()), + _type((u1)type), + _escape((u1)es), + _fields_escape((u1)es), + _flags(ScalarReplaceable) { + assert(n != NULL && es != UnknownEscape, "sanity"); +} + #endif // SHARE_VM_OPTO_ESCAPE_HPP From f1db529ce7b3f02c1043b31381b040405a8b2ca6 Mon Sep 17 00:00:00 2001 From: Dmitrij Pochepko Date: Sat, 25 Oct 2014 19:06:23 +0400 Subject: [PATCH 16/61] 8043674: Update compiler/intrinsic/bmi tests to run it on all platforms Reviewed-by: kvn, iignatyev, fzhinkin --- hotspot/test/compiler/intrinsics/bmi/TestAndnI.java | 6 +++--- hotspot/test/compiler/intrinsics/bmi/TestAndnL.java | 6 +++--- hotspot/test/compiler/intrinsics/bmi/TestBlsiI.java | 6 +++--- hotspot/test/compiler/intrinsics/bmi/TestBlsiL.java | 6 +++--- hotspot/test/compiler/intrinsics/bmi/TestBlsmskI.java | 6 +++--- hotspot/test/compiler/intrinsics/bmi/TestBlsmskL.java | 6 +++--- hotspot/test/compiler/intrinsics/bmi/TestBlsrI.java | 6 +++--- hotspot/test/compiler/intrinsics/bmi/TestBlsrL.java | 6 +++--- hotspot/test/compiler/intrinsics/bmi/TestLzcntI.java | 5 ++--- hotspot/test/compiler/intrinsics/bmi/TestLzcntL.java | 5 ++--- hotspot/test/compiler/intrinsics/bmi/TestTzcntI.java | 5 ++--- hotspot/test/compiler/intrinsics/bmi/TestTzcntL.java | 5 ++--- 12 files changed, 32 insertions(+), 36 deletions(-) diff --git a/hotspot/test/compiler/intrinsics/bmi/TestAndnI.java b/hotspot/test/compiler/intrinsics/bmi/TestAndnI.java index 45a79b0df37..fa7b842380e 100644 --- a/hotspot/test/compiler/intrinsics/bmi/TestAndnI.java +++ b/hotspot/test/compiler/intrinsics/bmi/TestAndnI.java @@ -41,14 +41,14 @@ public class TestAndnI { public static void main(String args[]) throws Throwable { if (!CPUInfo.hasFeature("bmi1")) { - System.out.println("CPU does not support bmi1 feature. "+ - "Test skipped."); - return; + System.out.println("INFO: CPU does not support bmi1 feature."); } BMITestRunner.runTests(AndnIExpr.class, args, + "-XX:+IgnoreUnrecognizedVMOptions", "-XX:+UseBMI1Instructions"); BMITestRunner.runTests(AndnICommutativeExpr.class, args, + "-XX:+IgnoreUnrecognizedVMOptions", "-XX:+UseBMI1Instructions"); } diff --git a/hotspot/test/compiler/intrinsics/bmi/TestAndnL.java b/hotspot/test/compiler/intrinsics/bmi/TestAndnL.java index 8746fefa483..6e7fbe4fbf8 100644 --- a/hotspot/test/compiler/intrinsics/bmi/TestAndnL.java +++ b/hotspot/test/compiler/intrinsics/bmi/TestAndnL.java @@ -41,14 +41,14 @@ public class TestAndnL { public static void main(String args[]) throws Throwable { if (!CPUInfo.hasFeature("bmi1")) { - System.out.println("CPU does not support bmi1 feature. " + - "Test skipped."); - return; + System.out.println("INFO: CPU does not support bmi1 feature."); } BMITestRunner.runTests(AndnLExpr.class, args, + "-XX:+IgnoreUnrecognizedVMOptions", "-XX:+UseBMI1Instructions"); BMITestRunner.runTests(AndnLCommutativeExpr.class, args, + "-XX:+IgnoreUnrecognizedVMOptions", "-XX:+UseBMI1Instructions"); } diff --git a/hotspot/test/compiler/intrinsics/bmi/TestBlsiI.java b/hotspot/test/compiler/intrinsics/bmi/TestBlsiI.java index 7ced5242692..794676252a0 100644 --- a/hotspot/test/compiler/intrinsics/bmi/TestBlsiI.java +++ b/hotspot/test/compiler/intrinsics/bmi/TestBlsiI.java @@ -41,14 +41,14 @@ public class TestBlsiI { public static void main(String args[]) throws Throwable { if (!CPUInfo.hasFeature("bmi1")) { - System.out.println("CPU does not support bmi1 feature. " + - "Test skipped."); - return; + System.out.println("INFO: CPU does not support bmi1 feature."); } BMITestRunner.runTests(BlsiIExpr.class, args, + "-XX:+IgnoreUnrecognizedVMOptions", "-XX:+UseBMI1Instructions"); BMITestRunner.runTests(BlsiICommutativeExpr.class, args, + "-XX:+IgnoreUnrecognizedVMOptions", "-XX:+UseBMI1Instructions"); } diff --git a/hotspot/test/compiler/intrinsics/bmi/TestBlsiL.java b/hotspot/test/compiler/intrinsics/bmi/TestBlsiL.java index d1fe59c204b..046351222e9 100644 --- a/hotspot/test/compiler/intrinsics/bmi/TestBlsiL.java +++ b/hotspot/test/compiler/intrinsics/bmi/TestBlsiL.java @@ -41,14 +41,14 @@ public class TestBlsiL { public static void main(String args[]) throws Throwable { if (!CPUInfo.hasFeature("bmi1")) { - System.out.println("CPU does not support bmi1 feature. " + - "Test skipped."); - return; + System.out.println("INFO: CPU does not support bmi1 feature."); } BMITestRunner.runTests(BlsiLExpr.class, args, + "-XX:+IgnoreUnrecognizedVMOptions", "-XX:+UseBMI1Instructions"); BMITestRunner.runTests(BlsiLCommutativeExpr.class, args, + "-XX:+IgnoreUnrecognizedVMOptions", "-XX:+UseBMI1Instructions"); } diff --git a/hotspot/test/compiler/intrinsics/bmi/TestBlsmskI.java b/hotspot/test/compiler/intrinsics/bmi/TestBlsmskI.java index 7cba5d88e36..3f1b95ffec2 100644 --- a/hotspot/test/compiler/intrinsics/bmi/TestBlsmskI.java +++ b/hotspot/test/compiler/intrinsics/bmi/TestBlsmskI.java @@ -41,14 +41,14 @@ public class TestBlsmskI { public static void main(String args[]) throws Throwable { if (!CPUInfo.hasFeature("bmi1")) { - System.out.println("CPU does not support bmi1 feature. " + - "Test skipped."); - return; + System.out.println("INFO: CPU does not support bmi1 feature."); } BMITestRunner.runTests(BlsmskIExpr.class, args, + "-XX:+IgnoreUnrecognizedVMOptions", "-XX:+UseBMI1Instructions"); BMITestRunner.runTests(BlsmskICommutativeExpr.class, args, + "-XX:+IgnoreUnrecognizedVMOptions", "-XX:+UseBMI1Instructions"); } diff --git a/hotspot/test/compiler/intrinsics/bmi/TestBlsmskL.java b/hotspot/test/compiler/intrinsics/bmi/TestBlsmskL.java index d2f3a3f6aea..aca3981f779 100644 --- a/hotspot/test/compiler/intrinsics/bmi/TestBlsmskL.java +++ b/hotspot/test/compiler/intrinsics/bmi/TestBlsmskL.java @@ -41,14 +41,14 @@ public class TestBlsmskL { public static void main(String args[]) throws Throwable { if (!CPUInfo.hasFeature("bmi1")) { - System.out.println("CPU does not support bmi1 feature. " + - "Test skipped."); - return; + System.out.println("INFO: CPU does not support bmi1 feature."); } BMITestRunner.runTests(BlsmskLExpr.class, args, + "-XX:+IgnoreUnrecognizedVMOptions", "-XX:+UseBMI1Instructions"); BMITestRunner.runTests(BlsmskLCommutativeExpr.class, args, + "-XX:+IgnoreUnrecognizedVMOptions", "-XX:+UseBMI1Instructions"); } diff --git a/hotspot/test/compiler/intrinsics/bmi/TestBlsrI.java b/hotspot/test/compiler/intrinsics/bmi/TestBlsrI.java index 53e7251143b..90121c88942 100644 --- a/hotspot/test/compiler/intrinsics/bmi/TestBlsrI.java +++ b/hotspot/test/compiler/intrinsics/bmi/TestBlsrI.java @@ -41,14 +41,14 @@ public class TestBlsrI { public static void main(String args[]) throws Throwable { if (!CPUInfo.hasFeature("bmi1")) { - System.out.println("CPU does not support bmi1 feature. " + - "Test skipped."); - return; + System.out.println("INFO: CPU does not support bmi1 feature."); } BMITestRunner.runTests(BlsrIExpr.class, args, + "-XX:+IgnoreUnrecognizedVMOptions", "-XX:+UseBMI1Instructions"); BMITestRunner.runTests(BlsrICommutativeExpr.class, args, + "-XX:+IgnoreUnrecognizedVMOptions", "-XX:+UseBMI1Instructions"); } diff --git a/hotspot/test/compiler/intrinsics/bmi/TestBlsrL.java b/hotspot/test/compiler/intrinsics/bmi/TestBlsrL.java index 5e3c885542b..ad267769dac 100644 --- a/hotspot/test/compiler/intrinsics/bmi/TestBlsrL.java +++ b/hotspot/test/compiler/intrinsics/bmi/TestBlsrL.java @@ -41,14 +41,14 @@ public class TestBlsrL { public static void main(String args[]) throws Throwable { if (!CPUInfo.hasFeature("bmi1")) { - System.out.println("CPU does not support bmi1 feature. " + - "Test skipped."); - return; + System.out.println("INFO: CPU does not support bmi1 feature."); } BMITestRunner.runTests(BlsrLExpr.class, args, + "-XX:+IgnoreUnrecognizedVMOptions", "-XX:+UseBMI1Instructions"); BMITestRunner.runTests(BlsrLCommutativeExpr.class, args, + "-XX:+IgnoreUnrecognizedVMOptions", "-XX:+UseBMI1Instructions"); } diff --git a/hotspot/test/compiler/intrinsics/bmi/TestLzcntI.java b/hotspot/test/compiler/intrinsics/bmi/TestLzcntI.java index d13b89c0246..5cb08e0a381 100644 --- a/hotspot/test/compiler/intrinsics/bmi/TestLzcntI.java +++ b/hotspot/test/compiler/intrinsics/bmi/TestLzcntI.java @@ -41,12 +41,11 @@ public class TestLzcntI { public static void main(String args[]) throws Throwable { if (!CPUInfo.hasFeature("lzcnt")) { - System.out.println("CPU does not support lzcnt feature. " + - "Test skipped."); - return; + System.out.println("INFO: CPU does not support lzcnt feature."); } BMITestRunner.runTests(LzcntIExpr.class, args, + "-XX:+IgnoreUnrecognizedVMOptions", "-XX:+UseCountLeadingZerosInstruction"); } diff --git a/hotspot/test/compiler/intrinsics/bmi/TestLzcntL.java b/hotspot/test/compiler/intrinsics/bmi/TestLzcntL.java index b75830df18a..fbcadf49dad 100644 --- a/hotspot/test/compiler/intrinsics/bmi/TestLzcntL.java +++ b/hotspot/test/compiler/intrinsics/bmi/TestLzcntL.java @@ -41,12 +41,11 @@ public class TestLzcntL { public static void main(String args[]) throws Throwable { if (!CPUInfo.hasFeature("lzcnt")) { - System.out.println("CPU does not support lzcnt feature. " + - "Test skipped."); - return; + System.out.println("INFO: CPU does not support lzcnt feature."); } BMITestRunner.runTests(LzcntLExpr.class, args, + "-XX:+IgnoreUnrecognizedVMOptions", "-XX:+UseCountLeadingZerosInstruction"); } diff --git a/hotspot/test/compiler/intrinsics/bmi/TestTzcntI.java b/hotspot/test/compiler/intrinsics/bmi/TestTzcntI.java index 285519537aa..bd8c8764617 100644 --- a/hotspot/test/compiler/intrinsics/bmi/TestTzcntI.java +++ b/hotspot/test/compiler/intrinsics/bmi/TestTzcntI.java @@ -41,12 +41,11 @@ public class TestTzcntI { public static void main(String args[]) throws Throwable { if (!CPUInfo.hasFeature("bmi1")) { - System.out.println("CPU does not support bmi1 feature. " + - "Test skipped."); - return; + System.out.println("INFO: CPU does not support bmi1 feature."); } BMITestRunner.runTests(TzcntIExpr.class, args, + "-XX:+IgnoreUnrecognizedVMOptions", "-XX:+UseCountTrailingZerosInstruction"); } diff --git a/hotspot/test/compiler/intrinsics/bmi/TestTzcntL.java b/hotspot/test/compiler/intrinsics/bmi/TestTzcntL.java index 36683fe7283..0a008aa4d58 100644 --- a/hotspot/test/compiler/intrinsics/bmi/TestTzcntL.java +++ b/hotspot/test/compiler/intrinsics/bmi/TestTzcntL.java @@ -41,12 +41,11 @@ public class TestTzcntL { public static void main(String args[]) throws Throwable { if (!CPUInfo.hasFeature("bmi1")) { - System.out.println("CPU does not support bmi1 feature. " + - "Test skipped."); - return; + System.out.println("INFO: CPU does not support bmi1 feature."); } BMITestRunner.runTests(TzcntLExpr.class, args, + "-XX:+IgnoreUnrecognizedVMOptions", "-XX:+UseCountTrailingZerosInstruction"); } From c86e8f5a2c460512227c83ea8129b368b0b6ded9 Mon Sep 17 00:00:00 2001 From: Igor Veresov Date: Sat, 25 Oct 2014 21:02:29 -1000 Subject: [PATCH 17/61] 8059200: Promoted JDK9 b31 for Solaris-amd64 fails (Error: dl failure on line 744, no picl library) on Solaris 11.1 Manually load libpicl.so (used on SPARC only) Reviewed-by: kvn --- hotspot/make/solaris/makefiles/vm.make | 2 +- .../vm/vm_version_solaris_sparc.cpp | 110 +++++++++++++++--- 2 files changed, 94 insertions(+), 18 deletions(-) diff --git a/hotspot/make/solaris/makefiles/vm.make b/hotspot/make/solaris/makefiles/vm.make index 59f2b575642..da906bcfad8 100644 --- a/hotspot/make/solaris/makefiles/vm.make +++ b/hotspot/make/solaris/makefiles/vm.make @@ -143,7 +143,7 @@ else LIBS += -lsocket -lsched -ldl $(LIBM) -lthread -lc -ldemangle endif # sparcWorks -LIBS += -lkstat -lpicl +LIBS += -lkstat # By default, link the *.o into the library, not the executable. LINK_INTO$(LINK_INTO) = LIBJVM diff --git a/hotspot/src/os_cpu/solaris_sparc/vm/vm_version_solaris_sparc.cpp b/hotspot/src/os_cpu/solaris_sparc/vm/vm_version_solaris_sparc.cpp index 20bac5061ee..b023ee4e0f3 100644 --- a/hotspot/src/os_cpu/solaris_sparc/vm/vm_version_solaris_sparc.cpp +++ b/hotspot/src/os_cpu/solaris_sparc/vm/vm_version_solaris_sparc.cpp @@ -33,18 +33,51 @@ #include #include #include +#include +#include extern "C" static int PICL_get_l1_data_cache_line_size_helper(picl_nodehdl_t nodeh, void *result); extern "C" static int PICL_get_l2_cache_line_size_helper(picl_nodehdl_t nodeh, void *result); +// Functions from the library we need (signatures should match those in picl.h) +extern "C" { + typedef int (*picl_initialize_func_t)(void); + typedef int (*picl_shutdown_func_t)(void); + typedef int (*picl_get_root_func_t)(picl_nodehdl_t *nodehandle); + typedef int (*picl_walk_tree_by_class_func_t)(picl_nodehdl_t rooth, + const char *classname, void *c_args, + int (*callback_fn)(picl_nodehdl_t hdl, void *args)); + typedef int (*picl_get_prop_by_name_func_t)(picl_nodehdl_t nodeh, const char *nm, + picl_prophdl_t *ph); + typedef int (*picl_get_propval_func_t)(picl_prophdl_t proph, void *valbuf, size_t sz); + typedef int (*picl_get_propinfo_func_t)(picl_prophdl_t proph, picl_propinfo_t *pi); +} + class PICL { + // Pointers to functions in the library + picl_initialize_func_t _picl_initialize; + picl_shutdown_func_t _picl_shutdown; + picl_get_root_func_t _picl_get_root; + picl_walk_tree_by_class_func_t _picl_walk_tree_by_class; + picl_get_prop_by_name_func_t _picl_get_prop_by_name; + picl_get_propval_func_t _picl_get_propval; + picl_get_propinfo_func_t _picl_get_propinfo; + // Handle to the library that is returned by dlopen + void *_dl_handle; + + bool open_library(); + void close_library(); + + template bool bind(FuncType& func, const char* name); + bool bind_library_functions(); + // Get a value of the integer property. The value in the tree can be either 32 or 64 bit // depending on the platform. The result is converted to int. - static int get_int_property(picl_nodehdl_t nodeh, const char* name, int* result) { + int get_int_property(picl_nodehdl_t nodeh, const char* name, int* result) { picl_propinfo_t pinfo; picl_prophdl_t proph; - if (picl_get_prop_by_name(nodeh, name, &proph) != PICL_SUCCESS || - picl_get_propinfo(proph, &pinfo) != PICL_SUCCESS) { + if (_picl_get_prop_by_name(nodeh, name, &proph) != PICL_SUCCESS || + _picl_get_propinfo(proph, &pinfo) != PICL_SUCCESS) { return PICL_FAILURE; } @@ -54,13 +87,13 @@ class PICL { } if (pinfo.size == sizeof(int64_t)) { int64_t val; - if (picl_get_propval(proph, &val, sizeof(int64_t)) != PICL_SUCCESS) { + if (_picl_get_propval(proph, &val, sizeof(int64_t)) != PICL_SUCCESS) { return PICL_FAILURE; } *result = static_cast(val); } else if (pinfo.size == sizeof(int32_t)) { int32_t val; - if (picl_get_propval(proph, &val, sizeof(int32_t)) != PICL_SUCCESS) { + if (_picl_get_propval(proph, &val, sizeof(int32_t)) != PICL_SUCCESS) { return PICL_FAILURE; } *result = static_cast(val); @@ -74,6 +107,7 @@ class PICL { // Visitor and a state machine that visits integer properties and verifies that the // values are the same. Stores the unique value observed. class UniqueValueVisitor { + PICL *_picl; enum { INITIAL, // Start state, no assignments happened ASSIGNED, // Assigned a value @@ -81,7 +115,7 @@ class PICL { } _state; int _value; public: - UniqueValueVisitor() : _state(INITIAL) { } + UniqueValueVisitor(PICL* picl) : _picl(picl), _state(INITIAL) { } int value() { assert(_state == ASSIGNED, "Precondition"); return _value; @@ -98,9 +132,10 @@ class PICL { static int visit(picl_nodehdl_t nodeh, const char* name, void *arg) { UniqueValueVisitor *state = static_cast(arg); + PICL* picl = state->_picl; assert(!state->is_inconsistent(), "Precondition"); int curr; - if (PICL::get_int_property(nodeh, name, &curr) == PICL_SUCCESS) { + if (picl->get_int_property(nodeh, name, &curr) == PICL_SUCCESS) { if (!state->is_assigned()) { // first iteration state->set_value(curr); } else if (curr != state->value()) { // following iterations @@ -124,32 +159,36 @@ public: return UniqueValueVisitor::visit(nodeh, "l2-cache-line-size", state); } - PICL() : _L1_data_cache_line_size(0), _L2_cache_line_size(0) { - if (picl_initialize() == PICL_SUCCESS) { + PICL() : _L1_data_cache_line_size(0), _L2_cache_line_size(0), _dl_handle(NULL) { + if (!open_library()) { + return; + } + if (_picl_initialize() == PICL_SUCCESS) { picl_nodehdl_t rooth; - if (picl_get_root(&rooth) == PICL_SUCCESS) { - UniqueValueVisitor L1_state; + if (_picl_get_root(&rooth) == PICL_SUCCESS) { + UniqueValueVisitor L1_state(this); // Visit all "cpu" class instances - picl_walk_tree_by_class(rooth, "cpu", &L1_state, PICL_get_l1_data_cache_line_size_helper); + _picl_walk_tree_by_class(rooth, "cpu", &L1_state, PICL_get_l1_data_cache_line_size_helper); if (L1_state.is_initial()) { // Still initial, iteration found no values // Try walk all "core" class instances, it might be a Fujitsu machine - picl_walk_tree_by_class(rooth, "core", &L1_state, PICL_get_l1_data_cache_line_size_helper); + _picl_walk_tree_by_class(rooth, "core", &L1_state, PICL_get_l1_data_cache_line_size_helper); } if (L1_state.is_assigned()) { // Is there a value? _L1_data_cache_line_size = L1_state.value(); } - UniqueValueVisitor L2_state; - picl_walk_tree_by_class(rooth, "cpu", &L2_state, PICL_get_l2_cache_line_size_helper); + UniqueValueVisitor L2_state(this); + _picl_walk_tree_by_class(rooth, "cpu", &L2_state, PICL_get_l2_cache_line_size_helper); if (L2_state.is_initial()) { - picl_walk_tree_by_class(rooth, "core", &L2_state, PICL_get_l2_cache_line_size_helper); + _picl_walk_tree_by_class(rooth, "core", &L2_state, PICL_get_l2_cache_line_size_helper); } if (L2_state.is_assigned()) { _L2_cache_line_size = L2_state.value(); } } - picl_shutdown(); + _picl_shutdown(); } + close_library(); } unsigned int L1_data_cache_line_size() const { return _L1_data_cache_line_size; } @@ -163,6 +202,43 @@ extern "C" static int PICL_get_l2_cache_line_size_helper(picl_nodehdl_t nodeh, v return PICL::get_l2_cache_line_size(nodeh, result); } +template +bool PICL::bind(FuncType& func, const char* name) { + func = reinterpret_cast(dlsym(_dl_handle, name)); + return func != NULL; +} + +bool PICL::bind_library_functions() { + assert(_dl_handle != NULL, "library should be open"); + return bind(_picl_initialize, "picl_initialize" ) && + bind(_picl_shutdown, "picl_shutdown" ) && + bind(_picl_get_root, "picl_get_root" ) && + bind(_picl_walk_tree_by_class, "picl_walk_tree_by_class") && + bind(_picl_get_prop_by_name, "picl_get_prop_by_name" ) && + bind(_picl_get_propval, "picl_get_propval" ) && + bind(_picl_get_propinfo, "picl_get_propinfo" ); +} + +bool PICL::open_library() { + _dl_handle = dlopen("libpicl.so.1", RTLD_LAZY); + if (_dl_handle == NULL) { + warning("PICL (libpicl.so.1) is missing. Performance will not be optimal."); + return false; + } + if (!bind_library_functions()) { + assert(false, "unexpected PICL API change"); + close_library(); + return false; + } + return true; +} + +void PICL::close_library() { + assert(_dl_handle != NULL, "library should be open"); + dlclose(_dl_handle); + _dl_handle = NULL; +} + // We need to keep these here as long as we have to build on Solaris // versions before 10. #ifndef SI_ARCHITECTURE_32 From b3f78699f78c8ec11bd23bd2eacf3af96796706e Mon Sep 17 00:00:00 2001 From: Morris Meyer Date: Wed, 13 Aug 2014 13:00:53 -0700 Subject: [PATCH 18/61] 8054530: C2: assert(res == old_res) failed: Inconsistency between old and new Fixed signedness problem with assertion. Reviewed-by: kvn --- hotspot/src/share/vm/oops/objArrayOop.hpp | 12 ++++++------ 1 file changed, 6 insertions(+), 6 deletions(-) diff --git a/hotspot/src/share/vm/oops/objArrayOop.hpp b/hotspot/src/share/vm/oops/objArrayOop.hpp index 897452a6624..bfb70564758 100644 --- a/hotspot/src/share/vm/oops/objArrayOop.hpp +++ b/hotspot/src/share/vm/oops/objArrayOop.hpp @@ -45,9 +45,10 @@ class objArrayOopDesc : public arrayOopDesc { private: // Give size of objArrayOop in HeapWords minus the header static int array_size(int length) { - const int OopsPerHeapWord = HeapWordSize/heapOopSize; + const uint OopsPerHeapWord = HeapWordSize/heapOopSize; assert(OopsPerHeapWord >= 1 && (HeapWordSize % heapOopSize == 0), "Else the following (new) computation would be in error"); + uint res = ((uint)length + OopsPerHeapWord - 1)/OopsPerHeapWord; #ifdef ASSERT // The old code is left in for sanity-checking; it'll // go away pretty soon. XXX @@ -55,16 +56,15 @@ private: // oop->length() * HeapWordsPerOop; // With narrowOops, HeapWordsPerOop is 1/2 or equal 0 as an integer. // The oop elements are aligned up to wordSize - const int HeapWordsPerOop = heapOopSize/HeapWordSize; - int old_res; + const uint HeapWordsPerOop = heapOopSize/HeapWordSize; + uint old_res; if (HeapWordsPerOop > 0) { old_res = length * HeapWordsPerOop; } else { - old_res = align_size_up(length, OopsPerHeapWord)/OopsPerHeapWord; + old_res = align_size_up((uint)length, OopsPerHeapWord)/OopsPerHeapWord; } -#endif // ASSERT - int res = ((uint)length + OopsPerHeapWord - 1)/OopsPerHeapWord; assert(res == old_res, "Inconsistency between old and new."); +#endif // ASSERT return res; } From 6c237d9d0f52888d8cafa1a94b599f32948b067b Mon Sep 17 00:00:00 2001 From: Vladimir Kozlov Date: Tue, 5 Aug 2014 14:44:18 -0700 Subject: [PATCH 19/61] 8049542: C2: assert(size_in_words <= (julong)max_jint) failed: no overflow Added juint cast to avoid gcc problem we have on one of our platforms. Reviewed-by: dholmes, roland --- hotspot/src/share/vm/oops/typeArrayOop.hpp | 2 +- 1 file changed, 1 insertion(+), 1 deletion(-) diff --git a/hotspot/src/share/vm/oops/typeArrayOop.hpp b/hotspot/src/share/vm/oops/typeArrayOop.hpp index 20f30dc996d..7d61e8946a2 100644 --- a/hotspot/src/share/vm/oops/typeArrayOop.hpp +++ b/hotspot/src/share/vm/oops/typeArrayOop.hpp @@ -150,7 +150,7 @@ class typeArrayOopDesc : public arrayOopDesc { DEBUG_ONLY(BasicType etype = Klass::layout_helper_element_type(lh)); assert(length <= arrayOopDesc::max_array_length(etype), "no overflow"); - julong size_in_bytes = length; + julong size_in_bytes = (juint)length; size_in_bytes <<= element_shift; size_in_bytes += instance_header_size; julong size_in_words = ((size_in_bytes + (HeapWordSize-1)) >> LogHeapWordSize); From 62d33442b8b2756b0ccbd1aa44df3090579f6bd0 Mon Sep 17 00:00:00 2001 From: Tobias Hartmann Date: Fri, 31 Oct 2014 12:16:20 +0100 Subject: [PATCH 20/61] 8062169: Multiple OSR compilations issued for same bci Fixed 'SimpleThresholdPolicy::event' to always perform OSR if an OSR nmethod is available. Reviewed-by: kvn, iveresov --- .../src/share/vm/runtime/simpleThresholdPolicy.cpp | 13 +++++++------ 1 file changed, 7 insertions(+), 6 deletions(-) diff --git a/hotspot/src/share/vm/runtime/simpleThresholdPolicy.cpp b/hotspot/src/share/vm/runtime/simpleThresholdPolicy.cpp index d70e8523a26..11803f1f6a4 100644 --- a/hotspot/src/share/vm/runtime/simpleThresholdPolicy.cpp +++ b/hotspot/src/share/vm/runtime/simpleThresholdPolicy.cpp @@ -196,7 +196,6 @@ nmethod* SimpleThresholdPolicy::event(methodHandle method, methodHandle inlinee, // Don't trigger other compiles in testing mode return NULL; } - nmethod *osr_nm = NULL; handle_counter_overflow(method()); if (method() != inlinee()) { @@ -210,14 +209,16 @@ nmethod* SimpleThresholdPolicy::event(methodHandle method, methodHandle inlinee, if (bci == InvocationEntryBci) { method_invocation_event(method, inlinee, comp_level, nm, thread); } else { - method_back_branch_event(method, inlinee, bci, comp_level, nm, thread); // method == inlinee if the event originated in the main method - int highest_level = inlinee->highest_osr_comp_level(); - if (highest_level > comp_level) { - osr_nm = inlinee->lookup_osr_nmethod_for(bci, highest_level, false); + method_back_branch_event(method, inlinee, bci, comp_level, nm, thread); + // Check if event led to a higher level OSR compilation + nmethod* osr_nm = inlinee->lookup_osr_nmethod_for(bci, comp_level, false); + if (osr_nm != NULL && osr_nm->comp_level() > comp_level) { + // Perform OSR with new nmethod + return osr_nm; } } - return osr_nm; + return NULL; } // Check if the method can be compiled, change level if necessary From 74def215cdc4ded6ce44a17ad45571f993389064 Mon Sep 17 00:00:00 2001 From: Vladimir Kozlov Date: Fri, 31 Oct 2014 16:51:57 -0700 Subject: [PATCH 21/61] 8054492: Casting can result in redundant null checks in generated code Add C2 intrinsic for Class.cast() method and force inline it too. Reviewed-by: jrose, roland, drchase, iignatyev --- hotspot/src/share/vm/classfile/vmSymbols.hpp | 3 + hotspot/src/share/vm/oops/method.cpp | 4 + hotspot/src/share/vm/opto/library_call.cpp | 86 +++++ hotspot/src/share/vm/prims/whitebox.cpp | 10 +- hotspot/test/TEST.groups | 1 + .../classcast/NullCheckDroppingsTest.java | 346 ++++++++++++++++++ .../whitebox/sun/hotspot/code/NMethod.java | 5 +- 7 files changed, 451 insertions(+), 4 deletions(-) create mode 100644 hotspot/test/compiler/intrinsics/classcast/NullCheckDroppingsTest.java diff --git a/hotspot/src/share/vm/classfile/vmSymbols.hpp b/hotspot/src/share/vm/classfile/vmSymbols.hpp index a4cf130d5c9..d6a84b75af0 100644 --- a/hotspot/src/share/vm/classfile/vmSymbols.hpp +++ b/hotspot/src/share/vm/classfile/vmSymbols.hpp @@ -455,6 +455,7 @@ template(object_void_signature, "(Ljava/lang/Object;)V") \ template(object_int_signature, "(Ljava/lang/Object;)I") \ template(object_boolean_signature, "(Ljava/lang/Object;)Z") \ + template(object_object_signature, "(Ljava/lang/Object;)Ljava/lang/Object;") \ template(string_void_signature, "(Ljava/lang/String;)V") \ template(string_int_signature, "(Ljava/lang/String;)I") \ template(throwable_void_signature, "(Ljava/lang/Throwable;)V") \ @@ -746,6 +747,8 @@ do_name( isPrimitive_name, "isPrimitive") \ do_intrinsic(_getSuperclass, java_lang_Class, getSuperclass_name, void_class_signature, F_RN) \ do_name( getSuperclass_name, "getSuperclass") \ + do_intrinsic(_Class_cast, java_lang_Class, Class_cast_name, object_object_signature, F_R) \ + do_name( Class_cast_name, "cast") \ \ do_intrinsic(_getClassAccessFlags, sun_reflect_Reflection, getClassAccessFlags_name, class_int_signature, F_SN) \ do_name( getClassAccessFlags_name, "getClassAccessFlags") \ diff --git a/hotspot/src/share/vm/oops/method.cpp b/hotspot/src/share/vm/oops/method.cpp index ef0349eeb26..a907ac44427 100644 --- a/hotspot/src/share/vm/oops/method.cpp +++ b/hotspot/src/share/vm/oops/method.cpp @@ -1295,6 +1295,10 @@ void Method::init_intrinsic_id() { vmIntrinsics::ID id = vmIntrinsics::find_id(klass_id, name_id, sig_id, flags); if (id != vmIntrinsics::_none) { set_intrinsic_id(id); + if (id == vmIntrinsics::_Class_cast) { + // Even if the intrinsic is rejected, we want to inline this simple method. + set_force_inline(true); + } return; } diff --git a/hotspot/src/share/vm/opto/library_call.cpp b/hotspot/src/share/vm/opto/library_call.cpp index a59007b7ccc..91d82d30f5f 100644 --- a/hotspot/src/share/vm/opto/library_call.cpp +++ b/hotspot/src/share/vm/opto/library_call.cpp @@ -268,6 +268,7 @@ class LibraryCallKit : public GraphKit { bool inline_fp_conversions(vmIntrinsics::ID id); bool inline_number_methods(vmIntrinsics::ID id); bool inline_reference_get(); + bool inline_Class_cast(); bool inline_aescrypt_Block(vmIntrinsics::ID id); bool inline_cipherBlockChaining_AESCrypt(vmIntrinsics::ID id); Node* inline_cipherBlockChaining_AESCrypt_predicate(bool decrypting); @@ -869,6 +870,8 @@ bool LibraryCallKit::try_to_inline(int predicate) { case vmIntrinsics::_Reference_get: return inline_reference_get(); + case vmIntrinsics::_Class_cast: return inline_Class_cast(); + case vmIntrinsics::_aescrypt_encryptBlock: case vmIntrinsics::_aescrypt_decryptBlock: return inline_aescrypt_Block(intrinsic_id()); @@ -3546,6 +3549,89 @@ bool LibraryCallKit::inline_native_Class_query(vmIntrinsics::ID id) { return true; } +//-------------------------inline_Class_cast------------------- +bool LibraryCallKit::inline_Class_cast() { + Node* mirror = argument(0); // Class + Node* obj = argument(1); + const TypeInstPtr* mirror_con = _gvn.type(mirror)->isa_instptr(); + if (mirror_con == NULL) { + return false; // dead path (mirror->is_top()). + } + if (obj == NULL || obj->is_top()) { + return false; // dead path + } + const TypeOopPtr* tp = _gvn.type(obj)->isa_oopptr(); + + // First, see if Class.cast() can be folded statically. + // java_mirror_type() returns non-null for compile-time Class constants. + ciType* tm = mirror_con->java_mirror_type(); + if (tm != NULL && tm->is_klass() && + tp != NULL && tp->klass() != NULL) { + if (!tp->klass()->is_loaded()) { + // Don't use intrinsic when class is not loaded. + return false; + } else { + int static_res = C->static_subtype_check(tm->as_klass(), tp->klass()); + if (static_res == Compile::SSC_always_true) { + // isInstance() is true - fold the code. + set_result(obj); + return true; + } else if (static_res == Compile::SSC_always_false) { + // Don't use intrinsic, have to throw ClassCastException. + // If the reference is null, the non-intrinsic bytecode will + // be optimized appropriately. + return false; + } + } + } + + // Bailout intrinsic and do normal inlining if exception path is frequent. + if (too_many_traps(Deoptimization::Reason_intrinsic)) { + return false; + } + + // Generate dynamic checks. + // Class.cast() is java implementation of _checkcast bytecode. + // Do checkcast (Parse::do_checkcast()) optimizations here. + + mirror = null_check(mirror); + // If mirror is dead, only null-path is taken. + if (stopped()) { + return true; + } + + // Not-subtype or the mirror's klass ptr is NULL (in case it is a primitive). + enum { _bad_type_path = 1, _prim_path = 2, PATH_LIMIT }; + RegionNode* region = new RegionNode(PATH_LIMIT); + record_for_igvn(region); + + // Now load the mirror's klass metaobject, and null-check it. + // If kls is null, we have a primitive mirror and + // nothing is an instance of a primitive type. + Node* kls = load_klass_from_mirror(mirror, false, region, _prim_path); + + Node* res = top(); + if (!stopped()) { + Node* bad_type_ctrl = top(); + // Do checkcast optimizations. + res = gen_checkcast(obj, kls, &bad_type_ctrl); + region->init_req(_bad_type_path, bad_type_ctrl); + } + if (region->in(_prim_path) != top() || + region->in(_bad_type_path) != top()) { + // Let Interpreter throw ClassCastException. + PreserveJVMState pjvms(this); + set_control(_gvn.transform(region)); + uncommon_trap(Deoptimization::Reason_intrinsic, + Deoptimization::Action_maybe_recompile); + } + if (!stopped()) { + set_result(res); + } + return true; +} + + //--------------------------inline_native_subtype_check------------------------ // This intrinsic takes the JNI calls out of the heart of // UnsafeFieldAccessorImpl.set, which improves Field.set, readObject, etc. diff --git a/hotspot/src/share/vm/prims/whitebox.cpp b/hotspot/src/share/vm/prims/whitebox.cpp index c4cf7088e69..ac497910f8c 100644 --- a/hotspot/src/share/vm/prims/whitebox.cpp +++ b/hotspot/src/share/vm/prims/whitebox.cpp @@ -803,20 +803,24 @@ WB_ENTRY(jobjectArray, WB_GetNMethod(JNIEnv* env, jobject o, jobject method, jbo ThreadToNativeFromVM ttn(thread); jclass clazz = env->FindClass(vmSymbols::java_lang_Object()->as_C_string()); CHECK_JNI_EXCEPTION_(env, NULL); - result = env->NewObjectArray(2, clazz, NULL); + result = env->NewObjectArray(3, clazz, NULL); if (result == NULL) { return result; } - jobject obj = integerBox(thread, env, code->comp_level()); + jobject level = integerBox(thread, env, code->comp_level()); CHECK_JNI_EXCEPTION_(env, NULL); - env->SetObjectArrayElement(result, 0, obj); + env->SetObjectArrayElement(result, 0, level); jbyteArray insts = env->NewByteArray(insts_size); CHECK_JNI_EXCEPTION_(env, NULL); env->SetByteArrayRegion(insts, 0, insts_size, (jbyte*) code->insts_begin()); env->SetObjectArrayElement(result, 1, insts); + jobject id = integerBox(thread, env, code->compile_id()); + CHECK_JNI_EXCEPTION_(env, NULL); + env->SetObjectArrayElement(result, 2, id); + return result; WB_END diff --git a/hotspot/test/TEST.groups b/hotspot/test/TEST.groups index 051e2e3fa3b..5b2f9d3a280 100644 --- a/hotspot/test/TEST.groups +++ b/hotspot/test/TEST.groups @@ -479,6 +479,7 @@ hotspot_compiler_3 = \ compiler/intrinsics/mathexact/SubExactILoopDependentTest.java \ compiler/intrinsics/stringequals/TestStringEqualsBadLength.java \ compiler/intrinsics/unsafe/UnsafeGetAddressTest.java \ + compiler/intrinsics/classcast/NullCheckDroppingsTest.java \ compiler/jsr292/ConcurrentClassLoadingTest.java \ compiler/jsr292/CreatesInterfaceDotEqualsCallInfo.java \ compiler/loopopts/TestLogSum.java \ diff --git a/hotspot/test/compiler/intrinsics/classcast/NullCheckDroppingsTest.java b/hotspot/test/compiler/intrinsics/classcast/NullCheckDroppingsTest.java new file mode 100644 index 00000000000..9f88fe44f70 --- /dev/null +++ b/hotspot/test/compiler/intrinsics/classcast/NullCheckDroppingsTest.java @@ -0,0 +1,346 @@ +/* + * Copyright (c) 2014, Oracle and/or its affiliates. All rights reserved. + * DO NOT ALTER OR REMOVE COPYRIGHT NOTICES OR THIS FILE HEADER. + * + * This code is free software; you can redistribute it and/or modify it + * under the terms of the GNU General Public License version 2 only, as + * published by the Free Software Foundation. + * + * This code is distributed in the hope that it will be useful, but WITHOUT + * ANY WARRANTY; without even the implied warranty of MERCHANTABILITY or + * FITNESS FOR A PARTICULAR PURPOSE. See the GNU General Public License + * version 2 for more details (a copy is included in the LICENSE file that + * accompanied this code). + * + * You should have received a copy of the GNU General Public License version + * 2 along with this work; if not, write to the Free Software Foundation, + * Inc., 51 Franklin St, Fifth Floor, Boston, MA 02110-1301 USA. + * + * Please contact Oracle, 500 Oracle Parkway, Redwood Shores, CA 94065 USA + * or visit www.oracle.com if you need additional information or have any + * questions. + */ + +/* + * @test NullCheckDroppingsTest + * @bug 8054492 + * @summary "Casting can result in redundant null checks in generated code" + * @library /testlibrary /testlibrary/whitebox /testlibrary/com/oracle/java/testlibrary + * @build NullCheckDroppingsTest + * @run main ClassFileInstaller sun.hotspot.WhiteBox + * sun.hotspot.WhiteBox$WhiteBoxPermission + * @run main ClassFileInstaller com.oracle.java.testlibrary.Platform + * @run main/othervm -Xbootclasspath/a:. -XX:+IgnoreUnrecognizedVMOptions -XX:+UnlockDiagnosticVMOptions -XX:+WhiteBoxAPI + * -Xmixed -XX:-BackgroundCompilation -XX:-TieredCompilation -XX:CompileThreshold=1000 + * -XX:CompileCommand=exclude,NullCheckDroppingsTest::runTest NullCheckDroppingsTest + */ + +import sun.hotspot.WhiteBox; +import sun.hotspot.code.NMethod; +import com.oracle.java.testlibrary.Platform; + +import java.lang.reflect.Method; +import java.lang.invoke.MethodHandle; +import java.lang.invoke.MethodHandles; +import java.lang.invoke.MethodType; +import java.util.function.BiFunction; + +public class NullCheckDroppingsTest { + + private static final WhiteBox WHITE_BOX = WhiteBox.getWhiteBox(); + + static final BiFunction fCast = (c, o) -> c.cast(o); + + static final MethodHandle SET_SSINK; + static final MethodHandle MH_CAST; + + static { + try { + SET_SSINK = MethodHandles.lookup().findSetter(NullCheckDroppingsTest.class, "ssink", String.class); + MH_CAST = MethodHandles.lookup().findVirtual(Class.class, + "cast", + MethodType.methodType(Object.class, Object.class)); + } + catch (Exception e) { + throw new Error(e); + } + } + + static volatile String svalue = "A"; + static volatile String snull = null; + static volatile Integer iobj = new Integer(0); + static volatile int[] arr = new int[2]; + static volatile Class objClass = String.class; + static volatile Class nullClass = null; + + String ssink; + Integer isink; + int[] asink; + + public static void main(String[] args) throws Exception { + + // Only test C2 in Server VM + if (!Platform.isServer()) { + return; + } + // Make sure background compilation is disabled + if (WHITE_BOX.getBooleanVMFlag("BackgroundCompilation")) { + throw new AssertionError("Background compilation enabled"); + } + // Make sure Tiered compilation is disabled + if (WHITE_BOX.getBooleanVMFlag("TieredCompilation")) { + throw new AssertionError("Tiered compilation enabled"); + } + + Method methodClassCast = NullCheckDroppingsTest.class.getDeclaredMethod("testClassCast", String.class); + Method methodMHCast = NullCheckDroppingsTest.class.getDeclaredMethod("testMHCast", String.class); + Method methodMHSetter = NullCheckDroppingsTest.class.getDeclaredMethod("testMHSetter", String.class); + Method methodFunction = NullCheckDroppingsTest.class.getDeclaredMethod("testFunction", String.class); + + NullCheckDroppingsTest t = new NullCheckDroppingsTest(); + t.runTest(methodClassCast, false); + t.runTest(methodMHCast, false); + t.runTest(methodMHSetter, false); + t.runTest(methodFunction, false); + + // Edge cases + Method methodClassCastNull = NullCheckDroppingsTest.class.getDeclaredMethod("testClassCastNull", String.class); + Method methodNullClassCast = NullCheckDroppingsTest.class.getDeclaredMethod("testNullClassCast", String.class); + Method methodClassCastObj = NullCheckDroppingsTest.class.getDeclaredMethod("testClassCastObj", Object.class); + Method methodObjClassCast = NullCheckDroppingsTest.class.getDeclaredMethod("testObjClassCast", String.class); + Method methodVarClassCast = NullCheckDroppingsTest.class.getDeclaredMethod("testVarClassCast", String.class); + Method methodClassCastInt = NullCheckDroppingsTest.class.getDeclaredMethod("testClassCastInt", Object.class); + Method methodIntClassCast = NullCheckDroppingsTest.class.getDeclaredMethod("testIntClassCast", Object.class); + Method methodClassCastint = NullCheckDroppingsTest.class.getDeclaredMethod("testClassCastint", Object.class); + Method methodintClassCast = NullCheckDroppingsTest.class.getDeclaredMethod("testintClassCast", Object.class); + Method methodClassCastPrim = NullCheckDroppingsTest.class.getDeclaredMethod("testClassCastPrim", Object.class); + Method methodPrimClassCast = NullCheckDroppingsTest.class.getDeclaredMethod("testPrimClassCast", Object.class); + + t.runTest(methodClassCastNull, false); + t.runTest(methodNullClassCast, false); + t.runTest(methodClassCastObj, false); + t.runTest(methodObjClassCast, true); + t.runTest(methodVarClassCast, true); + t.runTest(methodClassCastInt, false); + t.runTest(methodIntClassCast, true); + t.runTest(methodClassCastint, false); + t.runTest(methodintClassCast, false); + t.runTest(methodClassCastPrim, false); + t.runTest(methodPrimClassCast, true); + } + + void testClassCast(String s) { + try { + ssink = String.class.cast(s); + } catch (Throwable t) { + throw new Error(t); + } + } + + void testClassCastNull(String s) { + try { + ssink = String.class.cast(null); + } catch (Throwable t) { + throw new Error(t); + } + } + + void testNullClassCast(String s) { + try { + ssink = (String)nullClass.cast(s); + throw new AssertionError("NullPointerException is not thrown"); + } catch (NullPointerException t) { + // Ignore NullPointerException + } catch (Throwable t) { + throw new Error(t); + } + } + + void testClassCastObj(Object s) { + try { + ssink = String.class.cast(s); + } catch (Throwable t) { + throw new Error(t); + } + } + + void testObjClassCast(String s) { + try { + ssink = (String)objClass.cast(s); + } catch (Throwable t) { + throw new Error(t); + } + } + + void testVarClassCast(String s) { + Class cl = (s == null) ? null : String.class; + try { + ssink = (String)cl.cast(svalue); + if (s == null) { + throw new AssertionError("NullPointerException is not thrown"); + } + } catch (NullPointerException t) { + // Ignore NullPointerException + } catch (Throwable t) { + throw new Error(t); + } + } + + void testClassCastInt(Object s) { + try { + ssink = String.class.cast(iobj); + throw new AssertionError("ClassCastException is not thrown"); + } catch (ClassCastException t) { + // Ignore ClassCastException: Cannot cast java.lang.Integer to java.lang.String + } catch (Throwable t) { + throw new Error(t); + } + } + + void testIntClassCast(Object s) { + try { + isink = Integer.class.cast(s); + if (s != null) { + throw new AssertionError("ClassCastException is not thrown"); + } + } catch (ClassCastException t) { + // Ignore ClassCastException: Cannot cast java.lang.String to java.lang.Integer + } catch (Throwable t) { + throw new Error(t); + } + } + + void testClassCastint(Object s) { + try { + ssink = String.class.cast(45); + throw new AssertionError("ClassCastException is not thrown"); + } catch (ClassCastException t) { + // Ignore ClassCastException: Cannot cast java.lang.Integer to java.lang.String + } catch (Throwable t) { + throw new Error(t); + } + } + + void testintClassCast(Object s) { + try { + isink = int.class.cast(s); + if (s != null) { + throw new AssertionError("ClassCastException is not thrown"); + } + } catch (ClassCastException t) { + // Ignore ClassCastException: Cannot cast java.lang.String to java.lang.Integer + } catch (Throwable t) { + throw new Error(t); + } + } + + void testClassCastPrim(Object s) { + try { + ssink = String.class.cast(arr); + throw new AssertionError("ClassCastException is not thrown"); + } catch (ClassCastException t) { + // Ignore ClassCastException: Cannot cast [I to java.lang.String + } catch (Throwable t) { + throw new Error(t); + } + } + + void testPrimClassCast(Object s) { + try { + asink = int[].class.cast(s); + if (s != null) { + throw new AssertionError("ClassCastException is not thrown"); + } + } catch (ClassCastException t) { + // Ignore ClassCastException: Cannot cast java.lang.String to [I + } catch (Throwable t) { + throw new Error(t); + } + } + + void testMHCast(String s) { + try { + ssink = (String) (Object) MH_CAST.invokeExact(String.class, (Object) s); + } catch (Throwable t) { + throw new Error(t); + } + } + + void testMHSetter(String s) { + try { + SET_SSINK.invokeExact(this, s); + } catch (Throwable t) { + throw new Error(t); + } + } + + void testFunction(String s) { + try { + ssink = (String) fCast.apply(String.class, s); + } catch (Throwable t) { + throw new Error(t); + } + } + + void runTest(Method method, boolean deopt) { + if (method == null) { + throw new AssertionError("method was not found"); + } + // Ensure method is compiled + WHITE_BOX.testSetDontInlineMethod(method, true); + for (int i = 0; i < 3000; i++) { + try { + method.invoke(this, svalue); + } catch (Exception e) { + throw new Error("Unexpected exception: ", e); + } + } + NMethod nm = getNMethod(method); + + // Passing null should cause a de-optimization + // if method is compiled with a null-check. + try { + method.invoke(this, snull); + } catch (Exception e) { + throw new Error("Unexpected exception: ", e); + } + checkDeoptimization(method, nm, deopt); + } + + static NMethod getNMethod(Method test) { + // Because background compilation is disabled, method should now be compiled + if (!WHITE_BOX.isMethodCompiled(test)) { + throw new AssertionError(test + " not compiled"); + } + + NMethod nm = NMethod.get(test, false); // not OSR nmethod + if (nm == null) { + throw new AssertionError(test + " missing nmethod?"); + } + if (nm.comp_level != 4) { + throw new AssertionError(test + " compiled by not C2: " + nm); + } + return nm; + } + + static void checkDeoptimization(Method method, NMethod nmOrig, boolean deopt) { + // Check deoptimization event (intrinsic Class.cast() works). + if (WHITE_BOX.isMethodCompiled(method) == deopt) { + throw new AssertionError(method + " was" + (deopt ? " not" : "") + " deoptimized"); + } + if (deopt) { + return; + } + // Ensure no recompilation when no deoptimization is expected. + NMethod nm = NMethod.get(method, false); // not OSR nmethod + if (nm == null) { + throw new AssertionError(method + " missing nmethod?"); + } + if (nm.comp_level != 4) { + throw new AssertionError(method + " compiled by not C2: " + nm); + } + if (nm.compile_id != nmOrig.compile_id) { + throw new AssertionError(method + " was recompiled: old nmethod=" + nmOrig + ", new nmethod=" + nm); + } + } +} diff --git a/hotspot/test/testlibrary/whitebox/sun/hotspot/code/NMethod.java b/hotspot/test/testlibrary/whitebox/sun/hotspot/code/NMethod.java index 4bdb49d0b3e..9ac182df343 100644 --- a/hotspot/test/testlibrary/whitebox/sun/hotspot/code/NMethod.java +++ b/hotspot/test/testlibrary/whitebox/sun/hotspot/code/NMethod.java @@ -34,18 +34,21 @@ public class NMethod { return obj == null ? null : new NMethod(obj); } private NMethod(Object[] obj) { - assert obj.length == 2; + assert obj.length == 3; comp_level = (Integer) obj[0]; insts = (byte[]) obj[1]; + compile_id = (Integer) obj[2]; } public byte[] insts; public int comp_level; + public int compile_id; @Override public String toString() { return "NMethod{" + "insts=" + insts + ", comp_level=" + comp_level + + ", compile_id=" + compile_id + '}'; } } From e5a126fe00f017ef0b5b5a650cc98bf21af923a1 Mon Sep 17 00:00:00 2001 From: Igor Ignatyev Date: Sun, 2 Nov 2014 18:42:30 +0300 Subject: [PATCH 22/61] 8036913: make DeoptimizeALot dependent on number of threads Reviewed-by: kvn, shade --- .../src/share/vm/runtime/interfaceSupport.cpp | 24 ++++++++++++------- 1 file changed, 16 insertions(+), 8 deletions(-) diff --git a/hotspot/src/share/vm/runtime/interfaceSupport.cpp b/hotspot/src/share/vm/runtime/interfaceSupport.cpp index 78a58200f5a..6a30aba6f8e 100644 --- a/hotspot/src/share/vm/runtime/interfaceSupport.cpp +++ b/hotspot/src/share/vm/runtime/interfaceSupport.cpp @@ -187,19 +187,22 @@ void InterfaceSupport::zap_dead_locals_old() { # endif - +// invocation counter for InterfaceSupport::deoptimizeAll/zombieAll functions int deoptimizeAllCounter = 0; int zombieAllCounter = 0; - void InterfaceSupport::zombieAll() { - if (is_init_completed() && zombieAllCounter > ZombieALotInterval) { + // This method is called by all threads when a thread make + // transition to VM state (for example, runtime calls). + // Divide number of calls by number of threads to avoid + // dependence of ZombieAll events frequency on number of threads. + int value = zombieAllCounter / Threads::number_of_threads(); + if (is_init_completed() && value > ZombieALotInterval) { zombieAllCounter = 0; VM_ZombieAll op; VMThread::execute(&op); - } else { - zombieAllCounter++; } + zombieAllCounter++; } void InterfaceSupport::unlinkSymbols() { @@ -208,12 +211,17 @@ void InterfaceSupport::unlinkSymbols() { } void InterfaceSupport::deoptimizeAll() { - if (is_init_completed() ) { - if (DeoptimizeALot && deoptimizeAllCounter > DeoptimizeALotInterval) { + // This method is called by all threads when a thread make + // transition to VM state (for example, runtime calls). + // Divide number of calls by number of threads to avoid + // dependence of DeoptimizeAll events frequency on number of threads. + int value = deoptimizeAllCounter / Threads::number_of_threads(); + if (is_init_completed()) { + if (DeoptimizeALot && value > DeoptimizeALotInterval) { deoptimizeAllCounter = 0; VM_DeoptimizeAll op; VMThread::execute(&op); - } else if (DeoptimizeRandom && (deoptimizeAllCounter & 0x1f) == (os::random() & 0x1f)) { + } else if (DeoptimizeRandom && (value & 0x1F) == (os::random() & 0x1F)) { VM_DeoptimizeAll op; VMThread::execute(&op); } From e429e497cec3ade23a43ca0b79a0ffa23bc86f5d Mon Sep 17 00:00:00 2001 From: Igor Ignatyev Date: Sun, 2 Nov 2014 18:43:00 +0300 Subject: [PATCH 23/61] 8043125: compiler/types/correctness/CorrectnessTest.java: assert(layout->tag() == DataLayout::speculative_trap_data_tag) failed: wrong type Reviewed-by: kvn --- hotspot/src/share/vm/prims/whitebox.cpp | 14 ++------------ 1 file changed, 2 insertions(+), 12 deletions(-) diff --git a/hotspot/src/share/vm/prims/whitebox.cpp b/hotspot/src/share/vm/prims/whitebox.cpp index ac497910f8c..1ed1413727f 100644 --- a/hotspot/src/share/vm/prims/whitebox.cpp +++ b/hotspot/src/share/vm/prims/whitebox.cpp @@ -509,16 +509,6 @@ class AlwaysFalseClosure : public BoolObjectClosure { static AlwaysFalseClosure always_false; -class VM_WhiteBoxCleanMethodData : public VM_WhiteBoxOperation { - public: - VM_WhiteBoxCleanMethodData(MethodData* mdo) : _mdo(mdo) { } - void doit() { - _mdo->clean_method_data(&always_false); - } - private: - MethodData* _mdo; -}; - WB_ENTRY(void, WB_ClearMethodState(JNIEnv* env, jobject o, jobject method)) jmethodID jmid = reflected_method_to_jmid(thread, env, method); CHECK_JNI_EXCEPTION(env); @@ -534,8 +524,8 @@ WB_ENTRY(void, WB_ClearMethodState(JNIEnv* env, jobject o, jobject method)) for (int i = 0; i < arg_count; i++) { mdo->set_arg_modified(i, 0); } - VM_WhiteBoxCleanMethodData op(mdo); - VMThread::execute(&op); + MutexLockerEx mu(mdo->extra_data_lock()); + mdo->clean_method_data(&always_false); } mh->clear_not_c1_compilable(); From 8152a3ea35bce218ad74fdb810dfc627d7e917ce Mon Sep 17 00:00:00 2001 From: Sergei Kovalev Date: Sun, 2 Nov 2014 18:43:38 +0300 Subject: [PATCH 24/61] 8044186: Introduce a reproducible random generator Reviewed-by: kvn, iveresov, iignatyev --- .../test/compiler/6896617/Test6896617.java | 17 +- .../test/compiler/7100757/Test7100757.java | 10 +- .../test/compiler/7177917/Test7177917.java | 15 +- .../test/compiler/7184394/TestAESBase.java | 10 +- .../test/compiler/7184394/TestAESMain.java | 1 + .../test/compiler/8005956/PolynomialRoot.java | 15 +- .../intrinsics/bmi/BMITestRunner.java | 25 +-- .../mathexact/AddExactIConstantTest.java | 3 +- .../mathexact/AddExactILoadTest.java | 3 +- .../mathexact/AddExactILoopDependentTest.java | 3 +- .../mathexact/AddExactINonConstantTest.java | 3 +- .../mathexact/AddExactIRepeatTest.java | 8 +- .../mathexact/AddExactLConstantTest.java | 3 +- .../mathexact/AddExactLNonConstantTest.java | 3 +- .../intrinsics/mathexact/DecExactITest.java | 3 +- .../intrinsics/mathexact/DecExactLTest.java | 3 +- .../intrinsics/mathexact/IncExactITest.java | 3 +- .../intrinsics/mathexact/IncExactLTest.java | 3 +- .../mathexact/MulExactIConstantTest.java | 3 +- .../mathexact/MulExactILoadTest.java | 3 +- .../mathexact/MulExactILoopDependentTest.java | 3 +- .../mathexact/MulExactINonConstantTest.java | 3 +- .../mathexact/MulExactIRepeatTest.java | 8 +- .../mathexact/MulExactLConstantTest.java | 3 +- .../mathexact/MulExactLNonConstantTest.java | 3 +- .../mathexact/NegExactIConstantTest.java | 3 +- .../mathexact/NegExactILoadTest.java | 3 +- .../mathexact/NegExactILoopDependentTest.java | 3 +- .../mathexact/NegExactINonConstantTest.java | 3 +- .../mathexact/NegExactLConstantTest.java | 3 +- .../mathexact/NegExactLNonConstantTest.java | 3 +- .../mathexact/SubExactICondTest.java | 3 +- .../mathexact/SubExactIConstantTest.java | 3 +- .../mathexact/SubExactILoadTest.java | 3 +- .../mathexact/SubExactILoopDependentTest.java | 3 +- .../mathexact/SubExactINonConstantTest.java | 3 +- .../mathexact/SubExactIRepeatTest.java | 8 +- .../mathexact/SubExactLConstantTest.java | 3 +- .../mathexact/SubExactLNonConstantTest.java | 3 +- .../compiler/intrinsics/mathexact/Verify.java | 17 +- .../jsr292/ConcurrentClassLoadingTest.java | 26 ++- .../compiler/types/correctness/OffTest.java | 13 +- hotspot/test/compiler/unsafe/UnsafeRaw.java | 2 +- .../threads/TestFalseDeadLock.java | 6 +- .../com/oracle/java/testlibrary/Utils.java | 43 ++++- .../RandomGeneratorTest.java | 154 ++++++++++++++++++ 46 files changed, 352 insertions(+), 113 deletions(-) create mode 100644 hotspot/test/testlibrary_tests/RandomGeneratorTest.java diff --git a/hotspot/test/compiler/6896617/Test6896617.java b/hotspot/test/compiler/6896617/Test6896617.java index e28d3d7d57b..38835e0e420 100644 --- a/hotspot/test/compiler/6896617/Test6896617.java +++ b/hotspot/test/compiler/6896617/Test6896617.java @@ -1,5 +1,5 @@ /* - * Copyright (c) 2013, Oracle and/or its affiliates. All rights reserved. + * Copyright (c) 2013, 2014, Oracle and/or its affiliates. All rights reserved. * DO NOT ALTER OR REMOVE COPYRIGHT NOTICES OR THIS FILE HEADER. * * This code is free software; you can redistribute it and/or modify it @@ -25,13 +25,20 @@ * @test * @bug 6896617 * @summary Optimize sun.nio.cs.ISO_8859_1$Encode.encodeArrayLoop() with SSE instructions on x86 + * @library /testlibrary * @run main/othervm/timeout=1200 -Xbatch -Xmx256m Test6896617 * */ -import java.util.*; -import java.nio.*; -import java.nio.charset.*; +import com.oracle.java.testlibrary.Utils; +import java.nio.ByteBuffer; +import java.nio.CharBuffer; +import java.nio.charset.Charset; +import java.nio.charset.CharsetDecoder; +import java.nio.charset.CharsetEncoder; +import java.nio.charset.CodingErrorAction; +import java.util.Arrays; +import java.util.Random; public class Test6896617 { final static int SIZE = 256; @@ -54,7 +61,7 @@ public class Test6896617 { sun.nio.cs.ArrayDecoder arrdec = (sun.nio.cs.ArrayDecoder)dec; // Populate char[] with chars which can be encoded by ISO_8859_1 (<= 0xFF) - Random rnd = new Random(0); + Random rnd = Utils.getRandomInstance(); int maxchar = 0xFF; char[] a = new char[SIZE]; byte[] b = new byte[SIZE]; diff --git a/hotspot/test/compiler/7100757/Test7100757.java b/hotspot/test/compiler/7100757/Test7100757.java index daa0bfeb22e..50ee9e11550 100644 --- a/hotspot/test/compiler/7100757/Test7100757.java +++ b/hotspot/test/compiler/7100757/Test7100757.java @@ -1,5 +1,5 @@ /* - * Copyright (c) 2011, Oracle and/or its affiliates. All rights reserved. + * Copyright (c) 2011, 2014, Oracle and/or its affiliates. All rights reserved. * DO NOT ALTER OR REMOVE COPYRIGHT NOTICES OR THIS FILE HEADER. * * This code is free software; you can redistribute it and/or modify it @@ -26,11 +26,13 @@ * @test * @bug 7100757 * @summary The BitSet.nextSetBit() produces incorrect result in 32bit VM on Sparc - * + * @library /testlibrary * @run main/timeout=300 Test7100757 */ -import java.util.*; +import com.oracle.java.testlibrary.Utils; +import java.util.BitSet; +import java.util.Random; public class Test7100757 { @@ -39,7 +41,7 @@ public class Test7100757 { public static void main(String[] args) { BitSet bs = new BitSet(NBITS); - Random rnd = new Random(); + Random rnd = Utils.getRandomInstance(); long[] ra = new long[(NBITS+63)/64]; for(int l=0; l < 5000000; l++) { diff --git a/hotspot/test/compiler/7177917/Test7177917.java b/hotspot/test/compiler/7177917/Test7177917.java index 7d2c76490a9..708f8c3f424 100644 --- a/hotspot/test/compiler/7177917/Test7177917.java +++ b/hotspot/test/compiler/7177917/Test7177917.java @@ -1,5 +1,5 @@ /* - * Copyright (c) 2012, Oracle and/or its affiliates. All rights reserved. + * Copyright (c) 2012, 2014, Oracle and/or its affiliates. All rights reserved. * DO NOT ALTER OR REMOVE COPYRIGHT NOTICES OR THIS FILE HEADER. * * This code is free software; you can redistribute it and/or modify it @@ -26,13 +26,14 @@ * Micro-benchmark for Math.pow() and Math.exp() */ -import java.util.*; +import com.oracle.java.testlibrary.Utils; +import java.util.Random; public class Test7177917 { static double d; - static Random r = new Random(0); + static final Random R = Utils.getRandomInstance(); static long m_pow(double[][] values) { double res = 0; @@ -59,10 +60,10 @@ public class Test7177917 { static double[][] pow_values(int nb) { double[][] res = new double[nb][2]; for (int i = 0; i < nb; i++) { - double ylogx = (1 + (r.nextDouble() * 2045)) - 1023; // 2045 rather than 2046 as a safety margin - double x = Math.abs(Double.longBitsToDouble(r.nextLong())); + double ylogx = (1 + (R.nextDouble() * 2045)) - 1023; // 2045 rather than 2046 as a safety margin + double x = Math.abs(Double.longBitsToDouble(R.nextLong())); while (x != x) { - x = Math.abs(Double.longBitsToDouble(r.nextLong())); + x = Math.abs(Double.longBitsToDouble(R.nextLong())); } double logx = Math.log(x) / Math.log(2); double y = ylogx / logx; @@ -76,7 +77,7 @@ public class Test7177917 { static double[] exp_values(int nb) { double[] res = new double[nb]; for (int i = 0; i < nb; i++) { - double ylogx = (1 + (r.nextDouble() * 2045)) - 1023; // 2045 rather than 2046 as a safety margin + double ylogx = (1 + (R.nextDouble() * 2045)) - 1023; // 2045 rather than 2046 as a safety margin double x = Math.E; double logx = Math.log(x) / Math.log(2); double y = ylogx / logx; diff --git a/hotspot/test/compiler/7184394/TestAESBase.java b/hotspot/test/compiler/7184394/TestAESBase.java index 4d3204880bc..73a4994e662 100644 --- a/hotspot/test/compiler/7184394/TestAESBase.java +++ b/hotspot/test/compiler/7184394/TestAESBase.java @@ -26,15 +26,13 @@ * @author Tom Deneau */ +import com.oracle.java.testlibrary.Utils; +import java.security.AlgorithmParameters; +import java.util.Random; import javax.crypto.Cipher; -import javax.crypto.KeyGenerator; import javax.crypto.SecretKey; import javax.crypto.spec.IvParameterSpec; import javax.crypto.spec.SecretKeySpec; -import java.security.AlgorithmParameters; - -import java.util.Random; -import java.util.Arrays; abstract public class TestAESBase { int msgSize = Integer.getInteger("msgSize", 646); @@ -59,7 +57,7 @@ abstract public class TestAESBase { byte[] expectedEncode; byte[] decode; byte[] expectedDecode; - Random random = new Random(0); + final Random random = Utils.getRandomInstance(); Cipher cipher; Cipher dCipher; AlgorithmParameters algParams; diff --git a/hotspot/test/compiler/7184394/TestAESMain.java b/hotspot/test/compiler/7184394/TestAESMain.java index 20929e8ba68..d09a305a3b4 100644 --- a/hotspot/test/compiler/7184394/TestAESMain.java +++ b/hotspot/test/compiler/7184394/TestAESMain.java @@ -26,6 +26,7 @@ * @test * @bug 7184394 * @summary add intrinsics to use AES instructions + * @library /testlibrary * * @run main/othervm/timeout=600 -Xbatch -DcheckOutput=true -Dmode=CBC TestAESMain * @run main/othervm/timeout=600 -Xbatch -DcheckOutput=true -Dmode=CBC -DencInputOffset=1 TestAESMain diff --git a/hotspot/test/compiler/8005956/PolynomialRoot.java b/hotspot/test/compiler/8005956/PolynomialRoot.java index 1ec220955a5..54cc8f3d5c5 100644 --- a/hotspot/test/compiler/8005956/PolynomialRoot.java +++ b/hotspot/test/compiler/8005956/PolynomialRoot.java @@ -1,4 +1,3 @@ -//package com.polytechnik.utils; /* * (C) Vladislav Malyshkin 2010 * This file is under GPL version 3. @@ -14,10 +13,14 @@ * @test * @bug 8005956 * @summary C2: assert(!def_outside->member(r)) failed: Use of external LRG overlaps the same LRG defined in this block -* +* @library /testlibrary * @run main/timeout=300 PolynomialRoot */ +import com.oracle.java.testlibrary.Utils; +import java.util.Arrays; +import java.util.Random; + public class PolynomialRoot { @@ -57,7 +60,7 @@ private static final boolean PRINT_DEBUG=false; public static int root4(final double [] p,final double [] re_root,final double [] im_root) { - if(PRINT_DEBUG) System.err.println("=====================root4:p="+java.util.Arrays.toString(p)); + if (PRINT_DEBUG) { System.err.println("=====================root4:p=" + Arrays.toString(p)); } final double vs=p[4]; if(PRINT_DEBUG) System.err.println("p[4]="+p[4]); if(!(Math.abs(vs)>EPS)) @@ -367,7 +370,7 @@ public static int root4(final double [] p,final double [] re_root,final double [ - static void setRandomP(final double [] p,final int n,java.util.Random r) + static void setRandomP(final double [] p, final int n, Random r) { if(r.nextDouble()<0.1) { @@ -465,7 +468,7 @@ public static int root4(final double [] p,final double [] re_root,final double [ static void testRoots(final int n, final int n_tests, - final java.util.Random rn, + final Random rn, final double eps) { final double [] p=new double [n+1]; @@ -763,7 +766,7 @@ public static int root4(final double [] p,final double [] re_root,final double [ final long t0=System.currentTimeMillis(); final double eps=1e-6; //checkRoots(); - final java.util.Random r=new java.util.Random(-1381923); + final Random r = Utils.getRandomInstance(); printSpecialValues(); final int n_tests=100000; diff --git a/hotspot/test/compiler/intrinsics/bmi/BMITestRunner.java b/hotspot/test/compiler/intrinsics/bmi/BMITestRunner.java index ea7fd821f33..31a65115c22 100644 --- a/hotspot/test/compiler/intrinsics/bmi/BMITestRunner.java +++ b/hotspot/test/compiler/intrinsics/bmi/BMITestRunner.java @@ -22,13 +22,17 @@ * */ -import java.util.*; +import com.oracle.java.testlibrary.Asserts; +import com.oracle.java.testlibrary.OutputAnalyzer; +import com.oracle.java.testlibrary.ProcessTools; +import com.oracle.java.testlibrary.Utils; import java.io.IOException; import java.nio.file.Files; import java.nio.file.Paths; -import java.nio.charset.StandardCharsets; - -import com.oracle.java.testlibrary.*; +import java.util.Collections; +import java.util.LinkedList; +import java.util.List; +import java.util.Random; /** * Test runner that invokes all methods implemented by particular Expr @@ -69,7 +73,7 @@ public class BMITestRunner { String... additionalVMOpts) throws Throwable { - int seed = new Random().nextInt(); + int seed = Utils.getRandomInstance().nextInt(); int iterations = DEFAULT_ITERATIONS_COUNT; for (String testOption : testOpts) { @@ -81,8 +85,6 @@ public class BMITestRunner { } } - System.out.println("Running test with seed: " + seed); - OutputAnalyzer intOutput = runTest(expr, VMMode.INT, additionalVMOpts, seed, iterations); @@ -139,9 +141,9 @@ public class BMITestRunner { Collections.addAll(vmOpts, new String[] { "-XX:+DisplayVMOutputToStderr", + "-D" + Utils.SEED_PROPERTY_NAME + "=" + seed, Executor.class.getName(), expr.getName(), - new Integer(seed).toString(), new Integer(iterations).toString() }); @@ -179,16 +181,15 @@ public class BMITestRunner { public static class Executor { /** - * Usage: BMITestRunner$Executor + * Usage: BMITestRunner$Executor <ExprClassName> <iterations> */ public static void main(String args[]) throws Exception { @SuppressWarnings("unchecked") Class exprClass = (Class)Class.forName(args[0]); Expr expr = exprClass.getConstructor().newInstance(); - Random rng = new Random(Integer.valueOf(args[1])); - int iterations = Integer.valueOf(args[2]); - runTests(expr, iterations, rng); + int iterations = Integer.valueOf(args[1]); + runTests(expr, iterations, Utils.getRandomInstance()); } diff --git a/hotspot/test/compiler/intrinsics/mathexact/AddExactIConstantTest.java b/hotspot/test/compiler/intrinsics/mathexact/AddExactIConstantTest.java index 77000a1d958..71e1a9762fa 100644 --- a/hotspot/test/compiler/intrinsics/mathexact/AddExactIConstantTest.java +++ b/hotspot/test/compiler/intrinsics/mathexact/AddExactIConstantTest.java @@ -1,5 +1,5 @@ /* - * Copyright (c) 2013, Oracle and/or its affiliates. All rights reserved. + * Copyright (c) 2013, 2014, Oracle and/or its affiliates. All rights reserved. * DO NOT ALTER OR REMOVE COPYRIGHT NOTICES OR THIS FILE HEADER. * * This code is free software; you can redistribute it and/or modify it @@ -25,6 +25,7 @@ * @test * @bug 8024924 * @summary Test constant addExact + * @library /testlibrary * @compile AddExactIConstantTest.java Verify.java * @run main AddExactIConstantTest * diff --git a/hotspot/test/compiler/intrinsics/mathexact/AddExactILoadTest.java b/hotspot/test/compiler/intrinsics/mathexact/AddExactILoadTest.java index 2d96bb8b8a6..81bcc240ad5 100644 --- a/hotspot/test/compiler/intrinsics/mathexact/AddExactILoadTest.java +++ b/hotspot/test/compiler/intrinsics/mathexact/AddExactILoadTest.java @@ -1,5 +1,5 @@ /* - * Copyright (c) 2013, Oracle and/or its affiliates. All rights reserved. + * Copyright (c) 2013, 2014, Oracle and/or its affiliates. All rights reserved. * DO NOT ALTER OR REMOVE COPYRIGHT NOTICES OR THIS FILE HEADER. * * This code is free software; you can redistribute it and/or modify it @@ -25,6 +25,7 @@ * @test * @bug 8024924 * @summary Test non constant addExact + * @library /testlibrary * @compile AddExactILoadTest.java Verify.java * @run main AddExactILoadTest * diff --git a/hotspot/test/compiler/intrinsics/mathexact/AddExactILoopDependentTest.java b/hotspot/test/compiler/intrinsics/mathexact/AddExactILoopDependentTest.java index 99aae0d7b21..f0adb45018e 100644 --- a/hotspot/test/compiler/intrinsics/mathexact/AddExactILoopDependentTest.java +++ b/hotspot/test/compiler/intrinsics/mathexact/AddExactILoopDependentTest.java @@ -1,5 +1,5 @@ /* - * Copyright (c) 2013, Oracle and/or its affiliates. All rights reserved. + * Copyright (c) 2013, 2014, Oracle and/or its affiliates. All rights reserved. * DO NOT ALTER OR REMOVE COPYRIGHT NOTICES OR THIS FILE HEADER. * * This code is free software; you can redistribute it and/or modify it @@ -25,6 +25,7 @@ * @test * @bug 8024924 * @summary Test non constant addExact + * @library /testlibrary * @compile AddExactILoopDependentTest.java Verify.java * @run main AddExactILoopDependentTest * diff --git a/hotspot/test/compiler/intrinsics/mathexact/AddExactINonConstantTest.java b/hotspot/test/compiler/intrinsics/mathexact/AddExactINonConstantTest.java index b3a24758569..96c0b6014df 100644 --- a/hotspot/test/compiler/intrinsics/mathexact/AddExactINonConstantTest.java +++ b/hotspot/test/compiler/intrinsics/mathexact/AddExactINonConstantTest.java @@ -1,5 +1,5 @@ /* - * Copyright (c) 2013, Oracle and/or its affiliates. All rights reserved. + * Copyright (c) 2013, 2014, Oracle and/or its affiliates. All rights reserved. * DO NOT ALTER OR REMOVE COPYRIGHT NOTICES OR THIS FILE HEADER. * * This code is free software; you can redistribute it and/or modify it @@ -25,6 +25,7 @@ * @test * @bug 8024924 * @summary Test non constant addExact + * @library /testlibrary * @compile AddExactINonConstantTest.java Verify.java * @run main AddExactINonConstantTest * diff --git a/hotspot/test/compiler/intrinsics/mathexact/AddExactIRepeatTest.java b/hotspot/test/compiler/intrinsics/mathexact/AddExactIRepeatTest.java index d111b66ce82..2ba7268838d 100644 --- a/hotspot/test/compiler/intrinsics/mathexact/AddExactIRepeatTest.java +++ b/hotspot/test/compiler/intrinsics/mathexact/AddExactIRepeatTest.java @@ -1,5 +1,5 @@ /* - * Copyright (c) 2013, Oracle and/or its affiliates. All rights reserved. + * Copyright (c) 2013, 2014, Oracle and/or its affiliates. All rights reserved. * DO NOT ALTER OR REMOVE COPYRIGHT NOTICES OR THIS FILE HEADER. * * This code is free software; you can redistribute it and/or modify it @@ -25,11 +25,15 @@ * @test * @bug 8025657 * @summary Test repeating addExact + * @library /testlibrary * @compile AddExactIRepeatTest.java Verify.java * @run main AddExactIRepeatTest * */ +import com.oracle.java.testlibrary.Utils; +import java.util.Random; + public class AddExactIRepeatTest { public static void main(String[] args) { runTest(new Verify.AddExactI()); @@ -44,7 +48,7 @@ public class AddExactIRepeatTest { } public static void runTest(Verify.BinaryMethod method) { - java.util.Random rnd = new java.util.Random(); + Random rnd = Utils.getRandomInstance(); for (int i = 0; i < 50000; ++i) { int x = Integer.MAX_VALUE - 10; int y = Integer.MAX_VALUE - 10 + rnd.nextInt(5); diff --git a/hotspot/test/compiler/intrinsics/mathexact/AddExactLConstantTest.java b/hotspot/test/compiler/intrinsics/mathexact/AddExactLConstantTest.java index dc751406192..f36c925f7fd 100644 --- a/hotspot/test/compiler/intrinsics/mathexact/AddExactLConstantTest.java +++ b/hotspot/test/compiler/intrinsics/mathexact/AddExactLConstantTest.java @@ -1,5 +1,5 @@ /* - * Copyright (c) 2013, Oracle and/or its affiliates. All rights reserved. + * Copyright (c) 2013, 2014, Oracle and/or its affiliates. All rights reserved. * DO NOT ALTER OR REMOVE COPYRIGHT NOTICES OR THIS FILE HEADER. * * This code is free software; you can redistribute it and/or modify it @@ -25,6 +25,7 @@ * @test * @bug 8026844 * @summary Test constant addExact + * @library /testlibrary * @compile AddExactLConstantTest.java Verify.java * @run main AddExactLConstantTest * diff --git a/hotspot/test/compiler/intrinsics/mathexact/AddExactLNonConstantTest.java b/hotspot/test/compiler/intrinsics/mathexact/AddExactLNonConstantTest.java index efd5fd7c92b..01860ba94a7 100644 --- a/hotspot/test/compiler/intrinsics/mathexact/AddExactLNonConstantTest.java +++ b/hotspot/test/compiler/intrinsics/mathexact/AddExactLNonConstantTest.java @@ -1,5 +1,5 @@ /* - * Copyright (c) 2013, Oracle and/or its affiliates. All rights reserved. + * Copyright (c) 2013, 2014, Oracle and/or its affiliates. All rights reserved. * DO NOT ALTER OR REMOVE COPYRIGHT NOTICES OR THIS FILE HEADER. * * This code is free software; you can redistribute it and/or modify it @@ -25,6 +25,7 @@ * @test * @bug 8026844 * @summary Test non constant addExact + * @library /testlibrary * @compile AddExactLNonConstantTest.java Verify.java * @run main AddExactLNonConstantTest * diff --git a/hotspot/test/compiler/intrinsics/mathexact/DecExactITest.java b/hotspot/test/compiler/intrinsics/mathexact/DecExactITest.java index 7e6e1ca3bde..256aa916563 100644 --- a/hotspot/test/compiler/intrinsics/mathexact/DecExactITest.java +++ b/hotspot/test/compiler/intrinsics/mathexact/DecExactITest.java @@ -1,5 +1,5 @@ /* - * Copyright (c) 2013, Oracle and/or its affiliates. All rights reserved. + * Copyright (c) 2013, 2014, Oracle and/or its affiliates. All rights reserved. * DO NOT ALTER OR REMOVE COPYRIGHT NOTICES OR THIS FILE HEADER. * * This code is free software; you can redistribute it and/or modify it @@ -25,6 +25,7 @@ * @test * @bug 8026844 * @summary Test decrementExact + * @library /testlibrary * @compile DecExactITest.java Verify.java * @run main DecExactITest * diff --git a/hotspot/test/compiler/intrinsics/mathexact/DecExactLTest.java b/hotspot/test/compiler/intrinsics/mathexact/DecExactLTest.java index 53a16596e3c..1a9f0c86aa1 100644 --- a/hotspot/test/compiler/intrinsics/mathexact/DecExactLTest.java +++ b/hotspot/test/compiler/intrinsics/mathexact/DecExactLTest.java @@ -1,5 +1,5 @@ /* - * Copyright (c) 2013, Oracle and/or its affiliates. All rights reserved. + * Copyright (c) 2013, 2014, Oracle and/or its affiliates. All rights reserved. * DO NOT ALTER OR REMOVE COPYRIGHT NOTICES OR THIS FILE HEADER. * * This code is free software; you can redistribute it and/or modify it @@ -25,6 +25,7 @@ * @test * @bug 8026844 * @summary Test decrementExact + * @library /testlibrary * @compile DecExactLTest.java Verify.java * @run main DecExactLTest * diff --git a/hotspot/test/compiler/intrinsics/mathexact/IncExactITest.java b/hotspot/test/compiler/intrinsics/mathexact/IncExactITest.java index 9f7ddbd3211..14ab592a885 100644 --- a/hotspot/test/compiler/intrinsics/mathexact/IncExactITest.java +++ b/hotspot/test/compiler/intrinsics/mathexact/IncExactITest.java @@ -1,5 +1,5 @@ /* - * Copyright (c) 2013, Oracle and/or its affiliates. All rights reserved. + * Copyright (c) 2013, 2014, Oracle and/or its affiliates. All rights reserved. * DO NOT ALTER OR REMOVE COPYRIGHT NOTICES OR THIS FILE HEADER. * * This code is free software; you can redistribute it and/or modify it @@ -25,6 +25,7 @@ * @test * @bug 8026844 * @summary Test incrementExact + * @library /testlibrary * @compile IncExactITest.java Verify.java * @run main IncExactITest * diff --git a/hotspot/test/compiler/intrinsics/mathexact/IncExactLTest.java b/hotspot/test/compiler/intrinsics/mathexact/IncExactLTest.java index 755d81908ce..5665b8080c1 100644 --- a/hotspot/test/compiler/intrinsics/mathexact/IncExactLTest.java +++ b/hotspot/test/compiler/intrinsics/mathexact/IncExactLTest.java @@ -1,5 +1,5 @@ /* - * Copyright (c) 2013, Oracle and/or its affiliates. All rights reserved. + * Copyright (c) 2013, 2014, Oracle and/or its affiliates. All rights reserved. * DO NOT ALTER OR REMOVE COPYRIGHT NOTICES OR THIS FILE HEADER. * * This code is free software; you can redistribute it and/or modify it @@ -25,6 +25,7 @@ * @test * @bug 8026844 * @summary Test incrementExact + * @library /testlibrary * @compile IncExactLTest.java Verify.java * @run main IncExactLTest * diff --git a/hotspot/test/compiler/intrinsics/mathexact/MulExactIConstantTest.java b/hotspot/test/compiler/intrinsics/mathexact/MulExactIConstantTest.java index 120bef5e9b9..3d3f23ea90e 100644 --- a/hotspot/test/compiler/intrinsics/mathexact/MulExactIConstantTest.java +++ b/hotspot/test/compiler/intrinsics/mathexact/MulExactIConstantTest.java @@ -1,5 +1,5 @@ /* - * Copyright (c) 2013, Oracle and/or its affiliates. All rights reserved. + * Copyright (c) 2013, 2014, Oracle and/or its affiliates. All rights reserved. * DO NOT ALTER OR REMOVE COPYRIGHT NOTICES OR THIS FILE HEADER. * * This code is free software; you can redistribute it and/or modify it @@ -25,6 +25,7 @@ * @test * @bug 8026844 * @summary Test constant multiplyExact + * @library /testlibrary * @compile MulExactIConstantTest.java Verify.java * @run main MulExactIConstantTest * diff --git a/hotspot/test/compiler/intrinsics/mathexact/MulExactILoadTest.java b/hotspot/test/compiler/intrinsics/mathexact/MulExactILoadTest.java index 36aa3d46230..4551e9d4d62 100644 --- a/hotspot/test/compiler/intrinsics/mathexact/MulExactILoadTest.java +++ b/hotspot/test/compiler/intrinsics/mathexact/MulExactILoadTest.java @@ -1,5 +1,5 @@ /* - * Copyright (c) 2013, Oracle and/or its affiliates. All rights reserved. + * Copyright (c) 2013, 2014, Oracle and/or its affiliates. All rights reserved. * DO NOT ALTER OR REMOVE COPYRIGHT NOTICES OR THIS FILE HEADER. * * This code is free software; you can redistribute it and/or modify it @@ -25,6 +25,7 @@ * @test * @bug 8026844 * @summary Test multiplyExact + * @library /testlibrary * @compile MulExactILoadTest.java Verify.java * @run main MulExactILoadTest * diff --git a/hotspot/test/compiler/intrinsics/mathexact/MulExactILoopDependentTest.java b/hotspot/test/compiler/intrinsics/mathexact/MulExactILoopDependentTest.java index 5ba4ad3cfc3..b324135ab53 100644 --- a/hotspot/test/compiler/intrinsics/mathexact/MulExactILoopDependentTest.java +++ b/hotspot/test/compiler/intrinsics/mathexact/MulExactILoopDependentTest.java @@ -1,5 +1,5 @@ /* - * Copyright (c) 2013, Oracle and/or its affiliates. All rights reserved. + * Copyright (c) 2013, 2014, Oracle and/or its affiliates. All rights reserved. * DO NOT ALTER OR REMOVE COPYRIGHT NOTICES OR THIS FILE HEADER. * * This code is free software; you can redistribute it and/or modify it @@ -25,6 +25,7 @@ * @test * @bug 8026844 * @summary Test loop dependent multiplyExact + * @library /testlibrary * @compile MulExactILoopDependentTest.java Verify.java * @run main MulExactILoopDependentTest * diff --git a/hotspot/test/compiler/intrinsics/mathexact/MulExactINonConstantTest.java b/hotspot/test/compiler/intrinsics/mathexact/MulExactINonConstantTest.java index e108059885b..5f60c66c611 100644 --- a/hotspot/test/compiler/intrinsics/mathexact/MulExactINonConstantTest.java +++ b/hotspot/test/compiler/intrinsics/mathexact/MulExactINonConstantTest.java @@ -1,5 +1,5 @@ /* - * Copyright (c) 2013, Oracle and/or its affiliates. All rights reserved. + * Copyright (c) 2013, 2014, Oracle and/or its affiliates. All rights reserved. * DO NOT ALTER OR REMOVE COPYRIGHT NOTICES OR THIS FILE HEADER. * * This code is free software; you can redistribute it and/or modify it @@ -25,6 +25,7 @@ * @test * @bug 8026844 * @summary Test non constant multiplyExact + * @library /testlibrary * @compile MulExactINonConstantTest.java Verify.java * @run main MulExactINonConstantTest * diff --git a/hotspot/test/compiler/intrinsics/mathexact/MulExactIRepeatTest.java b/hotspot/test/compiler/intrinsics/mathexact/MulExactIRepeatTest.java index dd14ce21ed6..5d1784e8560 100644 --- a/hotspot/test/compiler/intrinsics/mathexact/MulExactIRepeatTest.java +++ b/hotspot/test/compiler/intrinsics/mathexact/MulExactIRepeatTest.java @@ -1,5 +1,5 @@ /* - * Copyright (c) 2013, Oracle and/or its affiliates. All rights reserved. + * Copyright (c) 2013, 2014, Oracle and/or its affiliates. All rights reserved. * DO NOT ALTER OR REMOVE COPYRIGHT NOTICES OR THIS FILE HEADER. * * This code is free software; you can redistribute it and/or modify it @@ -25,11 +25,15 @@ * @test * @bug 8026844 * @summary Test repeating multiplyExact + * @library /testlibrary * @compile MulExactIRepeatTest.java Verify.java * @run main MulExactIRepeatTest * */ +import com.oracle.java.testlibrary.Utils; +import java.util.Random; + public class MulExactIRepeatTest { public static void main(String[] args) { runTest(new Verify.MulExactI()); @@ -44,7 +48,7 @@ public class MulExactIRepeatTest { } public static void runTest(Verify.BinaryMethod method) { - java.util.Random rnd = new java.util.Random(); + Random rnd = Utils.getRandomInstance(); for (int i = 0; i < 50000; ++i) { int x = Integer.MAX_VALUE - 10; int y = Integer.MAX_VALUE - 10 + rnd.nextInt(5); diff --git a/hotspot/test/compiler/intrinsics/mathexact/MulExactLConstantTest.java b/hotspot/test/compiler/intrinsics/mathexact/MulExactLConstantTest.java index c687cc276f2..d830cf54812 100644 --- a/hotspot/test/compiler/intrinsics/mathexact/MulExactLConstantTest.java +++ b/hotspot/test/compiler/intrinsics/mathexact/MulExactLConstantTest.java @@ -1,5 +1,5 @@ /* - * Copyright (c) 2013, Oracle and/or its affiliates. All rights reserved. + * Copyright (c) 2013, 2014, Oracle and/or its affiliates. All rights reserved. * DO NOT ALTER OR REMOVE COPYRIGHT NOTICES OR THIS FILE HEADER. * * This code is free software; you can redistribute it and/or modify it @@ -25,6 +25,7 @@ * @test * @bug 8026844 * @summary Test constant mulExact + * @library /testlibrary * @compile MulExactLConstantTest.java Verify.java * @run main MulExactLConstantTest * diff --git a/hotspot/test/compiler/intrinsics/mathexact/MulExactLNonConstantTest.java b/hotspot/test/compiler/intrinsics/mathexact/MulExactLNonConstantTest.java index f9d82ed0876..c0f97a9c143 100644 --- a/hotspot/test/compiler/intrinsics/mathexact/MulExactLNonConstantTest.java +++ b/hotspot/test/compiler/intrinsics/mathexact/MulExactLNonConstantTest.java @@ -1,5 +1,5 @@ /* - * Copyright (c) 2013, Oracle and/or its affiliates. All rights reserved. + * Copyright (c) 2013, 2014, Oracle and/or its affiliates. All rights reserved. * DO NOT ALTER OR REMOVE COPYRIGHT NOTICES OR THIS FILE HEADER. * * This code is free software; you can redistribute it and/or modify it @@ -25,6 +25,7 @@ * @test * @bug 8026844 * @summary Test non constant mulExact + * @library /testlibrary * @compile MulExactLNonConstantTest.java Verify.java * @run main MulExactLNonConstantTest * diff --git a/hotspot/test/compiler/intrinsics/mathexact/NegExactIConstantTest.java b/hotspot/test/compiler/intrinsics/mathexact/NegExactIConstantTest.java index ba49d778762..a8e6c7c9984 100644 --- a/hotspot/test/compiler/intrinsics/mathexact/NegExactIConstantTest.java +++ b/hotspot/test/compiler/intrinsics/mathexact/NegExactIConstantTest.java @@ -1,5 +1,5 @@ /* - * Copyright (c) 2013, Oracle and/or its affiliates. All rights reserved. + * Copyright (c) 2013, 2014, Oracle and/or its affiliates. All rights reserved. * DO NOT ALTER OR REMOVE COPYRIGHT NOTICES OR THIS FILE HEADER. * * This code is free software; you can redistribute it and/or modify it @@ -25,6 +25,7 @@ * @test * @bug 8026844 * @summary Test constant negExact + * @library /testlibrary * @compile NegExactIConstantTest.java Verify.java * @run main NegExactIConstantTest * diff --git a/hotspot/test/compiler/intrinsics/mathexact/NegExactILoadTest.java b/hotspot/test/compiler/intrinsics/mathexact/NegExactILoadTest.java index d7e8215600a..dfa8ba21d11 100644 --- a/hotspot/test/compiler/intrinsics/mathexact/NegExactILoadTest.java +++ b/hotspot/test/compiler/intrinsics/mathexact/NegExactILoadTest.java @@ -1,5 +1,5 @@ /* - * Copyright (c) 2013, Oracle and/or its affiliates. All rights reserved. + * Copyright (c) 2013, 2014, Oracle and/or its affiliates. All rights reserved. * DO NOT ALTER OR REMOVE COPYRIGHT NOTICES OR THIS FILE HEADER. * * This code is free software; you can redistribute it and/or modify it @@ -25,6 +25,7 @@ * @test * @bug 8026844 * @summary Test negExact + * @library /testlibrary * @compile NegExactILoadTest.java Verify.java * @run main NegExactILoadTest * diff --git a/hotspot/test/compiler/intrinsics/mathexact/NegExactILoopDependentTest.java b/hotspot/test/compiler/intrinsics/mathexact/NegExactILoopDependentTest.java index 882f80b91a1..17e49739e71 100644 --- a/hotspot/test/compiler/intrinsics/mathexact/NegExactILoopDependentTest.java +++ b/hotspot/test/compiler/intrinsics/mathexact/NegExactILoopDependentTest.java @@ -1,5 +1,5 @@ /* - * Copyright (c) 2013, Oracle and/or its affiliates. All rights reserved. + * Copyright (c) 2013, 2014, Oracle and/or its affiliates. All rights reserved. * DO NOT ALTER OR REMOVE COPYRIGHT NOTICES OR THIS FILE HEADER. * * This code is free software; you can redistribute it and/or modify it @@ -25,6 +25,7 @@ * @test * @bug 8026844 * @summary Test negExact loop dependent + * @library /testlibrary * @compile NegExactILoopDependentTest.java Verify.java * @run main NegExactILoopDependentTest * diff --git a/hotspot/test/compiler/intrinsics/mathexact/NegExactINonConstantTest.java b/hotspot/test/compiler/intrinsics/mathexact/NegExactINonConstantTest.java index 6f044f0d969..883dc4f82b7 100644 --- a/hotspot/test/compiler/intrinsics/mathexact/NegExactINonConstantTest.java +++ b/hotspot/test/compiler/intrinsics/mathexact/NegExactINonConstantTest.java @@ -1,5 +1,5 @@ /* - * Copyright (c) 2013, Oracle and/or its affiliates. All rights reserved. + * Copyright (c) 2013, 2014, Oracle and/or its affiliates. All rights reserved. * DO NOT ALTER OR REMOVE COPYRIGHT NOTICES OR THIS FILE HEADER. * * This code is free software; you can redistribute it and/or modify it @@ -25,6 +25,7 @@ * @test * @bug 8026844 * @summary Test non constant negExact + * @library /testlibrary * @compile NegExactINonConstantTest.java Verify.java * @run main NegExactINonConstantTest * diff --git a/hotspot/test/compiler/intrinsics/mathexact/NegExactLConstantTest.java b/hotspot/test/compiler/intrinsics/mathexact/NegExactLConstantTest.java index 382cd5c5f9e..6425f81b4b2 100644 --- a/hotspot/test/compiler/intrinsics/mathexact/NegExactLConstantTest.java +++ b/hotspot/test/compiler/intrinsics/mathexact/NegExactLConstantTest.java @@ -1,5 +1,5 @@ /* - * Copyright (c) 2013, Oracle and/or its affiliates. All rights reserved. + * Copyright (c) 2013, 2014, Oracle and/or its affiliates. All rights reserved. * DO NOT ALTER OR REMOVE COPYRIGHT NOTICES OR THIS FILE HEADER. * * This code is free software; you can redistribute it and/or modify it @@ -25,6 +25,7 @@ * @test * @bug 8026844 * @summary Test constant negExact + * @library /testlibrary * @compile NegExactLConstantTest.java Verify.java * @run main NegExactLConstantTest * diff --git a/hotspot/test/compiler/intrinsics/mathexact/NegExactLNonConstantTest.java b/hotspot/test/compiler/intrinsics/mathexact/NegExactLNonConstantTest.java index 0bcad8b2b78..105b80d539e 100644 --- a/hotspot/test/compiler/intrinsics/mathexact/NegExactLNonConstantTest.java +++ b/hotspot/test/compiler/intrinsics/mathexact/NegExactLNonConstantTest.java @@ -1,5 +1,5 @@ /* - * Copyright (c) 2013, Oracle and/or its affiliates. All rights reserved. + * Copyright (c) 2013, 2014, Oracle and/or its affiliates. All rights reserved. * DO NOT ALTER OR REMOVE COPYRIGHT NOTICES OR THIS FILE HEADER. * * This code is free software; you can redistribute it and/or modify it @@ -25,6 +25,7 @@ * @test * @bug 8026844 * @summary Test constant negExact + * @library /testlibrary * @compile NegExactLNonConstantTest.java Verify.java * @run main NegExactLNonConstantTest * diff --git a/hotspot/test/compiler/intrinsics/mathexact/SubExactICondTest.java b/hotspot/test/compiler/intrinsics/mathexact/SubExactICondTest.java index f539bdc7cbe..213aa02c29b 100644 --- a/hotspot/test/compiler/intrinsics/mathexact/SubExactICondTest.java +++ b/hotspot/test/compiler/intrinsics/mathexact/SubExactICondTest.java @@ -1,5 +1,5 @@ /* - * Copyright (c) 2013, Oracle and/or its affiliates. All rights reserved. + * Copyright (c) 2013, 2014, Oracle and/or its affiliates. All rights reserved. * DO NOT ALTER OR REMOVE COPYRIGHT NOTICES OR THIS FILE HEADER. * * This code is free software; you can redistribute it and/or modify it @@ -25,6 +25,7 @@ * @test * @bug 8026844 * @summary Test subtractExact as condition + * @library /testlibrary * @compile SubExactICondTest.java Verify.java * @run main SubExactICondTest * diff --git a/hotspot/test/compiler/intrinsics/mathexact/SubExactIConstantTest.java b/hotspot/test/compiler/intrinsics/mathexact/SubExactIConstantTest.java index b450bd90b11..094b47497ac 100644 --- a/hotspot/test/compiler/intrinsics/mathexact/SubExactIConstantTest.java +++ b/hotspot/test/compiler/intrinsics/mathexact/SubExactIConstantTest.java @@ -1,5 +1,5 @@ /* - * Copyright (c) 2013, Oracle and/or its affiliates. All rights reserved. + * Copyright (c) 2013, 2014, Oracle and/or its affiliates. All rights reserved. * DO NOT ALTER OR REMOVE COPYRIGHT NOTICES OR THIS FILE HEADER. * * This code is free software; you can redistribute it and/or modify it @@ -25,6 +25,7 @@ * @test * @bug 8026844 * @summary Test constant subtractExact + * @library /testlibrary * @compile SubExactIConstantTest.java Verify.java * @run main SubExactIConstantTest * diff --git a/hotspot/test/compiler/intrinsics/mathexact/SubExactILoadTest.java b/hotspot/test/compiler/intrinsics/mathexact/SubExactILoadTest.java index af2ed018258..976bf9babc4 100644 --- a/hotspot/test/compiler/intrinsics/mathexact/SubExactILoadTest.java +++ b/hotspot/test/compiler/intrinsics/mathexact/SubExactILoadTest.java @@ -1,5 +1,5 @@ /* - * Copyright (c) 2013, Oracle and/or its affiliates. All rights reserved. + * Copyright (c) 2013, 2014, Oracle and/or its affiliates. All rights reserved. * DO NOT ALTER OR REMOVE COPYRIGHT NOTICES OR THIS FILE HEADER. * * This code is free software; you can redistribute it and/or modify it @@ -25,6 +25,7 @@ * @test * @bug 8026844 * @summary Test non constant subtractExact + * @library /testlibrary * @compile SubExactILoadTest.java Verify.java * @run main SubExactILoadTest * diff --git a/hotspot/test/compiler/intrinsics/mathexact/SubExactILoopDependentTest.java b/hotspot/test/compiler/intrinsics/mathexact/SubExactILoopDependentTest.java index 67ebcbca321..959bbb9eb92 100644 --- a/hotspot/test/compiler/intrinsics/mathexact/SubExactILoopDependentTest.java +++ b/hotspot/test/compiler/intrinsics/mathexact/SubExactILoopDependentTest.java @@ -1,5 +1,5 @@ /* - * Copyright (c) 2013, Oracle and/or its affiliates. All rights reserved. + * Copyright (c) 2013, 2014, Oracle and/or its affiliates. All rights reserved. * DO NOT ALTER OR REMOVE COPYRIGHT NOTICES OR THIS FILE HEADER. * * This code is free software; you can redistribute it and/or modify it @@ -25,6 +25,7 @@ * @test * @bug 8026844 * @summary Test non constant subtractExact + * @library /testlibrary * @compile SubExactILoopDependentTest.java Verify.java * @run main SubExactILoopDependentTest * diff --git a/hotspot/test/compiler/intrinsics/mathexact/SubExactINonConstantTest.java b/hotspot/test/compiler/intrinsics/mathexact/SubExactINonConstantTest.java index b8153810892..74f41f38a0e 100644 --- a/hotspot/test/compiler/intrinsics/mathexact/SubExactINonConstantTest.java +++ b/hotspot/test/compiler/intrinsics/mathexact/SubExactINonConstantTest.java @@ -1,5 +1,5 @@ /* - * Copyright (c) 2013, Oracle and/or its affiliates. All rights reserved. + * Copyright (c) 2013, 2014, Oracle and/or its affiliates. All rights reserved. * DO NOT ALTER OR REMOVE COPYRIGHT NOTICES OR THIS FILE HEADER. * * This code is free software; you can redistribute it and/or modify it @@ -25,6 +25,7 @@ * @test * @bug 8026844 * @summary Test non constant subtractExact + * @library /testlibrary * @compile SubExactINonConstantTest.java Verify.java * @run main SubExactINonConstantTest * diff --git a/hotspot/test/compiler/intrinsics/mathexact/SubExactIRepeatTest.java b/hotspot/test/compiler/intrinsics/mathexact/SubExactIRepeatTest.java index 3c57f6f3f76..a7494c77583 100644 --- a/hotspot/test/compiler/intrinsics/mathexact/SubExactIRepeatTest.java +++ b/hotspot/test/compiler/intrinsics/mathexact/SubExactIRepeatTest.java @@ -1,5 +1,5 @@ /* - * Copyright (c) 2013, Oracle and/or its affiliates. All rights reserved. + * Copyright (c) 2013, 2014, Oracle and/or its affiliates. All rights reserved. * DO NOT ALTER OR REMOVE COPYRIGHT NOTICES OR THIS FILE HEADER. * * This code is free software; you can redistribute it and/or modify it @@ -25,12 +25,14 @@ * @test * @bug 8026844 * @summary Test repeating subtractExact + * @library /testlibrary * @compile SubExactIRepeatTest.java Verify.java * @run main SubExactIRepeatTest * */ -import java.lang.ArithmeticException; +import com.oracle.java.testlibrary.Utils; +import java.util.Random; public class SubExactIRepeatTest { public static void main(String[] args) { @@ -46,7 +48,7 @@ public class SubExactIRepeatTest { } public static void runTest(Verify.BinaryMethod method) { - java.util.Random rnd = new java.util.Random(); + Random rnd = Utils.getRandomInstance(); for (int i = 0; i < 50000; ++i) { int x = Integer.MIN_VALUE + 10; int y = Integer.MAX_VALUE - 10 + rnd.nextInt(5); diff --git a/hotspot/test/compiler/intrinsics/mathexact/SubExactLConstantTest.java b/hotspot/test/compiler/intrinsics/mathexact/SubExactLConstantTest.java index ec554d7662b..67427615f29 100644 --- a/hotspot/test/compiler/intrinsics/mathexact/SubExactLConstantTest.java +++ b/hotspot/test/compiler/intrinsics/mathexact/SubExactLConstantTest.java @@ -1,5 +1,5 @@ /* - * Copyright (c) 2013, Oracle and/or its affiliates. All rights reserved. + * Copyright (c) 2013, 2014, Oracle and/or its affiliates. All rights reserved. * DO NOT ALTER OR REMOVE COPYRIGHT NOTICES OR THIS FILE HEADER. * * This code is free software; you can redistribute it and/or modify it @@ -26,6 +26,7 @@ * @bug 8026844 * @bug 8027353 * @summary Test constant subtractExact + * @library /testlibrary * @compile SubExactLConstantTest.java Verify.java * @run main SubExactLConstantTest * diff --git a/hotspot/test/compiler/intrinsics/mathexact/SubExactLNonConstantTest.java b/hotspot/test/compiler/intrinsics/mathexact/SubExactLNonConstantTest.java index 86ecf20f366..ec68f88e061 100644 --- a/hotspot/test/compiler/intrinsics/mathexact/SubExactLNonConstantTest.java +++ b/hotspot/test/compiler/intrinsics/mathexact/SubExactLNonConstantTest.java @@ -1,5 +1,5 @@ /* - * Copyright (c) 2013, Oracle and/or its affiliates. All rights reserved. + * Copyright (c) 2013, 2014, Oracle and/or its affiliates. All rights reserved. * DO NOT ALTER OR REMOVE COPYRIGHT NOTICES OR THIS FILE HEADER. * * This code is free software; you can redistribute it and/or modify it @@ -26,6 +26,7 @@ * @bug 8026844 * @bug 8027353 * @summary Test non constant subtractExact + * @library /testlibrary * @compile SubExactLNonConstantTest.java Verify.java * @run main SubExactLNonConstantTest * diff --git a/hotspot/test/compiler/intrinsics/mathexact/Verify.java b/hotspot/test/compiler/intrinsics/mathexact/Verify.java index 3936bf1b4f4..1f5871aff95 100644 --- a/hotspot/test/compiler/intrinsics/mathexact/Verify.java +++ b/hotspot/test/compiler/intrinsics/mathexact/Verify.java @@ -1,5 +1,5 @@ /* - * Copyright (c) 2013, Oracle and/or its affiliates. All rights reserved. + * Copyright (c) 2013, 2014, Oracle and/or its affiliates. All rights reserved. * DO NOT ALTER OR REMOVE COPYRIGHT NOTICES OR THIS FILE HEADER. * * This code is free software; you can redistribute it and/or modify it @@ -21,6 +21,13 @@ * questions. */ +import com.oracle.java.testlibrary.Utils; +import java.util.Random; + +/** + * The class depends on Utils class from testlibrary package. + * It uses factory method that obtains random generator. + */ public class Verify { public static String throwWord(boolean threw) { return (threw ? "threw" : "didn't throw"); @@ -134,7 +141,7 @@ public class Verify { public static class LoadTest { - public static java.util.Random rnd = new java.util.Random(); + public static Random rnd = Utils.getRandomInstance(); public static int[] values = new int[256]; public static void init() { @@ -159,7 +166,7 @@ public class Verify { } public static class NonConstantTest { - public static java.util.Random rnd = new java.util.Random(); + public static Random rnd = Utils.getRandomInstance(); public static int[] values = new int[] { Integer.MAX_VALUE, Integer.MIN_VALUE }; public static void verify(BinaryMethod method) { @@ -180,7 +187,7 @@ public class Verify { public static class NonConstantLongTest { public static long[] values = { Long.MIN_VALUE, Long.MAX_VALUE, 0, Long.MAX_VALUE - 1831 }; - public static java.util.Random rnd = new java.util.Random(); + public static Random rnd = Utils.getRandomInstance(); public static void verify(BinaryLongMethod method) { for (int i = 0; i < 50000; ++i) { @@ -199,7 +206,7 @@ public class Verify { } public static class LoopDependentTest { - public static java.util.Random rnd = new java.util.Random(); + public static Random rnd = Utils.getRandomInstance(); public static void verify(BinaryMethod method) { int rnd1 = rnd.nextInt(), rnd2 = rnd.nextInt(); diff --git a/hotspot/test/compiler/jsr292/ConcurrentClassLoadingTest.java b/hotspot/test/compiler/jsr292/ConcurrentClassLoadingTest.java index 06e900f077d..3aa6b061204 100644 --- a/hotspot/test/compiler/jsr292/ConcurrentClassLoadingTest.java +++ b/hotspot/test/compiler/jsr292/ConcurrentClassLoadingTest.java @@ -1,5 +1,5 @@ /* - * Copyright (c) 2013, Oracle and/or its affiliates. All rights reserved. + * Copyright (c) 2013, 2014, Oracle and/or its affiliates. All rights reserved. * DO NOT ALTER OR REMOVE COPYRIGHT NOTICES OR THIS FILE HEADER. * * This code is free software; you can redistribute it and/or modify it @@ -25,18 +25,21 @@ * @test * @bug 8022595 * @summary JSR292: deadlock during class loading of MethodHandles, MethodHandleImpl & MethodHandleNatives - * + * @library /testlibrary * @run main/othervm ConcurrentClassLoadingTest */ -import java.util.*; +import com.oracle.java.testlibrary.Utils; +import java.util.ArrayList; +import java.util.Arrays; +import java.util.List; +import java.util.Random; import java.util.concurrent.BrokenBarrierException; import java.util.concurrent.CyclicBarrier; public class ConcurrentClassLoadingTest { int numThreads = 0; - long seed = 0; CyclicBarrier l; - Random rand; + private static final Random rand = Utils.getRandomInstance(); public static void main(String[] args) throws Throwable { ConcurrentClassLoadingTest test = new ConcurrentClassLoadingTest(); @@ -49,9 +52,6 @@ public class ConcurrentClassLoadingTest { while (i < args.length) { String flag = args[i]; switch(flag) { - case "-seed": - seed = Long.parseLong(args[++i]); - break; case "-numThreads": numThreads = Integer.parseInt(args[++i]); break; @@ -67,15 +67,9 @@ public class ConcurrentClassLoadingTest { numThreads = Runtime.getRuntime().availableProcessors(); } - if (seed == 0) { - seed = (new Random()).nextLong(); - } - rand = new Random(seed); - l = new CyclicBarrier(numThreads + 1); System.out.printf("Threads: %d\n", numThreads); - System.out.printf("Seed: %d\n", seed); } final List loaders = new ArrayList<>(); @@ -90,7 +84,9 @@ public class ConcurrentClassLoadingTest { System.out.printf("Thread #%d:\n", t); for (int i = 0; i < count; i++) { - if (c.size() == 0) break; + if (c.isEmpty()) { + break; + } int k = rand.nextInt(c.size()); String elem = c.remove(k); diff --git a/hotspot/test/compiler/types/correctness/OffTest.java b/hotspot/test/compiler/types/correctness/OffTest.java index 04be21cd2ee..374db539b80 100644 --- a/hotspot/test/compiler/types/correctness/OffTest.java +++ b/hotspot/test/compiler/types/correctness/OffTest.java @@ -36,9 +36,9 @@ import com.oracle.java.testlibrary.OutputAnalyzer; import com.oracle.java.testlibrary.ProcessTools; -import scenarios.ProfilingType; - +import com.oracle.java.testlibrary.Utils; import java.util.Random; +import scenarios.ProfilingType; public class OffTest { private static final String[] OPTIONS = { @@ -63,14 +63,7 @@ public class OffTest { private static final int PROFILING_TYPE_INDEX = OPTIONS.length - 1; private static final int TYPE_PROFILE_INDEX = OPTIONS.length - 4; private static final int USE_TYPE_SPECULATION_INDEX = OPTIONS.length - 3; - private static final Random RNG; - - static { - String str = System.getProperty("seed"); - long seed = str != null ? Long.parseLong(str) : new Random().nextLong(); - RNG = new Random(seed); - System.out.printf("-Dseed=%d%n", seed); - } + private static final Random RNG = Utils.getRandomInstance(); public static void main(String[] args) throws Exception { int count = DEFAULT_COUNT; diff --git a/hotspot/test/compiler/unsafe/UnsafeRaw.java b/hotspot/test/compiler/unsafe/UnsafeRaw.java index 5d172a5f4a9..f2a19ff06af 100644 --- a/hotspot/test/compiler/unsafe/UnsafeRaw.java +++ b/hotspot/test/compiler/unsafe/UnsafeRaw.java @@ -80,7 +80,7 @@ public class UnsafeRaw { final int element_size = 4; final int magic = 0x12345678; - Random rnd = new Random(); + Random rnd = Utils.getRandomInstance(); long array = unsafe.allocateMemory(array_size * element_size); // 128 ints long addr = array + array_size * element_size / 2; // something in the middle to work with diff --git a/hotspot/test/serviceability/threads/TestFalseDeadLock.java b/hotspot/test/serviceability/threads/TestFalseDeadLock.java index 7ee0fe1116f..30d6e9735c5 100644 --- a/hotspot/test/serviceability/threads/TestFalseDeadLock.java +++ b/hotspot/test/serviceability/threads/TestFalseDeadLock.java @@ -1,5 +1,5 @@ /* - * Copyright (c) 2013, Oracle and/or its affiliates. All rights reserved. + * Copyright (c) 2013, 2014, Oracle and/or its affiliates. All rights reserved. * DO NOT ALTER OR REMOVE COPYRIGHT NOTICES OR THIS FILE HEADER. * * This code is free software; you can redistribute it and/or modify it @@ -21,6 +21,7 @@ * questions. */ +import com.oracle.java.testlibrary.Utils; import java.lang.management.ManagementFactory; import java.lang.management.ThreadMXBean; import java.util.Random; @@ -29,6 +30,7 @@ import java.util.Random; * @test * @bug 8016304 * @summary Make sure no deadlock is reported for this program which has no deadlocks. + * @library /testlibrary * @run main/othervm TestFalseDeadLock */ @@ -65,7 +67,7 @@ public class TestFalseDeadLock { public static class Test implements Runnable { public void run() { - Random r = new Random(); + Random r = Utils.getRandomInstance(); while (running) { try { synchronized (this) { diff --git a/hotspot/test/testlibrary/com/oracle/java/testlibrary/Utils.java b/hotspot/test/testlibrary/com/oracle/java/testlibrary/Utils.java index ba4bea5e937..8ad6155eeb9 100644 --- a/hotspot/test/testlibrary/com/oracle/java/testlibrary/Utils.java +++ b/hotspot/test/testlibrary/com/oracle/java/testlibrary/Utils.java @@ -24,21 +24,21 @@ package com.oracle.java.testlibrary; import static com.oracle.java.testlibrary.Asserts.assertTrue; - import java.io.BufferedReader; import java.io.File; import java.io.FileReader; import java.io.IOException; +import java.lang.reflect.Field; import java.net.InetAddress; import java.net.ServerSocket; import java.net.UnknownHostException; import java.util.ArrayList; -import java.util.List; import java.util.Arrays; import java.util.Collections; -import java.util.regex.Pattern; +import java.util.List; +import java.util.Random; import java.util.regex.Matcher; -import java.lang.reflect.Field; +import java.util.regex.Pattern; import sun.misc.Unsafe; /** @@ -63,6 +63,21 @@ public final class Utils { private static Unsafe unsafe = null; + /** + * Defines property name for seed value. + */ + public static final String SEED_PROPERTY_NAME = "com.oracle.java.testlibrary.random.seed"; + + /* (non-javadoc) + * Random generator with (or without) predefined seed. Depends on + * "com.oracle.java.testlibrary.random.seed" property value. + */ + private static volatile Random RANDOM_GENERATOR; + + /** + * Contains the seed value used for {@link java.util.Random} creation. + */ + public static final long SEED = Long.getLong(SEED_PROPERTY_NAME, new Random().nextLong()); /** * Returns the value of 'test.timeout.factor' system property * converted to {@code double}. @@ -332,4 +347,24 @@ public final class Utils { } return new String(hexView); } + + /** + * Returns {@link java.util.Random} generator initialized with particular seed. + * The seed could be provided via system property {@link Utils#SEED_PROPERTY_NAME} + * In case no seed is provided, the method uses a random number. + * The used seed printed to stdout. + * @return {@link java.util.Random} generator with particular seed. + */ + public static Random getRandomInstance() { + if (RANDOM_GENERATOR == null) { + synchronized (Utils.class) { + if (RANDOM_GENERATOR == null) { + RANDOM_GENERATOR = new Random(SEED); + System.out.printf("For random generator using seed: %d%n", SEED); + System.out.printf("To re-run test with same seed value please add \"-D%s=%d\" to command line.%n", SEED_PROPERTY_NAME, SEED); + } + } + } + return RANDOM_GENERATOR; + } } diff --git a/hotspot/test/testlibrary_tests/RandomGeneratorTest.java b/hotspot/test/testlibrary_tests/RandomGeneratorTest.java new file mode 100644 index 00000000000..ff00999e9b9 --- /dev/null +++ b/hotspot/test/testlibrary_tests/RandomGeneratorTest.java @@ -0,0 +1,154 @@ +/* + * Copyright (c) 2014, Oracle and/or its affiliates. All rights reserved. + * DO NOT ALTER OR REMOVE COPYRIGHT NOTICES OR THIS FILE HEADER. + * + * This code is free software; you can redistribute it and/or modify it + * under the terms of the GNU General Public License version 2 only, as + * published by the Free Software Foundation. + * + * This code is distributed in the hope that it will be useful, but WITHOUT + * ANY WARRANTY; without even the implied warranty of MERCHANTABILITY or + * FITNESS FOR A PARTICULAR PURPOSE. See the GNU General Public License + * version 2 for more details (a copy is included in the LICENSE file that + * accompanied this code). + * + * You should have received a copy of the GNU General Public License version + * 2 along with this work; if not, write to the Free Software Foundation, + * Inc., 51 Franklin St, Fifth Floor, Boston, MA 02110-1301 USA. + * + * Please contact Oracle, 500 Oracle Parkway, Redwood Shores, CA 94065 USA + * or visit www.oracle.com if you need additional information or have any + * questions. + */ + +/* + * @test + * @summary Verify correctnes of the random generator from Utility.java + * @library /testlibrary + * @run driver RandomGeneratorTest SAME_SEED + * @run driver RandomGeneratorTest NO_SEED + * @run driver RandomGeneratorTest DIFFERENT_SEED + */ + +import com.oracle.java.testlibrary.ProcessTools; +import com.oracle.java.testlibrary.Utils; +import java.util.ArrayList; +import java.util.List; +import java.util.Random; + +/** + * The test verifies correctness of work {@link com.oracle.java.testlibrary.Utils#getRandomInstance()}. + * Test works in three modes: same seed provided, no seed provided and + * different seed provided. In the first case the test expects that all random numbers + * will be repeated in all next iterations. For other two modes test expects that + * randomly generated numbers differ from original. + */ +public class RandomGeneratorTest { + private static final String SEED_VM_OPTION = "-D" + Utils.SEED_PROPERTY_NAME + "="; + + public static void main( String[] args) throws Throwable { + if (args.length == 0) { + throw new Error("TESTBUG: No test mode provided."); + } + SeedOption seedOpt = SeedOption.valueOf(args[0]); + List jvmArgs = new ArrayList(); + String optStr = seedOpt.getSeedOption(); + if (optStr != null) { + jvmArgs.add(optStr); + } + jvmArgs.add(RandomRunner.class.getName()); + String[] cmdLineArgs = jvmArgs.toArray(new String[jvmArgs.size()]); + String etalon = ProcessTools.executeTestJvm(cmdLineArgs).getOutput().trim(); + seedOpt.verify(etalon, cmdLineArgs); + } + + /** + * The utility enum helps to generate an appropriate string that should be passed + * to the command line depends on the testing mode. It is also responsible for the result + * validation. + */ + private enum SeedOption { + SAME_SEED { + @Override + public String getSeedOption() { + return SEED_VM_OPTION + Utils.SEED; + } + + @Override + protected boolean isOutputExpected(String orig, String output) { + return output.equals(orig); + } + }, + DIFFERENT_SEED { + @Override + public String getSeedOption() { + return SEED_VM_OPTION + Utils.getRandomInstance().nextLong(); + } + + @Override + public void verify(String orig, String[] cmdLine) { + cmdLine[0] = getSeedOption(); + super.verify(orig, cmdLine); + } + }, + NO_SEED { + @Override + public String getSeedOption() { + return null; + } + }; + + /** + * Generates a string to be added as a command line argument. + * It contains "-D" prefix, system property name, '=' sign + * and seed value. + * @return command line argument + */ + public abstract String getSeedOption(); + + protected boolean isOutputExpected(String orig, String output) { + return !output.equals(orig); + } + + /** + * Verifies that the original output meets expectations + * depending on the test mode. It compares the output of second execution + * to original one. + * @param orig original output + * @param cmdLine command line arguments + * @throws Throwable - Throws an exception in case test failure. + */ + public void verify(String orig, String[] cmdLine) { + String lastLineOrig = getLastLine(orig); + String lastLine; + try { + lastLine = getLastLine(ProcessTools.executeTestJvm(cmdLine).getOutput().trim()); + } catch (Throwable t) { + throw new Error("TESTBUG: Unexpedted exception during jvm execution.", t); + } + if (!isOutputExpected(lastLineOrig, lastLine)) { + throw new AssertionError("Unexpected random number sequence for mode: " + this.name()); + } + } + + private static String getLastLine(String output) { + return output.substring(output.lastIndexOf(Utils.NEW_LINE)).trim(); + } + } + + /** + * The helper class generates several random numbers + * and prints them out. + */ + public static class RandomRunner { + private static final int COUNT = 10; + public static void main(String[] args) { + StringBuilder sb = new StringBuilder(); + Random rng = Utils.getRandomInstance(); + for (int i = 0; i < COUNT; i++) { + sb.append(rng.nextLong()).append(' '); + } + System.out.println(sb.toString()); + } + } +} From 8cd1a874e89d73f30841a9d6d152e9392f3d71d0 Mon Sep 17 00:00:00 2001 From: Vladimir Kozlov Date: Mon, 3 Nov 2014 12:02:40 -0800 Subject: [PATCH 25/61] 8059780: SPECjvm2008-MPEG performance regressions on x64 platforms Back-out 8052081 changes made in lcm.cpp. Reviewed-by: iveresov, roland --- hotspot/src/share/vm/opto/lcm.cpp | 8 ++------ 1 file changed, 2 insertions(+), 6 deletions(-) diff --git a/hotspot/src/share/vm/opto/lcm.cpp b/hotspot/src/share/vm/opto/lcm.cpp index 187d2699768..a601752d4cd 100644 --- a/hotspot/src/share/vm/opto/lcm.cpp +++ b/hotspot/src/share/vm/opto/lcm.cpp @@ -464,9 +464,7 @@ Node* PhaseCFG::select(Block* block, Node_List &worklist, GrowableArray &re iop == Op_CreateEx || // Create-exception must start block iop == Op_CheckCastPP ) { - // select the node n - // remove n from worklist and retain the order of remaining nodes - worklist.remove((uint)i); + worklist.map(i,worklist.pop()); return n; } @@ -552,9 +550,7 @@ Node* PhaseCFG::select(Block* block, Node_List &worklist, GrowableArray &re assert(idx >= 0, "index should be set"); Node *n = worklist[(uint)idx]; // Get the winner - // select the node n - // remove n from worklist and retain the order of remaining nodes - worklist.remove((uint)idx); + worklist.map((uint)idx, worklist.pop()); // Compress worklist return n; } From 79738069b0d5bc58d62aa6cfff066936424b064e Mon Sep 17 00:00:00 2001 From: Roland Westrelin Date: Mon, 20 Oct 2014 22:53:37 +0200 Subject: [PATCH 26/61] 8060252: JDK-7173584 compiler changes regress SPECjvm2008 on SPARC Arraycopy code misses opportunities to optimize copies to just allocated array. Reviewed-by: kvn --- hotspot/src/share/vm/opto/library_call.cpp | 5 ++++- 1 file changed, 4 insertions(+), 1 deletion(-) diff --git a/hotspot/src/share/vm/opto/library_call.cpp b/hotspot/src/share/vm/opto/library_call.cpp index 91d82d30f5f..10c857ca0dd 100644 --- a/hotspot/src/share/vm/opto/library_call.cpp +++ b/hotspot/src/share/vm/opto/library_call.cpp @@ -4697,6 +4697,10 @@ bool LibraryCallKit::inline_arraycopy() { Node* dest_offset = argument(3); // type: int Node* length = argument(4); // type: int + // Check for allocation before we add nodes that would confuse + // tightly_coupled_allocation() + AllocateArrayNode* alloc = tightly_coupled_allocation(dest, NULL); + // The following tests must be performed // (1) src and dest are arrays. // (2) src and dest arrays must have elements of the same BasicType @@ -4870,7 +4874,6 @@ bool LibraryCallKit::inline_arraycopy() { return true; } - AllocateArrayNode* alloc = tightly_coupled_allocation(dest, NULL); ArrayCopyNode* ac = ArrayCopyNode::make(this, true, src, src_offset, dest, dest_offset, length, alloc != NULL, // Create LoadRange and LoadKlass nodes for use during macro expansion here // so the compiler has a chance to eliminate them: during macro expansion, From 209ffcd9a5eb7c2c21174967de14b1d791ad361d Mon Sep 17 00:00:00 2001 From: Frederic Parain Date: Wed, 22 Oct 2014 02:31:25 -0700 Subject: [PATCH 27/61] 8061618: Removed unused networking functions from os class Reviewed-by: lfoltan, hseigel, dholmes --- hotspot/src/os/aix/vm/os_aix.cpp | 9 --- hotspot/src/os/aix/vm/os_aix.inline.hpp | 78 ------------------- hotspot/src/os/bsd/vm/os_bsd.cpp | 15 ---- hotspot/src/os/bsd/vm/os_bsd.inline.hpp | 77 ------------------ hotspot/src/os/linux/vm/os_linux.cpp | 9 --- hotspot/src/os/linux/vm/os_linux.inline.hpp | 78 ------------------- hotspot/src/os/solaris/vm/os_solaris.cpp | 71 ----------------- .../src/os/solaris/vm/os_solaris.inline.hpp | 28 ------- hotspot/src/os/windows/vm/os_windows.cpp | 64 --------------- hotspot/src/share/vm/runtime/os.hpp | 18 ----- 10 files changed, 447 deletions(-) diff --git a/hotspot/src/os/aix/vm/os_aix.cpp b/hotspot/src/os/aix/vm/os_aix.cpp index bec34838920..fc873a11eed 100644 --- a/hotspot/src/os/aix/vm/os_aix.cpp +++ b/hotspot/src/os/aix/vm/os_aix.cpp @@ -4137,15 +4137,6 @@ int os::available(int fd, jlong *bytes) { return 1; } -int os::socket_available(int fd, jint *pbytes) { - // Linux doc says EINTR not returned, unlike Solaris - int ret = ::ioctl(fd, FIONREAD, pbytes); - - //%% note ioctl can return 0 when successful, JVM_SocketAvailable - // is expected to return 0 on failure and 1 on success to the jdk. - return (ret < 0) ? 0 : 1; -} - // Map a block of memory. char* os::pd_map_memory(int fd, const char* file_name, size_t file_offset, char *addr, size_t bytes, bool read_only, diff --git a/hotspot/src/os/aix/vm/os_aix.inline.hpp b/hotspot/src/os/aix/vm/os_aix.inline.hpp index bb3232bfbc7..5602342b4ff 100644 --- a/hotspot/src/os/aix/vm/os_aix.inline.hpp +++ b/hotspot/src/os/aix/vm/os_aix.inline.hpp @@ -178,92 +178,14 @@ inline int os::raw_send(int fd, char* buf, size_t nBytes, uint flags) { return os::send(fd, buf, nBytes, flags); } -inline int os::timeout(int fd, long timeout) { - julong prevtime,newtime; - struct timeval t; - - gettimeofday(&t, NULL); - prevtime = ((julong)t.tv_sec * 1000) + t.tv_usec / 1000; - - for(;;) { - struct pollfd pfd; - - pfd.fd = fd; - pfd.events = POLLIN | POLLERR; - - int res = ::poll(&pfd, 1, timeout); - - if (res == OS_ERR && errno == EINTR) { - - // On Linux any value < 0 means "forever" - - if(timeout >= 0) { - gettimeofday(&t, NULL); - newtime = ((julong)t.tv_sec * 1000) + t.tv_usec / 1000; - timeout -= newtime - prevtime; - if(timeout <= 0) - return OS_OK; - prevtime = newtime; - } - } else - return res; - } -} - -inline int os::listen(int fd, int count) { - return ::listen(fd, count); -} - inline int os::connect(int fd, struct sockaddr* him, socklen_t len) { RESTARTABLE_RETURN_INT(::connect(fd, him, len)); } -inline int os::accept(int fd, struct sockaddr* him, socklen_t* len) { - // Linux doc says this can't return EINTR, unlike accept() on Solaris. - // But see attachListener_linux.cpp, LinuxAttachListener::dequeue(). - return (int)::accept(fd, him, len); -} - -inline int os::recvfrom(int fd, char* buf, size_t nBytes, uint flags, - sockaddr* from, socklen_t* fromlen) { - RESTARTABLE_RETURN_INT((int)::recvfrom(fd, buf, nBytes, flags, from, fromlen)); -} - -inline int os::sendto(int fd, char* buf, size_t len, uint flags, - struct sockaddr* to, socklen_t tolen) { - RESTARTABLE_RETURN_INT((int)::sendto(fd, buf, len, flags, to, tolen)); -} - -inline int os::socket_shutdown(int fd, int howto) { - return ::shutdown(fd, howto); -} - -inline int os::bind(int fd, struct sockaddr* him, socklen_t len) { - return ::bind(fd, him, len); -} - -inline int os::get_sock_name(int fd, struct sockaddr* him, socklen_t* len) { - return ::getsockname(fd, him, len); -} - -inline int os::get_host_name(char* name, int namelen) { - return ::gethostname(name, namelen); -} - inline struct hostent* os::get_host_by_name(char* name) { return ::gethostbyname(name); } -inline int os::get_sock_opt(int fd, int level, int optname, - char* optval, socklen_t* optlen) { - return ::getsockopt(fd, level, optname, optval, optlen); -} - -inline int os::set_sock_opt(int fd, int level, int optname, - const char* optval, socklen_t optlen) { - return ::setsockopt(fd, level, optname, optval, optlen); -} - inline bool os::supports_monotonic_clock() { // mread_real_time() is monotonic on AIX (see os::javaTimeNanos() comments) return true; diff --git a/hotspot/src/os/bsd/vm/os_bsd.cpp b/hotspot/src/os/bsd/vm/os_bsd.cpp index 95e026651ac..0d8ba0a2367 100644 --- a/hotspot/src/os/bsd/vm/os_bsd.cpp +++ b/hotspot/src/os/bsd/vm/os_bsd.cpp @@ -3958,21 +3958,6 @@ int os::available(int fd, jlong *bytes) { return 1; } -int os::socket_available(int fd, jint *pbytes) { - if (fd < 0) { - return OS_OK; - } - - int ret; - - RESTARTABLE(::ioctl(fd, FIONREAD, pbytes), ret); - - //%% note ioctl can return 0 when successful, JVM_SocketAvailable - // is expected to return 0 on failure and 1 on success to the jdk. - - return (ret == OS_ERR) ? 0 : 1; -} - // Map a block of memory. char* os::pd_map_memory(int fd, const char* file_name, size_t file_offset, char *addr, size_t bytes, bool read_only, diff --git a/hotspot/src/os/bsd/vm/os_bsd.inline.hpp b/hotspot/src/os/bsd/vm/os_bsd.inline.hpp index 1eafb9c76e9..3afb5c21a83 100644 --- a/hotspot/src/os/bsd/vm/os_bsd.inline.hpp +++ b/hotspot/src/os/bsd/vm/os_bsd.inline.hpp @@ -181,91 +181,14 @@ inline int os::raw_send(int fd, char* buf, size_t nBytes, uint flags) { return os::send(fd, buf, nBytes, flags); } -inline int os::timeout(int fd, long timeout) { - julong prevtime,newtime; - struct timeval t; - - gettimeofday(&t, NULL); - prevtime = ((julong)t.tv_sec * 1000) + t.tv_usec / 1000; - - for(;;) { - struct pollfd pfd; - - pfd.fd = fd; - pfd.events = POLLIN | POLLERR; - - int res = ::poll(&pfd, 1, timeout); - - if (res == OS_ERR && errno == EINTR) { - - // On Bsd any value < 0 means "forever" - - if(timeout >= 0) { - gettimeofday(&t, NULL); - newtime = ((julong)t.tv_sec * 1000) + t.tv_usec / 1000; - timeout -= newtime - prevtime; - if(timeout <= 0) - return OS_OK; - prevtime = newtime; - } - } else - return res; - } -} - -inline int os::listen(int fd, int count) { - return ::listen(fd, count); -} - inline int os::connect(int fd, struct sockaddr* him, socklen_t len) { RESTARTABLE_RETURN_INT(::connect(fd, him, len)); } -inline int os::accept(int fd, struct sockaddr* him, socklen_t* len) { - // At least OpenBSD and FreeBSD can return EINTR from accept. - RESTARTABLE_RETURN_INT(::accept(fd, him, len)); -} - -inline int os::recvfrom(int fd, char* buf, size_t nBytes, uint flags, - sockaddr* from, socklen_t* fromlen) { - RESTARTABLE_RETURN_INT((int)::recvfrom(fd, buf, nBytes, flags, from, fromlen)); -} - -inline int os::sendto(int fd, char* buf, size_t len, uint flags, - struct sockaddr *to, socklen_t tolen) { - RESTARTABLE_RETURN_INT((int)::sendto(fd, buf, len, flags, to, tolen)); -} - -inline int os::socket_shutdown(int fd, int howto) { - return ::shutdown(fd, howto); -} - -inline int os::bind(int fd, struct sockaddr* him, socklen_t len) { - return ::bind(fd, him, len); -} - -inline int os::get_sock_name(int fd, struct sockaddr* him, socklen_t* len) { - return ::getsockname(fd, him, len); -} - -inline int os::get_host_name(char* name, int namelen) { - return ::gethostname(name, namelen); -} - inline struct hostent* os::get_host_by_name(char* name) { return ::gethostbyname(name); } -inline int os::get_sock_opt(int fd, int level, int optname, - char *optval, socklen_t* optlen) { - return ::getsockopt(fd, level, optname, optval, optlen); -} - -inline int os::set_sock_opt(int fd, int level, int optname, - const char* optval, socklen_t optlen) { - return ::setsockopt(fd, level, optname, optval, optlen); -} - inline bool os::supports_monotonic_clock() { #ifdef __APPLE__ return true; diff --git a/hotspot/src/os/linux/vm/os_linux.cpp b/hotspot/src/os/linux/vm/os_linux.cpp index 3d82d976f37..3e5dc4066d5 100644 --- a/hotspot/src/os/linux/vm/os_linux.cpp +++ b/hotspot/src/os/linux/vm/os_linux.cpp @@ -5211,15 +5211,6 @@ int os::available(int fd, jlong *bytes) { return 1; } -int os::socket_available(int fd, jint *pbytes) { - // Linux doc says EINTR not returned, unlike Solaris - int ret = ::ioctl(fd, FIONREAD, pbytes); - - //%% note ioctl can return 0 when successful, JVM_SocketAvailable - // is expected to return 0 on failure and 1 on success to the jdk. - return (ret < 0) ? 0 : 1; -} - // Map a block of memory. char* os::pd_map_memory(int fd, const char* file_name, size_t file_offset, char *addr, size_t bytes, bool read_only, diff --git a/hotspot/src/os/linux/vm/os_linux.inline.hpp b/hotspot/src/os/linux/vm/os_linux.inline.hpp index d83fb5b7930..ba4b777d520 100644 --- a/hotspot/src/os/linux/vm/os_linux.inline.hpp +++ b/hotspot/src/os/linux/vm/os_linux.inline.hpp @@ -173,92 +173,14 @@ inline int os::raw_send(int fd, char* buf, size_t nBytes, uint flags) { return os::send(fd, buf, nBytes, flags); } -inline int os::timeout(int fd, long timeout) { - julong prevtime,newtime; - struct timeval t; - - gettimeofday(&t, NULL); - prevtime = ((julong)t.tv_sec * 1000) + t.tv_usec / 1000; - - for(;;) { - struct pollfd pfd; - - pfd.fd = fd; - pfd.events = POLLIN | POLLERR; - - int res = ::poll(&pfd, 1, timeout); - - if (res == OS_ERR && errno == EINTR) { - - // On Linux any value < 0 means "forever" - - if(timeout >= 0) { - gettimeofday(&t, NULL); - newtime = ((julong)t.tv_sec * 1000) + t.tv_usec / 1000; - timeout -= newtime - prevtime; - if(timeout <= 0) - return OS_OK; - prevtime = newtime; - } - } else - return res; - } -} - -inline int os::listen(int fd, int count) { - return ::listen(fd, count); -} - inline int os::connect(int fd, struct sockaddr* him, socklen_t len) { RESTARTABLE_RETURN_INT(::connect(fd, him, len)); } -inline int os::accept(int fd, struct sockaddr* him, socklen_t* len) { - // Linux doc says this can't return EINTR, unlike accept() on Solaris. - // But see attachListener_linux.cpp, LinuxAttachListener::dequeue(). - return (int)::accept(fd, him, len); -} - -inline int os::recvfrom(int fd, char* buf, size_t nBytes, uint flags, - sockaddr* from, socklen_t* fromlen) { - RESTARTABLE_RETURN_INT((int)::recvfrom(fd, buf, nBytes, flags, from, fromlen)); -} - -inline int os::sendto(int fd, char* buf, size_t len, uint flags, - struct sockaddr* to, socklen_t tolen) { - RESTARTABLE_RETURN_INT((int)::sendto(fd, buf, len, flags, to, tolen)); -} - -inline int os::socket_shutdown(int fd, int howto) { - return ::shutdown(fd, howto); -} - -inline int os::bind(int fd, struct sockaddr* him, socklen_t len) { - return ::bind(fd, him, len); -} - -inline int os::get_sock_name(int fd, struct sockaddr* him, socklen_t* len) { - return ::getsockname(fd, him, len); -} - -inline int os::get_host_name(char* name, int namelen) { - return ::gethostname(name, namelen); -} - inline struct hostent* os::get_host_by_name(char* name) { return ::gethostbyname(name); } -inline int os::get_sock_opt(int fd, int level, int optname, - char* optval, socklen_t* optlen) { - return ::getsockopt(fd, level, optname, optval, optlen); -} - -inline int os::set_sock_opt(int fd, int level, int optname, - const char* optval, socklen_t optlen) { - return ::setsockopt(fd, level, optname, optval, optlen); -} - inline bool os::supports_monotonic_clock() { return Linux::_clock_gettime != NULL; } diff --git a/hotspot/src/os/solaris/vm/os_solaris.cpp b/hotspot/src/os/solaris/vm/os_solaris.cpp index 109bf44bdc0..dddb4e7e567 100644 --- a/hotspot/src/os/solaris/vm/os_solaris.cpp +++ b/hotspot/src/os/solaris/vm/os_solaris.cpp @@ -5912,37 +5912,6 @@ int os::raw_send(int fd, char* buf, size_t nBytes, uint flags) { // a poll() is done with timeout == -1, in which case we repeat with this // "wait forever" value. -int os::timeout(int fd, long timeout) { - int res; - struct timeval t; - julong prevtime, newtime; - static const char* aNull = 0; - struct pollfd pfd; - pfd.fd = fd; - pfd.events = POLLIN; - - assert(((JavaThread*)Thread::current())->thread_state() == _thread_in_native, - "Assumed _thread_in_native"); - - gettimeofday(&t, &aNull); - prevtime = ((julong)t.tv_sec * 1000) + t.tv_usec / 1000; - - for (;;) { - res = ::poll(&pfd, 1, timeout); - if (res == OS_ERR && errno == EINTR) { - if (timeout != -1) { - gettimeofday(&t, &aNull); - newtime = ((julong)t.tv_sec * 1000) + t.tv_usec /1000; - timeout -= newtime - prevtime; - if (timeout <= 0) { - return OS_OK; - } - prevtime = newtime; - } - } else return res; - } -} - int os::connect(int fd, struct sockaddr *him, socklen_t len) { int _result; _result = ::connect(fd, him, len); @@ -5982,46 +5951,6 @@ int os::connect(int fd, struct sockaddr *him, socklen_t len) { return _result; } -int os::accept(int fd, struct sockaddr* him, socklen_t* len) { - if (fd < 0) { - return OS_ERR; - } - assert(((JavaThread*)Thread::current())->thread_state() == _thread_in_native, - "Assumed _thread_in_native"); - RESTARTABLE_RETURN_INT((int)::accept(fd, him, len)); -} - -int os::recvfrom(int fd, char* buf, size_t nBytes, uint flags, - sockaddr* from, socklen_t* fromlen) { - assert(((JavaThread*)Thread::current())->thread_state() == _thread_in_native, - "Assumed _thread_in_native"); - RESTARTABLE_RETURN_INT((int)::recvfrom(fd, buf, nBytes, flags, from, fromlen)); -} - -int os::sendto(int fd, char* buf, size_t len, uint flags, - struct sockaddr* to, socklen_t tolen) { - assert(((JavaThread*)Thread::current())->thread_state() == _thread_in_native, - "Assumed _thread_in_native"); - RESTARTABLE_RETURN_INT((int)::sendto(fd, buf, len, flags, to, tolen)); -} - -int os::socket_available(int fd, jint *pbytes) { - if (fd < 0) { - return OS_OK; - } - int ret; - RESTARTABLE(::ioctl(fd, FIONREAD, pbytes), ret); - // note: ioctl can return 0 when successful, JVM_SocketAvailable - // is expected to return 0 on failure and 1 on success to the jdk. - return (ret == OS_ERR) ? 0 : 1; -} - -int os::bind(int fd, struct sockaddr* him, socklen_t len) { - assert(((JavaThread*)Thread::current())->thread_state() == _thread_in_native, - "Assumed _thread_in_native"); - return ::bind(fd, him, len); -} - // Get the default path to the core file // Returns the length of the string int os::get_core_path(char* buffer, size_t bufferSize) { diff --git a/hotspot/src/os/solaris/vm/os_solaris.inline.hpp b/hotspot/src/os/solaris/vm/os_solaris.inline.hpp index 7609abac014..3456414f048 100644 --- a/hotspot/src/os/solaris/vm/os_solaris.inline.hpp +++ b/hotspot/src/os/solaris/vm/os_solaris.inline.hpp @@ -120,38 +120,10 @@ inline int os::socket(int domain, int type, int protocol) { return ::socket(domain, type, protocol); } -inline int os::listen(int fd, int count) { - if (fd < 0) return OS_ERR; - - return ::listen(fd, count); -} - -inline int os::socket_shutdown(int fd, int howto){ - return ::shutdown(fd, howto); -} - -inline int os::get_sock_name(int fd, struct sockaddr* him, socklen_t* len){ - return ::getsockname(fd, him, len); -} - -inline int os::get_host_name(char* name, int namelen){ - return ::gethostname(name, namelen); -} - inline struct hostent* os::get_host_by_name(char* name) { return ::gethostbyname(name); } -inline int os::get_sock_opt(int fd, int level, int optname, - char* optval, socklen_t* optlen) { - return ::getsockopt(fd, level, optname, optval, optlen); -} - -inline int os::set_sock_opt(int fd, int level, int optname, - const char *optval, socklen_t optlen) { - return ::setsockopt(fd, level, optname, optval, optlen); -} - inline bool os::supports_monotonic_clock() { // javaTimeNanos() is monotonic on Solaris, see getTimeNanos() comments return true; diff --git a/hotspot/src/os/windows/vm/os_windows.cpp b/hotspot/src/os/windows/vm/os_windows.cpp index 2bde459105b..cc3f8f75832 100644 --- a/hotspot/src/os/windows/vm/os_windows.cpp +++ b/hotspot/src/os/windows/vm/os_windows.cpp @@ -5091,39 +5091,14 @@ int os::socket_close(int fd) { return ::closesocket(fd); } -int os::socket_available(int fd, jint *pbytes) { - int ret = ::ioctlsocket(fd, FIONREAD, (u_long*)pbytes); - return (ret < 0) ? 0 : 1; -} - int os::socket(int domain, int type, int protocol) { return ::socket(domain, type, protocol); } -int os::listen(int fd, int count) { - return ::listen(fd, count); -} - int os::connect(int fd, struct sockaddr* him, socklen_t len) { return ::connect(fd, him, len); } -int os::accept(int fd, struct sockaddr* him, socklen_t* len) { - return ::accept(fd, him, len); -} - -int os::sendto(int fd, char* buf, size_t len, uint flags, - struct sockaddr* to, socklen_t tolen) { - - return ::sendto(fd, buf, (int)len, flags, to, tolen); -} - -int os::recvfrom(int fd, char *buf, size_t nBytes, uint flags, - sockaddr* from, socklen_t* fromlen) { - - return ::recvfrom(fd, buf, (int)nBytes, flags, from, fromlen); -} - int os::recv(int fd, char* buf, size_t nBytes, uint flags) { return ::recv(fd, buf, (int)nBytes, flags); } @@ -5136,45 +5111,6 @@ int os::raw_send(int fd, char* buf, size_t nBytes, uint flags) { return ::send(fd, buf, (int)nBytes, flags); } -int os::timeout(int fd, long timeout) { - fd_set tbl; - struct timeval t; - - t.tv_sec = timeout / 1000; - t.tv_usec = (timeout % 1000) * 1000; - - tbl.fd_count = 1; - tbl.fd_array[0] = fd; - - return ::select(1, &tbl, 0, 0, &t); -} - -int os::get_host_name(char* name, int namelen) { - return ::gethostname(name, namelen); -} - -int os::socket_shutdown(int fd, int howto) { - return ::shutdown(fd, howto); -} - -int os::bind(int fd, struct sockaddr* him, socklen_t len) { - return ::bind(fd, him, len); -} - -int os::get_sock_name(int fd, struct sockaddr* him, socklen_t* len) { - return ::getsockname(fd, him, len); -} - -int os::get_sock_opt(int fd, int level, int optname, - char* optval, socklen_t* optlen) { - return ::getsockopt(fd, level, optname, optval, optlen); -} - -int os::set_sock_opt(int fd, int level, int optname, - const char* optval, socklen_t optlen) { - return ::setsockopt(fd, level, optname, optval, optlen); -} - // WINDOWS CONTEXT Flags for THREAD_SAMPLING #if defined(IA32) #define sampling_context_flags (CONTEXT_FULL | CONTEXT_FLOATING_POINT | CONTEXT_EXTENDED_REGISTERS) diff --git a/hotspot/src/share/vm/runtime/os.hpp b/hotspot/src/share/vm/runtime/os.hpp index d2e78b43a4c..009e2f18c97 100644 --- a/hotspot/src/share/vm/runtime/os.hpp +++ b/hotspot/src/share/vm/runtime/os.hpp @@ -680,28 +680,10 @@ class os: AllStatic { // SocketInterface (ex HPI SocketInterface ) static int socket(int domain, int type, int protocol); static int socket_close(int fd); - static int socket_shutdown(int fd, int howto); static int recv(int fd, char* buf, size_t nBytes, uint flags); static int send(int fd, char* buf, size_t nBytes, uint flags); static int raw_send(int fd, char* buf, size_t nBytes, uint flags); - static int timeout(int fd, long timeout); - static int listen(int fd, int count); static int connect(int fd, struct sockaddr* him, socklen_t len); - static int bind(int fd, struct sockaddr* him, socklen_t len); - static int accept(int fd, struct sockaddr* him, socklen_t* len); - static int recvfrom(int fd, char* buf, size_t nbytes, uint flags, - struct sockaddr* from, socklen_t* fromlen); - static int get_sock_name(int fd, struct sockaddr* him, socklen_t* len); - static int sendto(int fd, char* buf, size_t len, uint flags, - struct sockaddr* to, socklen_t tolen); - static int socket_available(int fd, jint* pbytes); - - static int get_sock_opt(int fd, int level, int optname, - char* optval, socklen_t* optlen); - static int set_sock_opt(int fd, int level, int optname, - const char* optval, socklen_t optlen); - static int get_host_name(char* name, int namelen); - static struct hostent* get_host_by_name(char* name); // Support for signals (see JVM_RaiseSignal, JVM_RegisterSignal) From ea48bceb5e72162e695c15914dce027ae9a43a1f Mon Sep 17 00:00:00 2001 From: Andreas Eriksson Date: Wed, 22 Oct 2014 13:59:56 +0200 Subject: [PATCH 28/61] 8057043: Type annotations not retained during class redefine / retransform Reviewed-by: coleenp, sspitsyn, jfranck --- .../vm/prims/jvmtiClassFileReconstituter.cpp | 22 + .../share/vm/prims/jvmtiRedefineClasses.cpp | 622 +++++++++++++++++- .../share/vm/prims/jvmtiRedefineClasses.hpp | 17 + .../RedefineTests/RedefineAnnotations.java | 410 ++++++++++++ 4 files changed, 1054 insertions(+), 17 deletions(-) create mode 100644 hotspot/test/runtime/RedefineTests/RedefineAnnotations.java diff --git a/hotspot/src/share/vm/prims/jvmtiClassFileReconstituter.cpp b/hotspot/src/share/vm/prims/jvmtiClassFileReconstituter.cpp index c6633bf34a9..53b5850712e 100644 --- a/hotspot/src/share/vm/prims/jvmtiClassFileReconstituter.cpp +++ b/hotspot/src/share/vm/prims/jvmtiClassFileReconstituter.cpp @@ -41,6 +41,7 @@ void JvmtiClassFileReconstituter::write_field_infos() { HandleMark hm(thread()); Array* fields_anno = ikh()->fields_annotations(); + Array* fields_type_anno = ikh()->fields_type_annotations(); // Compute the real number of Java fields int java_fields = ikh()->java_fields_count(); @@ -55,6 +56,7 @@ void JvmtiClassFileReconstituter::write_field_infos() { // int offset = ikh()->field_offset( index ); int generic_signature_index = fs.generic_signature_index(); AnnotationArray* anno = fields_anno == NULL ? NULL : fields_anno->at(fs.index()); + AnnotationArray* type_anno = fields_type_anno == NULL ? NULL : fields_type_anno->at(fs.index()); // JVMSpec| field_info { // JVMSpec| u2 access_flags; @@ -80,6 +82,9 @@ void JvmtiClassFileReconstituter::write_field_infos() { if (anno != NULL) { ++attr_count; // has RuntimeVisibleAnnotations attribute } + if (type_anno != NULL) { + ++attr_count; // has RuntimeVisibleTypeAnnotations attribute + } write_u2(attr_count); @@ -97,6 +102,9 @@ void JvmtiClassFileReconstituter::write_field_infos() { if (anno != NULL) { write_annotations_attribute("RuntimeVisibleAnnotations", anno); } + if (type_anno != NULL) { + write_annotations_attribute("RuntimeVisibleTypeAnnotations", type_anno); + } } } @@ -537,6 +545,7 @@ void JvmtiClassFileReconstituter::write_method_info(methodHandle method) { AnnotationArray* anno = method->annotations(); AnnotationArray* param_anno = method->parameter_annotations(); AnnotationArray* default_anno = method->annotation_default(); + AnnotationArray* type_anno = method->type_annotations(); // skip generated default interface methods if (method->is_overpass()) { @@ -572,6 +581,9 @@ void JvmtiClassFileReconstituter::write_method_info(methodHandle method) { if (param_anno != NULL) { ++attr_count; // has RuntimeVisibleParameterAnnotations attribute } + if (type_anno != NULL) { + ++attr_count; // has RuntimeVisibleTypeAnnotations attribute + } write_u2(attr_count); if (const_method->code_size() > 0) { @@ -596,6 +608,9 @@ void JvmtiClassFileReconstituter::write_method_info(methodHandle method) { if (param_anno != NULL) { write_annotations_attribute("RuntimeVisibleParameterAnnotations", param_anno); } + if (type_anno != NULL) { + write_annotations_attribute("RuntimeVisibleTypeAnnotations", type_anno); + } } // Write the class attributes portion of ClassFile structure @@ -605,6 +620,7 @@ void JvmtiClassFileReconstituter::write_class_attributes() { u2 inner_classes_length = inner_classes_attribute_length(); Symbol* generic_signature = ikh()->generic_signature(); AnnotationArray* anno = ikh()->class_annotations(); + AnnotationArray* type_anno = ikh()->class_type_annotations(); int attr_count = 0; if (generic_signature != NULL) { @@ -622,6 +638,9 @@ void JvmtiClassFileReconstituter::write_class_attributes() { if (anno != NULL) { ++attr_count; // has RuntimeVisibleAnnotations attribute } + if (type_anno != NULL) { + ++attr_count; // has RuntimeVisibleTypeAnnotations attribute + } if (cpool()->operands() != NULL) { ++attr_count; } @@ -643,6 +662,9 @@ void JvmtiClassFileReconstituter::write_class_attributes() { if (anno != NULL) { write_annotations_attribute("RuntimeVisibleAnnotations", anno); } + if (type_anno != NULL) { + write_annotations_attribute("RuntimeVisibleTypeAnnotations", type_anno); + } if (cpool()->operands() != NULL) { write_bootstrapmethod_attribute(); } diff --git a/hotspot/src/share/vm/prims/jvmtiRedefineClasses.cpp b/hotspot/src/share/vm/prims/jvmtiRedefineClasses.cpp index 796f5580326..9335857ee56 100644 --- a/hotspot/src/share/vm/prims/jvmtiRedefineClasses.cpp +++ b/hotspot/src/share/vm/prims/jvmtiRedefineClasses.cpp @@ -1569,6 +1569,29 @@ bool VM_RedefineClasses::rewrite_cp_refs(instanceKlassHandle scratch_class, return false; } + // rewrite constant pool references in the class_type_annotations: + if (!rewrite_cp_refs_in_class_type_annotations(scratch_class, THREAD)) { + // propagate failure back to caller + return false; + } + + // rewrite constant pool references in the fields_type_annotations: + if (!rewrite_cp_refs_in_fields_type_annotations(scratch_class, THREAD)) { + // propagate failure back to caller + return false; + } + + // rewrite constant pool references in the methods_type_annotations: + if (!rewrite_cp_refs_in_methods_type_annotations(scratch_class, THREAD)) { + // propagate failure back to caller + return false; + } + + // There can be type annotations in the Code part of a method_info attribute. + // These annotations are not accessible, even by reflection. + // Currently they are not even parsed by the ClassFileParser. + // If runtime access is added they will also need to be rewritten. + // rewrite source file name index: u2 source_file_name_idx = scratch_class->source_file_name_index(); if (source_file_name_idx != 0) { @@ -2239,6 +2262,588 @@ bool VM_RedefineClasses::rewrite_cp_refs_in_methods_default_annotations( } // end rewrite_cp_refs_in_methods_default_annotations() +// Rewrite constant pool references in a class_type_annotations field. +bool VM_RedefineClasses::rewrite_cp_refs_in_class_type_annotations( + instanceKlassHandle scratch_class, TRAPS) { + + AnnotationArray* class_type_annotations = scratch_class->class_type_annotations(); + if (class_type_annotations == NULL || class_type_annotations->length() == 0) { + // no class_type_annotations so nothing to do + return true; + } + + RC_TRACE_WITH_THREAD(0x02000000, THREAD, + ("class_type_annotations length=%d", class_type_annotations->length())); + + int byte_i = 0; // byte index into class_type_annotations + return rewrite_cp_refs_in_type_annotations_typeArray(class_type_annotations, + byte_i, "ClassFile", THREAD); +} // end rewrite_cp_refs_in_class_type_annotations() + + +// Rewrite constant pool references in a fields_type_annotations field. +bool VM_RedefineClasses::rewrite_cp_refs_in_fields_type_annotations( + instanceKlassHandle scratch_class, TRAPS) { + + Array* fields_type_annotations = scratch_class->fields_type_annotations(); + if (fields_type_annotations == NULL || fields_type_annotations->length() == 0) { + // no fields_type_annotations so nothing to do + return true; + } + + RC_TRACE_WITH_THREAD(0x02000000, THREAD, + ("fields_type_annotations length=%d", fields_type_annotations->length())); + + for (int i = 0; i < fields_type_annotations->length(); i++) { + AnnotationArray* field_type_annotations = fields_type_annotations->at(i); + if (field_type_annotations == NULL || field_type_annotations->length() == 0) { + // this field does not have any annotations so skip it + continue; + } + + int byte_i = 0; // byte index into field_type_annotations + if (!rewrite_cp_refs_in_type_annotations_typeArray(field_type_annotations, + byte_i, "field_info", THREAD)) { + RC_TRACE_WITH_THREAD(0x02000000, THREAD, + ("bad field_type_annotations at %d", i)); + // propagate failure back to caller + return false; + } + } + + return true; +} // end rewrite_cp_refs_in_fields_type_annotations() + + +// Rewrite constant pool references in a methods_type_annotations field. +bool VM_RedefineClasses::rewrite_cp_refs_in_methods_type_annotations( + instanceKlassHandle scratch_class, TRAPS) { + + for (int i = 0; i < scratch_class->methods()->length(); i++) { + Method* m = scratch_class->methods()->at(i); + AnnotationArray* method_type_annotations = m->constMethod()->type_annotations(); + + if (method_type_annotations == NULL || method_type_annotations->length() == 0) { + // this method does not have any annotations so skip it + continue; + } + + RC_TRACE_WITH_THREAD(0x02000000, THREAD, + ("methods type_annotations length=%d", method_type_annotations->length())); + + int byte_i = 0; // byte index into method_type_annotations + if (!rewrite_cp_refs_in_type_annotations_typeArray(method_type_annotations, + byte_i, "method_info", THREAD)) { + RC_TRACE_WITH_THREAD(0x02000000, THREAD, + ("bad method_type_annotations at %d", i)); + // propagate failure back to caller + return false; + } + } + + return true; +} // end rewrite_cp_refs_in_methods_type_annotations() + + +// Rewrite constant pool references in a type_annotations +// field. This "structure" is adapted from the +// RuntimeVisibleTypeAnnotations_attribute described in +// section 4.7.20 of the Java SE 8 Edition of the VM spec: +// +// type_annotations_typeArray { +// u2 num_annotations; +// type_annotation annotations[num_annotations]; +// } +// +bool VM_RedefineClasses::rewrite_cp_refs_in_type_annotations_typeArray( + AnnotationArray* type_annotations_typeArray, int &byte_i_ref, + const char * location_mesg, TRAPS) { + + if ((byte_i_ref + 2) > type_annotations_typeArray->length()) { + // not enough room for num_annotations field + RC_TRACE_WITH_THREAD(0x02000000, THREAD, + ("length() is too small for num_annotations field")); + return false; + } + + u2 num_annotations = Bytes::get_Java_u2((address) + type_annotations_typeArray->adr_at(byte_i_ref)); + byte_i_ref += 2; + + RC_TRACE_WITH_THREAD(0x02000000, THREAD, + ("num_type_annotations=%d", num_annotations)); + + int calc_num_annotations = 0; + for (; calc_num_annotations < num_annotations; calc_num_annotations++) { + if (!rewrite_cp_refs_in_type_annotation_struct(type_annotations_typeArray, + byte_i_ref, location_mesg, THREAD)) { + RC_TRACE_WITH_THREAD(0x02000000, THREAD, + ("bad type_annotation_struct at %d", calc_num_annotations)); + // propagate failure back to caller + return false; + } + } + assert(num_annotations == calc_num_annotations, "sanity check"); + + if (byte_i_ref != type_annotations_typeArray->length()) { + RC_TRACE_WITH_THREAD(0x02000000, THREAD, + ("read wrong amount of bytes at end of processing " + "type_annotations_typeArray (%d of %d bytes were read)", + byte_i_ref, type_annotations_typeArray->length())); + return false; + } + + return true; +} // end rewrite_cp_refs_in_type_annotations_typeArray() + + +// Rewrite constant pool references in a type_annotation +// field. This "structure" is adapted from the +// RuntimeVisibleTypeAnnotations_attribute described in +// section 4.7.20 of the Java SE 8 Edition of the VM spec: +// +// type_annotation { +// u1 target_type; +// union { +// type_parameter_target; +// supertype_target; +// type_parameter_bound_target; +// empty_target; +// method_formal_parameter_target; +// throws_target; +// localvar_target; +// catch_target; +// offset_target; +// type_argument_target; +// } target_info; +// type_path target_path; +// annotation anno; +// } +// +bool VM_RedefineClasses::rewrite_cp_refs_in_type_annotation_struct( + AnnotationArray* type_annotations_typeArray, int &byte_i_ref, + const char * location_mesg, TRAPS) { + + if (!skip_type_annotation_target(type_annotations_typeArray, + byte_i_ref, location_mesg, THREAD)) { + return false; + } + + if (!skip_type_annotation_type_path(type_annotations_typeArray, + byte_i_ref, THREAD)) { + return false; + } + + if (!rewrite_cp_refs_in_annotation_struct(type_annotations_typeArray, + byte_i_ref, THREAD)) { + return false; + } + + return true; +} // end rewrite_cp_refs_in_type_annotation_struct() + + +// Read, verify and skip over the target_type and target_info part +// so that rewriting can continue in the later parts of the struct. +// +// u1 target_type; +// union { +// type_parameter_target; +// supertype_target; +// type_parameter_bound_target; +// empty_target; +// method_formal_parameter_target; +// throws_target; +// localvar_target; +// catch_target; +// offset_target; +// type_argument_target; +// } target_info; +// +bool VM_RedefineClasses::skip_type_annotation_target( + AnnotationArray* type_annotations_typeArray, int &byte_i_ref, + const char * location_mesg, TRAPS) { + + if ((byte_i_ref + 1) > type_annotations_typeArray->length()) { + // not enough room for a target_type let alone the rest of a type_annotation + RC_TRACE_WITH_THREAD(0x02000000, THREAD, + ("length() is too small for a target_type")); + return false; + } + + u1 target_type = type_annotations_typeArray->at(byte_i_ref); + byte_i_ref += 1; + RC_TRACE_WITH_THREAD(0x02000000, THREAD, ("target_type=0x%.2x", target_type)); + RC_TRACE_WITH_THREAD(0x02000000, THREAD, ("location=%s", location_mesg)); + + // Skip over target_info + switch (target_type) { + case 0x00: + // kind: type parameter declaration of generic class or interface + // location: ClassFile + case 0x01: + // kind: type parameter declaration of generic method or constructor + // location: method_info + + { + // struct: + // type_parameter_target { + // u1 type_parameter_index; + // } + // + if ((byte_i_ref + 1) > type_annotations_typeArray->length()) { + RC_TRACE_WITH_THREAD(0x02000000, THREAD, + ("length() is too small for a type_parameter_target")); + return false; + } + + u1 type_parameter_index = type_annotations_typeArray->at(byte_i_ref); + byte_i_ref += 1; + + RC_TRACE_WITH_THREAD(0x02000000, THREAD, + ("type_parameter_target: type_parameter_index=%d", + type_parameter_index)); + } break; + + case 0x10: + // kind: type in extends clause of class or interface declaration + // (including the direct superclass of an anonymous class declaration), + // or in implements clause of interface declaration + // location: ClassFile + + { + // struct: + // supertype_target { + // u2 supertype_index; + // } + // + if ((byte_i_ref + 2) > type_annotations_typeArray->length()) { + RC_TRACE_WITH_THREAD(0x02000000, THREAD, + ("length() is too small for a supertype_target")); + return false; + } + + u2 supertype_index = Bytes::get_Java_u2((address) + type_annotations_typeArray->adr_at(byte_i_ref)); + byte_i_ref += 2; + + RC_TRACE_WITH_THREAD(0x02000000, THREAD, + ("supertype_target: supertype_index=%d", supertype_index)); + } break; + + case 0x11: + // kind: type in bound of type parameter declaration of generic class or interface + // location: ClassFile + case 0x12: + // kind: type in bound of type parameter declaration of generic method or constructor + // location: method_info + + { + // struct: + // type_parameter_bound_target { + // u1 type_parameter_index; + // u1 bound_index; + // } + // + if ((byte_i_ref + 2) > type_annotations_typeArray->length()) { + RC_TRACE_WITH_THREAD(0x02000000, THREAD, + ("length() is too small for a type_parameter_bound_target")); + return false; + } + + u1 type_parameter_index = type_annotations_typeArray->at(byte_i_ref); + byte_i_ref += 1; + u1 bound_index = type_annotations_typeArray->at(byte_i_ref); + byte_i_ref += 1; + + RC_TRACE_WITH_THREAD(0x02000000, THREAD, + ("type_parameter_bound_target: type_parameter_index=%d, bound_index=%d", + type_parameter_index, bound_index)); + } break; + + case 0x13: + // kind: type in field declaration + // location: field_info + case 0x14: + // kind: return type of method, or type of newly constructed object + // location: method_info + case 0x15: + // kind: receiver type of method or constructor + // location: method_info + + { + // struct: + // empty_target { + // } + // + RC_TRACE_WITH_THREAD(0x02000000, THREAD, + ("empty_target")); + } break; + + case 0x16: + // kind: type in formal parameter declaration of method, constructor, or lambda expression + // location: method_info + + { + // struct: + // formal_parameter_target { + // u1 formal_parameter_index; + // } + // + if ((byte_i_ref + 1) > type_annotations_typeArray->length()) { + RC_TRACE_WITH_THREAD(0x02000000, THREAD, + ("length() is too small for a formal_parameter_target")); + return false; + } + + u1 formal_parameter_index = type_annotations_typeArray->at(byte_i_ref); + byte_i_ref += 1; + + RC_TRACE_WITH_THREAD(0x02000000, THREAD, + ("formal_parameter_target: formal_parameter_index=%d", + formal_parameter_index)); + } break; + + case 0x17: + // kind: type in throws clause of method or constructor + // location: method_info + + { + // struct: + // throws_target { + // u2 throws_type_index + // } + // + if ((byte_i_ref + 2) > type_annotations_typeArray->length()) { + RC_TRACE_WITH_THREAD(0x02000000, THREAD, + ("length() is too small for a throws_target")); + return false; + } + + u2 throws_type_index = Bytes::get_Java_u2((address) + type_annotations_typeArray->adr_at(byte_i_ref)); + byte_i_ref += 2; + + RC_TRACE_WITH_THREAD(0x02000000, THREAD, + ("throws_target: throws_type_index=%d", throws_type_index)); + } break; + + case 0x40: + // kind: type in local variable declaration + // location: Code + case 0x41: + // kind: type in resource variable declaration + // location: Code + + { + // struct: + // localvar_target { + // u2 table_length; + // struct { + // u2 start_pc; + // u2 length; + // u2 index; + // } table[table_length]; + // } + // + if ((byte_i_ref + 2) > type_annotations_typeArray->length()) { + // not enough room for a table_length let alone the rest of a localvar_target + RC_TRACE_WITH_THREAD(0x02000000, THREAD, + ("length() is too small for a localvar_target table_length")); + return false; + } + + u2 table_length = Bytes::get_Java_u2((address) + type_annotations_typeArray->adr_at(byte_i_ref)); + byte_i_ref += 2; + + RC_TRACE_WITH_THREAD(0x02000000, THREAD, + ("localvar_target: table_length=%d", table_length)); + + int table_struct_size = 2 + 2 + 2; // 3 u2 variables per table entry + int table_size = table_length * table_struct_size; + + if ((byte_i_ref + table_size) > type_annotations_typeArray->length()) { + // not enough room for a table + RC_TRACE_WITH_THREAD(0x02000000, THREAD, + ("length() is too small for a table array of length %d", table_length)); + return false; + } + + // Skip over table + byte_i_ref += table_size; + } break; + + case 0x42: + // kind: type in exception parameter declaration + // location: Code + + { + // struct: + // catch_target { + // u2 exception_table_index; + // } + // + if ((byte_i_ref + 2) > type_annotations_typeArray->length()) { + RC_TRACE_WITH_THREAD(0x02000000, THREAD, + ("length() is too small for a catch_target")); + return false; + } + + u2 exception_table_index = Bytes::get_Java_u2((address) + type_annotations_typeArray->adr_at(byte_i_ref)); + byte_i_ref += 2; + + RC_TRACE_WITH_THREAD(0x02000000, THREAD, + ("catch_target: exception_table_index=%d", exception_table_index)); + } break; + + case 0x43: + // kind: type in instanceof expression + // location: Code + case 0x44: + // kind: type in new expression + // location: Code + case 0x45: + // kind: type in method reference expression using ::new + // location: Code + case 0x46: + // kind: type in method reference expression using ::Identifier + // location: Code + + { + // struct: + // offset_target { + // u2 offset; + // } + // + if ((byte_i_ref + 2) > type_annotations_typeArray->length()) { + RC_TRACE_WITH_THREAD(0x02000000, THREAD, + ("length() is too small for a offset_target")); + return false; + } + + u2 offset = Bytes::get_Java_u2((address) + type_annotations_typeArray->adr_at(byte_i_ref)); + byte_i_ref += 2; + + RC_TRACE_WITH_THREAD(0x02000000, THREAD, + ("offset_target: offset=%d", offset)); + } break; + + case 0x47: + // kind: type in cast expression + // location: Code + case 0x48: + // kind: type argument for generic constructor in new expression or + // explicit constructor invocation statement + // location: Code + case 0x49: + // kind: type argument for generic method in method invocation expression + // location: Code + case 0x4A: + // kind: type argument for generic constructor in method reference expression using ::new + // location: Code + case 0x4B: + // kind: type argument for generic method in method reference expression using ::Identifier + // location: Code + + { + // struct: + // type_argument_target { + // u2 offset; + // u1 type_argument_index; + // } + // + if ((byte_i_ref + 3) > type_annotations_typeArray->length()) { + RC_TRACE_WITH_THREAD(0x02000000, THREAD, + ("length() is too small for a type_argument_target")); + return false; + } + + u2 offset = Bytes::get_Java_u2((address) + type_annotations_typeArray->adr_at(byte_i_ref)); + byte_i_ref += 2; + u1 type_argument_index = type_annotations_typeArray->at(byte_i_ref); + byte_i_ref += 1; + + RC_TRACE_WITH_THREAD(0x02000000, THREAD, + ("type_argument_target: offset=%d, type_argument_index=%d", + offset, type_argument_index)); + } break; + + default: + RC_TRACE_WITH_THREAD(0x02000000, THREAD, + ("unknown target_type")); +#ifdef ASSERT + ShouldNotReachHere(); +#endif + return false; + } + + return true; +} // end skip_type_annotation_target() + + +// Read, verify and skip over the type_path part so that rewriting +// can continue in the later parts of the struct. +// +// type_path { +// u1 path_length; +// { +// u1 type_path_kind; +// u1 type_argument_index; +// } path[path_length]; +// } +// +bool VM_RedefineClasses::skip_type_annotation_type_path( + AnnotationArray* type_annotations_typeArray, int &byte_i_ref, TRAPS) { + + if ((byte_i_ref + 1) > type_annotations_typeArray->length()) { + // not enough room for a path_length let alone the rest of the type_path + RC_TRACE_WITH_THREAD(0x02000000, THREAD, + ("length() is too small for a type_path")); + return false; + } + + u1 path_length = type_annotations_typeArray->at(byte_i_ref); + byte_i_ref += 1; + + RC_TRACE_WITH_THREAD(0x02000000, THREAD, + ("type_path: path_length=%d", path_length)); + + int calc_path_length = 0; + for (; calc_path_length < path_length; calc_path_length++) { + if ((byte_i_ref + 1 + 1) > type_annotations_typeArray->length()) { + // not enough room for a path + RC_TRACE_WITH_THREAD(0x02000000, THREAD, + ("length() is too small for path entry %d of %d", + calc_path_length, path_length)); + return false; + } + + u1 type_path_kind = type_annotations_typeArray->at(byte_i_ref); + byte_i_ref += 1; + u1 type_argument_index = type_annotations_typeArray->at(byte_i_ref); + byte_i_ref += 1; + + RC_TRACE_WITH_THREAD(0x02000000, THREAD, + ("type_path: path[%d]: type_path_kind=%d, type_argument_index=%d", + calc_path_length, type_path_kind, type_argument_index)); + + if (type_path_kind > 3 || (type_path_kind != 3 && type_argument_index != 0)) { + // not enough room for a path + RC_TRACE_WITH_THREAD(0x02000000, THREAD, + ("inconsistent type_path values")); + return false; + } + } + assert(path_length == calc_path_length, "sanity check"); + + return true; +} // end skip_type_annotation_type_path() + + // Rewrite constant pool references in the method's stackmap table. // These "structures" are adapted from the StackMapTable_attribute that // is described in section 4.8.4 of the 6.0 version of the VM spec @@ -3223,23 +3828,6 @@ void VM_RedefineClasses::compute_added_deleted_matching_methods() { void VM_RedefineClasses::swap_annotations(instanceKlassHandle the_class, instanceKlassHandle scratch_class) { - // Since there is currently no rewriting of type annotations indexes - // into the CP, we null out type annotations on scratch_class before - // we swap annotations with the_class rather than facing the - // possibility of shipping annotations with broken indexes to - // Java-land. - ClassLoaderData* loader_data = scratch_class->class_loader_data(); - AnnotationArray* new_class_type_annotations = scratch_class->class_type_annotations(); - if (new_class_type_annotations != NULL) { - MetadataFactory::free_array(loader_data, new_class_type_annotations); - scratch_class->annotations()->set_class_type_annotations(NULL); - } - Array* new_field_type_annotations = scratch_class->fields_type_annotations(); - if (new_field_type_annotations != NULL) { - Annotations::free_contents(loader_data, new_field_type_annotations); - scratch_class->annotations()->set_fields_type_annotations(NULL); - } - // Swap annotation fields values Annotations* old_annotations = the_class->annotations(); the_class->set_annotations(scratch_class->annotations()); diff --git a/hotspot/src/share/vm/prims/jvmtiRedefineClasses.hpp b/hotspot/src/share/vm/prims/jvmtiRedefineClasses.hpp index 2383aa86e17..8394f5f50a3 100644 --- a/hotspot/src/share/vm/prims/jvmtiRedefineClasses.hpp +++ b/hotspot/src/share/vm/prims/jvmtiRedefineClasses.hpp @@ -452,6 +452,17 @@ class VM_RedefineClasses: public VM_Operation { instanceKlassHandle scratch_class, TRAPS); bool rewrite_cp_refs_in_element_value( AnnotationArray* class_annotations, int &byte_i_ref, TRAPS); + bool rewrite_cp_refs_in_type_annotations_typeArray( + AnnotationArray* type_annotations_typeArray, int &byte_i_ref, + const char * location_mesg, TRAPS); + bool rewrite_cp_refs_in_type_annotation_struct( + AnnotationArray* type_annotations_typeArray, int &byte_i_ref, + const char * location_mesg, TRAPS); + bool skip_type_annotation_target( + AnnotationArray* type_annotations_typeArray, int &byte_i_ref, + const char * location_mesg, TRAPS); + bool skip_type_annotation_type_path( + AnnotationArray* type_annotations_typeArray, int &byte_i_ref, TRAPS); bool rewrite_cp_refs_in_fields_annotations( instanceKlassHandle scratch_class, TRAPS); void rewrite_cp_refs_in_method(methodHandle method, @@ -463,6 +474,12 @@ class VM_RedefineClasses: public VM_Operation { instanceKlassHandle scratch_class, TRAPS); bool rewrite_cp_refs_in_methods_parameter_annotations( instanceKlassHandle scratch_class, TRAPS); + bool rewrite_cp_refs_in_class_type_annotations( + instanceKlassHandle scratch_class, TRAPS); + bool rewrite_cp_refs_in_fields_type_annotations( + instanceKlassHandle scratch_class, TRAPS); + bool rewrite_cp_refs_in_methods_type_annotations( + instanceKlassHandle scratch_class, TRAPS); void rewrite_cp_refs_in_stack_map_table(methodHandle method, TRAPS); void rewrite_cp_refs_in_verification_type_info( address& stackmap_addr_ref, address stackmap_end, u2 frame_i, diff --git a/hotspot/test/runtime/RedefineTests/RedefineAnnotations.java b/hotspot/test/runtime/RedefineTests/RedefineAnnotations.java new file mode 100644 index 00000000000..eb74b68426e --- /dev/null +++ b/hotspot/test/runtime/RedefineTests/RedefineAnnotations.java @@ -0,0 +1,410 @@ +/* + * Copyright (c) 2014, Oracle and/or its affiliates. All rights reserved. + * DO NOT ALTER OR REMOVE COPYRIGHT NOTICES OR THIS FILE HEADER. + * + * This code is free software; you can redistribute it and/or modify it + * under the terms of the GNU General Public License version 2 only, as + * published by the Free Software Foundation. + * + * This code is distributed in the hope that it will be useful, but WITHOUT + * ANY WARRANTY; without even the implied warranty of MERCHANTABILITY or + * FITNESS FOR A PARTICULAR PURPOSE. See the GNU General Public License + * version 2 for more details (a copy is included in the LICENSE file that + * accompanied this code). + * + * You should have received a copy of the GNU General Public License version + * 2 along with this work; if not, write to the Free Software Foundation, + * Inc., 51 Franklin St, Fifth Floor, Boston, MA 02110-1301 USA. + * + * Please contact Oracle, 500 Oracle Parkway, Redwood Shores, CA 94065 USA + * or visit www.oracle.com if you need additional information or have any + * questions. + */ + +/* + * @test + * @library /testlibrary + * @summary Test that type annotations are retained after a retransform + * @run main RedefineAnnotations buildagent + * @run main/othervm -javaagent:redefineagent.jar RedefineAnnotations + */ + +import static com.oracle.java.testlibrary.Asserts.assertTrue; +import java.io.FileNotFoundException; +import java.io.PrintWriter; +import java.lang.NoSuchFieldException; +import java.lang.NoSuchMethodException; +import java.lang.RuntimeException; +import java.lang.annotation.Annotation; +import java.lang.annotation.ElementType; +import java.lang.annotation.Retention; +import java.lang.annotation.RetentionPolicy; +import java.lang.annotation.Target; +import java.lang.instrument.ClassFileTransformer; +import java.lang.instrument.IllegalClassFormatException; +import java.lang.instrument.Instrumentation; +import java.lang.instrument.UnmodifiableClassException; +import java.lang.reflect.AnnotatedArrayType; +import java.lang.reflect.AnnotatedParameterizedType; +import java.lang.reflect.AnnotatedType; +import java.lang.reflect.AnnotatedWildcardType; +import java.lang.reflect.Executable; +import java.lang.reflect.TypeVariable; +import java.security.ProtectionDomain; +import java.util.Arrays; +import java.util.LinkedList; +import java.util.List; +import java.util.Map; +import jdk.internal.org.objectweb.asm.ClassReader; +import jdk.internal.org.objectweb.asm.ClassVisitor; +import jdk.internal.org.objectweb.asm.ClassWriter; +import jdk.internal.org.objectweb.asm.FieldVisitor; +import static jdk.internal.org.objectweb.asm.Opcodes.ASM5; + +@Retention(RetentionPolicy.RUNTIME) +@Target(ElementType.TYPE_USE) +@interface TestAnn { + String site(); +} + +public class RedefineAnnotations { + static Instrumentation inst; + public static void premain(String agentArgs, Instrumentation inst) { + RedefineAnnotations.inst = inst; + } + + static class Transformer implements ClassFileTransformer { + + public byte[] asm(ClassLoader loader, String className, + Class classBeingRedefined, + ProtectionDomain protectionDomain, byte[] classfileBuffer) + throws IllegalClassFormatException { + + ClassWriter cw = new ClassWriter(0); + ClassVisitor cv = new ReAddDummyFieldsClassVisitor(ASM5, cw) { }; + ClassReader cr = new ClassReader(classfileBuffer); + cr.accept(cv, 0); + return cw.toByteArray(); + } + + public class ReAddDummyFieldsClassVisitor extends ClassVisitor { + + LinkedList fields = new LinkedList<>(); + + public ReAddDummyFieldsClassVisitor(int api, ClassVisitor cv) { + super(api, cv); + } + + @Override public FieldVisitor visitField(int access, String name, + String desc, String signature, Object value) { + if (name.startsWith("dummy")) { + // Remove dummy field + fields.addLast(new F(access, name, desc, signature, value)); + return null; + } + return cv.visitField(access, name, desc, signature, value); + } + + @Override public void visitEnd() { + F f; + while ((f = fields.pollFirst()) != null) { + // Re-add dummy fields + cv.visitField(f.access, f.name, f.desc, f.signature, f.value); + } + } + + private class F { + private int access; + private String name; + private String desc; + private String signature; + private Object value; + F(int access, String name, String desc, String signature, Object value) { + this.access = access; + this.name = name; + this.desc = desc; + this.signature = signature; + this.value = value; + } + } + } + + @Override public byte[] transform(ClassLoader loader, String className, + Class classBeingRedefined, + ProtectionDomain protectionDomain, byte[] classfileBuffer) + throws IllegalClassFormatException { + + if (className.contains("TypeAnnotatedTestClass")) { + try { + // Here we remove and re-add the dummy fields. This shuffles the constant pool + return asm(loader, className, classBeingRedefined, protectionDomain, classfileBuffer); + } catch (Throwable e) { + // The retransform native code that called this method does not propagate + // exceptions. Instead of getting an uninformative generic error, catch + // problems here and print it, then exit. + e.printStackTrace(); + System.exit(1); + } + } + return null; + } + } + + private static void buildAgent() { + try { + ClassFileInstaller.main("RedefineAnnotations"); + } catch (Exception e) { + throw new RuntimeException("Could not write agent classfile", e); + } + + try { + PrintWriter pw = new PrintWriter("MANIFEST.MF"); + pw.println("Premain-Class: RedefineAnnotations"); + pw.println("Agent-Class: RedefineAnnotations"); + pw.println("Can-Retransform-Classes: true"); + pw.close(); + } catch (FileNotFoundException e) { + throw new RuntimeException("Could not write manifest file for the agent", e); + } + + sun.tools.jar.Main jarTool = new sun.tools.jar.Main(System.out, System.err, "jar"); + if (!jarTool.run(new String[] { "-cmf", "MANIFEST.MF", "redefineagent.jar", "RedefineAnnotations.class" })) { + throw new RuntimeException("Could not write the agent jar file"); + } + } + + public static void main(String argv[]) throws NoSuchFieldException, NoSuchMethodException { + if (argv.length == 1 && argv[0].equals("buildagent")) { + buildAgent(); + return; + } + + if (inst == null) { + throw new RuntimeException("Instrumentation object was null"); + } + + RedefineAnnotations test = new RedefineAnnotations(); + test.testTransformAndVerify(); + } + + // Class type annotations + private Annotation classTypeParameterTA; + private Annotation extendsTA; + private Annotation implementsTA; + + // Field type annotations + private Annotation fieldTA; + private Annotation innerTA; + private Annotation[] arrayTA = new Annotation[4]; + private Annotation[] mapTA = new Annotation[5]; + + // Method type annotations + private Annotation returnTA, methodTypeParameterTA, formalParameterTA, throwsTA; + + private void testTransformAndVerify() + throws NoSuchFieldException, NoSuchMethodException { + + Class c = TypeAnnotatedTestClass.class; + Class myClass = c; + + /* + * Verify that the expected annotations are where they should be before transform. + */ + verifyClassTypeAnnotations(c); + verifyFieldTypeAnnotations(c); + verifyMethodTypeAnnotations(c); + + try { + inst.addTransformer(new Transformer(), true); + inst.retransformClasses(myClass); + } catch (UnmodifiableClassException e) { + throw new RuntimeException(e); + } + + /* + * Verify that the expected annotations are where they should be after transform. + * Also verify that before and after are equal. + */ + verifyClassTypeAnnotations(c); + verifyFieldTypeAnnotations(c); + verifyMethodTypeAnnotations(c); + } + + private void verifyClassTypeAnnotations(Class c) { + Annotation anno; + + anno = c.getTypeParameters()[0].getAnnotations()[0]; + verifyTestAnn(classTypeParameterTA, anno, "classTypeParameter"); + classTypeParameterTA = anno; + + anno = c.getAnnotatedSuperclass().getAnnotations()[0]; + verifyTestAnn(extendsTA, anno, "extends"); + extendsTA = anno; + + anno = c.getAnnotatedInterfaces()[0].getAnnotations()[0]; + verifyTestAnn(implementsTA, anno, "implements"); + implementsTA = anno; + } + + private void verifyFieldTypeAnnotations(Class c) + throws NoSuchFieldException, NoSuchMethodException { + + verifyBasicFieldTypeAnnotations(c); + verifyInnerFieldTypeAnnotations(c); + verifyArrayFieldTypeAnnotations(c); + verifyMapFieldTypeAnnotations(c); + } + + private void verifyBasicFieldTypeAnnotations(Class c) + throws NoSuchFieldException, NoSuchMethodException { + + Annotation anno = c.getDeclaredField("typeAnnotatedBoolean").getAnnotatedType().getAnnotations()[0]; + verifyTestAnn(fieldTA, anno, "field"); + fieldTA = anno; + } + + private void verifyInnerFieldTypeAnnotations(Class c) + throws NoSuchFieldException, NoSuchMethodException { + + AnnotatedType at = c.getDeclaredField("typeAnnotatedInner").getAnnotatedType(); + Annotation anno = at.getAnnotations()[0]; + verifyTestAnn(innerTA, anno, "inner"); + innerTA = anno; + } + + private void verifyArrayFieldTypeAnnotations(Class c) + throws NoSuchFieldException, NoSuchMethodException { + + Annotation anno; + AnnotatedType at; + + at = c.getDeclaredField("typeAnnotatedArray").getAnnotatedType(); + anno = at.getAnnotations()[0]; + verifyTestAnn(arrayTA[0], anno, "array1"); + arrayTA[0] = anno; + + for (int i = 1; i <= 3; i++) { + at = ((AnnotatedArrayType) at).getAnnotatedGenericComponentType(); + anno = at.getAnnotations()[0]; + verifyTestAnn(arrayTA[i], anno, "array" + (i + 1)); + arrayTA[i] = anno; + } + } + + private void verifyMapFieldTypeAnnotations(Class c) + throws NoSuchFieldException, NoSuchMethodException { + + Annotation anno; + AnnotatedType atBase; + AnnotatedType atParameter; + atBase = c.getDeclaredField("typeAnnotatedMap").getAnnotatedType(); + + anno = atBase.getAnnotations()[0]; + verifyTestAnn(mapTA[0], anno, "map1"); + mapTA[0] = anno; + + atParameter = + ((AnnotatedParameterizedType) atBase). + getAnnotatedActualTypeArguments()[0]; + anno = ((AnnotatedWildcardType) atParameter).getAnnotations()[0]; + verifyTestAnn(mapTA[1], anno, "map2"); + mapTA[1] = anno; + + anno = + ((AnnotatedWildcardType) atParameter). + getAnnotatedUpperBounds()[0].getAnnotations()[0]; + verifyTestAnn(mapTA[2], anno, "map3"); + mapTA[2] = anno; + + atParameter = + ((AnnotatedParameterizedType) atBase). + getAnnotatedActualTypeArguments()[1]; + anno = ((AnnotatedParameterizedType) atParameter).getAnnotations()[0]; + verifyTestAnn(mapTA[3], anno, "map4"); + mapTA[3] = anno; + + anno = + ((AnnotatedParameterizedType) atParameter). + getAnnotatedActualTypeArguments()[0].getAnnotations()[0]; + verifyTestAnn(mapTA[4], anno, "map5"); + mapTA[4] = anno; + } + + private void verifyMethodTypeAnnotations(Class c) + throws NoSuchFieldException, NoSuchMethodException { + Annotation anno; + Executable typeAnnotatedMethod = + c.getDeclaredMethod("typeAnnotatedMethod", TypeAnnotatedTestClass.class); + + anno = typeAnnotatedMethod.getAnnotatedReturnType().getAnnotations()[0]; + verifyTestAnn(returnTA, anno, "return"); + returnTA = anno; + + anno = typeAnnotatedMethod.getTypeParameters()[0].getAnnotations()[0]; + verifyTestAnn(methodTypeParameterTA, anno, "methodTypeParameter"); + methodTypeParameterTA = anno; + + anno = typeAnnotatedMethod.getAnnotatedParameterTypes()[0].getAnnotations()[0]; + verifyTestAnn(formalParameterTA, anno, "formalParameter"); + formalParameterTA = anno; + + anno = typeAnnotatedMethod.getAnnotatedExceptionTypes()[0].getAnnotations()[0]; + verifyTestAnn(throwsTA, anno, "throws"); + throwsTA = anno; + } + + private static void verifyTestAnn(Annotation verifyAgainst, Annotation anno, String expectedSite) { + verifyTestAnnSite(anno, expectedSite); + + // When called before transform verifyAgainst will be null, when called + // after transform it will be the annotation from before the transform + if (verifyAgainst != null) { + assertTrue(anno.equals(verifyAgainst), + "Annotations do not match before and after." + + " Before: \"" + verifyAgainst + "\", After: \"" + anno + "\""); + } + } + + private static void verifyTestAnnSite(Annotation testAnn, String expectedSite) { + String expectedAnn = "@TestAnn(site=" + expectedSite + ")"; + assertTrue(testAnn.toString().equals(expectedAnn), + "Expected \"" + expectedAnn + "\", got \"" + testAnn + "\""); + } + + public static class TypeAnnotatedTestClass <@TestAnn(site="classTypeParameter") S,T> + extends @TestAnn(site="extends") Thread + implements @TestAnn(site="implements") Runnable { + + public @TestAnn(site="field") boolean typeAnnotatedBoolean; + + public + RedefineAnnotations. + @TestAnn(site="inner") TypeAnnotatedTestClass + typeAnnotatedInner; + + public + @TestAnn(site="array4") boolean + @TestAnn(site="array1") [] + @TestAnn(site="array2") [] + @TestAnn(site="array3") [] + typeAnnotatedArray; + + public @TestAnn(site="map1") Map + <@TestAnn(site="map2") ? extends @TestAnn(site="map3") String, + @TestAnn(site="map4") List<@TestAnn(site="map5") Object>> typeAnnotatedMap; + + public int dummy1; + public int dummy2; + public int dummy3; + + @TestAnn(site="return") <@TestAnn(site="methodTypeParameter") U,V> Class + typeAnnotatedMethod(@TestAnn(site="formalParameter") TypeAnnotatedTestClass arg) + throws @TestAnn(site="throws") ClassNotFoundException { + + @TestAnn(site="local_variable_type") int foo = 0; + throw new ClassNotFoundException(); + } + + public void run() {} + } +} From 0e1283a8117af0f3ffe822f23876aeb0a949e0e0 Mon Sep 17 00:00:00 2001 From: Karen Kinnear Date: Wed, 22 Oct 2014 15:24:37 -0700 Subject: [PATCH 29/61] 8043275: Fix interface initialization for default methods Initialize interfaces that declare concrete instance methods. Reviewed-by: kamg, coleenp, psandoz --- .../share/vm/classfile/classFileParser.cpp | 20 +- .../vm/classfile/classFileParser.cpp.orig | 5274 +++++++++++++++++ .../share/vm/classfile/classFileParser.hpp | 2 +- hotspot/src/share/vm/oops/instanceKlass.cpp | 65 +- hotspot/src/share/vm/oops/instanceKlass.hpp | 27 +- .../share/vm/utilities/dtrace_disabled.hpp | 2 +- .../InvokespecialInterface.java | 4 +- .../lambda-features/TestInterfaceInit.java | 87 + .../lambda-features/TestInterfaceOrder.java | 88 + 9 files changed, 5525 insertions(+), 44 deletions(-) create mode 100644 hotspot/src/share/vm/classfile/classFileParser.cpp.orig create mode 100644 hotspot/test/runtime/lambda-features/TestInterfaceInit.java create mode 100644 hotspot/test/runtime/lambda-features/TestInterfaceOrder.java diff --git a/hotspot/src/share/vm/classfile/classFileParser.cpp b/hotspot/src/share/vm/classfile/classFileParser.cpp index 0f2f8d590c4..fe9f2443a80 100644 --- a/hotspot/src/share/vm/classfile/classFileParser.cpp +++ b/hotspot/src/share/vm/classfile/classFileParser.cpp @@ -2557,7 +2557,7 @@ methodHandle ClassFileParser::parse_method(bool is_interface, Array* ClassFileParser::parse_methods(bool is_interface, AccessFlags* promoted_flags, bool* has_final_method, - bool* has_default_methods, + bool* declares_default_methods, TRAPS) { ClassFileStream* cfs = stream(); cfs->guarantee_more(2, CHECK_NULL); // length @@ -2576,11 +2576,11 @@ Array* ClassFileParser::parse_methods(bool is_interface, if (method->is_final()) { *has_final_method = true; } - if (is_interface && !(*has_default_methods) - && !method->is_abstract() && !method->is_static() - && !method->is_private()) { - // default method - *has_default_methods = true; + // declares_default_methods: declares concrete instance methods, any access flags + // used for interface initialization, and default method inheritance analysis + if (is_interface && !(*declares_default_methods) + && !method->is_abstract() && !method->is_static()) { + *declares_default_methods = true; } _methods->at_put(index, method()); } @@ -3739,6 +3739,7 @@ instanceKlassHandle ClassFileParser::parseClassFile(Symbol* name, JvmtiCachedClassFileData *cached_class_file = NULL; Handle class_loader(THREAD, loader_data->class_loader()); bool has_default_methods = false; + bool declares_default_methods = false; ResourceMark rm(THREAD); ClassFileStream* cfs = stream(); @@ -3976,9 +3977,13 @@ instanceKlassHandle ClassFileParser::parseClassFile(Symbol* name, Array* methods = parse_methods(access_flags.is_interface(), &promoted_flags, &has_final_method, - &has_default_methods, + &declares_default_methods, CHECK_(nullHandle)); + if (declares_default_methods) { + has_default_methods = true; + } + // Additional attributes ClassAnnotationCollector parsed_annotations; parse_classfile_attributes(&parsed_annotations, CHECK_(nullHandle)); @@ -4120,6 +4125,7 @@ instanceKlassHandle ClassFileParser::parseClassFile(Symbol* name, this_klass->set_minor_version(minor_version); this_klass->set_major_version(major_version); this_klass->set_has_default_methods(has_default_methods); + this_klass->set_declares_default_methods(declares_default_methods); if (!host_klass.is_null()) { assert (this_klass->is_anonymous(), "should be the same"); diff --git a/hotspot/src/share/vm/classfile/classFileParser.cpp.orig b/hotspot/src/share/vm/classfile/classFileParser.cpp.orig new file mode 100644 index 00000000000..0f2f8d590c4 --- /dev/null +++ b/hotspot/src/share/vm/classfile/classFileParser.cpp.orig @@ -0,0 +1,5274 @@ +/* + * Copyright (c) 1997, 2014, Oracle and/or its affiliates. All rights reserved. + * DO NOT ALTER OR REMOVE COPYRIGHT NOTICES OR THIS FILE HEADER. + * + * This code is free software; you can redistribute it and/or modify it + * under the terms of the GNU General Public License version 2 only, as + * published by the Free Software Foundation. + * + * This code is distributed in the hope that it will be useful, but WITHOUT + * ANY WARRANTY; without even the implied warranty of MERCHANTABILITY or + * FITNESS FOR A PARTICULAR PURPOSE. See the GNU General Public License + * version 2 for more details (a copy is included in the LICENSE file that + * accompanied this code). + * + * You should have received a copy of the GNU General Public License version + * 2 along with this work; if not, write to the Free Software Foundation, + * Inc., 51 Franklin St, Fifth Floor, Boston, MA 02110-1301 USA. + * + * Please contact Oracle, 500 Oracle Parkway, Redwood Shores, CA 94065 USA + * or visit www.oracle.com if you need additional information or have any + * questions. + * + */ + +#include "precompiled.hpp" +#include "classfile/classFileParser.hpp" +#include "classfile/classLoader.hpp" +#include "classfile/classLoaderData.hpp" +#include "classfile/classLoaderData.inline.hpp" +#include "classfile/defaultMethods.hpp" +#include "classfile/javaClasses.hpp" +#include "classfile/symbolTable.hpp" +#include "classfile/systemDictionary.hpp" +#if INCLUDE_CDS +#include "classfile/systemDictionaryShared.hpp" +#endif +#include "classfile/verificationType.hpp" +#include "classfile/verifier.hpp" +#include "classfile/vmSymbols.hpp" +#include "memory/allocation.hpp" +#include "memory/gcLocker.hpp" +#include "memory/metadataFactory.hpp" +#include "memory/oopFactory.hpp" +#include "memory/referenceType.hpp" +#include "memory/universe.inline.hpp" +#include "oops/constantPool.hpp" +#include "oops/fieldStreams.hpp" +#include "oops/instanceKlass.hpp" +#include "oops/instanceMirrorKlass.hpp" +#include "oops/klass.inline.hpp" +#include "oops/klassVtable.hpp" +#include "oops/method.hpp" +#include "oops/symbol.hpp" +#include "prims/jvm.h" +#include "prims/jvmtiExport.hpp" +#include "prims/jvmtiThreadState.hpp" +#include "runtime/javaCalls.hpp" +#include "runtime/perfData.hpp" +#include "runtime/reflection.hpp" +#include "runtime/signature.hpp" +#include "runtime/timer.hpp" +#include "services/classLoadingService.hpp" +#include "services/threadService.hpp" +#include "utilities/array.hpp" +#include "utilities/globalDefinitions.hpp" +#include "utilities/ostream.hpp" + +// We generally try to create the oops directly when parsing, rather than +// allocating temporary data structures and copying the bytes twice. A +// temporary area is only needed when parsing utf8 entries in the constant +// pool and when parsing line number tables. + +// We add assert in debug mode when class format is not checked. + +#define JAVA_CLASSFILE_MAGIC 0xCAFEBABE +#define JAVA_MIN_SUPPORTED_VERSION 45 +#define JAVA_MAX_SUPPORTED_VERSION 52 +#define JAVA_MAX_SUPPORTED_MINOR_VERSION 0 + +// Used for two backward compatibility reasons: +// - to check for new additions to the class file format in JDK1.5 +// - to check for bug fixes in the format checker in JDK1.5 +#define JAVA_1_5_VERSION 49 + +// Used for backward compatibility reasons: +// - to check for javac bug fixes that happened after 1.5 +// - also used as the max version when running in jdk6 +#define JAVA_6_VERSION 50 + +// Used for backward compatibility reasons: +// - to check NameAndType_info signatures more aggressively +#define JAVA_7_VERSION 51 + +// Extension method support. +#define JAVA_8_VERSION 52 + +void ClassFileParser::parse_constant_pool_entries(int length, TRAPS) { + // Use a local copy of ClassFileStream. It helps the C++ compiler to optimize + // this function (_current can be allocated in a register, with scalar + // replacement of aggregates). The _current pointer is copied back to + // stream() when this function returns. DON'T call another method within + // this method that uses stream(). + ClassFileStream* cfs0 = stream(); + ClassFileStream cfs1 = *cfs0; + ClassFileStream* cfs = &cfs1; +#ifdef ASSERT + assert(cfs->allocated_on_stack(),"should be local"); + u1* old_current = cfs0->current(); +#endif + Handle class_loader(THREAD, _loader_data->class_loader()); + + // Used for batching symbol allocations. + const char* names[SymbolTable::symbol_alloc_batch_size]; + int lengths[SymbolTable::symbol_alloc_batch_size]; + int indices[SymbolTable::symbol_alloc_batch_size]; + unsigned int hashValues[SymbolTable::symbol_alloc_batch_size]; + int names_count = 0; + + // parsing Index 0 is unused + for (int index = 1; index < length; index++) { + // Each of the following case guarantees one more byte in the stream + // for the following tag or the access_flags following constant pool, + // so we don't need bounds-check for reading tag. + u1 tag = cfs->get_u1_fast(); + switch (tag) { + case JVM_CONSTANT_Class : + { + cfs->guarantee_more(3, CHECK); // name_index, tag/access_flags + u2 name_index = cfs->get_u2_fast(); + _cp->klass_index_at_put(index, name_index); + } + break; + case JVM_CONSTANT_Fieldref : + { + cfs->guarantee_more(5, CHECK); // class_index, name_and_type_index, tag/access_flags + u2 class_index = cfs->get_u2_fast(); + u2 name_and_type_index = cfs->get_u2_fast(); + _cp->field_at_put(index, class_index, name_and_type_index); + } + break; + case JVM_CONSTANT_Methodref : + { + cfs->guarantee_more(5, CHECK); // class_index, name_and_type_index, tag/access_flags + u2 class_index = cfs->get_u2_fast(); + u2 name_and_type_index = cfs->get_u2_fast(); + _cp->method_at_put(index, class_index, name_and_type_index); + } + break; + case JVM_CONSTANT_InterfaceMethodref : + { + cfs->guarantee_more(5, CHECK); // class_index, name_and_type_index, tag/access_flags + u2 class_index = cfs->get_u2_fast(); + u2 name_and_type_index = cfs->get_u2_fast(); + _cp->interface_method_at_put(index, class_index, name_and_type_index); + } + break; + case JVM_CONSTANT_String : + { + cfs->guarantee_more(3, CHECK); // string_index, tag/access_flags + u2 string_index = cfs->get_u2_fast(); + _cp->string_index_at_put(index, string_index); + } + break; + case JVM_CONSTANT_MethodHandle : + case JVM_CONSTANT_MethodType : + if (_major_version < Verifier::INVOKEDYNAMIC_MAJOR_VERSION) { + classfile_parse_error( + "Class file version does not support constant tag %u in class file %s", + tag, CHECK); + } + if (tag == JVM_CONSTANT_MethodHandle) { + cfs->guarantee_more(4, CHECK); // ref_kind, method_index, tag/access_flags + u1 ref_kind = cfs->get_u1_fast(); + u2 method_index = cfs->get_u2_fast(); + _cp->method_handle_index_at_put(index, ref_kind, method_index); + } else if (tag == JVM_CONSTANT_MethodType) { + cfs->guarantee_more(3, CHECK); // signature_index, tag/access_flags + u2 signature_index = cfs->get_u2_fast(); + _cp->method_type_index_at_put(index, signature_index); + } else { + ShouldNotReachHere(); + } + break; + case JVM_CONSTANT_InvokeDynamic : + { + if (_major_version < Verifier::INVOKEDYNAMIC_MAJOR_VERSION) { + classfile_parse_error( + "Class file version does not support constant tag %u in class file %s", + tag, CHECK); + } + cfs->guarantee_more(5, CHECK); // bsm_index, nt, tag/access_flags + u2 bootstrap_specifier_index = cfs->get_u2_fast(); + u2 name_and_type_index = cfs->get_u2_fast(); + if (_max_bootstrap_specifier_index < (int) bootstrap_specifier_index) + _max_bootstrap_specifier_index = (int) bootstrap_specifier_index; // collect for later + _cp->invoke_dynamic_at_put(index, bootstrap_specifier_index, name_and_type_index); + } + break; + case JVM_CONSTANT_Integer : + { + cfs->guarantee_more(5, CHECK); // bytes, tag/access_flags + u4 bytes = cfs->get_u4_fast(); + _cp->int_at_put(index, (jint) bytes); + } + break; + case JVM_CONSTANT_Float : + { + cfs->guarantee_more(5, CHECK); // bytes, tag/access_flags + u4 bytes = cfs->get_u4_fast(); + _cp->float_at_put(index, *(jfloat*)&bytes); + } + break; + case JVM_CONSTANT_Long : + // A mangled type might cause you to overrun allocated memory + guarantee_property(index+1 < length, + "Invalid constant pool entry %u in class file %s", + index, CHECK); + { + cfs->guarantee_more(9, CHECK); // bytes, tag/access_flags + u8 bytes = cfs->get_u8_fast(); + _cp->long_at_put(index, bytes); + } + index++; // Skip entry following eigth-byte constant, see JVM book p. 98 + break; + case JVM_CONSTANT_Double : + // A mangled type might cause you to overrun allocated memory + guarantee_property(index+1 < length, + "Invalid constant pool entry %u in class file %s", + index, CHECK); + { + cfs->guarantee_more(9, CHECK); // bytes, tag/access_flags + u8 bytes = cfs->get_u8_fast(); + _cp->double_at_put(index, *(jdouble*)&bytes); + } + index++; // Skip entry following eigth-byte constant, see JVM book p. 98 + break; + case JVM_CONSTANT_NameAndType : + { + cfs->guarantee_more(5, CHECK); // name_index, signature_index, tag/access_flags + u2 name_index = cfs->get_u2_fast(); + u2 signature_index = cfs->get_u2_fast(); + _cp->name_and_type_at_put(index, name_index, signature_index); + } + break; + case JVM_CONSTANT_Utf8 : + { + cfs->guarantee_more(2, CHECK); // utf8_length + u2 utf8_length = cfs->get_u2_fast(); + u1* utf8_buffer = cfs->get_u1_buffer(); + assert(utf8_buffer != NULL, "null utf8 buffer"); + // Got utf8 string, guarantee utf8_length+1 bytes, set stream position forward. + cfs->guarantee_more(utf8_length+1, CHECK); // utf8 string, tag/access_flags + cfs->skip_u1_fast(utf8_length); + + // Before storing the symbol, make sure it's legal + if (_need_verify) { + verify_legal_utf8((unsigned char*)utf8_buffer, utf8_length, CHECK); + } + + if (has_cp_patch_at(index)) { + Handle patch = clear_cp_patch_at(index); + guarantee_property(java_lang_String::is_instance(patch()), + "Illegal utf8 patch at %d in class file %s", + index, CHECK); + char* str = java_lang_String::as_utf8_string(patch()); + // (could use java_lang_String::as_symbol instead, but might as well batch them) + utf8_buffer = (u1*) str; + utf8_length = (int) strlen(str); + } + + unsigned int hash; + Symbol* result = SymbolTable::lookup_only((char*)utf8_buffer, utf8_length, hash); + if (result == NULL) { + names[names_count] = (char*)utf8_buffer; + lengths[names_count] = utf8_length; + indices[names_count] = index; + hashValues[names_count++] = hash; + if (names_count == SymbolTable::symbol_alloc_batch_size) { + SymbolTable::new_symbols(_loader_data, _cp, names_count, names, lengths, indices, hashValues, CHECK); + names_count = 0; + } + } else { + _cp->symbol_at_put(index, result); + } + } + break; + default: + classfile_parse_error( + "Unknown constant tag %u in class file %s", tag, CHECK); + break; + } + } + + // Allocate the remaining symbols + if (names_count > 0) { + SymbolTable::new_symbols(_loader_data, _cp, names_count, names, lengths, indices, hashValues, CHECK); + } + + // Copy _current pointer of local copy back to stream(). +#ifdef ASSERT + assert(cfs0->current() == old_current, "non-exclusive use of stream()"); +#endif + cfs0->set_current(cfs1.current()); +} + +bool inline valid_cp_range(int index, int length) { return (index > 0 && index < length); } + +inline Symbol* check_symbol_at(constantPoolHandle cp, int index) { + if (valid_cp_range(index, cp->length()) && cp->tag_at(index).is_utf8()) + return cp->symbol_at(index); + else + return NULL; +} + +constantPoolHandle ClassFileParser::parse_constant_pool(TRAPS) { + ClassFileStream* cfs = stream(); + constantPoolHandle nullHandle; + + cfs->guarantee_more(3, CHECK_(nullHandle)); // length, first cp tag + u2 length = cfs->get_u2_fast(); + guarantee_property( + length >= 1, "Illegal constant pool size %u in class file %s", + length, CHECK_(nullHandle)); + ConstantPool* constant_pool = ConstantPool::allocate(_loader_data, length, + CHECK_(nullHandle)); + _cp = constant_pool; // save in case of errors + constantPoolHandle cp (THREAD, constant_pool); + + // parsing constant pool entries + parse_constant_pool_entries(length, CHECK_(nullHandle)); + + int index = 1; // declared outside of loops for portability + + // first verification pass - validate cross references and fixup class and string constants + for (index = 1; index < length; index++) { // Index 0 is unused + jbyte tag = cp->tag_at(index).value(); + switch (tag) { + case JVM_CONSTANT_Class : + ShouldNotReachHere(); // Only JVM_CONSTANT_ClassIndex should be present + break; + case JVM_CONSTANT_Fieldref : + // fall through + case JVM_CONSTANT_Methodref : + // fall through + case JVM_CONSTANT_InterfaceMethodref : { + if (!_need_verify) break; + int klass_ref_index = cp->klass_ref_index_at(index); + int name_and_type_ref_index = cp->name_and_type_ref_index_at(index); + check_property(valid_klass_reference_at(klass_ref_index), + "Invalid constant pool index %u in class file %s", + klass_ref_index, + CHECK_(nullHandle)); + check_property(valid_cp_range(name_and_type_ref_index, length) && + cp->tag_at(name_and_type_ref_index).is_name_and_type(), + "Invalid constant pool index %u in class file %s", + name_and_type_ref_index, + CHECK_(nullHandle)); + break; + } + case JVM_CONSTANT_String : + ShouldNotReachHere(); // Only JVM_CONSTANT_StringIndex should be present + break; + case JVM_CONSTANT_Integer : + break; + case JVM_CONSTANT_Float : + break; + case JVM_CONSTANT_Long : + case JVM_CONSTANT_Double : + index++; + check_property( + (index < length && cp->tag_at(index).is_invalid()), + "Improper constant pool long/double index %u in class file %s", + index, CHECK_(nullHandle)); + break; + case JVM_CONSTANT_NameAndType : { + if (!_need_verify) break; + int name_ref_index = cp->name_ref_index_at(index); + int signature_ref_index = cp->signature_ref_index_at(index); + check_property(valid_symbol_at(name_ref_index), + "Invalid constant pool index %u in class file %s", + name_ref_index, CHECK_(nullHandle)); + check_property(valid_symbol_at(signature_ref_index), + "Invalid constant pool index %u in class file %s", + signature_ref_index, CHECK_(nullHandle)); + break; + } + case JVM_CONSTANT_Utf8 : + break; + case JVM_CONSTANT_UnresolvedClass : // fall-through + case JVM_CONSTANT_UnresolvedClassInError: + ShouldNotReachHere(); // Only JVM_CONSTANT_ClassIndex should be present + break; + case JVM_CONSTANT_ClassIndex : + { + int class_index = cp->klass_index_at(index); + check_property(valid_symbol_at(class_index), + "Invalid constant pool index %u in class file %s", + class_index, CHECK_(nullHandle)); + cp->unresolved_klass_at_put(index, cp->symbol_at(class_index)); + } + break; + case JVM_CONSTANT_StringIndex : + { + int string_index = cp->string_index_at(index); + check_property(valid_symbol_at(string_index), + "Invalid constant pool index %u in class file %s", + string_index, CHECK_(nullHandle)); + Symbol* sym = cp->symbol_at(string_index); + cp->unresolved_string_at_put(index, sym); + } + break; + case JVM_CONSTANT_MethodHandle : + { + int ref_index = cp->method_handle_index_at(index); + check_property( + valid_cp_range(ref_index, length), + "Invalid constant pool index %u in class file %s", + ref_index, CHECK_(nullHandle)); + constantTag tag = cp->tag_at(ref_index); + int ref_kind = cp->method_handle_ref_kind_at(index); + switch (ref_kind) { + case JVM_REF_getField: + case JVM_REF_getStatic: + case JVM_REF_putField: + case JVM_REF_putStatic: + check_property( + tag.is_field(), + "Invalid constant pool index %u in class file %s (not a field)", + ref_index, CHECK_(nullHandle)); + break; + case JVM_REF_invokeVirtual: + case JVM_REF_newInvokeSpecial: + check_property( + tag.is_method(), + "Invalid constant pool index %u in class file %s (not a method)", + ref_index, CHECK_(nullHandle)); + break; + case JVM_REF_invokeStatic: + case JVM_REF_invokeSpecial: + check_property(tag.is_method() || + ((_major_version >= JAVA_8_VERSION) && tag.is_interface_method()), + "Invalid constant pool index %u in class file %s (not a method)", + ref_index, CHECK_(nullHandle)); + break; + case JVM_REF_invokeInterface: + check_property( + tag.is_interface_method(), + "Invalid constant pool index %u in class file %s (not an interface method)", + ref_index, CHECK_(nullHandle)); + break; + default: + classfile_parse_error( + "Bad method handle kind at constant pool index %u in class file %s", + index, CHECK_(nullHandle)); + } + // Keep the ref_index unchanged. It will be indirected at link-time. + } + break; + case JVM_CONSTANT_MethodType : + { + int ref_index = cp->method_type_index_at(index); + check_property(valid_symbol_at(ref_index), + "Invalid constant pool index %u in class file %s", + ref_index, CHECK_(nullHandle)); + } + break; + case JVM_CONSTANT_InvokeDynamic : + { + int name_and_type_ref_index = cp->invoke_dynamic_name_and_type_ref_index_at(index); + check_property(valid_cp_range(name_and_type_ref_index, length) && + cp->tag_at(name_and_type_ref_index).is_name_and_type(), + "Invalid constant pool index %u in class file %s", + name_and_type_ref_index, + CHECK_(nullHandle)); + // bootstrap specifier index must be checked later, when BootstrapMethods attr is available + break; + } + default: + fatal(err_msg("bad constant pool tag value %u", + cp->tag_at(index).value())); + ShouldNotReachHere(); + break; + } // end of switch + } // end of for + + if (_cp_patches != NULL) { + // need to treat this_class specially... + int this_class_index; + { + cfs->guarantee_more(8, CHECK_(nullHandle)); // flags, this_class, super_class, infs_len + u1* mark = cfs->current(); + u2 flags = cfs->get_u2_fast(); + this_class_index = cfs->get_u2_fast(); + cfs->set_current(mark); // revert to mark + } + + for (index = 1; index < length; index++) { // Index 0 is unused + if (has_cp_patch_at(index)) { + guarantee_property(index != this_class_index, + "Illegal constant pool patch to self at %d in class file %s", + index, CHECK_(nullHandle)); + patch_constant_pool(cp, index, cp_patch_at(index), CHECK_(nullHandle)); + } + } + } + + if (!_need_verify) { + return cp; + } + + // second verification pass - checks the strings are of the right format. + // but not yet to the other entries + for (index = 1; index < length; index++) { + jbyte tag = cp->tag_at(index).value(); + switch (tag) { + case JVM_CONSTANT_UnresolvedClass: { + Symbol* class_name = cp->klass_name_at(index); + // check the name, even if _cp_patches will overwrite it + verify_legal_class_name(class_name, CHECK_(nullHandle)); + break; + } + case JVM_CONSTANT_NameAndType: { + if (_need_verify && _major_version >= JAVA_7_VERSION) { + int sig_index = cp->signature_ref_index_at(index); + int name_index = cp->name_ref_index_at(index); + Symbol* name = cp->symbol_at(name_index); + Symbol* sig = cp->symbol_at(sig_index); + if (sig->byte_at(0) == JVM_SIGNATURE_FUNC) { + verify_legal_method_signature(name, sig, CHECK_(nullHandle)); + } else { + verify_legal_field_signature(name, sig, CHECK_(nullHandle)); + } + } + break; + } + case JVM_CONSTANT_InvokeDynamic: + case JVM_CONSTANT_Fieldref: + case JVM_CONSTANT_Methodref: + case JVM_CONSTANT_InterfaceMethodref: { + int name_and_type_ref_index = cp->name_and_type_ref_index_at(index); + // already verified to be utf8 + int name_ref_index = cp->name_ref_index_at(name_and_type_ref_index); + // already verified to be utf8 + int signature_ref_index = cp->signature_ref_index_at(name_and_type_ref_index); + Symbol* name = cp->symbol_at(name_ref_index); + Symbol* signature = cp->symbol_at(signature_ref_index); + if (tag == JVM_CONSTANT_Fieldref) { + verify_legal_field_name(name, CHECK_(nullHandle)); + if (_need_verify && _major_version >= JAVA_7_VERSION) { + // Signature is verified above, when iterating NameAndType_info. + // Need only to be sure it's the right type. + if (signature->byte_at(0) == JVM_SIGNATURE_FUNC) { + throwIllegalSignature( + "Field", name, signature, CHECK_(nullHandle)); + } + } else { + verify_legal_field_signature(name, signature, CHECK_(nullHandle)); + } + } else { + verify_legal_method_name(name, CHECK_(nullHandle)); + if (_need_verify && _major_version >= JAVA_7_VERSION) { + // Signature is verified above, when iterating NameAndType_info. + // Need only to be sure it's the right type. + if (signature->byte_at(0) != JVM_SIGNATURE_FUNC) { + throwIllegalSignature( + "Method", name, signature, CHECK_(nullHandle)); + } + } else { + verify_legal_method_signature(name, signature, CHECK_(nullHandle)); + } + if (tag == JVM_CONSTANT_Methodref) { + // 4509014: If a class method name begins with '<', it must be "". + assert(name != NULL, "method name in constant pool is null"); + unsigned int name_len = name->utf8_length(); + assert(name_len > 0, "bad method name"); // already verified as legal name + if (name->byte_at(0) == '<') { + if (name != vmSymbols::object_initializer_name()) { + classfile_parse_error( + "Bad method name at constant pool index %u in class file %s", + name_ref_index, CHECK_(nullHandle)); + } + } + } + } + break; + } + case JVM_CONSTANT_MethodHandle: { + int ref_index = cp->method_handle_index_at(index); + int ref_kind = cp->method_handle_ref_kind_at(index); + switch (ref_kind) { + case JVM_REF_invokeVirtual: + case JVM_REF_invokeStatic: + case JVM_REF_invokeSpecial: + case JVM_REF_newInvokeSpecial: + { + int name_and_type_ref_index = cp->name_and_type_ref_index_at(ref_index); + int name_ref_index = cp->name_ref_index_at(name_and_type_ref_index); + Symbol* name = cp->symbol_at(name_ref_index); + if (ref_kind == JVM_REF_newInvokeSpecial) { + if (name != vmSymbols::object_initializer_name()) { + classfile_parse_error( + "Bad constructor name at constant pool index %u in class file %s", + name_ref_index, CHECK_(nullHandle)); + } + } else { + if (name == vmSymbols::object_initializer_name()) { + classfile_parse_error( + "Bad method name at constant pool index %u in class file %s", + name_ref_index, CHECK_(nullHandle)); + } + } + } + break; + // Other ref_kinds are already fully checked in previous pass. + } + break; + } + case JVM_CONSTANT_MethodType: { + Symbol* no_name = vmSymbols::type_name(); // place holder + Symbol* signature = cp->method_type_signature_at(index); + verify_legal_method_signature(no_name, signature, CHECK_(nullHandle)); + break; + } + case JVM_CONSTANT_Utf8: { + assert(cp->symbol_at(index)->refcount() != 0, "count corrupted"); + } + } // end of switch + } // end of for + + return cp; +} + + +void ClassFileParser::patch_constant_pool(constantPoolHandle cp, int index, Handle patch, TRAPS) { + BasicType patch_type = T_VOID; + + switch (cp->tag_at(index).value()) { + + case JVM_CONSTANT_UnresolvedClass : + // Patching a class means pre-resolving it. + // The name in the constant pool is ignored. + if (java_lang_Class::is_instance(patch())) { + guarantee_property(!java_lang_Class::is_primitive(patch()), + "Illegal class patch at %d in class file %s", + index, CHECK); + cp->klass_at_put(index, java_lang_Class::as_Klass(patch())); + } else { + guarantee_property(java_lang_String::is_instance(patch()), + "Illegal class patch at %d in class file %s", + index, CHECK); + Symbol* name = java_lang_String::as_symbol(patch(), CHECK); + cp->unresolved_klass_at_put(index, name); + } + break; + + case JVM_CONSTANT_String : + // skip this patch and don't clear it. Needs the oop array for resolved + // references to be created first. + return; + + case JVM_CONSTANT_Integer : patch_type = T_INT; goto patch_prim; + case JVM_CONSTANT_Float : patch_type = T_FLOAT; goto patch_prim; + case JVM_CONSTANT_Long : patch_type = T_LONG; goto patch_prim; + case JVM_CONSTANT_Double : patch_type = T_DOUBLE; goto patch_prim; + patch_prim: + { + jvalue value; + BasicType value_type = java_lang_boxing_object::get_value(patch(), &value); + guarantee_property(value_type == patch_type, + "Illegal primitive patch at %d in class file %s", + index, CHECK); + switch (value_type) { + case T_INT: cp->int_at_put(index, value.i); break; + case T_FLOAT: cp->float_at_put(index, value.f); break; + case T_LONG: cp->long_at_put(index, value.j); break; + case T_DOUBLE: cp->double_at_put(index, value.d); break; + default: assert(false, ""); + } + } + break; + + default: + // %%% TODO: put method handles into CONSTANT_InterfaceMethodref, etc. + guarantee_property(!has_cp_patch_at(index), + "Illegal unexpected patch at %d in class file %s", + index, CHECK); + return; + } + + // On fall-through, mark the patch as used. + clear_cp_patch_at(index); +} + + + +class NameSigHash: public ResourceObj { + public: + Symbol* _name; // name + Symbol* _sig; // signature + NameSigHash* _next; // Next entry in hash table +}; + + +#define HASH_ROW_SIZE 256 + +unsigned int hash(Symbol* name, Symbol* sig) { + unsigned int raw_hash = 0; + raw_hash += ((unsigned int)(uintptr_t)name) >> (LogHeapWordSize + 2); + raw_hash += ((unsigned int)(uintptr_t)sig) >> LogHeapWordSize; + + return (raw_hash + (unsigned int)(uintptr_t)name) % HASH_ROW_SIZE; +} + + +void initialize_hashtable(NameSigHash** table) { + memset((void*)table, 0, sizeof(NameSigHash*) * HASH_ROW_SIZE); +} + +// Return false if the name/sig combination is found in table. +// Return true if no duplicate is found. And name/sig is added as a new entry in table. +// The old format checker uses heap sort to find duplicates. +// NOTE: caller should guarantee that GC doesn't happen during the life cycle +// of table since we don't expect Symbol*'s to move. +bool put_after_lookup(Symbol* name, Symbol* sig, NameSigHash** table) { + assert(name != NULL, "name in constant pool is NULL"); + + // First lookup for duplicates + int index = hash(name, sig); + NameSigHash* entry = table[index]; + while (entry != NULL) { + if (entry->_name == name && entry->_sig == sig) { + return false; + } + entry = entry->_next; + } + + // No duplicate is found, allocate a new entry and fill it. + entry = new NameSigHash(); + entry->_name = name; + entry->_sig = sig; + + // Insert into hash table + entry->_next = table[index]; + table[index] = entry; + + return true; +} + + +Array* ClassFileParser::parse_interfaces(int length, + Handle protection_domain, + Symbol* class_name, + bool* has_default_methods, + TRAPS) { + if (length == 0) { + _local_interfaces = Universe::the_empty_klass_array(); + } else { + ClassFileStream* cfs = stream(); + assert(length > 0, "only called for length>0"); + _local_interfaces = MetadataFactory::new_array(_loader_data, length, NULL, CHECK_NULL); + + int index; + for (index = 0; index < length; index++) { + u2 interface_index = cfs->get_u2(CHECK_NULL); + KlassHandle interf; + check_property( + valid_klass_reference_at(interface_index), + "Interface name has bad constant pool index %u in class file %s", + interface_index, CHECK_NULL); + if (_cp->tag_at(interface_index).is_klass()) { + interf = KlassHandle(THREAD, _cp->resolved_klass_at(interface_index)); + } else { + Symbol* unresolved_klass = _cp->klass_name_at(interface_index); + + // Don't need to check legal name because it's checked when parsing constant pool. + // But need to make sure it's not an array type. + guarantee_property(unresolved_klass->byte_at(0) != JVM_SIGNATURE_ARRAY, + "Bad interface name in class file %s", CHECK_NULL); + Handle class_loader(THREAD, _loader_data->class_loader()); + + // Call resolve_super so classcircularity is checked + Klass* k = SystemDictionary::resolve_super_or_fail(class_name, + unresolved_klass, class_loader, protection_domain, + false, CHECK_NULL); + interf = KlassHandle(THREAD, k); + } + + if (!interf()->is_interface()) { + THROW_MSG_(vmSymbols::java_lang_IncompatibleClassChangeError(), "Implementing class", NULL); + } + if (InstanceKlass::cast(interf())->has_default_methods()) { + *has_default_methods = true; + } + _local_interfaces->at_put(index, interf()); + } + + if (!_need_verify || length <= 1) { + return _local_interfaces; + } + + // Check if there's any duplicates in interfaces + ResourceMark rm(THREAD); + NameSigHash** interface_names = NEW_RESOURCE_ARRAY_IN_THREAD( + THREAD, NameSigHash*, HASH_ROW_SIZE); + initialize_hashtable(interface_names); + bool dup = false; + { + debug_only(No_Safepoint_Verifier nsv;) + for (index = 0; index < length; index++) { + Klass* k = _local_interfaces->at(index); + Symbol* name = InstanceKlass::cast(k)->name(); + // If no duplicates, add (name, NULL) in hashtable interface_names. + if (!put_after_lookup(name, NULL, interface_names)) { + dup = true; + break; + } + } + } + if (dup) { + classfile_parse_error("Duplicate interface name in class file %s", CHECK_NULL); + } + } + return _local_interfaces; +} + + +void ClassFileParser::verify_constantvalue(int constantvalue_index, int signature_index, TRAPS) { + // Make sure the constant pool entry is of a type appropriate to this field + guarantee_property( + (constantvalue_index > 0 && + constantvalue_index < _cp->length()), + "Bad initial value index %u in ConstantValue attribute in class file %s", + constantvalue_index, CHECK); + constantTag value_type = _cp->tag_at(constantvalue_index); + switch ( _cp->basic_type_for_signature_at(signature_index) ) { + case T_LONG: + guarantee_property(value_type.is_long(), "Inconsistent constant value type in class file %s", CHECK); + break; + case T_FLOAT: + guarantee_property(value_type.is_float(), "Inconsistent constant value type in class file %s", CHECK); + break; + case T_DOUBLE: + guarantee_property(value_type.is_double(), "Inconsistent constant value type in class file %s", CHECK); + break; + case T_BYTE: case T_CHAR: case T_SHORT: case T_BOOLEAN: case T_INT: + guarantee_property(value_type.is_int(), "Inconsistent constant value type in class file %s", CHECK); + break; + case T_OBJECT: + guarantee_property((_cp->symbol_at(signature_index)->equals("Ljava/lang/String;") + && value_type.is_string()), + "Bad string initial value in class file %s", CHECK); + break; + default: + classfile_parse_error( + "Unable to set initial value %u in class file %s", + constantvalue_index, CHECK); + } +} + + +// Parse attributes for a field. +void ClassFileParser::parse_field_attributes(u2 attributes_count, + bool is_static, u2 signature_index, + u2* constantvalue_index_addr, + bool* is_synthetic_addr, + u2* generic_signature_index_addr, + ClassFileParser::FieldAnnotationCollector* parsed_annotations, + TRAPS) { + ClassFileStream* cfs = stream(); + assert(attributes_count > 0, "length should be greater than 0"); + u2 constantvalue_index = 0; + u2 generic_signature_index = 0; + bool is_synthetic = false; + u1* runtime_visible_annotations = NULL; + int runtime_visible_annotations_length = 0; + u1* runtime_invisible_annotations = NULL; + int runtime_invisible_annotations_length = 0; + u1* runtime_visible_type_annotations = NULL; + int runtime_visible_type_annotations_length = 0; + u1* runtime_invisible_type_annotations = NULL; + int runtime_invisible_type_annotations_length = 0; + bool runtime_invisible_annotations_exists = false; + bool runtime_invisible_type_annotations_exists = false; + while (attributes_count--) { + cfs->guarantee_more(6, CHECK); // attribute_name_index, attribute_length + u2 attribute_name_index = cfs->get_u2_fast(); + u4 attribute_length = cfs->get_u4_fast(); + check_property(valid_symbol_at(attribute_name_index), + "Invalid field attribute index %u in class file %s", + attribute_name_index, + CHECK); + Symbol* attribute_name = _cp->symbol_at(attribute_name_index); + if (is_static && attribute_name == vmSymbols::tag_constant_value()) { + // ignore if non-static + if (constantvalue_index != 0) { + classfile_parse_error("Duplicate ConstantValue attribute in class file %s", CHECK); + } + check_property( + attribute_length == 2, + "Invalid ConstantValue field attribute length %u in class file %s", + attribute_length, CHECK); + constantvalue_index = cfs->get_u2(CHECK); + if (_need_verify) { + verify_constantvalue(constantvalue_index, signature_index, CHECK); + } + } else if (attribute_name == vmSymbols::tag_synthetic()) { + if (attribute_length != 0) { + classfile_parse_error( + "Invalid Synthetic field attribute length %u in class file %s", + attribute_length, CHECK); + } + is_synthetic = true; + } else if (attribute_name == vmSymbols::tag_deprecated()) { // 4276120 + if (attribute_length != 0) { + classfile_parse_error( + "Invalid Deprecated field attribute length %u in class file %s", + attribute_length, CHECK); + } + } else if (_major_version >= JAVA_1_5_VERSION) { + if (attribute_name == vmSymbols::tag_signature()) { + if (attribute_length != 2) { + classfile_parse_error( + "Wrong size %u for field's Signature attribute in class file %s", + attribute_length, CHECK); + } + generic_signature_index = parse_generic_signature_attribute(CHECK); + } else if (attribute_name == vmSymbols::tag_runtime_visible_annotations()) { + if (runtime_visible_annotations != NULL) { + classfile_parse_error( + "Multiple RuntimeVisibleAnnotations attributes for field in class file %s", CHECK); + } + runtime_visible_annotations_length = attribute_length; + runtime_visible_annotations = cfs->get_u1_buffer(); + assert(runtime_visible_annotations != NULL, "null visible annotations"); + parse_annotations(runtime_visible_annotations, + runtime_visible_annotations_length, + parsed_annotations, + CHECK); + cfs->skip_u1(runtime_visible_annotations_length, CHECK); + } else if (attribute_name == vmSymbols::tag_runtime_invisible_annotations()) { + if (runtime_invisible_annotations_exists) { + classfile_parse_error( + "Multiple RuntimeInvisibleAnnotations attributes for field in class file %s", CHECK); + } + runtime_invisible_annotations_exists = true; + if (PreserveAllAnnotations) { + runtime_invisible_annotations_length = attribute_length; + runtime_invisible_annotations = cfs->get_u1_buffer(); + assert(runtime_invisible_annotations != NULL, "null invisible annotations"); + } + cfs->skip_u1(attribute_length, CHECK); + } else if (attribute_name == vmSymbols::tag_runtime_visible_type_annotations()) { + if (runtime_visible_type_annotations != NULL) { + classfile_parse_error( + "Multiple RuntimeVisibleTypeAnnotations attributes for field in class file %s", CHECK); + } + runtime_visible_type_annotations_length = attribute_length; + runtime_visible_type_annotations = cfs->get_u1_buffer(); + assert(runtime_visible_type_annotations != NULL, "null visible type annotations"); + cfs->skip_u1(runtime_visible_type_annotations_length, CHECK); + } else if (attribute_name == vmSymbols::tag_runtime_invisible_type_annotations()) { + if (runtime_invisible_type_annotations_exists) { + classfile_parse_error( + "Multiple RuntimeInvisibleTypeAnnotations attributes for field in class file %s", CHECK); + } else { + runtime_invisible_type_annotations_exists = true; + } + if (PreserveAllAnnotations) { + runtime_invisible_type_annotations_length = attribute_length; + runtime_invisible_type_annotations = cfs->get_u1_buffer(); + assert(runtime_invisible_type_annotations != NULL, "null invisible type annotations"); + } + cfs->skip_u1(attribute_length, CHECK); + } else { + cfs->skip_u1(attribute_length, CHECK); // Skip unknown attributes + } + } else { + cfs->skip_u1(attribute_length, CHECK); // Skip unknown attributes + } + } + + *constantvalue_index_addr = constantvalue_index; + *is_synthetic_addr = is_synthetic; + *generic_signature_index_addr = generic_signature_index; + AnnotationArray* a = assemble_annotations(runtime_visible_annotations, + runtime_visible_annotations_length, + runtime_invisible_annotations, + runtime_invisible_annotations_length, + CHECK); + parsed_annotations->set_field_annotations(a); + a = assemble_annotations(runtime_visible_type_annotations, + runtime_visible_type_annotations_length, + runtime_invisible_type_annotations, + runtime_invisible_type_annotations_length, + CHECK); + parsed_annotations->set_field_type_annotations(a); + return; +} + + +// Field allocation types. Used for computing field offsets. + +enum FieldAllocationType { + STATIC_OOP, // Oops + STATIC_BYTE, // Boolean, Byte, char + STATIC_SHORT, // shorts + STATIC_WORD, // ints + STATIC_DOUBLE, // aligned long or double + NONSTATIC_OOP, + NONSTATIC_BYTE, + NONSTATIC_SHORT, + NONSTATIC_WORD, + NONSTATIC_DOUBLE, + MAX_FIELD_ALLOCATION_TYPE, + BAD_ALLOCATION_TYPE = -1 +}; + +static FieldAllocationType _basic_type_to_atype[2 * (T_CONFLICT + 1)] = { + BAD_ALLOCATION_TYPE, // 0 + BAD_ALLOCATION_TYPE, // 1 + BAD_ALLOCATION_TYPE, // 2 + BAD_ALLOCATION_TYPE, // 3 + NONSTATIC_BYTE , // T_BOOLEAN = 4, + NONSTATIC_SHORT, // T_CHAR = 5, + NONSTATIC_WORD, // T_FLOAT = 6, + NONSTATIC_DOUBLE, // T_DOUBLE = 7, + NONSTATIC_BYTE, // T_BYTE = 8, + NONSTATIC_SHORT, // T_SHORT = 9, + NONSTATIC_WORD, // T_INT = 10, + NONSTATIC_DOUBLE, // T_LONG = 11, + NONSTATIC_OOP, // T_OBJECT = 12, + NONSTATIC_OOP, // T_ARRAY = 13, + BAD_ALLOCATION_TYPE, // T_VOID = 14, + BAD_ALLOCATION_TYPE, // T_ADDRESS = 15, + BAD_ALLOCATION_TYPE, // T_NARROWOOP = 16, + BAD_ALLOCATION_TYPE, // T_METADATA = 17, + BAD_ALLOCATION_TYPE, // T_NARROWKLASS = 18, + BAD_ALLOCATION_TYPE, // T_CONFLICT = 19, + BAD_ALLOCATION_TYPE, // 0 + BAD_ALLOCATION_TYPE, // 1 + BAD_ALLOCATION_TYPE, // 2 + BAD_ALLOCATION_TYPE, // 3 + STATIC_BYTE , // T_BOOLEAN = 4, + STATIC_SHORT, // T_CHAR = 5, + STATIC_WORD, // T_FLOAT = 6, + STATIC_DOUBLE, // T_DOUBLE = 7, + STATIC_BYTE, // T_BYTE = 8, + STATIC_SHORT, // T_SHORT = 9, + STATIC_WORD, // T_INT = 10, + STATIC_DOUBLE, // T_LONG = 11, + STATIC_OOP, // T_OBJECT = 12, + STATIC_OOP, // T_ARRAY = 13, + BAD_ALLOCATION_TYPE, // T_VOID = 14, + BAD_ALLOCATION_TYPE, // T_ADDRESS = 15, + BAD_ALLOCATION_TYPE, // T_NARROWOOP = 16, + BAD_ALLOCATION_TYPE, // T_METADATA = 17, + BAD_ALLOCATION_TYPE, // T_NARROWKLASS = 18, + BAD_ALLOCATION_TYPE, // T_CONFLICT = 19, +}; + +static FieldAllocationType basic_type_to_atype(bool is_static, BasicType type) { + assert(type >= T_BOOLEAN && type < T_VOID, "only allowable values"); + FieldAllocationType result = _basic_type_to_atype[type + (is_static ? (T_CONFLICT + 1) : 0)]; + assert(result != BAD_ALLOCATION_TYPE, "bad type"); + return result; +} + +class FieldAllocationCount: public ResourceObj { + public: + u2 count[MAX_FIELD_ALLOCATION_TYPE]; + + FieldAllocationCount() { + for (int i = 0; i < MAX_FIELD_ALLOCATION_TYPE; i++) { + count[i] = 0; + } + } + + FieldAllocationType update(bool is_static, BasicType type) { + FieldAllocationType atype = basic_type_to_atype(is_static, type); + // Make sure there is no overflow with injected fields. + assert(count[atype] < 0xFFFF, "More than 65535 fields"); + count[atype]++; + return atype; + } +}; + +Array* ClassFileParser::parse_fields(Symbol* class_name, + bool is_interface, + FieldAllocationCount *fac, + u2* java_fields_count_ptr, TRAPS) { + ClassFileStream* cfs = stream(); + cfs->guarantee_more(2, CHECK_NULL); // length + u2 length = cfs->get_u2_fast(); + *java_fields_count_ptr = length; + + int num_injected = 0; + InjectedField* injected = JavaClasses::get_injected(class_name, &num_injected); + int total_fields = length + num_injected; + + // The field array starts with tuples of shorts + // [access, name index, sig index, initial value index, byte offset]. + // A generic signature slot only exists for field with generic + // signature attribute. And the access flag is set with + // JVM_ACC_FIELD_HAS_GENERIC_SIGNATURE for that field. The generic + // signature slots are at the end of the field array and after all + // other fields data. + // + // f1: [access, name index, sig index, initial value index, low_offset, high_offset] + // f2: [access, name index, sig index, initial value index, low_offset, high_offset] + // ... + // fn: [access, name index, sig index, initial value index, low_offset, high_offset] + // [generic signature index] + // [generic signature index] + // ... + // + // Allocate a temporary resource array for field data. For each field, + // a slot is reserved in the temporary array for the generic signature + // index. After parsing all fields, the data are copied to a permanent + // array and any unused slots will be discarded. + ResourceMark rm(THREAD); + u2* fa = NEW_RESOURCE_ARRAY_IN_THREAD( + THREAD, u2, total_fields * (FieldInfo::field_slots + 1)); + + // The generic signature slots start after all other fields' data. + int generic_signature_slot = total_fields * FieldInfo::field_slots; + int num_generic_signature = 0; + for (int n = 0; n < length; n++) { + cfs->guarantee_more(8, CHECK_NULL); // access_flags, name_index, descriptor_index, attributes_count + + AccessFlags access_flags; + jint flags = cfs->get_u2_fast() & JVM_RECOGNIZED_FIELD_MODIFIERS; + verify_legal_field_modifiers(flags, is_interface, CHECK_NULL); + access_flags.set_flags(flags); + + u2 name_index = cfs->get_u2_fast(); + int cp_size = _cp->length(); + check_property(valid_symbol_at(name_index), + "Invalid constant pool index %u for field name in class file %s", + name_index, + CHECK_NULL); + Symbol* name = _cp->symbol_at(name_index); + verify_legal_field_name(name, CHECK_NULL); + + u2 signature_index = cfs->get_u2_fast(); + check_property(valid_symbol_at(signature_index), + "Invalid constant pool index %u for field signature in class file %s", + signature_index, CHECK_NULL); + Symbol* sig = _cp->symbol_at(signature_index); + verify_legal_field_signature(name, sig, CHECK_NULL); + + u2 constantvalue_index = 0; + bool is_synthetic = false; + u2 generic_signature_index = 0; + bool is_static = access_flags.is_static(); + FieldAnnotationCollector parsed_annotations(_loader_data); + + u2 attributes_count = cfs->get_u2_fast(); + if (attributes_count > 0) { + parse_field_attributes(attributes_count, is_static, signature_index, + &constantvalue_index, &is_synthetic, + &generic_signature_index, &parsed_annotations, + CHECK_NULL); + if (parsed_annotations.field_annotations() != NULL) { + if (_fields_annotations == NULL) { + _fields_annotations = MetadataFactory::new_array( + _loader_data, length, NULL, + CHECK_NULL); + } + _fields_annotations->at_put(n, parsed_annotations.field_annotations()); + parsed_annotations.set_field_annotations(NULL); + } + if (parsed_annotations.field_type_annotations() != NULL) { + if (_fields_type_annotations == NULL) { + _fields_type_annotations = MetadataFactory::new_array( + _loader_data, length, NULL, + CHECK_NULL); + } + _fields_type_annotations->at_put(n, parsed_annotations.field_type_annotations()); + parsed_annotations.set_field_type_annotations(NULL); + } + + if (is_synthetic) { + access_flags.set_is_synthetic(); + } + if (generic_signature_index != 0) { + access_flags.set_field_has_generic_signature(); + fa[generic_signature_slot] = generic_signature_index; + generic_signature_slot ++; + num_generic_signature ++; + } + } + + FieldInfo* field = FieldInfo::from_field_array(fa, n); + field->initialize(access_flags.as_short(), + name_index, + signature_index, + constantvalue_index); + BasicType type = _cp->basic_type_for_signature_at(signature_index); + + // Remember how many oops we encountered and compute allocation type + FieldAllocationType atype = fac->update(is_static, type); + field->set_allocation_type(atype); + + // After field is initialized with type, we can augment it with aux info + if (parsed_annotations.has_any_annotations()) + parsed_annotations.apply_to(field); + } + + int index = length; + if (num_injected != 0) { + for (int n = 0; n < num_injected; n++) { + // Check for duplicates + if (injected[n].may_be_java) { + Symbol* name = injected[n].name(); + Symbol* signature = injected[n].signature(); + bool duplicate = false; + for (int i = 0; i < length; i++) { + FieldInfo* f = FieldInfo::from_field_array(fa, i); + if (name == _cp->symbol_at(f->name_index()) && + signature == _cp->symbol_at(f->signature_index())) { + // Symbol is desclared in Java so skip this one + duplicate = true; + break; + } + } + if (duplicate) { + // These will be removed from the field array at the end + continue; + } + } + + // Injected field + FieldInfo* field = FieldInfo::from_field_array(fa, index); + field->initialize(JVM_ACC_FIELD_INTERNAL, + injected[n].name_index, + injected[n].signature_index, + 0); + + BasicType type = FieldType::basic_type(injected[n].signature()); + + // Remember how many oops we encountered and compute allocation type + FieldAllocationType atype = fac->update(false, type); + field->set_allocation_type(atype); + index++; + } + } + + // Now copy the fields' data from the temporary resource array. + // Sometimes injected fields already exist in the Java source so + // the fields array could be too long. In that case the + // fields array is trimed. Also unused slots that were reserved + // for generic signature indexes are discarded. + Array* fields = MetadataFactory::new_array( + _loader_data, index * FieldInfo::field_slots + num_generic_signature, + CHECK_NULL); + _fields = fields; // save in case of error + { + int i = 0; + for (; i < index * FieldInfo::field_slots; i++) { + fields->at_put(i, fa[i]); + } + for (int j = total_fields * FieldInfo::field_slots; + j < generic_signature_slot; j++) { + fields->at_put(i++, fa[j]); + } + assert(i == fields->length(), ""); + } + + if (_need_verify && length > 1) { + // Check duplicated fields + ResourceMark rm(THREAD); + NameSigHash** names_and_sigs = NEW_RESOURCE_ARRAY_IN_THREAD( + THREAD, NameSigHash*, HASH_ROW_SIZE); + initialize_hashtable(names_and_sigs); + bool dup = false; + { + debug_only(No_Safepoint_Verifier nsv;) + for (AllFieldStream fs(fields, _cp); !fs.done(); fs.next()) { + Symbol* name = fs.name(); + Symbol* sig = fs.signature(); + // If no duplicates, add name/signature in hashtable names_and_sigs. + if (!put_after_lookup(name, sig, names_and_sigs)) { + dup = true; + break; + } + } + } + if (dup) { + classfile_parse_error("Duplicate field name&signature in class file %s", + CHECK_NULL); + } + } + + return fields; +} + + +static void copy_u2_with_conversion(u2* dest, u2* src, int length) { + while (length-- > 0) { + *dest++ = Bytes::get_Java_u2((u1*) (src++)); + } +} + + +u2* ClassFileParser::parse_exception_table(u4 code_length, + u4 exception_table_length, + TRAPS) { + ClassFileStream* cfs = stream(); + + u2* exception_table_start = cfs->get_u2_buffer(); + assert(exception_table_start != NULL, "null exception table"); + cfs->guarantee_more(8 * exception_table_length, CHECK_NULL); // start_pc, end_pc, handler_pc, catch_type_index + // Will check legal target after parsing code array in verifier. + if (_need_verify) { + for (unsigned int i = 0; i < exception_table_length; i++) { + u2 start_pc = cfs->get_u2_fast(); + u2 end_pc = cfs->get_u2_fast(); + u2 handler_pc = cfs->get_u2_fast(); + u2 catch_type_index = cfs->get_u2_fast(); + guarantee_property((start_pc < end_pc) && (end_pc <= code_length), + "Illegal exception table range in class file %s", + CHECK_NULL); + guarantee_property(handler_pc < code_length, + "Illegal exception table handler in class file %s", + CHECK_NULL); + if (catch_type_index != 0) { + guarantee_property(valid_klass_reference_at(catch_type_index), + "Catch type in exception table has bad constant type in class file %s", CHECK_NULL); + } + } + } else { + cfs->skip_u2_fast(exception_table_length * 4); + } + return exception_table_start; +} + +void ClassFileParser::parse_linenumber_table( + u4 code_attribute_length, u4 code_length, + CompressedLineNumberWriteStream** write_stream, TRAPS) { + ClassFileStream* cfs = stream(); + unsigned int num_entries = cfs->get_u2(CHECK); + + // Each entry is a u2 start_pc, and a u2 line_number + unsigned int length_in_bytes = num_entries * (sizeof(u2) + sizeof(u2)); + + // Verify line number attribute and table length + check_property( + code_attribute_length == sizeof(u2) + length_in_bytes, + "LineNumberTable attribute has wrong length in class file %s", CHECK); + + cfs->guarantee_more(length_in_bytes, CHECK); + + if ((*write_stream) == NULL) { + if (length_in_bytes > fixed_buffer_size) { + (*write_stream) = new CompressedLineNumberWriteStream(length_in_bytes); + } else { + (*write_stream) = new CompressedLineNumberWriteStream( + linenumbertable_buffer, fixed_buffer_size); + } + } + + while (num_entries-- > 0) { + u2 bci = cfs->get_u2_fast(); // start_pc + u2 line = cfs->get_u2_fast(); // line_number + guarantee_property(bci < code_length, + "Invalid pc in LineNumberTable in class file %s", CHECK); + (*write_stream)->write_pair(bci, line); + } +} + + +// Class file LocalVariableTable elements. +class Classfile_LVT_Element VALUE_OBJ_CLASS_SPEC { + public: + u2 start_bci; + u2 length; + u2 name_cp_index; + u2 descriptor_cp_index; + u2 slot; +}; + + +class LVT_Hash: public CHeapObj { + public: + LocalVariableTableElement *_elem; // element + LVT_Hash* _next; // Next entry in hash table +}; + +unsigned int hash(LocalVariableTableElement *elem) { + unsigned int raw_hash = elem->start_bci; + + raw_hash = elem->length + raw_hash * 37; + raw_hash = elem->name_cp_index + raw_hash * 37; + raw_hash = elem->slot + raw_hash * 37; + + return raw_hash % HASH_ROW_SIZE; +} + +void initialize_hashtable(LVT_Hash** table) { + for (int i = 0; i < HASH_ROW_SIZE; i++) { + table[i] = NULL; + } +} + +void clear_hashtable(LVT_Hash** table) { + for (int i = 0; i < HASH_ROW_SIZE; i++) { + LVT_Hash* current = table[i]; + LVT_Hash* next; + while (current != NULL) { + next = current->_next; + current->_next = NULL; + delete(current); + current = next; + } + table[i] = NULL; + } +} + +LVT_Hash* LVT_lookup(LocalVariableTableElement *elem, int index, LVT_Hash** table) { + LVT_Hash* entry = table[index]; + + /* + * 3-tuple start_bci/length/slot has to be unique key, + * so the following comparison seems to be redundant: + * && elem->name_cp_index == entry->_elem->name_cp_index + */ + while (entry != NULL) { + if (elem->start_bci == entry->_elem->start_bci + && elem->length == entry->_elem->length + && elem->name_cp_index == entry->_elem->name_cp_index + && elem->slot == entry->_elem->slot + ) { + return entry; + } + entry = entry->_next; + } + return NULL; +} + +// Return false if the local variable is found in table. +// Return true if no duplicate is found. +// And local variable is added as a new entry in table. +bool LVT_put_after_lookup(LocalVariableTableElement *elem, LVT_Hash** table) { + // First lookup for duplicates + int index = hash(elem); + LVT_Hash* entry = LVT_lookup(elem, index, table); + + if (entry != NULL) { + return false; + } + // No duplicate is found, allocate a new entry and fill it. + if ((entry = new LVT_Hash()) == NULL) { + return false; + } + entry->_elem = elem; + + // Insert into hash table + entry->_next = table[index]; + table[index] = entry; + + return true; +} + +void copy_lvt_element(Classfile_LVT_Element *src, LocalVariableTableElement *lvt) { + lvt->start_bci = Bytes::get_Java_u2((u1*) &src->start_bci); + lvt->length = Bytes::get_Java_u2((u1*) &src->length); + lvt->name_cp_index = Bytes::get_Java_u2((u1*) &src->name_cp_index); + lvt->descriptor_cp_index = Bytes::get_Java_u2((u1*) &src->descriptor_cp_index); + lvt->signature_cp_index = 0; + lvt->slot = Bytes::get_Java_u2((u1*) &src->slot); +} + +// Function is used to parse both attributes: +// LocalVariableTable (LVT) and LocalVariableTypeTable (LVTT) +u2* ClassFileParser::parse_localvariable_table(u4 code_length, + u2 max_locals, + u4 code_attribute_length, + u2* localvariable_table_length, + bool isLVTT, + TRAPS) { + ClassFileStream* cfs = stream(); + const char * tbl_name = (isLVTT) ? "LocalVariableTypeTable" : "LocalVariableTable"; + *localvariable_table_length = cfs->get_u2(CHECK_NULL); + unsigned int size = (*localvariable_table_length) * sizeof(Classfile_LVT_Element) / sizeof(u2); + // Verify local variable table attribute has right length + if (_need_verify) { + guarantee_property(code_attribute_length == (sizeof(*localvariable_table_length) + size * sizeof(u2)), + "%s has wrong length in class file %s", tbl_name, CHECK_NULL); + } + u2* localvariable_table_start = cfs->get_u2_buffer(); + assert(localvariable_table_start != NULL, "null local variable table"); + if (!_need_verify) { + cfs->skip_u2_fast(size); + } else { + cfs->guarantee_more(size * 2, CHECK_NULL); + for(int i = 0; i < (*localvariable_table_length); i++) { + u2 start_pc = cfs->get_u2_fast(); + u2 length = cfs->get_u2_fast(); + u2 name_index = cfs->get_u2_fast(); + u2 descriptor_index = cfs->get_u2_fast(); + u2 index = cfs->get_u2_fast(); + // Assign to a u4 to avoid overflow + u4 end_pc = (u4)start_pc + (u4)length; + + if (start_pc >= code_length) { + classfile_parse_error( + "Invalid start_pc %u in %s in class file %s", + start_pc, tbl_name, CHECK_NULL); + } + if (end_pc > code_length) { + classfile_parse_error( + "Invalid length %u in %s in class file %s", + length, tbl_name, CHECK_NULL); + } + int cp_size = _cp->length(); + guarantee_property(valid_symbol_at(name_index), + "Name index %u in %s has bad constant type in class file %s", + name_index, tbl_name, CHECK_NULL); + guarantee_property(valid_symbol_at(descriptor_index), + "Signature index %u in %s has bad constant type in class file %s", + descriptor_index, tbl_name, CHECK_NULL); + + Symbol* name = _cp->symbol_at(name_index); + Symbol* sig = _cp->symbol_at(descriptor_index); + verify_legal_field_name(name, CHECK_NULL); + u2 extra_slot = 0; + if (!isLVTT) { + verify_legal_field_signature(name, sig, CHECK_NULL); + + // 4894874: check special cases for double and long local variables + if (sig == vmSymbols::type_signature(T_DOUBLE) || + sig == vmSymbols::type_signature(T_LONG)) { + extra_slot = 1; + } + } + guarantee_property((index + extra_slot) < max_locals, + "Invalid index %u in %s in class file %s", + index, tbl_name, CHECK_NULL); + } + } + return localvariable_table_start; +} + + +void ClassFileParser::parse_type_array(u2 array_length, u4 code_length, u4* u1_index, u4* u2_index, + u1* u1_array, u2* u2_array, TRAPS) { + ClassFileStream* cfs = stream(); + u2 index = 0; // index in the array with long/double occupying two slots + u4 i1 = *u1_index; + u4 i2 = *u2_index + 1; + for(int i = 0; i < array_length; i++) { + u1 tag = u1_array[i1++] = cfs->get_u1(CHECK); + index++; + if (tag == ITEM_Long || tag == ITEM_Double) { + index++; + } else if (tag == ITEM_Object) { + u2 class_index = u2_array[i2++] = cfs->get_u2(CHECK); + guarantee_property(valid_klass_reference_at(class_index), + "Bad class index %u in StackMap in class file %s", + class_index, CHECK); + } else if (tag == ITEM_Uninitialized) { + u2 offset = u2_array[i2++] = cfs->get_u2(CHECK); + guarantee_property( + offset < code_length, + "Bad uninitialized type offset %u in StackMap in class file %s", + offset, CHECK); + } else { + guarantee_property( + tag <= (u1)ITEM_Uninitialized, + "Unknown variable type %u in StackMap in class file %s", + tag, CHECK); + } + } + u2_array[*u2_index] = index; + *u1_index = i1; + *u2_index = i2; +} + +u1* ClassFileParser::parse_stackmap_table( + u4 code_attribute_length, TRAPS) { + if (code_attribute_length == 0) + return NULL; + + ClassFileStream* cfs = stream(); + u1* stackmap_table_start = cfs->get_u1_buffer(); + assert(stackmap_table_start != NULL, "null stackmap table"); + + // check code_attribute_length first + stream()->skip_u1(code_attribute_length, CHECK_NULL); + + if (!_need_verify && !DumpSharedSpaces) { + return NULL; + } + return stackmap_table_start; +} + +u2* ClassFileParser::parse_checked_exceptions(u2* checked_exceptions_length, + u4 method_attribute_length, + TRAPS) { + ClassFileStream* cfs = stream(); + cfs->guarantee_more(2, CHECK_NULL); // checked_exceptions_length + *checked_exceptions_length = cfs->get_u2_fast(); + unsigned int size = (*checked_exceptions_length) * sizeof(CheckedExceptionElement) / sizeof(u2); + u2* checked_exceptions_start = cfs->get_u2_buffer(); + assert(checked_exceptions_start != NULL, "null checked exceptions"); + if (!_need_verify) { + cfs->skip_u2_fast(size); + } else { + // Verify each value in the checked exception table + u2 checked_exception; + u2 len = *checked_exceptions_length; + cfs->guarantee_more(2 * len, CHECK_NULL); + for (int i = 0; i < len; i++) { + checked_exception = cfs->get_u2_fast(); + check_property( + valid_klass_reference_at(checked_exception), + "Exception name has bad type at constant pool %u in class file %s", + checked_exception, CHECK_NULL); + } + } + // check exceptions attribute length + if (_need_verify) { + guarantee_property(method_attribute_length == (sizeof(*checked_exceptions_length) + + sizeof(u2) * size), + "Exceptions attribute has wrong length in class file %s", CHECK_NULL); + } + return checked_exceptions_start; +} + +void ClassFileParser::throwIllegalSignature( + const char* type, Symbol* name, Symbol* sig, TRAPS) { + ResourceMark rm(THREAD); + Exceptions::fthrow(THREAD_AND_LOCATION, + vmSymbols::java_lang_ClassFormatError(), + "%s \"%s\" in class %s has illegal signature \"%s\"", type, + name->as_C_string(), _class_name->as_C_string(), sig->as_C_string()); +} + +// Skip an annotation. Return >=limit if there is any problem. +int ClassFileParser::skip_annotation(u1* buffer, int limit, int index) { + // annotation := atype:u2 do(nmem:u2) {member:u2 value} + // value := switch (tag:u1) { ... } + index += 2; // skip atype + if ((index += 2) >= limit) return limit; // read nmem + int nmem = Bytes::get_Java_u2(buffer+index-2); + while (--nmem >= 0 && index < limit) { + index += 2; // skip member + index = skip_annotation_value(buffer, limit, index); + } + return index; +} + +// Skip an annotation value. Return >=limit if there is any problem. +int ClassFileParser::skip_annotation_value(u1* buffer, int limit, int index) { + // value := switch (tag:u1) { + // case B, C, I, S, Z, D, F, J, c: con:u2; + // case e: e_class:u2 e_name:u2; + // case s: s_con:u2; + // case [: do(nval:u2) {value}; + // case @: annotation; + // case s: s_con:u2; + // } + if ((index += 1) >= limit) return limit; // read tag + u1 tag = buffer[index-1]; + switch (tag) { + case 'B': case 'C': case 'I': case 'S': case 'Z': + case 'D': case 'F': case 'J': case 'c': case 's': + index += 2; // skip con or s_con + break; + case 'e': + index += 4; // skip e_class, e_name + break; + case '[': + { + if ((index += 2) >= limit) return limit; // read nval + int nval = Bytes::get_Java_u2(buffer+index-2); + while (--nval >= 0 && index < limit) { + index = skip_annotation_value(buffer, limit, index); + } + } + break; + case '@': + index = skip_annotation(buffer, limit, index); + break; + default: + assert(false, "annotation tag"); + return limit; // bad tag byte + } + return index; +} + +// Sift through annotations, looking for those significant to the VM: +void ClassFileParser::parse_annotations(u1* buffer, int limit, + ClassFileParser::AnnotationCollector* coll, + TRAPS) { + // annotations := do(nann:u2) {annotation} + int index = 0; + if ((index += 2) >= limit) return; // read nann + int nann = Bytes::get_Java_u2(buffer+index-2); + enum { // initial annotation layout + atype_off = 0, // utf8 such as 'Ljava/lang/annotation/Retention;' + count_off = 2, // u2 such as 1 (one value) + member_off = 4, // utf8 such as 'value' + tag_off = 6, // u1 such as 'c' (type) or 'e' (enum) + e_tag_val = 'e', + e_type_off = 7, // utf8 such as 'Ljava/lang/annotation/RetentionPolicy;' + e_con_off = 9, // utf8 payload, such as 'SOURCE', 'CLASS', 'RUNTIME' + e_size = 11, // end of 'e' annotation + c_tag_val = 'c', // payload is type + c_con_off = 7, // utf8 payload, such as 'I' + c_size = 9, // end of 'c' annotation + s_tag_val = 's', // payload is String + s_con_off = 7, // utf8 payload, such as 'Ljava/lang/String;' + s_size = 9, + min_size = 6 // smallest possible size (zero members) + }; + while ((--nann) >= 0 && (index-2 + min_size <= limit)) { + int index0 = index; + index = skip_annotation(buffer, limit, index); + u1* abase = buffer + index0; + int atype = Bytes::get_Java_u2(abase + atype_off); + int count = Bytes::get_Java_u2(abase + count_off); + Symbol* aname = check_symbol_at(_cp, atype); + if (aname == NULL) break; // invalid annotation name + Symbol* member = NULL; + if (count >= 1) { + int member_index = Bytes::get_Java_u2(abase + member_off); + member = check_symbol_at(_cp, member_index); + if (member == NULL) break; // invalid member name + } + + // Here is where parsing particular annotations will take place. + AnnotationCollector::ID id = coll->annotation_index(_loader_data, aname); + if (id == AnnotationCollector::_unknown) continue; + coll->set_annotation(id); + + if (id == AnnotationCollector::_sun_misc_Contended) { + // @Contended can optionally specify the contention group. + // + // Contended group defines the equivalence class over the fields: + // the fields within the same contended group are not treated distinct. + // The only exception is default group, which does not incur the + // equivalence. Naturally, contention group for classes is meaningless. + // + // While the contention group is specified as String, annotation + // values are already interned, and we might as well use the constant + // pool index as the group tag. + // + u2 group_index = 0; // default contended group + if (count == 1 + && s_size == (index - index0) // match size + && s_tag_val == *(abase + tag_off) + && member == vmSymbols::value_name()) { + group_index = Bytes::get_Java_u2(abase + s_con_off); + if (_cp->symbol_at(group_index)->utf8_length() == 0) { + group_index = 0; // default contended group + } + } + coll->set_contended_group(group_index); + } + } +} + +ClassFileParser::AnnotationCollector::ID +ClassFileParser::AnnotationCollector::annotation_index(ClassLoaderData* loader_data, + Symbol* name) { + vmSymbols::SID sid = vmSymbols::find_sid(name); + // Privileged code can use all annotations. Other code silently drops some. + const bool privileged = loader_data->is_the_null_class_loader_data() || + loader_data->is_ext_class_loader_data() || + loader_data->is_anonymous(); + switch (sid) { + case vmSymbols::VM_SYMBOL_ENUM_NAME(sun_reflect_CallerSensitive_signature): + if (_location != _in_method) break; // only allow for methods + if (!privileged) break; // only allow in privileged code + return _method_CallerSensitive; + case vmSymbols::VM_SYMBOL_ENUM_NAME(java_lang_invoke_ForceInline_signature): + if (_location != _in_method) break; // only allow for methods + if (!privileged) break; // only allow in privileged code + return _method_ForceInline; + case vmSymbols::VM_SYMBOL_ENUM_NAME(java_lang_invoke_DontInline_signature): + if (_location != _in_method) break; // only allow for methods + if (!privileged) break; // only allow in privileged code + return _method_DontInline; + case vmSymbols::VM_SYMBOL_ENUM_NAME(java_lang_invoke_LambdaForm_Compiled_signature): + if (_location != _in_method) break; // only allow for methods + if (!privileged) break; // only allow in privileged code + return _method_LambdaForm_Compiled; + case vmSymbols::VM_SYMBOL_ENUM_NAME(java_lang_invoke_LambdaForm_Hidden_signature): + if (_location != _in_method) break; // only allow for methods + if (!privileged) break; // only allow in privileged code + return _method_LambdaForm_Hidden; + case vmSymbols::VM_SYMBOL_ENUM_NAME(java_lang_invoke_Stable_signature): + if (_location != _in_field) break; // only allow for fields + if (!privileged) break; // only allow in privileged code + return _field_Stable; + case vmSymbols::VM_SYMBOL_ENUM_NAME(sun_misc_Contended_signature): + if (_location != _in_field && _location != _in_class) break; // only allow for fields and classes + if (!EnableContended || (RestrictContended && !privileged)) break; // honor privileges + return _sun_misc_Contended; + default: break; + } + return AnnotationCollector::_unknown; +} + +void ClassFileParser::FieldAnnotationCollector::apply_to(FieldInfo* f) { + if (is_contended()) + f->set_contended_group(contended_group()); + if (is_stable()) + f->set_stable(true); +} + +ClassFileParser::FieldAnnotationCollector::~FieldAnnotationCollector() { + // If there's an error deallocate metadata for field annotations + MetadataFactory::free_array(_loader_data, _field_annotations); + MetadataFactory::free_array(_loader_data, _field_type_annotations); +} + +void ClassFileParser::MethodAnnotationCollector::apply_to(methodHandle m) { + if (has_annotation(_method_CallerSensitive)) + m->set_caller_sensitive(true); + if (has_annotation(_method_ForceInline)) + m->set_force_inline(true); + if (has_annotation(_method_DontInline)) + m->set_dont_inline(true); + if (has_annotation(_method_LambdaForm_Compiled) && m->intrinsic_id() == vmIntrinsics::_none) + m->set_intrinsic_id(vmIntrinsics::_compiledLambdaForm); + if (has_annotation(_method_LambdaForm_Hidden)) + m->set_hidden(true); +} + +void ClassFileParser::ClassAnnotationCollector::apply_to(instanceKlassHandle k) { + k->set_is_contended(is_contended()); +} + + +#define MAX_ARGS_SIZE 255 +#define MAX_CODE_SIZE 65535 +#define INITIAL_MAX_LVT_NUMBER 256 + +/* Copy class file LVT's/LVTT's into the HotSpot internal LVT. + * + * Rules for LVT's and LVTT's are: + * - There can be any number of LVT's and LVTT's. + * - If there are n LVT's, it is the same as if there was just + * one LVT containing all the entries from the n LVT's. + * - There may be no more than one LVT entry per local variable. + * Two LVT entries are 'equal' if these fields are the same: + * start_pc, length, name, slot + * - There may be no more than one LVTT entry per each LVT entry. + * Each LVTT entry has to match some LVT entry. + * - HotSpot internal LVT keeps natural ordering of class file LVT entries. + */ +void ClassFileParser::copy_localvariable_table(ConstMethod* cm, + int lvt_cnt, + u2* localvariable_table_length, + u2** localvariable_table_start, + int lvtt_cnt, + u2* localvariable_type_table_length, + u2** localvariable_type_table_start, + TRAPS) { + + LVT_Hash** lvt_Hash = NEW_RESOURCE_ARRAY(LVT_Hash*, HASH_ROW_SIZE); + initialize_hashtable(lvt_Hash); + + // To fill LocalVariableTable in + Classfile_LVT_Element* cf_lvt; + LocalVariableTableElement* lvt = cm->localvariable_table_start(); + + for (int tbl_no = 0; tbl_no < lvt_cnt; tbl_no++) { + cf_lvt = (Classfile_LVT_Element *) localvariable_table_start[tbl_no]; + for (int idx = 0; idx < localvariable_table_length[tbl_no]; idx++, lvt++) { + copy_lvt_element(&cf_lvt[idx], lvt); + // If no duplicates, add LVT elem in hashtable lvt_Hash. + if (LVT_put_after_lookup(lvt, lvt_Hash) == false + && _need_verify + && _major_version >= JAVA_1_5_VERSION) { + clear_hashtable(lvt_Hash); + classfile_parse_error("Duplicated LocalVariableTable attribute " + "entry for '%s' in class file %s", + _cp->symbol_at(lvt->name_cp_index)->as_utf8(), + CHECK); + } + } + } + + // To merge LocalVariableTable and LocalVariableTypeTable + Classfile_LVT_Element* cf_lvtt; + LocalVariableTableElement lvtt_elem; + + for (int tbl_no = 0; tbl_no < lvtt_cnt; tbl_no++) { + cf_lvtt = (Classfile_LVT_Element *) localvariable_type_table_start[tbl_no]; + for (int idx = 0; idx < localvariable_type_table_length[tbl_no]; idx++) { + copy_lvt_element(&cf_lvtt[idx], &lvtt_elem); + int index = hash(&lvtt_elem); + LVT_Hash* entry = LVT_lookup(&lvtt_elem, index, lvt_Hash); + if (entry == NULL) { + if (_need_verify) { + clear_hashtable(lvt_Hash); + classfile_parse_error("LVTT entry for '%s' in class file %s " + "does not match any LVT entry", + _cp->symbol_at(lvtt_elem.name_cp_index)->as_utf8(), + CHECK); + } + } else if (entry->_elem->signature_cp_index != 0 && _need_verify) { + clear_hashtable(lvt_Hash); + classfile_parse_error("Duplicated LocalVariableTypeTable attribute " + "entry for '%s' in class file %s", + _cp->symbol_at(lvtt_elem.name_cp_index)->as_utf8(), + CHECK); + } else { + // to add generic signatures into LocalVariableTable + entry->_elem->signature_cp_index = lvtt_elem.descriptor_cp_index; + } + } + } + clear_hashtable(lvt_Hash); +} + + +void ClassFileParser::copy_method_annotations(ConstMethod* cm, + u1* runtime_visible_annotations, + int runtime_visible_annotations_length, + u1* runtime_invisible_annotations, + int runtime_invisible_annotations_length, + u1* runtime_visible_parameter_annotations, + int runtime_visible_parameter_annotations_length, + u1* runtime_invisible_parameter_annotations, + int runtime_invisible_parameter_annotations_length, + u1* runtime_visible_type_annotations, + int runtime_visible_type_annotations_length, + u1* runtime_invisible_type_annotations, + int runtime_invisible_type_annotations_length, + u1* annotation_default, + int annotation_default_length, + TRAPS) { + + AnnotationArray* a; + + if (runtime_visible_annotations_length + + runtime_invisible_annotations_length > 0) { + a = assemble_annotations(runtime_visible_annotations, + runtime_visible_annotations_length, + runtime_invisible_annotations, + runtime_invisible_annotations_length, + CHECK); + cm->set_method_annotations(a); + } + + if (runtime_visible_parameter_annotations_length + + runtime_invisible_parameter_annotations_length > 0) { + a = assemble_annotations(runtime_visible_parameter_annotations, + runtime_visible_parameter_annotations_length, + runtime_invisible_parameter_annotations, + runtime_invisible_parameter_annotations_length, + CHECK); + cm->set_parameter_annotations(a); + } + + if (annotation_default_length > 0) { + a = assemble_annotations(annotation_default, + annotation_default_length, + NULL, + 0, + CHECK); + cm->set_default_annotations(a); + } + + if (runtime_visible_type_annotations_length + + runtime_invisible_type_annotations_length > 0) { + a = assemble_annotations(runtime_visible_type_annotations, + runtime_visible_type_annotations_length, + runtime_invisible_type_annotations, + runtime_invisible_type_annotations_length, + CHECK); + cm->set_type_annotations(a); + } +} + + +// Note: the parse_method below is big and clunky because all parsing of the code and exceptions +// attribute is inlined. This is cumbersome to avoid since we inline most of the parts in the +// Method* to save footprint, so we only know the size of the resulting Method* when the +// entire method attribute is parsed. +// +// The promoted_flags parameter is used to pass relevant access_flags +// from the method back up to the containing klass. These flag values +// are added to klass's access_flags. + +methodHandle ClassFileParser::parse_method(bool is_interface, + AccessFlags *promoted_flags, + TRAPS) { + ClassFileStream* cfs = stream(); + methodHandle nullHandle; + ResourceMark rm(THREAD); + // Parse fixed parts + cfs->guarantee_more(8, CHECK_(nullHandle)); // access_flags, name_index, descriptor_index, attributes_count + + int flags = cfs->get_u2_fast(); + u2 name_index = cfs->get_u2_fast(); + int cp_size = _cp->length(); + check_property( + valid_symbol_at(name_index), + "Illegal constant pool index %u for method name in class file %s", + name_index, CHECK_(nullHandle)); + Symbol* name = _cp->symbol_at(name_index); + verify_legal_method_name(name, CHECK_(nullHandle)); + + u2 signature_index = cfs->get_u2_fast(); + guarantee_property( + valid_symbol_at(signature_index), + "Illegal constant pool index %u for method signature in class file %s", + signature_index, CHECK_(nullHandle)); + Symbol* signature = _cp->symbol_at(signature_index); + + AccessFlags access_flags; + if (name == vmSymbols::class_initializer_name()) { + // We ignore the other access flags for a valid class initializer. + // (JVM Spec 2nd ed., chapter 4.6) + if (_major_version < 51) { // backward compatibility + flags = JVM_ACC_STATIC; + } else if ((flags & JVM_ACC_STATIC) == JVM_ACC_STATIC) { + flags &= JVM_ACC_STATIC | JVM_ACC_STRICT; + } + } else { + verify_legal_method_modifiers(flags, is_interface, name, CHECK_(nullHandle)); + } + + int args_size = -1; // only used when _need_verify is true + if (_need_verify) { + args_size = ((flags & JVM_ACC_STATIC) ? 0 : 1) + + verify_legal_method_signature(name, signature, CHECK_(nullHandle)); + if (args_size > MAX_ARGS_SIZE) { + classfile_parse_error("Too many arguments in method signature in class file %s", CHECK_(nullHandle)); + } + } + + access_flags.set_flags(flags & JVM_RECOGNIZED_METHOD_MODIFIERS); + + // Default values for code and exceptions attribute elements + u2 max_stack = 0; + u2 max_locals = 0; + u4 code_length = 0; + u1* code_start = 0; + u2 exception_table_length = 0; + u2* exception_table_start = NULL; + Array* exception_handlers = Universe::the_empty_int_array(); + u2 checked_exceptions_length = 0; + u2* checked_exceptions_start = NULL; + CompressedLineNumberWriteStream* linenumber_table = NULL; + int linenumber_table_length = 0; + int total_lvt_length = 0; + u2 lvt_cnt = 0; + u2 lvtt_cnt = 0; + bool lvt_allocated = false; + u2 max_lvt_cnt = INITIAL_MAX_LVT_NUMBER; + u2 max_lvtt_cnt = INITIAL_MAX_LVT_NUMBER; + u2* localvariable_table_length; + u2** localvariable_table_start; + u2* localvariable_type_table_length; + u2** localvariable_type_table_start; + u2 method_parameters_length = 0; + u1* method_parameters_data = NULL; + bool method_parameters_seen = false; + bool parsed_code_attribute = false; + bool parsed_checked_exceptions_attribute = false; + bool parsed_stackmap_attribute = false; + // stackmap attribute - JDK1.5 + u1* stackmap_data = NULL; + int stackmap_data_length = 0; + u2 generic_signature_index = 0; + MethodAnnotationCollector parsed_annotations; + u1* runtime_visible_annotations = NULL; + int runtime_visible_annotations_length = 0; + u1* runtime_invisible_annotations = NULL; + int runtime_invisible_annotations_length = 0; + u1* runtime_visible_parameter_annotations = NULL; + int runtime_visible_parameter_annotations_length = 0; + u1* runtime_invisible_parameter_annotations = NULL; + int runtime_invisible_parameter_annotations_length = 0; + u1* runtime_visible_type_annotations = NULL; + int runtime_visible_type_annotations_length = 0; + u1* runtime_invisible_type_annotations = NULL; + int runtime_invisible_type_annotations_length = 0; + bool runtime_invisible_annotations_exists = false; + bool runtime_invisible_type_annotations_exists = false; + bool runtime_invisible_parameter_annotations_exists = false; + u1* annotation_default = NULL; + int annotation_default_length = 0; + + // Parse code and exceptions attribute + u2 method_attributes_count = cfs->get_u2_fast(); + while (method_attributes_count--) { + cfs->guarantee_more(6, CHECK_(nullHandle)); // method_attribute_name_index, method_attribute_length + u2 method_attribute_name_index = cfs->get_u2_fast(); + u4 method_attribute_length = cfs->get_u4_fast(); + check_property( + valid_symbol_at(method_attribute_name_index), + "Invalid method attribute name index %u in class file %s", + method_attribute_name_index, CHECK_(nullHandle)); + + Symbol* method_attribute_name = _cp->symbol_at(method_attribute_name_index); + if (method_attribute_name == vmSymbols::tag_code()) { + // Parse Code attribute + if (_need_verify) { + guarantee_property( + !access_flags.is_native() && !access_flags.is_abstract(), + "Code attribute in native or abstract methods in class file %s", + CHECK_(nullHandle)); + } + if (parsed_code_attribute) { + classfile_parse_error("Multiple Code attributes in class file %s", CHECK_(nullHandle)); + } + parsed_code_attribute = true; + + // Stack size, locals size, and code size + if (_major_version == 45 && _minor_version <= 2) { + cfs->guarantee_more(4, CHECK_(nullHandle)); + max_stack = cfs->get_u1_fast(); + max_locals = cfs->get_u1_fast(); + code_length = cfs->get_u2_fast(); + } else { + cfs->guarantee_more(8, CHECK_(nullHandle)); + max_stack = cfs->get_u2_fast(); + max_locals = cfs->get_u2_fast(); + code_length = cfs->get_u4_fast(); + } + if (_need_verify) { + guarantee_property(args_size <= max_locals, + "Arguments can't fit into locals in class file %s", CHECK_(nullHandle)); + guarantee_property(code_length > 0 && code_length <= MAX_CODE_SIZE, + "Invalid method Code length %u in class file %s", + code_length, CHECK_(nullHandle)); + } + // Code pointer + code_start = cfs->get_u1_buffer(); + assert(code_start != NULL, "null code start"); + cfs->guarantee_more(code_length, CHECK_(nullHandle)); + cfs->skip_u1_fast(code_length); + + // Exception handler table + cfs->guarantee_more(2, CHECK_(nullHandle)); // exception_table_length + exception_table_length = cfs->get_u2_fast(); + if (exception_table_length > 0) { + exception_table_start = + parse_exception_table(code_length, exception_table_length, CHECK_(nullHandle)); + } + + // Parse additional attributes in code attribute + cfs->guarantee_more(2, CHECK_(nullHandle)); // code_attributes_count + u2 code_attributes_count = cfs->get_u2_fast(); + + unsigned int calculated_attribute_length = 0; + + if (_major_version > 45 || (_major_version == 45 && _minor_version > 2)) { + calculated_attribute_length = + sizeof(max_stack) + sizeof(max_locals) + sizeof(code_length); + } else { + // max_stack, locals and length are smaller in pre-version 45.2 classes + calculated_attribute_length = sizeof(u1) + sizeof(u1) + sizeof(u2); + } + calculated_attribute_length += + code_length + + sizeof(exception_table_length) + + sizeof(code_attributes_count) + + exception_table_length * + ( sizeof(u2) + // start_pc + sizeof(u2) + // end_pc + sizeof(u2) + // handler_pc + sizeof(u2) ); // catch_type_index + + while (code_attributes_count--) { + cfs->guarantee_more(6, CHECK_(nullHandle)); // code_attribute_name_index, code_attribute_length + u2 code_attribute_name_index = cfs->get_u2_fast(); + u4 code_attribute_length = cfs->get_u4_fast(); + calculated_attribute_length += code_attribute_length + + sizeof(code_attribute_name_index) + + sizeof(code_attribute_length); + check_property(valid_symbol_at(code_attribute_name_index), + "Invalid code attribute name index %u in class file %s", + code_attribute_name_index, + CHECK_(nullHandle)); + if (LoadLineNumberTables && + _cp->symbol_at(code_attribute_name_index) == vmSymbols::tag_line_number_table()) { + // Parse and compress line number table + parse_linenumber_table(code_attribute_length, code_length, + &linenumber_table, CHECK_(nullHandle)); + + } else if (LoadLocalVariableTables && + _cp->symbol_at(code_attribute_name_index) == vmSymbols::tag_local_variable_table()) { + // Parse local variable table + if (!lvt_allocated) { + localvariable_table_length = NEW_RESOURCE_ARRAY_IN_THREAD( + THREAD, u2, INITIAL_MAX_LVT_NUMBER); + localvariable_table_start = NEW_RESOURCE_ARRAY_IN_THREAD( + THREAD, u2*, INITIAL_MAX_LVT_NUMBER); + localvariable_type_table_length = NEW_RESOURCE_ARRAY_IN_THREAD( + THREAD, u2, INITIAL_MAX_LVT_NUMBER); + localvariable_type_table_start = NEW_RESOURCE_ARRAY_IN_THREAD( + THREAD, u2*, INITIAL_MAX_LVT_NUMBER); + lvt_allocated = true; + } + if (lvt_cnt == max_lvt_cnt) { + max_lvt_cnt <<= 1; + localvariable_table_length = REALLOC_RESOURCE_ARRAY(u2, localvariable_table_length, lvt_cnt, max_lvt_cnt); + localvariable_table_start = REALLOC_RESOURCE_ARRAY(u2*, localvariable_table_start, lvt_cnt, max_lvt_cnt); + } + localvariable_table_start[lvt_cnt] = + parse_localvariable_table(code_length, + max_locals, + code_attribute_length, + &localvariable_table_length[lvt_cnt], + false, // is not LVTT + CHECK_(nullHandle)); + total_lvt_length += localvariable_table_length[lvt_cnt]; + lvt_cnt++; + } else if (LoadLocalVariableTypeTables && + _major_version >= JAVA_1_5_VERSION && + _cp->symbol_at(code_attribute_name_index) == vmSymbols::tag_local_variable_type_table()) { + if (!lvt_allocated) { + localvariable_table_length = NEW_RESOURCE_ARRAY_IN_THREAD( + THREAD, u2, INITIAL_MAX_LVT_NUMBER); + localvariable_table_start = NEW_RESOURCE_ARRAY_IN_THREAD( + THREAD, u2*, INITIAL_MAX_LVT_NUMBER); + localvariable_type_table_length = NEW_RESOURCE_ARRAY_IN_THREAD( + THREAD, u2, INITIAL_MAX_LVT_NUMBER); + localvariable_type_table_start = NEW_RESOURCE_ARRAY_IN_THREAD( + THREAD, u2*, INITIAL_MAX_LVT_NUMBER); + lvt_allocated = true; + } + // Parse local variable type table + if (lvtt_cnt == max_lvtt_cnt) { + max_lvtt_cnt <<= 1; + localvariable_type_table_length = REALLOC_RESOURCE_ARRAY(u2, localvariable_type_table_length, lvtt_cnt, max_lvtt_cnt); + localvariable_type_table_start = REALLOC_RESOURCE_ARRAY(u2*, localvariable_type_table_start, lvtt_cnt, max_lvtt_cnt); + } + localvariable_type_table_start[lvtt_cnt] = + parse_localvariable_table(code_length, + max_locals, + code_attribute_length, + &localvariable_type_table_length[lvtt_cnt], + true, // is LVTT + CHECK_(nullHandle)); + lvtt_cnt++; + } else if (_major_version >= Verifier::STACKMAP_ATTRIBUTE_MAJOR_VERSION && + _cp->symbol_at(code_attribute_name_index) == vmSymbols::tag_stack_map_table()) { + // Stack map is only needed by the new verifier in JDK1.5. + if (parsed_stackmap_attribute) { + classfile_parse_error("Multiple StackMapTable attributes in class file %s", CHECK_(nullHandle)); + } + stackmap_data = parse_stackmap_table(code_attribute_length, CHECK_(nullHandle)); + stackmap_data_length = code_attribute_length; + parsed_stackmap_attribute = true; + } else { + // Skip unknown attributes + cfs->skip_u1(code_attribute_length, CHECK_(nullHandle)); + } + } + // check method attribute length + if (_need_verify) { + guarantee_property(method_attribute_length == calculated_attribute_length, + "Code segment has wrong length in class file %s", CHECK_(nullHandle)); + } + } else if (method_attribute_name == vmSymbols::tag_exceptions()) { + // Parse Exceptions attribute + if (parsed_checked_exceptions_attribute) { + classfile_parse_error("Multiple Exceptions attributes in class file %s", CHECK_(nullHandle)); + } + parsed_checked_exceptions_attribute = true; + checked_exceptions_start = + parse_checked_exceptions(&checked_exceptions_length, + method_attribute_length, + CHECK_(nullHandle)); + } else if (method_attribute_name == vmSymbols::tag_method_parameters()) { + // reject multiple method parameters + if (method_parameters_seen) { + classfile_parse_error("Multiple MethodParameters attributes in class file %s", CHECK_(nullHandle)); + } + method_parameters_seen = true; + method_parameters_length = cfs->get_u1_fast(); + if (method_attribute_length != (method_parameters_length * 4u) + 1u) { + classfile_parse_error( + "Invalid MethodParameters method attribute length %u in class file", + method_attribute_length, CHECK_(nullHandle)); + } + method_parameters_data = cfs->get_u1_buffer(); + cfs->skip_u2_fast(method_parameters_length); + cfs->skip_u2_fast(method_parameters_length); + // ignore this attribute if it cannot be reflected + if (!SystemDictionary::Parameter_klass_loaded()) + method_parameters_length = 0; + } else if (method_attribute_name == vmSymbols::tag_synthetic()) { + if (method_attribute_length != 0) { + classfile_parse_error( + "Invalid Synthetic method attribute length %u in class file %s", + method_attribute_length, CHECK_(nullHandle)); + } + // Should we check that there hasn't already been a synthetic attribute? + access_flags.set_is_synthetic(); + } else if (method_attribute_name == vmSymbols::tag_deprecated()) { // 4276120 + if (method_attribute_length != 0) { + classfile_parse_error( + "Invalid Deprecated method attribute length %u in class file %s", + method_attribute_length, CHECK_(nullHandle)); + } + } else if (_major_version >= JAVA_1_5_VERSION) { + if (method_attribute_name == vmSymbols::tag_signature()) { + if (method_attribute_length != 2) { + classfile_parse_error( + "Invalid Signature attribute length %u in class file %s", + method_attribute_length, CHECK_(nullHandle)); + } + generic_signature_index = parse_generic_signature_attribute(CHECK_(nullHandle)); + } else if (method_attribute_name == vmSymbols::tag_runtime_visible_annotations()) { + if (runtime_visible_annotations != NULL) { + classfile_parse_error( + "Multiple RuntimeVisibleAnnotations attributes for method in class file %s", CHECK_(nullHandle)); + } + runtime_visible_annotations_length = method_attribute_length; + runtime_visible_annotations = cfs->get_u1_buffer(); + assert(runtime_visible_annotations != NULL, "null visible annotations"); + parse_annotations(runtime_visible_annotations, + runtime_visible_annotations_length, &parsed_annotations, + CHECK_(nullHandle)); + cfs->skip_u1(runtime_visible_annotations_length, CHECK_(nullHandle)); + } else if (method_attribute_name == vmSymbols::tag_runtime_invisible_annotations()) { + if (runtime_invisible_annotations_exists) { + classfile_parse_error( + "Multiple RuntimeInvisibleAnnotations attributes for method in class file %s", CHECK_(nullHandle)); + } + runtime_invisible_annotations_exists = true; + if (PreserveAllAnnotations) { + runtime_invisible_annotations_length = method_attribute_length; + runtime_invisible_annotations = cfs->get_u1_buffer(); + assert(runtime_invisible_annotations != NULL, "null invisible annotations"); + } + cfs->skip_u1(method_attribute_length, CHECK_(nullHandle)); + } else if (method_attribute_name == vmSymbols::tag_runtime_visible_parameter_annotations()) { + if (runtime_visible_parameter_annotations != NULL) { + classfile_parse_error( + "Multiple RuntimeVisibleParameterAnnotations attributes for method in class file %s", CHECK_(nullHandle)); + } + runtime_visible_parameter_annotations_length = method_attribute_length; + runtime_visible_parameter_annotations = cfs->get_u1_buffer(); + assert(runtime_visible_parameter_annotations != NULL, "null visible parameter annotations"); + cfs->skip_u1(runtime_visible_parameter_annotations_length, CHECK_(nullHandle)); + } else if (method_attribute_name == vmSymbols::tag_runtime_invisible_parameter_annotations()) { + if (runtime_invisible_parameter_annotations_exists) { + classfile_parse_error( + "Multiple RuntimeInvisibleParameterAnnotations attributes for method in class file %s", CHECK_(nullHandle)); + } + runtime_invisible_parameter_annotations_exists = true; + if (PreserveAllAnnotations) { + runtime_invisible_parameter_annotations_length = method_attribute_length; + runtime_invisible_parameter_annotations = cfs->get_u1_buffer(); + assert(runtime_invisible_parameter_annotations != NULL, "null invisible parameter annotations"); + } + cfs->skip_u1(method_attribute_length, CHECK_(nullHandle)); + } else if (method_attribute_name == vmSymbols::tag_annotation_default()) { + if (annotation_default != NULL) { + classfile_parse_error( + "Multiple AnnotationDefault attributes for method in class file %s", + CHECK_(nullHandle)); + } + annotation_default_length = method_attribute_length; + annotation_default = cfs->get_u1_buffer(); + assert(annotation_default != NULL, "null annotation default"); + cfs->skip_u1(annotation_default_length, CHECK_(nullHandle)); + } else if (method_attribute_name == vmSymbols::tag_runtime_visible_type_annotations()) { + if (runtime_visible_type_annotations != NULL) { + classfile_parse_error( + "Multiple RuntimeVisibleTypeAnnotations attributes for method in class file %s", + CHECK_(nullHandle)); + } + runtime_visible_type_annotations_length = method_attribute_length; + runtime_visible_type_annotations = cfs->get_u1_buffer(); + assert(runtime_visible_type_annotations != NULL, "null visible type annotations"); + // No need for the VM to parse Type annotations + cfs->skip_u1(runtime_visible_type_annotations_length, CHECK_(nullHandle)); + } else if (method_attribute_name == vmSymbols::tag_runtime_invisible_type_annotations()) { + if (runtime_invisible_type_annotations_exists) { + classfile_parse_error( + "Multiple RuntimeInvisibleTypeAnnotations attributes for method in class file %s", + CHECK_(nullHandle)); + } else { + runtime_invisible_type_annotations_exists = true; + } + if (PreserveAllAnnotations) { + runtime_invisible_type_annotations_length = method_attribute_length; + runtime_invisible_type_annotations = cfs->get_u1_buffer(); + assert(runtime_invisible_type_annotations != NULL, "null invisible type annotations"); + } + cfs->skip_u1(method_attribute_length, CHECK_(nullHandle)); + } else { + // Skip unknown attributes + cfs->skip_u1(method_attribute_length, CHECK_(nullHandle)); + } + } else { + // Skip unknown attributes + cfs->skip_u1(method_attribute_length, CHECK_(nullHandle)); + } + } + + if (linenumber_table != NULL) { + linenumber_table->write_terminator(); + linenumber_table_length = linenumber_table->position(); + } + + // Make sure there's at least one Code attribute in non-native/non-abstract method + if (_need_verify) { + guarantee_property(access_flags.is_native() || access_flags.is_abstract() || parsed_code_attribute, + "Absent Code attribute in method that is not native or abstract in class file %s", CHECK_(nullHandle)); + } + + // All sizing information for a Method* is finally available, now create it + InlineTableSizes sizes( + total_lvt_length, + linenumber_table_length, + exception_table_length, + checked_exceptions_length, + method_parameters_length, + generic_signature_index, + runtime_visible_annotations_length + + runtime_invisible_annotations_length, + runtime_visible_parameter_annotations_length + + runtime_invisible_parameter_annotations_length, + runtime_visible_type_annotations_length + + runtime_invisible_type_annotations_length, + annotation_default_length, + 0); + + Method* m = Method::allocate( + _loader_data, code_length, access_flags, &sizes, + ConstMethod::NORMAL, CHECK_(nullHandle)); + + ClassLoadingService::add_class_method_size(m->size()*HeapWordSize); + + // Fill in information from fixed part (access_flags already set) + m->set_constants(_cp); + m->set_name_index(name_index); + m->set_signature_index(signature_index); +#ifdef CC_INTERP + // hmm is there a gc issue here?? + ResultTypeFinder rtf(_cp->symbol_at(signature_index)); + m->set_result_index(rtf.type()); +#endif + + if (args_size >= 0) { + m->set_size_of_parameters(args_size); + } else { + m->compute_size_of_parameters(THREAD); + } +#ifdef ASSERT + if (args_size >= 0) { + m->compute_size_of_parameters(THREAD); + assert(args_size == m->size_of_parameters(), ""); + } +#endif + + // Fill in code attribute information + m->set_max_stack(max_stack); + m->set_max_locals(max_locals); + if (stackmap_data != NULL) { + m->constMethod()->copy_stackmap_data(_loader_data, stackmap_data, + stackmap_data_length, CHECK_NULL); + } + + // Copy byte codes + m->set_code(code_start); + + // Copy line number table + if (linenumber_table != NULL) { + memcpy(m->compressed_linenumber_table(), + linenumber_table->buffer(), linenumber_table_length); + } + + // Copy exception table + if (exception_table_length > 0) { + int size = + exception_table_length * sizeof(ExceptionTableElement) / sizeof(u2); + copy_u2_with_conversion((u2*) m->exception_table_start(), + exception_table_start, size); + } + + // Copy method parameters + if (method_parameters_length > 0) { + MethodParametersElement* elem = m->constMethod()->method_parameters_start(); + for (int i = 0; i < method_parameters_length; i++) { + elem[i].name_cp_index = Bytes::get_Java_u2(method_parameters_data); + method_parameters_data += 2; + elem[i].flags = Bytes::get_Java_u2(method_parameters_data); + method_parameters_data += 2; + } + } + + // Copy checked exceptions + if (checked_exceptions_length > 0) { + int size = checked_exceptions_length * sizeof(CheckedExceptionElement) / sizeof(u2); + copy_u2_with_conversion((u2*) m->checked_exceptions_start(), checked_exceptions_start, size); + } + + // Copy class file LVT's/LVTT's into the HotSpot internal LVT. + if (total_lvt_length > 0) { + promoted_flags->set_has_localvariable_table(); + copy_localvariable_table(m->constMethod(), lvt_cnt, + localvariable_table_length, + localvariable_table_start, + lvtt_cnt, + localvariable_type_table_length, + localvariable_type_table_start, CHECK_NULL); + } + + if (parsed_annotations.has_any_annotations()) + parsed_annotations.apply_to(m); + + // Copy annotations + copy_method_annotations(m->constMethod(), + runtime_visible_annotations, + runtime_visible_annotations_length, + runtime_invisible_annotations, + runtime_invisible_annotations_length, + runtime_visible_parameter_annotations, + runtime_visible_parameter_annotations_length, + runtime_invisible_parameter_annotations, + runtime_invisible_parameter_annotations_length, + runtime_visible_type_annotations, + runtime_visible_type_annotations_length, + runtime_invisible_type_annotations, + runtime_invisible_type_annotations_length, + annotation_default, + annotation_default_length, + CHECK_NULL); + + if (name == vmSymbols::finalize_method_name() && + signature == vmSymbols::void_method_signature()) { + if (m->is_empty_method()) { + _has_empty_finalizer = true; + } else { + _has_finalizer = true; + } + } + if (name == vmSymbols::object_initializer_name() && + signature == vmSymbols::void_method_signature() && + m->is_vanilla_constructor()) { + _has_vanilla_constructor = true; + } + + NOT_PRODUCT(m->verify()); + return m; +} + + +// The promoted_flags parameter is used to pass relevant access_flags +// from the methods back up to the containing klass. These flag values +// are added to klass's access_flags. + +Array* ClassFileParser::parse_methods(bool is_interface, + AccessFlags* promoted_flags, + bool* has_final_method, + bool* has_default_methods, + TRAPS) { + ClassFileStream* cfs = stream(); + cfs->guarantee_more(2, CHECK_NULL); // length + u2 length = cfs->get_u2_fast(); + if (length == 0) { + _methods = Universe::the_empty_method_array(); + } else { + _methods = MetadataFactory::new_array(_loader_data, length, NULL, CHECK_NULL); + + HandleMark hm(THREAD); + for (int index = 0; index < length; index++) { + methodHandle method = parse_method(is_interface, + promoted_flags, + CHECK_NULL); + + if (method->is_final()) { + *has_final_method = true; + } + if (is_interface && !(*has_default_methods) + && !method->is_abstract() && !method->is_static() + && !method->is_private()) { + // default method + *has_default_methods = true; + } + _methods->at_put(index, method()); + } + + if (_need_verify && length > 1) { + // Check duplicated methods + ResourceMark rm(THREAD); + NameSigHash** names_and_sigs = NEW_RESOURCE_ARRAY_IN_THREAD( + THREAD, NameSigHash*, HASH_ROW_SIZE); + initialize_hashtable(names_and_sigs); + bool dup = false; + { + debug_only(No_Safepoint_Verifier nsv;) + for (int i = 0; i < length; i++) { + Method* m = _methods->at(i); + // If no duplicates, add name/signature in hashtable names_and_sigs. + if (!put_after_lookup(m->name(), m->signature(), names_and_sigs)) { + dup = true; + break; + } + } + } + if (dup) { + classfile_parse_error("Duplicate method name&signature in class file %s", + CHECK_NULL); + } + } + } + return _methods; +} + + +intArray* ClassFileParser::sort_methods(Array* methods) { + int length = methods->length(); + // If JVMTI original method ordering or sharing is enabled we have to + // remember the original class file ordering. + // We temporarily use the vtable_index field in the Method* to store the + // class file index, so we can read in after calling qsort. + // Put the method ordering in the shared archive. + if (JvmtiExport::can_maintain_original_method_order() || DumpSharedSpaces) { + for (int index = 0; index < length; index++) { + Method* m = methods->at(index); + assert(!m->valid_vtable_index(), "vtable index should not be set"); + m->set_vtable_index(index); + } + } + // Sort method array by ascending method name (for faster lookups & vtable construction) + // Note that the ordering is not alphabetical, see Symbol::fast_compare + Method::sort_methods(methods); + + intArray* method_ordering = NULL; + // If JVMTI original method ordering or sharing is enabled construct int + // array remembering the original ordering + if (JvmtiExport::can_maintain_original_method_order() || DumpSharedSpaces) { + method_ordering = new intArray(length); + for (int index = 0; index < length; index++) { + Method* m = methods->at(index); + int old_index = m->vtable_index(); + assert(old_index >= 0 && old_index < length, "invalid method index"); + method_ordering->at_put(index, old_index); + m->set_vtable_index(Method::invalid_vtable_index); + } + } + return method_ordering; +} + +// Parse generic_signature attribute for methods and fields +u2 ClassFileParser::parse_generic_signature_attribute(TRAPS) { + ClassFileStream* cfs = stream(); + cfs->guarantee_more(2, CHECK_0); // generic_signature_index + u2 generic_signature_index = cfs->get_u2_fast(); + check_property( + valid_symbol_at(generic_signature_index), + "Invalid Signature attribute at constant pool index %u in class file %s", + generic_signature_index, CHECK_0); + return generic_signature_index; +} + +void ClassFileParser::parse_classfile_sourcefile_attribute(TRAPS) { + ClassFileStream* cfs = stream(); + cfs->guarantee_more(2, CHECK); // sourcefile_index + u2 sourcefile_index = cfs->get_u2_fast(); + check_property( + valid_symbol_at(sourcefile_index), + "Invalid SourceFile attribute at constant pool index %u in class file %s", + sourcefile_index, CHECK); + set_class_sourcefile_index(sourcefile_index); +} + + + +void ClassFileParser::parse_classfile_source_debug_extension_attribute(int length, TRAPS) { + ClassFileStream* cfs = stream(); + u1* sde_buffer = cfs->get_u1_buffer(); + assert(sde_buffer != NULL, "null sde buffer"); + + // Don't bother storing it if there is no way to retrieve it + if (JvmtiExport::can_get_source_debug_extension()) { + assert((length+1) > length, "Overflow checking"); + u1* sde = NEW_RESOURCE_ARRAY_IN_THREAD(THREAD, u1, length+1); + for (int i = 0; i < length; i++) { + sde[i] = sde_buffer[i]; + } + sde[length] = '\0'; + set_class_sde_buffer((char*)sde, length); + } + // Got utf8 string, set stream position forward + cfs->skip_u1(length, CHECK); +} + + +// Inner classes can be static, private or protected (classic VM does this) +#define RECOGNIZED_INNER_CLASS_MODIFIERS (JVM_RECOGNIZED_CLASS_MODIFIERS | JVM_ACC_PRIVATE | JVM_ACC_PROTECTED | JVM_ACC_STATIC) + +// Return number of classes in the inner classes attribute table +u2 ClassFileParser::parse_classfile_inner_classes_attribute(u1* inner_classes_attribute_start, + bool parsed_enclosingmethod_attribute, + u2 enclosing_method_class_index, + u2 enclosing_method_method_index, + TRAPS) { + ClassFileStream* cfs = stream(); + u1* current_mark = cfs->current(); + u2 length = 0; + if (inner_classes_attribute_start != NULL) { + cfs->set_current(inner_classes_attribute_start); + cfs->guarantee_more(2, CHECK_0); // length + length = cfs->get_u2_fast(); + } + + // 4-tuples of shorts of inner classes data and 2 shorts of enclosing + // method data: + // [inner_class_info_index, + // outer_class_info_index, + // inner_name_index, + // inner_class_access_flags, + // ... + // enclosing_method_class_index, + // enclosing_method_method_index] + int size = length * 4 + (parsed_enclosingmethod_attribute ? 2 : 0); + Array* inner_classes = MetadataFactory::new_array(_loader_data, size, CHECK_0); + _inner_classes = inner_classes; + + int index = 0; + int cp_size = _cp->length(); + cfs->guarantee_more(8 * length, CHECK_0); // 4-tuples of u2 + for (int n = 0; n < length; n++) { + // Inner class index + u2 inner_class_info_index = cfs->get_u2_fast(); + check_property( + inner_class_info_index == 0 || + valid_klass_reference_at(inner_class_info_index), + "inner_class_info_index %u has bad constant type in class file %s", + inner_class_info_index, CHECK_0); + // Outer class index + u2 outer_class_info_index = cfs->get_u2_fast(); + check_property( + outer_class_info_index == 0 || + valid_klass_reference_at(outer_class_info_index), + "outer_class_info_index %u has bad constant type in class file %s", + outer_class_info_index, CHECK_0); + // Inner class name + u2 inner_name_index = cfs->get_u2_fast(); + check_property( + inner_name_index == 0 || valid_symbol_at(inner_name_index), + "inner_name_index %u has bad constant type in class file %s", + inner_name_index, CHECK_0); + if (_need_verify) { + guarantee_property(inner_class_info_index != outer_class_info_index, + "Class is both outer and inner class in class file %s", CHECK_0); + } + // Access flags + AccessFlags inner_access_flags; + jint flags = cfs->get_u2_fast() & RECOGNIZED_INNER_CLASS_MODIFIERS; + if ((flags & JVM_ACC_INTERFACE) && _major_version < JAVA_6_VERSION) { + // Set abstract bit for old class files for backward compatibility + flags |= JVM_ACC_ABSTRACT; + } + verify_legal_class_modifiers(flags, CHECK_0); + inner_access_flags.set_flags(flags); + + inner_classes->at_put(index++, inner_class_info_index); + inner_classes->at_put(index++, outer_class_info_index); + inner_classes->at_put(index++, inner_name_index); + inner_classes->at_put(index++, inner_access_flags.as_short()); + } + + // 4347400: make sure there's no duplicate entry in the classes array + if (_need_verify && _major_version >= JAVA_1_5_VERSION) { + for(int i = 0; i < length * 4; i += 4) { + for(int j = i + 4; j < length * 4; j += 4) { + guarantee_property((inner_classes->at(i) != inner_classes->at(j) || + inner_classes->at(i+1) != inner_classes->at(j+1) || + inner_classes->at(i+2) != inner_classes->at(j+2) || + inner_classes->at(i+3) != inner_classes->at(j+3)), + "Duplicate entry in InnerClasses in class file %s", + CHECK_0); + } + } + } + + // Set EnclosingMethod class and method indexes. + if (parsed_enclosingmethod_attribute) { + inner_classes->at_put(index++, enclosing_method_class_index); + inner_classes->at_put(index++, enclosing_method_method_index); + } + assert(index == size, "wrong size"); + + // Restore buffer's current position. + cfs->set_current(current_mark); + + return length; +} + +void ClassFileParser::parse_classfile_synthetic_attribute(TRAPS) { + set_class_synthetic_flag(true); +} + +void ClassFileParser::parse_classfile_signature_attribute(TRAPS) { + ClassFileStream* cfs = stream(); + u2 signature_index = cfs->get_u2(CHECK); + check_property( + valid_symbol_at(signature_index), + "Invalid constant pool index %u in Signature attribute in class file %s", + signature_index, CHECK); + set_class_generic_signature_index(signature_index); +} + +void ClassFileParser::parse_classfile_bootstrap_methods_attribute(u4 attribute_byte_length, TRAPS) { + ClassFileStream* cfs = stream(); + u1* current_start = cfs->current(); + + guarantee_property(attribute_byte_length >= sizeof(u2), + "Invalid BootstrapMethods attribute length %u in class file %s", + attribute_byte_length, + CHECK); + + cfs->guarantee_more(attribute_byte_length, CHECK); + + int attribute_array_length = cfs->get_u2_fast(); + + guarantee_property(_max_bootstrap_specifier_index < attribute_array_length, + "Short length on BootstrapMethods in class file %s", + CHECK); + + + // The attribute contains a counted array of counted tuples of shorts, + // represending bootstrap specifiers: + // length*{bootstrap_method_index, argument_count*{argument_index}} + int operand_count = (attribute_byte_length - sizeof(u2)) / sizeof(u2); + // operand_count = number of shorts in attr, except for leading length + + // The attribute is copied into a short[] array. + // The array begins with a series of short[2] pairs, one for each tuple. + int index_size = (attribute_array_length * 2); + + Array* operands = MetadataFactory::new_array(_loader_data, index_size + operand_count, CHECK); + + // Eagerly assign operands so they will be deallocated with the constant + // pool if there is an error. + _cp->set_operands(operands); + + int operand_fill_index = index_size; + int cp_size = _cp->length(); + + for (int n = 0; n < attribute_array_length; n++) { + // Store a 32-bit offset into the header of the operand array. + ConstantPool::operand_offset_at_put(operands, n, operand_fill_index); + + // Read a bootstrap specifier. + cfs->guarantee_more(sizeof(u2) * 2, CHECK); // bsm, argc + u2 bootstrap_method_index = cfs->get_u2_fast(); + u2 argument_count = cfs->get_u2_fast(); + check_property( + valid_cp_range(bootstrap_method_index, cp_size) && + _cp->tag_at(bootstrap_method_index).is_method_handle(), + "bootstrap_method_index %u has bad constant type in class file %s", + bootstrap_method_index, + CHECK); + + guarantee_property((operand_fill_index + 1 + argument_count) < operands->length(), + "Invalid BootstrapMethods num_bootstrap_methods or num_bootstrap_arguments value in class file %s", + CHECK); + + operands->at_put(operand_fill_index++, bootstrap_method_index); + operands->at_put(operand_fill_index++, argument_count); + + cfs->guarantee_more(sizeof(u2) * argument_count, CHECK); // argv[argc] + for (int j = 0; j < argument_count; j++) { + u2 argument_index = cfs->get_u2_fast(); + check_property( + valid_cp_range(argument_index, cp_size) && + _cp->tag_at(argument_index).is_loadable_constant(), + "argument_index %u has bad constant type in class file %s", + argument_index, + CHECK); + operands->at_put(operand_fill_index++, argument_index); + } + } + + u1* current_end = cfs->current(); + guarantee_property(current_end == current_start + attribute_byte_length, + "Bad length on BootstrapMethods in class file %s", + CHECK); +} + +void ClassFileParser::parse_classfile_attributes(ClassFileParser::ClassAnnotationCollector* parsed_annotations, + TRAPS) { + ClassFileStream* cfs = stream(); + // Set inner classes attribute to default sentinel + _inner_classes = Universe::the_empty_short_array(); + cfs->guarantee_more(2, CHECK); // attributes_count + u2 attributes_count = cfs->get_u2_fast(); + bool parsed_sourcefile_attribute = false; + bool parsed_innerclasses_attribute = false; + bool parsed_enclosingmethod_attribute = false; + bool parsed_bootstrap_methods_attribute = false; + u1* runtime_visible_annotations = NULL; + int runtime_visible_annotations_length = 0; + u1* runtime_invisible_annotations = NULL; + int runtime_invisible_annotations_length = 0; + u1* runtime_visible_type_annotations = NULL; + int runtime_visible_type_annotations_length = 0; + u1* runtime_invisible_type_annotations = NULL; + int runtime_invisible_type_annotations_length = 0; + bool runtime_invisible_type_annotations_exists = false; + bool runtime_invisible_annotations_exists = false; + bool parsed_source_debug_ext_annotations_exist = false; + u1* inner_classes_attribute_start = NULL; + u4 inner_classes_attribute_length = 0; + u2 enclosing_method_class_index = 0; + u2 enclosing_method_method_index = 0; + // Iterate over attributes + while (attributes_count--) { + cfs->guarantee_more(6, CHECK); // attribute_name_index, attribute_length + u2 attribute_name_index = cfs->get_u2_fast(); + u4 attribute_length = cfs->get_u4_fast(); + check_property( + valid_symbol_at(attribute_name_index), + "Attribute name has bad constant pool index %u in class file %s", + attribute_name_index, CHECK); + Symbol* tag = _cp->symbol_at(attribute_name_index); + if (tag == vmSymbols::tag_source_file()) { + // Check for SourceFile tag + if (_need_verify) { + guarantee_property(attribute_length == 2, "Wrong SourceFile attribute length in class file %s", CHECK); + } + if (parsed_sourcefile_attribute) { + classfile_parse_error("Multiple SourceFile attributes in class file %s", CHECK); + } else { + parsed_sourcefile_attribute = true; + } + parse_classfile_sourcefile_attribute(CHECK); + } else if (tag == vmSymbols::tag_source_debug_extension()) { + // Check for SourceDebugExtension tag + if (parsed_source_debug_ext_annotations_exist) { + classfile_parse_error( + "Multiple SourceDebugExtension attributes in class file %s", CHECK); + } + parsed_source_debug_ext_annotations_exist = true; + parse_classfile_source_debug_extension_attribute((int)attribute_length, CHECK); + } else if (tag == vmSymbols::tag_inner_classes()) { + // Check for InnerClasses tag + if (parsed_innerclasses_attribute) { + classfile_parse_error("Multiple InnerClasses attributes in class file %s", CHECK); + } else { + parsed_innerclasses_attribute = true; + } + inner_classes_attribute_start = cfs->get_u1_buffer(); + inner_classes_attribute_length = attribute_length; + cfs->skip_u1(inner_classes_attribute_length, CHECK); + } else if (tag == vmSymbols::tag_synthetic()) { + // Check for Synthetic tag + // Shouldn't we check that the synthetic flags wasn't already set? - not required in spec + if (attribute_length != 0) { + classfile_parse_error( + "Invalid Synthetic classfile attribute length %u in class file %s", + attribute_length, CHECK); + } + parse_classfile_synthetic_attribute(CHECK); + } else if (tag == vmSymbols::tag_deprecated()) { + // Check for Deprecatd tag - 4276120 + if (attribute_length != 0) { + classfile_parse_error( + "Invalid Deprecated classfile attribute length %u in class file %s", + attribute_length, CHECK); + } + } else if (_major_version >= JAVA_1_5_VERSION) { + if (tag == vmSymbols::tag_signature()) { + if (attribute_length != 2) { + classfile_parse_error( + "Wrong Signature attribute length %u in class file %s", + attribute_length, CHECK); + } + parse_classfile_signature_attribute(CHECK); + } else if (tag == vmSymbols::tag_runtime_visible_annotations()) { + if (runtime_visible_annotations != NULL) { + classfile_parse_error( + "Multiple RuntimeVisibleAnnotations attributes in class file %s", CHECK); + } + runtime_visible_annotations_length = attribute_length; + runtime_visible_annotations = cfs->get_u1_buffer(); + assert(runtime_visible_annotations != NULL, "null visible annotations"); + parse_annotations(runtime_visible_annotations, + runtime_visible_annotations_length, + parsed_annotations, + CHECK); + cfs->skip_u1(runtime_visible_annotations_length, CHECK); + } else if (tag == vmSymbols::tag_runtime_invisible_annotations()) { + if (runtime_invisible_annotations_exists) { + classfile_parse_error( + "Multiple RuntimeInvisibleAnnotations attributes in class file %s", CHECK); + } + runtime_invisible_annotations_exists = true; + if (PreserveAllAnnotations) { + runtime_invisible_annotations_length = attribute_length; + runtime_invisible_annotations = cfs->get_u1_buffer(); + assert(runtime_invisible_annotations != NULL, "null invisible annotations"); + } + cfs->skip_u1(attribute_length, CHECK); + } else if (tag == vmSymbols::tag_enclosing_method()) { + if (parsed_enclosingmethod_attribute) { + classfile_parse_error("Multiple EnclosingMethod attributes in class file %s", CHECK); + } else { + parsed_enclosingmethod_attribute = true; + } + guarantee_property(attribute_length == 4, + "Wrong EnclosingMethod attribute length %u in class file %s", + attribute_length, CHECK); + cfs->guarantee_more(4, CHECK); // class_index, method_index + enclosing_method_class_index = cfs->get_u2_fast(); + enclosing_method_method_index = cfs->get_u2_fast(); + if (enclosing_method_class_index == 0) { + classfile_parse_error("Invalid class index in EnclosingMethod attribute in class file %s", CHECK); + } + // Validate the constant pool indices and types + check_property(valid_klass_reference_at(enclosing_method_class_index), + "Invalid or out-of-bounds class index in EnclosingMethod attribute in class file %s", CHECK); + if (enclosing_method_method_index != 0 && + (!_cp->is_within_bounds(enclosing_method_method_index) || + !_cp->tag_at(enclosing_method_method_index).is_name_and_type())) { + classfile_parse_error("Invalid or out-of-bounds method index in EnclosingMethod attribute in class file %s", CHECK); + } + } else if (tag == vmSymbols::tag_bootstrap_methods() && + _major_version >= Verifier::INVOKEDYNAMIC_MAJOR_VERSION) { + if (parsed_bootstrap_methods_attribute) + classfile_parse_error("Multiple BootstrapMethods attributes in class file %s", CHECK); + parsed_bootstrap_methods_attribute = true; + parse_classfile_bootstrap_methods_attribute(attribute_length, CHECK); + } else if (tag == vmSymbols::tag_runtime_visible_type_annotations()) { + if (runtime_visible_type_annotations != NULL) { + classfile_parse_error( + "Multiple RuntimeVisibleTypeAnnotations attributes in class file %s", CHECK); + } + runtime_visible_type_annotations_length = attribute_length; + runtime_visible_type_annotations = cfs->get_u1_buffer(); + assert(runtime_visible_type_annotations != NULL, "null visible type annotations"); + // No need for the VM to parse Type annotations + cfs->skip_u1(runtime_visible_type_annotations_length, CHECK); + } else if (tag == vmSymbols::tag_runtime_invisible_type_annotations()) { + if (runtime_invisible_type_annotations_exists) { + classfile_parse_error( + "Multiple RuntimeInvisibleTypeAnnotations attributes in class file %s", CHECK); + } else { + runtime_invisible_type_annotations_exists = true; + } + if (PreserveAllAnnotations) { + runtime_invisible_type_annotations_length = attribute_length; + runtime_invisible_type_annotations = cfs->get_u1_buffer(); + assert(runtime_invisible_type_annotations != NULL, "null invisible type annotations"); + } + cfs->skip_u1(attribute_length, CHECK); + } else { + // Unknown attribute + cfs->skip_u1(attribute_length, CHECK); + } + } else { + // Unknown attribute + cfs->skip_u1(attribute_length, CHECK); + } + } + _annotations = assemble_annotations(runtime_visible_annotations, + runtime_visible_annotations_length, + runtime_invisible_annotations, + runtime_invisible_annotations_length, + CHECK); + _type_annotations = assemble_annotations(runtime_visible_type_annotations, + runtime_visible_type_annotations_length, + runtime_invisible_type_annotations, + runtime_invisible_type_annotations_length, + CHECK); + + if (parsed_innerclasses_attribute || parsed_enclosingmethod_attribute) { + u2 num_of_classes = parse_classfile_inner_classes_attribute( + inner_classes_attribute_start, + parsed_innerclasses_attribute, + enclosing_method_class_index, + enclosing_method_method_index, + CHECK); + if (parsed_innerclasses_attribute &&_need_verify && _major_version >= JAVA_1_5_VERSION) { + guarantee_property( + inner_classes_attribute_length == sizeof(num_of_classes) + 4 * sizeof(u2) * num_of_classes, + "Wrong InnerClasses attribute length in class file %s", CHECK); + } + } + + if (_max_bootstrap_specifier_index >= 0) { + guarantee_property(parsed_bootstrap_methods_attribute, + "Missing BootstrapMethods attribute in class file %s", CHECK); + } +} + +void ClassFileParser::apply_parsed_class_attributes(instanceKlassHandle k) { + if (_synthetic_flag) + k->set_is_synthetic(); + if (_sourcefile_index != 0) { + k->set_source_file_name_index(_sourcefile_index); + } + if (_generic_signature_index != 0) { + k->set_generic_signature_index(_generic_signature_index); + } + if (_sde_buffer != NULL) { + k->set_source_debug_extension(_sde_buffer, _sde_length); + } +} + +// Transfer ownership of metadata allocated to the InstanceKlass. +void ClassFileParser::apply_parsed_class_metadata( + instanceKlassHandle this_klass, + int java_fields_count, TRAPS) { + // Assign annotations if needed + if (_annotations != NULL || _type_annotations != NULL || + _fields_annotations != NULL || _fields_type_annotations != NULL) { + Annotations* annotations = Annotations::allocate(_loader_data, CHECK); + annotations->set_class_annotations(_annotations); + annotations->set_class_type_annotations(_type_annotations); + annotations->set_fields_annotations(_fields_annotations); + annotations->set_fields_type_annotations(_fields_type_annotations); + this_klass->set_annotations(annotations); + } + + _cp->set_pool_holder(this_klass()); + this_klass->set_constants(_cp); + this_klass->set_fields(_fields, java_fields_count); + this_klass->set_methods(_methods); + this_klass->set_inner_classes(_inner_classes); + this_klass->set_local_interfaces(_local_interfaces); + this_klass->set_transitive_interfaces(_transitive_interfaces); + + // Clear out these fields so they don't get deallocated by the destructor + clear_class_metadata(); +} + +AnnotationArray* ClassFileParser::assemble_annotations(u1* runtime_visible_annotations, + int runtime_visible_annotations_length, + u1* runtime_invisible_annotations, + int runtime_invisible_annotations_length, TRAPS) { + AnnotationArray* annotations = NULL; + if (runtime_visible_annotations != NULL || + runtime_invisible_annotations != NULL) { + annotations = MetadataFactory::new_array(_loader_data, + runtime_visible_annotations_length + + runtime_invisible_annotations_length, + CHECK_(annotations)); + if (runtime_visible_annotations != NULL) { + for (int i = 0; i < runtime_visible_annotations_length; i++) { + annotations->at_put(i, runtime_visible_annotations[i]); + } + } + if (runtime_invisible_annotations != NULL) { + for (int i = 0; i < runtime_invisible_annotations_length; i++) { + int append = runtime_visible_annotations_length+i; + annotations->at_put(append, runtime_invisible_annotations[i]); + } + } + } + return annotations; +} + +instanceKlassHandle ClassFileParser::parse_super_class(int super_class_index, + TRAPS) { + instanceKlassHandle super_klass; + if (super_class_index == 0) { + check_property(_class_name == vmSymbols::java_lang_Object(), + "Invalid superclass index %u in class file %s", + super_class_index, + CHECK_NULL); + } else { + check_property(valid_klass_reference_at(super_class_index), + "Invalid superclass index %u in class file %s", + super_class_index, + CHECK_NULL); + // The class name should be legal because it is checked when parsing constant pool. + // However, make sure it is not an array type. + bool is_array = false; + if (_cp->tag_at(super_class_index).is_klass()) { + super_klass = instanceKlassHandle(THREAD, _cp->resolved_klass_at(super_class_index)); + if (_need_verify) + is_array = super_klass->oop_is_array(); + } else if (_need_verify) { + is_array = (_cp->klass_name_at(super_class_index)->byte_at(0) == JVM_SIGNATURE_ARRAY); + } + if (_need_verify) { + guarantee_property(!is_array, + "Bad superclass name in class file %s", CHECK_NULL); + } + } + return super_klass; +} + + +// Values needed for oopmap and InstanceKlass creation +class FieldLayoutInfo : public StackObj { + public: + int* nonstatic_oop_offsets; + unsigned int* nonstatic_oop_counts; + unsigned int nonstatic_oop_map_count; + unsigned int total_oop_map_count; + int instance_size; + int nonstatic_field_size; + int static_field_size; + bool has_nonstatic_fields; +}; + +// Layout fields and fill in FieldLayoutInfo. Could use more refactoring! +void ClassFileParser::layout_fields(Handle class_loader, + FieldAllocationCount* fac, + ClassAnnotationCollector* parsed_annotations, + FieldLayoutInfo* info, + TRAPS) { + + // Field size and offset computation + int nonstatic_field_size = _super_klass() == NULL ? 0 : _super_klass()->nonstatic_field_size(); + int next_static_oop_offset; + int next_static_double_offset; + int next_static_word_offset; + int next_static_short_offset; + int next_static_byte_offset; + int next_nonstatic_oop_offset; + int next_nonstatic_double_offset; + int next_nonstatic_word_offset; + int next_nonstatic_short_offset; + int next_nonstatic_byte_offset; + int first_nonstatic_oop_offset; + int next_nonstatic_field_offset; + int next_nonstatic_padded_offset; + + // Count the contended fields by type. + // + // We ignore static fields, because @Contended is not supported for them. + // The layout code below will also ignore the static fields. + int nonstatic_contended_count = 0; + FieldAllocationCount fac_contended; + for (AllFieldStream fs(_fields, _cp); !fs.done(); fs.next()) { + FieldAllocationType atype = (FieldAllocationType) fs.allocation_type(); + if (fs.is_contended()) { + fac_contended.count[atype]++; + if (!fs.access_flags().is_static()) { + nonstatic_contended_count++; + } + } + } + + + // Calculate the starting byte offsets + next_static_oop_offset = InstanceMirrorKlass::offset_of_static_fields(); + next_static_double_offset = next_static_oop_offset + + ((fac->count[STATIC_OOP]) * heapOopSize); + if ( fac->count[STATIC_DOUBLE] && + (Universe::field_type_should_be_aligned(T_DOUBLE) || + Universe::field_type_should_be_aligned(T_LONG)) ) { + next_static_double_offset = align_size_up(next_static_double_offset, BytesPerLong); + } + + next_static_word_offset = next_static_double_offset + + ((fac->count[STATIC_DOUBLE]) * BytesPerLong); + next_static_short_offset = next_static_word_offset + + ((fac->count[STATIC_WORD]) * BytesPerInt); + next_static_byte_offset = next_static_short_offset + + ((fac->count[STATIC_SHORT]) * BytesPerShort); + + int nonstatic_fields_start = instanceOopDesc::base_offset_in_bytes() + + nonstatic_field_size * heapOopSize; + + next_nonstatic_field_offset = nonstatic_fields_start; + + bool is_contended_class = parsed_annotations->is_contended(); + + // Class is contended, pad before all the fields + if (is_contended_class) { + next_nonstatic_field_offset += ContendedPaddingWidth; + } + + // Compute the non-contended fields count. + // The packing code below relies on these counts to determine if some field + // can be squeezed into the alignment gap. Contended fields are obviously + // exempt from that. + unsigned int nonstatic_double_count = fac->count[NONSTATIC_DOUBLE] - fac_contended.count[NONSTATIC_DOUBLE]; + unsigned int nonstatic_word_count = fac->count[NONSTATIC_WORD] - fac_contended.count[NONSTATIC_WORD]; + unsigned int nonstatic_short_count = fac->count[NONSTATIC_SHORT] - fac_contended.count[NONSTATIC_SHORT]; + unsigned int nonstatic_byte_count = fac->count[NONSTATIC_BYTE] - fac_contended.count[NONSTATIC_BYTE]; + unsigned int nonstatic_oop_count = fac->count[NONSTATIC_OOP] - fac_contended.count[NONSTATIC_OOP]; + + // Total non-static fields count, including every contended field + unsigned int nonstatic_fields_count = fac->count[NONSTATIC_DOUBLE] + fac->count[NONSTATIC_WORD] + + fac->count[NONSTATIC_SHORT] + fac->count[NONSTATIC_BYTE] + + fac->count[NONSTATIC_OOP]; + + bool super_has_nonstatic_fields = + (_super_klass() != NULL && _super_klass->has_nonstatic_fields()); + bool has_nonstatic_fields = super_has_nonstatic_fields || (nonstatic_fields_count != 0); + + + // Prepare list of oops for oop map generation. + // + // "offset" and "count" lists are describing the set of contiguous oop + // regions. offset[i] is the start of the i-th region, which then has + // count[i] oops following. Before we know how many regions are required, + // we pessimistically allocate the maps to fit all the oops into the + // distinct regions. + // + // TODO: We add +1 to always allocate non-zero resource arrays; we need + // to figure out if we still need to do this. + int* nonstatic_oop_offsets; + unsigned int* nonstatic_oop_counts; + unsigned int nonstatic_oop_map_count = 0; + unsigned int max_nonstatic_oop_maps = fac->count[NONSTATIC_OOP] + 1; + + nonstatic_oop_offsets = NEW_RESOURCE_ARRAY_IN_THREAD( + THREAD, int, max_nonstatic_oop_maps); + nonstatic_oop_counts = NEW_RESOURCE_ARRAY_IN_THREAD( + THREAD, unsigned int, max_nonstatic_oop_maps); + + first_nonstatic_oop_offset = 0; // will be set for first oop field + + bool compact_fields = CompactFields; + int allocation_style = FieldsAllocationStyle; + if( allocation_style < 0 || allocation_style > 2 ) { // Out of range? + assert(false, "0 <= FieldsAllocationStyle <= 2"); + allocation_style = 1; // Optimistic + } + + // The next classes have predefined hard-coded fields offsets + // (see in JavaClasses::compute_hard_coded_offsets()). + // Use default fields allocation order for them. + if( (allocation_style != 0 || compact_fields ) && class_loader.is_null() && + (_class_name == vmSymbols::java_lang_AssertionStatusDirectives() || + _class_name == vmSymbols::java_lang_Class() || + _class_name == vmSymbols::java_lang_ClassLoader() || + _class_name == vmSymbols::java_lang_ref_Reference() || + _class_name == vmSymbols::java_lang_ref_SoftReference() || + _class_name == vmSymbols::java_lang_StackTraceElement() || + _class_name == vmSymbols::java_lang_String() || + _class_name == vmSymbols::java_lang_Throwable() || + _class_name == vmSymbols::java_lang_Boolean() || + _class_name == vmSymbols::java_lang_Character() || + _class_name == vmSymbols::java_lang_Float() || + _class_name == vmSymbols::java_lang_Double() || + _class_name == vmSymbols::java_lang_Byte() || + _class_name == vmSymbols::java_lang_Short() || + _class_name == vmSymbols::java_lang_Integer() || + _class_name == vmSymbols::java_lang_Long())) { + allocation_style = 0; // Allocate oops first + compact_fields = false; // Don't compact fields + } + + // Rearrange fields for a given allocation style + if( allocation_style == 0 ) { + // Fields order: oops, longs/doubles, ints, shorts/chars, bytes, padded fields + next_nonstatic_oop_offset = next_nonstatic_field_offset; + next_nonstatic_double_offset = next_nonstatic_oop_offset + + (nonstatic_oop_count * heapOopSize); + } else if( allocation_style == 1 ) { + // Fields order: longs/doubles, ints, shorts/chars, bytes, oops, padded fields + next_nonstatic_double_offset = next_nonstatic_field_offset; + } else if( allocation_style == 2 ) { + // Fields allocation: oops fields in super and sub classes are together. + if( nonstatic_field_size > 0 && _super_klass() != NULL && + _super_klass->nonstatic_oop_map_size() > 0 ) { + unsigned int map_count = _super_klass->nonstatic_oop_map_count(); + OopMapBlock* first_map = _super_klass->start_of_nonstatic_oop_maps(); + OopMapBlock* last_map = first_map + map_count - 1; + int next_offset = last_map->offset() + (last_map->count() * heapOopSize); + if (next_offset == next_nonstatic_field_offset) { + allocation_style = 0; // allocate oops first + next_nonstatic_oop_offset = next_nonstatic_field_offset; + next_nonstatic_double_offset = next_nonstatic_oop_offset + + (nonstatic_oop_count * heapOopSize); + } + } + if( allocation_style == 2 ) { + allocation_style = 1; // allocate oops last + next_nonstatic_double_offset = next_nonstatic_field_offset; + } + } else { + ShouldNotReachHere(); + } + + int nonstatic_oop_space_count = 0; + int nonstatic_word_space_count = 0; + int nonstatic_short_space_count = 0; + int nonstatic_byte_space_count = 0; + int nonstatic_oop_space_offset; + int nonstatic_word_space_offset; + int nonstatic_short_space_offset; + int nonstatic_byte_space_offset; + + // Try to squeeze some of the fields into the gaps due to + // long/double alignment. + if( nonstatic_double_count > 0 ) { + int offset = next_nonstatic_double_offset; + next_nonstatic_double_offset = align_size_up(offset, BytesPerLong); + if( compact_fields && offset != next_nonstatic_double_offset ) { + // Allocate available fields into the gap before double field. + int length = next_nonstatic_double_offset - offset; + assert(length == BytesPerInt, ""); + nonstatic_word_space_offset = offset; + if( nonstatic_word_count > 0 ) { + nonstatic_word_count -= 1; + nonstatic_word_space_count = 1; // Only one will fit + length -= BytesPerInt; + offset += BytesPerInt; + } + nonstatic_short_space_offset = offset; + while( length >= BytesPerShort && nonstatic_short_count > 0 ) { + nonstatic_short_count -= 1; + nonstatic_short_space_count += 1; + length -= BytesPerShort; + offset += BytesPerShort; + } + nonstatic_byte_space_offset = offset; + while( length > 0 && nonstatic_byte_count > 0 ) { + nonstatic_byte_count -= 1; + nonstatic_byte_space_count += 1; + length -= 1; + } + // Allocate oop field in the gap if there are no other fields for that. + nonstatic_oop_space_offset = offset; + if( length >= heapOopSize && nonstatic_oop_count > 0 && + allocation_style != 0 ) { // when oop fields not first + nonstatic_oop_count -= 1; + nonstatic_oop_space_count = 1; // Only one will fit + length -= heapOopSize; + offset += heapOopSize; + } + } + } + + next_nonstatic_word_offset = next_nonstatic_double_offset + + (nonstatic_double_count * BytesPerLong); + next_nonstatic_short_offset = next_nonstatic_word_offset + + (nonstatic_word_count * BytesPerInt); + next_nonstatic_byte_offset = next_nonstatic_short_offset + + (nonstatic_short_count * BytesPerShort); + next_nonstatic_padded_offset = next_nonstatic_byte_offset + + nonstatic_byte_count; + + // let oops jump before padding with this allocation style + if( allocation_style == 1 ) { + next_nonstatic_oop_offset = next_nonstatic_padded_offset; + if( nonstatic_oop_count > 0 ) { + next_nonstatic_oop_offset = align_size_up(next_nonstatic_oop_offset, heapOopSize); + } + next_nonstatic_padded_offset = next_nonstatic_oop_offset + (nonstatic_oop_count * heapOopSize); + } + + // Iterate over fields again and compute correct offsets. + // The field allocation type was temporarily stored in the offset slot. + // oop fields are located before non-oop fields (static and non-static). + for (AllFieldStream fs(_fields, _cp); !fs.done(); fs.next()) { + + // skip already laid out fields + if (fs.is_offset_set()) continue; + + // contended instance fields are handled below + if (fs.is_contended() && !fs.access_flags().is_static()) continue; + + int real_offset; + FieldAllocationType atype = (FieldAllocationType) fs.allocation_type(); + + // pack the rest of the fields + switch (atype) { + case STATIC_OOP: + real_offset = next_static_oop_offset; + next_static_oop_offset += heapOopSize; + break; + case STATIC_BYTE: + real_offset = next_static_byte_offset; + next_static_byte_offset += 1; + break; + case STATIC_SHORT: + real_offset = next_static_short_offset; + next_static_short_offset += BytesPerShort; + break; + case STATIC_WORD: + real_offset = next_static_word_offset; + next_static_word_offset += BytesPerInt; + break; + case STATIC_DOUBLE: + real_offset = next_static_double_offset; + next_static_double_offset += BytesPerLong; + break; + case NONSTATIC_OOP: + if( nonstatic_oop_space_count > 0 ) { + real_offset = nonstatic_oop_space_offset; + nonstatic_oop_space_offset += heapOopSize; + nonstatic_oop_space_count -= 1; + } else { + real_offset = next_nonstatic_oop_offset; + next_nonstatic_oop_offset += heapOopSize; + } + // Update oop maps + if( nonstatic_oop_map_count > 0 && + nonstatic_oop_offsets[nonstatic_oop_map_count - 1] == + real_offset - + int(nonstatic_oop_counts[nonstatic_oop_map_count - 1]) * + heapOopSize ) { + // Extend current oop map + assert(nonstatic_oop_map_count - 1 < max_nonstatic_oop_maps, "range check"); + nonstatic_oop_counts[nonstatic_oop_map_count - 1] += 1; + } else { + // Create new oop map + assert(nonstatic_oop_map_count < max_nonstatic_oop_maps, "range check"); + nonstatic_oop_offsets[nonstatic_oop_map_count] = real_offset; + nonstatic_oop_counts [nonstatic_oop_map_count] = 1; + nonstatic_oop_map_count += 1; + if( first_nonstatic_oop_offset == 0 ) { // Undefined + first_nonstatic_oop_offset = real_offset; + } + } + break; + case NONSTATIC_BYTE: + if( nonstatic_byte_space_count > 0 ) { + real_offset = nonstatic_byte_space_offset; + nonstatic_byte_space_offset += 1; + nonstatic_byte_space_count -= 1; + } else { + real_offset = next_nonstatic_byte_offset; + next_nonstatic_byte_offset += 1; + } + break; + case NONSTATIC_SHORT: + if( nonstatic_short_space_count > 0 ) { + real_offset = nonstatic_short_space_offset; + nonstatic_short_space_offset += BytesPerShort; + nonstatic_short_space_count -= 1; + } else { + real_offset = next_nonstatic_short_offset; + next_nonstatic_short_offset += BytesPerShort; + } + break; + case NONSTATIC_WORD: + if( nonstatic_word_space_count > 0 ) { + real_offset = nonstatic_word_space_offset; + nonstatic_word_space_offset += BytesPerInt; + nonstatic_word_space_count -= 1; + } else { + real_offset = next_nonstatic_word_offset; + next_nonstatic_word_offset += BytesPerInt; + } + break; + case NONSTATIC_DOUBLE: + real_offset = next_nonstatic_double_offset; + next_nonstatic_double_offset += BytesPerLong; + break; + default: + ShouldNotReachHere(); + } + fs.set_offset(real_offset); + } + + + // Handle the contended cases. + // + // Each contended field should not intersect the cache line with another contended field. + // In the absence of alignment information, we end up with pessimistically separating + // the fields with full-width padding. + // + // Additionally, this should not break alignment for the fields, so we round the alignment up + // for each field. + if (nonstatic_contended_count > 0) { + + // if there is at least one contended field, we need to have pre-padding for them + next_nonstatic_padded_offset += ContendedPaddingWidth; + + // collect all contended groups + BitMap bm(_cp->size()); + for (AllFieldStream fs(_fields, _cp); !fs.done(); fs.next()) { + // skip already laid out fields + if (fs.is_offset_set()) continue; + + if (fs.is_contended()) { + bm.set_bit(fs.contended_group()); + } + } + + int current_group = -1; + while ((current_group = (int)bm.get_next_one_offset(current_group + 1)) != (int)bm.size()) { + + for (AllFieldStream fs(_fields, _cp); !fs.done(); fs.next()) { + + // skip already laid out fields + if (fs.is_offset_set()) continue; + + // skip non-contended fields and fields from different group + if (!fs.is_contended() || (fs.contended_group() != current_group)) continue; + + // handle statics below + if (fs.access_flags().is_static()) continue; + + int real_offset; + FieldAllocationType atype = (FieldAllocationType) fs.allocation_type(); + + switch (atype) { + case NONSTATIC_BYTE: + next_nonstatic_padded_offset = align_size_up(next_nonstatic_padded_offset, 1); + real_offset = next_nonstatic_padded_offset; + next_nonstatic_padded_offset += 1; + break; + + case NONSTATIC_SHORT: + next_nonstatic_padded_offset = align_size_up(next_nonstatic_padded_offset, BytesPerShort); + real_offset = next_nonstatic_padded_offset; + next_nonstatic_padded_offset += BytesPerShort; + break; + + case NONSTATIC_WORD: + next_nonstatic_padded_offset = align_size_up(next_nonstatic_padded_offset, BytesPerInt); + real_offset = next_nonstatic_padded_offset; + next_nonstatic_padded_offset += BytesPerInt; + break; + + case NONSTATIC_DOUBLE: + next_nonstatic_padded_offset = align_size_up(next_nonstatic_padded_offset, BytesPerLong); + real_offset = next_nonstatic_padded_offset; + next_nonstatic_padded_offset += BytesPerLong; + break; + + case NONSTATIC_OOP: + next_nonstatic_padded_offset = align_size_up(next_nonstatic_padded_offset, heapOopSize); + real_offset = next_nonstatic_padded_offset; + next_nonstatic_padded_offset += heapOopSize; + + // Create new oop map + assert(nonstatic_oop_map_count < max_nonstatic_oop_maps, "range check"); + nonstatic_oop_offsets[nonstatic_oop_map_count] = real_offset; + nonstatic_oop_counts [nonstatic_oop_map_count] = 1; + nonstatic_oop_map_count += 1; + if( first_nonstatic_oop_offset == 0 ) { // Undefined + first_nonstatic_oop_offset = real_offset; + } + break; + + default: + ShouldNotReachHere(); + } + + if (fs.contended_group() == 0) { + // Contended group defines the equivalence class over the fields: + // the fields within the same contended group are not inter-padded. + // The only exception is default group, which does not incur the + // equivalence, and so requires intra-padding. + next_nonstatic_padded_offset += ContendedPaddingWidth; + } + + fs.set_offset(real_offset); + } // for + + // Start laying out the next group. + // Note that this will effectively pad the last group in the back; + // this is expected to alleviate memory contention effects for + // subclass fields and/or adjacent object. + // If this was the default group, the padding is already in place. + if (current_group != 0) { + next_nonstatic_padded_offset += ContendedPaddingWidth; + } + } + + // handle static fields + } + + // Entire class is contended, pad in the back. + // This helps to alleviate memory contention effects for subclass fields + // and/or adjacent object. + if (is_contended_class) { + next_nonstatic_padded_offset += ContendedPaddingWidth; + } + + int notaligned_nonstatic_fields_end = next_nonstatic_padded_offset; + + int nonstatic_fields_end = align_size_up(notaligned_nonstatic_fields_end, heapOopSize); + int instance_end = align_size_up(notaligned_nonstatic_fields_end, wordSize); + int static_fields_end = align_size_up(next_static_byte_offset, wordSize); + + int static_field_size = (static_fields_end - + InstanceMirrorKlass::offset_of_static_fields()) / wordSize; + nonstatic_field_size = nonstatic_field_size + + (nonstatic_fields_end - nonstatic_fields_start) / heapOopSize; + + int instance_size = align_object_size(instance_end / wordSize); + + assert(instance_size == align_object_size(align_size_up( + (instanceOopDesc::base_offset_in_bytes() + nonstatic_field_size*heapOopSize), + wordSize) / wordSize), "consistent layout helper value"); + + // Invariant: nonstatic_field end/start should only change if there are + // nonstatic fields in the class, or if the class is contended. We compare + // against the non-aligned value, so that end alignment will not fail the + // assert without actually having the fields. + assert((notaligned_nonstatic_fields_end == nonstatic_fields_start) || + is_contended_class || + (nonstatic_fields_count > 0), "double-check nonstatic start/end"); + + // Number of non-static oop map blocks allocated at end of klass. + const unsigned int total_oop_map_count = + compute_oop_map_count(_super_klass, nonstatic_oop_map_count, + first_nonstatic_oop_offset); + +#ifndef PRODUCT + if (PrintFieldLayout) { + print_field_layout(_class_name, + _fields, + _cp, + instance_size, + nonstatic_fields_start, + nonstatic_fields_end, + static_fields_end); + } + +#endif + // Pass back information needed for InstanceKlass creation + info->nonstatic_oop_offsets = nonstatic_oop_offsets; + info->nonstatic_oop_counts = nonstatic_oop_counts; + info->nonstatic_oop_map_count = nonstatic_oop_map_count; + info->total_oop_map_count = total_oop_map_count; + info->instance_size = instance_size; + info->static_field_size = static_field_size; + info->nonstatic_field_size = nonstatic_field_size; + info->has_nonstatic_fields = has_nonstatic_fields; +} + + +instanceKlassHandle ClassFileParser::parseClassFile(Symbol* name, + ClassLoaderData* loader_data, + Handle protection_domain, + KlassHandle host_klass, + GrowableArray* cp_patches, + TempNewSymbol& parsed_name, + bool verify, + TRAPS) { + + // When a retransformable agent is attached, JVMTI caches the + // class bytes that existed before the first retransformation. + // If RedefineClasses() was used before the retransformable + // agent attached, then the cached class bytes may not be the + // original class bytes. + JvmtiCachedClassFileData *cached_class_file = NULL; + Handle class_loader(THREAD, loader_data->class_loader()); + bool has_default_methods = false; + ResourceMark rm(THREAD); + + ClassFileStream* cfs = stream(); + // Timing + assert(THREAD->is_Java_thread(), "must be a JavaThread"); + JavaThread* jt = (JavaThread*) THREAD; + + PerfClassTraceTime ctimer(ClassLoader::perf_class_parse_time(), + ClassLoader::perf_class_parse_selftime(), + NULL, + jt->get_thread_stat()->perf_recursion_counts_addr(), + jt->get_thread_stat()->perf_timers_addr(), + PerfClassTraceTime::PARSE_CLASS); + + init_parsed_class_attributes(loader_data); + + if (JvmtiExport::should_post_class_file_load_hook()) { + // Get the cached class file bytes (if any) from the class that + // is being redefined or retransformed. We use jvmti_thread_state() + // instead of JvmtiThreadState::state_for(jt) so we don't allocate + // a JvmtiThreadState any earlier than necessary. This will help + // avoid the bug described by 7126851. + JvmtiThreadState *state = jt->jvmti_thread_state(); + if (state != NULL) { + KlassHandle *h_class_being_redefined = + state->get_class_being_redefined(); + if (h_class_being_redefined != NULL) { + instanceKlassHandle ikh_class_being_redefined = + instanceKlassHandle(THREAD, (*h_class_being_redefined)()); + cached_class_file = ikh_class_being_redefined->get_cached_class_file(); + } + } + + unsigned char* ptr = cfs->buffer(); + unsigned char* end_ptr = cfs->buffer() + cfs->length(); + + JvmtiExport::post_class_file_load_hook(name, class_loader(), protection_domain, + &ptr, &end_ptr, &cached_class_file); + + if (ptr != cfs->buffer()) { + // JVMTI agent has modified class file data. + // Set new class file stream using JVMTI agent modified + // class file data. + cfs = new ClassFileStream(ptr, end_ptr - ptr, cfs->source()); + set_stream(cfs); + } + } + + _host_klass = host_klass; + _cp_patches = cp_patches; + + instanceKlassHandle nullHandle; + + // Figure out whether we can skip format checking (matching classic VM behavior) + if (DumpSharedSpaces) { + // verify == true means it's a 'remote' class (i.e., non-boot class) + // Verification decision is based on BytecodeVerificationRemote flag + // for those classes. + _need_verify = (verify) ? BytecodeVerificationRemote : + BytecodeVerificationLocal; + } else { + _need_verify = Verifier::should_verify_for(class_loader(), verify); + } + + // Set the verify flag in stream + cfs->set_verify(_need_verify); + + // Save the class file name for easier error message printing. + _class_name = (name != NULL) ? name : vmSymbols::unknown_class_name(); + + cfs->guarantee_more(8, CHECK_(nullHandle)); // magic, major, minor + // Magic value + u4 magic = cfs->get_u4_fast(); + guarantee_property(magic == JAVA_CLASSFILE_MAGIC, + "Incompatible magic value %u in class file %s", + magic, CHECK_(nullHandle)); + + // Version numbers + u2 minor_version = cfs->get_u2_fast(); + u2 major_version = cfs->get_u2_fast(); + + if (DumpSharedSpaces && major_version < JAVA_1_5_VERSION) { + ResourceMark rm; + warning("Pre JDK 1.5 class not supported by CDS: %u.%u %s", + major_version, minor_version, name->as_C_string()); + Exceptions::fthrow( + THREAD_AND_LOCATION, + vmSymbols::java_lang_UnsupportedClassVersionError(), + "Unsupported major.minor version for dump time %u.%u", + major_version, + minor_version); + } + + // Check version numbers - we check this even with verifier off + if (!is_supported_version(major_version, minor_version)) { + if (name == NULL) { + Exceptions::fthrow( + THREAD_AND_LOCATION, + vmSymbols::java_lang_UnsupportedClassVersionError(), + "Unsupported class file version %u.%u, " + "this version of the Java Runtime only recognizes class file versions up to %u.%u", + major_version, + minor_version, + JAVA_MAX_SUPPORTED_VERSION, + JAVA_MAX_SUPPORTED_MINOR_VERSION); + } else { + ResourceMark rm(THREAD); + Exceptions::fthrow( + THREAD_AND_LOCATION, + vmSymbols::java_lang_UnsupportedClassVersionError(), + "%s has been compiled by a more recent version of the Java Runtime (class file version %u.%u), " + "this version of the Java Runtime only recognizes class file versions up to %u.%u", + name->as_C_string(), + major_version, + minor_version, + JAVA_MAX_SUPPORTED_VERSION, + JAVA_MAX_SUPPORTED_MINOR_VERSION); + } + return nullHandle; + } + + _major_version = major_version; + _minor_version = minor_version; + + + // Check if verification needs to be relaxed for this class file + // Do not restrict it to jdk1.0 or jdk1.1 to maintain backward compatibility (4982376) + _relax_verify = Verifier::relax_verify_for(class_loader()); + + // Constant pool + constantPoolHandle cp = parse_constant_pool(CHECK_(nullHandle)); + + int cp_size = cp->length(); + + cfs->guarantee_more(8, CHECK_(nullHandle)); // flags, this_class, super_class, infs_len + + // Access flags + AccessFlags access_flags; + jint flags = cfs->get_u2_fast() & JVM_RECOGNIZED_CLASS_MODIFIERS; + + if ((flags & JVM_ACC_INTERFACE) && _major_version < JAVA_6_VERSION) { + // Set abstract bit for old class files for backward compatibility + flags |= JVM_ACC_ABSTRACT; + } + verify_legal_class_modifiers(flags, CHECK_(nullHandle)); + access_flags.set_flags(flags); + + // This class and superclass + u2 this_class_index = cfs->get_u2_fast(); + check_property( + valid_cp_range(this_class_index, cp_size) && + cp->tag_at(this_class_index).is_unresolved_klass(), + "Invalid this class index %u in constant pool in class file %s", + this_class_index, CHECK_(nullHandle)); + + Symbol* class_name = cp->klass_name_at(this_class_index); + assert(class_name != NULL, "class_name can't be null"); + + // It's important to set parsed_name *before* resolving the super class. + // (it's used for cleanup by the caller if parsing fails) + parsed_name = class_name; + // parsed_name is returned and can be used if there's an error, so add to + // its reference count. Caller will decrement the refcount. + parsed_name->increment_refcount(); + + // Update _class_name which could be null previously to be class_name + _class_name = class_name; + + // Don't need to check whether this class name is legal or not. + // It has been checked when constant pool is parsed. + // However, make sure it is not an array type. + if (_need_verify) { + guarantee_property(class_name->byte_at(0) != JVM_SIGNATURE_ARRAY, + "Bad class name in class file %s", + CHECK_(nullHandle)); + } + + Klass* preserve_this_klass; // for storing result across HandleMark + + // release all handles when parsing is done + { HandleMark hm(THREAD); + + // Checks if name in class file matches requested name + if (name != NULL && class_name != name) { + ResourceMark rm(THREAD); + Exceptions::fthrow( + THREAD_AND_LOCATION, + vmSymbols::java_lang_NoClassDefFoundError(), + "%s (wrong name: %s)", + name->as_C_string(), + class_name->as_C_string() + ); + return nullHandle; + } + + if (TraceClassLoadingPreorder) { + tty->print("[Loading %s", (name != NULL) ? name->as_klass_external_name() : "NoName"); + if (cfs->source() != NULL) tty->print(" from %s", cfs->source()); + tty->print_cr("]"); + } +#if INCLUDE_CDS + if (DumpLoadedClassList != NULL && cfs->source() != NULL && classlist_file->is_open()) { + // Only dump the classes that can be stored into CDS archive + if (SystemDictionaryShared::is_sharing_possible(loader_data)) { + if (name != NULL) { + ResourceMark rm(THREAD); + classlist_file->print_cr("%s", name->as_C_string()); + classlist_file->flush(); + } + } + } +#endif + + u2 super_class_index = cfs->get_u2_fast(); + instanceKlassHandle super_klass = parse_super_class(super_class_index, + CHECK_NULL); + + // Interfaces + u2 itfs_len = cfs->get_u2_fast(); + Array* local_interfaces = + parse_interfaces(itfs_len, protection_domain, _class_name, + &has_default_methods, CHECK_(nullHandle)); + + u2 java_fields_count = 0; + // Fields (offsets are filled in later) + FieldAllocationCount fac; + Array* fields = parse_fields(class_name, + access_flags.is_interface(), + &fac, &java_fields_count, + CHECK_(nullHandle)); + // Methods + bool has_final_method = false; + AccessFlags promoted_flags; + promoted_flags.set_flags(0); + Array* methods = parse_methods(access_flags.is_interface(), + &promoted_flags, + &has_final_method, + &has_default_methods, + CHECK_(nullHandle)); + + // Additional attributes + ClassAnnotationCollector parsed_annotations; + parse_classfile_attributes(&parsed_annotations, CHECK_(nullHandle)); + + // Make sure this is the end of class file stream + guarantee_property(cfs->at_eos(), "Extra bytes at the end of class file %s", CHECK_(nullHandle)); + + // We check super class after class file is parsed and format is checked + if (super_class_index > 0 && super_klass.is_null()) { + Symbol* sk = cp->klass_name_at(super_class_index); + if (access_flags.is_interface()) { + // Before attempting to resolve the superclass, check for class format + // errors not checked yet. + guarantee_property(sk == vmSymbols::java_lang_Object(), + "Interfaces must have java.lang.Object as superclass in class file %s", + CHECK_(nullHandle)); + } + Klass* k = SystemDictionary::resolve_super_or_fail(class_name, sk, + class_loader, + protection_domain, + true, + CHECK_(nullHandle)); + + KlassHandle kh (THREAD, k); + super_klass = instanceKlassHandle(THREAD, kh()); + } + if (super_klass.not_null()) { + + if (super_klass->has_default_methods()) { + has_default_methods = true; + } + + if (super_klass->is_interface()) { + ResourceMark rm(THREAD); + Exceptions::fthrow( + THREAD_AND_LOCATION, + vmSymbols::java_lang_IncompatibleClassChangeError(), + "class %s has interface %s as super class", + class_name->as_klass_external_name(), + super_klass->external_name() + ); + return nullHandle; + } + // Make sure super class is not final + if (super_klass->is_final()) { + THROW_MSG_(vmSymbols::java_lang_VerifyError(), "Cannot inherit from final class", nullHandle); + } + } + + // save super klass for error handling. + _super_klass = super_klass; + + // Compute the transitive list of all unique interfaces implemented by this class + _transitive_interfaces = + compute_transitive_interfaces(super_klass, local_interfaces, CHECK_(nullHandle)); + + // sort methods + intArray* method_ordering = sort_methods(methods); + + // promote flags from parse_methods() to the klass' flags + access_flags.add_promoted_flags(promoted_flags.as_int()); + + // Size of Java vtable (in words) + int vtable_size = 0; + int itable_size = 0; + int num_miranda_methods = 0; + + GrowableArray all_mirandas(20); + + klassVtable::compute_vtable_size_and_num_mirandas( + &vtable_size, &num_miranda_methods, &all_mirandas, super_klass(), methods, + access_flags, class_loader, class_name, local_interfaces, + CHECK_(nullHandle)); + + // Size of Java itable (in words) + itable_size = access_flags.is_interface() ? 0 : klassItable::compute_itable_size(_transitive_interfaces); + + FieldLayoutInfo info; + layout_fields(class_loader, &fac, &parsed_annotations, &info, CHECK_NULL); + + int total_oop_map_size2 = + InstanceKlass::nonstatic_oop_map_size(info.total_oop_map_count); + + // Compute reference type + ReferenceType rt; + if (super_klass() == NULL) { + rt = REF_NONE; + } else { + rt = super_klass->reference_type(); + } + + // We can now create the basic Klass* for this klass + _klass = InstanceKlass::allocate_instance_klass(loader_data, + vtable_size, + itable_size, + info.static_field_size, + total_oop_map_size2, + rt, + access_flags, + name, + super_klass(), + !host_klass.is_null(), + CHECK_(nullHandle)); + instanceKlassHandle this_klass (THREAD, _klass); + + assert(this_klass->static_field_size() == info.static_field_size, "sanity"); + assert(this_klass->nonstatic_oop_map_count() == info.total_oop_map_count, + "sanity"); + + // Fill in information already parsed + this_klass->set_should_verify_class(verify); + jint lh = Klass::instance_layout_helper(info.instance_size, false); + this_klass->set_layout_helper(lh); + assert(this_klass->oop_is_instance(), "layout is correct"); + assert(this_klass->size_helper() == info.instance_size, "correct size_helper"); + // Not yet: supers are done below to support the new subtype-checking fields + //this_klass->set_super(super_klass()); + this_klass->set_class_loader_data(loader_data); + this_klass->set_nonstatic_field_size(info.nonstatic_field_size); + this_klass->set_has_nonstatic_fields(info.has_nonstatic_fields); + this_klass->set_static_oop_field_count(fac.count[STATIC_OOP]); + + apply_parsed_class_metadata(this_klass, java_fields_count, CHECK_NULL); + + if (has_final_method) { + this_klass->set_has_final_method(); + } + this_klass->copy_method_ordering(method_ordering, CHECK_NULL); + // The InstanceKlass::_methods_jmethod_ids cache + // is managed on the assumption that the initial cache + // size is equal to the number of methods in the class. If + // that changes, then InstanceKlass::idnum_can_increment() + // has to be changed accordingly. + this_klass->set_initial_method_idnum(methods->length()); + this_klass->set_name(cp->klass_name_at(this_class_index)); + if (is_anonymous()) // I am well known to myself + cp->klass_at_put(this_class_index, this_klass()); // eagerly resolve + + this_klass->set_minor_version(minor_version); + this_klass->set_major_version(major_version); + this_klass->set_has_default_methods(has_default_methods); + + if (!host_klass.is_null()) { + assert (this_klass->is_anonymous(), "should be the same"); + this_klass->set_host_klass(host_klass()); + } + + // Set up Method*::intrinsic_id as soon as we know the names of methods. + // (We used to do this lazily, but now we query it in Rewriter, + // which is eagerly done for every method, so we might as well do it now, + // when everything is fresh in memory.) + if (Method::klass_id_for_intrinsics(this_klass()) != vmSymbols::NO_SID) { + for (int j = 0; j < methods->length(); j++) { + methods->at(j)->init_intrinsic_id(); + } + } + + if (cached_class_file != NULL) { + // JVMTI: we have an InstanceKlass now, tell it about the cached bytes + this_klass->set_cached_class_file(cached_class_file); + } + + // Fill in field values obtained by parse_classfile_attributes + if (parsed_annotations.has_any_annotations()) + parsed_annotations.apply_to(this_klass); + apply_parsed_class_attributes(this_klass); + + // Miranda methods + if ((num_miranda_methods > 0) || + // if this class introduced new miranda methods or + (super_klass.not_null() && (super_klass->has_miranda_methods())) + // super class exists and this class inherited miranda methods + ) { + this_klass->set_has_miranda_methods(); // then set a flag + } + + // Fill in information needed to compute superclasses. + this_klass->initialize_supers(super_klass(), CHECK_(nullHandle)); + + // Initialize itable offset tables + klassItable::setup_itable_offset_table(this_klass); + + // Compute transitive closure of interfaces this class implements + // Do final class setup + fill_oop_maps(this_klass, info.nonstatic_oop_map_count, info.nonstatic_oop_offsets, info.nonstatic_oop_counts); + + // Fill in has_finalizer, has_vanilla_constructor, and layout_helper + set_precomputed_flags(this_klass); + + // reinitialize modifiers, using the InnerClasses attribute + int computed_modifiers = this_klass->compute_modifier_flags(CHECK_(nullHandle)); + this_klass->set_modifier_flags(computed_modifiers); + + // check if this class can access its super class + check_super_class_access(this_klass, CHECK_(nullHandle)); + + // check if this class can access its superinterfaces + check_super_interface_access(this_klass, CHECK_(nullHandle)); + + // check if this class overrides any final method + check_final_method_override(this_klass, CHECK_(nullHandle)); + + // check that if this class is an interface then it doesn't have static methods + if (this_klass->is_interface()) { + /* An interface in a JAVA 8 classfile can be static */ + if (_major_version < JAVA_8_VERSION) { + check_illegal_static_method(this_klass, CHECK_(nullHandle)); + } + } + + // Allocate mirror and initialize static fields + java_lang_Class::create_mirror(this_klass, class_loader, protection_domain, + CHECK_(nullHandle)); + + // Generate any default methods - default methods are interface methods + // that have a default implementation. This is new with Lambda project. + if (has_default_methods ) { + DefaultMethods::generate_default_methods( + this_klass(), &all_mirandas, CHECK_(nullHandle)); + } + + // Update the loader_data graph. + record_defined_class_dependencies(this_klass, CHECK_NULL); + + ClassLoadingService::notify_class_loaded(InstanceKlass::cast(this_klass()), + false /* not shared class */); + + if (TraceClassLoading) { + ResourceMark rm; + // print in a single call to reduce interleaving of output + if (cfs->source() != NULL) { + tty->print("[Loaded %s from %s]\n", this_klass->external_name(), + cfs->source()); + } else if (class_loader.is_null()) { + Klass* caller = + THREAD->is_Java_thread() + ? ((JavaThread*)THREAD)->security_get_caller_class(1) + : NULL; + // caller can be NULL, for example, during a JVMTI VM_Init hook + if (caller != NULL) { + tty->print("[Loaded %s by instance of %s]\n", + this_klass->external_name(), + InstanceKlass::cast(caller)->external_name()); + } else { + tty->print("[Loaded %s]\n", this_klass->external_name()); + } + } else { + tty->print("[Loaded %s from %s]\n", this_klass->external_name(), + InstanceKlass::cast(class_loader->klass())->external_name()); + } + } + + if (TraceClassResolution) { + ResourceMark rm; + // print out the superclass. + const char * from = this_klass()->external_name(); + if (this_klass->java_super() != NULL) { + tty->print("RESOLVE %s %s (super)\n", from, InstanceKlass::cast(this_klass->java_super())->external_name()); + } + // print out each of the interface classes referred to by this class. + Array* local_interfaces = this_klass->local_interfaces(); + if (local_interfaces != NULL) { + int length = local_interfaces->length(); + for (int i = 0; i < length; i++) { + Klass* k = local_interfaces->at(i); + InstanceKlass* to_class = InstanceKlass::cast(k); + const char * to = to_class->external_name(); + tty->print("RESOLVE %s %s (interface)\n", from, to); + } + } + } + + // preserve result across HandleMark + preserve_this_klass = this_klass(); + } + + // Create new handle outside HandleMark (might be needed for + // Extended Class Redefinition) + instanceKlassHandle this_klass (THREAD, preserve_this_klass); + debug_only(this_klass->verify();) + + // Clear class if no error has occurred so destructor doesn't deallocate it + _klass = NULL; + return this_klass; +} + +// Destructor to clean up if there's an error +ClassFileParser::~ClassFileParser() { + MetadataFactory::free_metadata(_loader_data, _cp); + MetadataFactory::free_array(_loader_data, _fields); + + // Free methods + InstanceKlass::deallocate_methods(_loader_data, _methods); + + // beware of the Universe::empty_blah_array!! + if (_inner_classes != Universe::the_empty_short_array()) { + MetadataFactory::free_array(_loader_data, _inner_classes); + } + + // Free interfaces + InstanceKlass::deallocate_interfaces(_loader_data, _super_klass(), + _local_interfaces, _transitive_interfaces); + + MetadataFactory::free_array(_loader_data, _annotations); + MetadataFactory::free_array(_loader_data, _type_annotations); + Annotations::free_contents(_loader_data, _fields_annotations); + Annotations::free_contents(_loader_data, _fields_type_annotations); + + clear_class_metadata(); + + // deallocate the klass if already created. Don't directly deallocate, but add + // to the deallocate list so that the klass is removed from the CLD::_klasses list + // at a safepoint. + if (_klass != NULL) { + _loader_data->add_to_deallocate_list(_klass); + } + _klass = NULL; +} + +void ClassFileParser::print_field_layout(Symbol* name, + Array* fields, + constantPoolHandle cp, + int instance_size, + int instance_fields_start, + int instance_fields_end, + int static_fields_end) { + tty->print("%s: field layout\n", name->as_klass_external_name()); + tty->print(" @%3d %s\n", instance_fields_start, "--- instance fields start ---"); + for (AllFieldStream fs(fields, cp); !fs.done(); fs.next()) { + if (!fs.access_flags().is_static()) { + tty->print(" @%3d \"%s\" %s\n", + fs.offset(), + fs.name()->as_klass_external_name(), + fs.signature()->as_klass_external_name()); + } + } + tty->print(" @%3d %s\n", instance_fields_end, "--- instance fields end ---"); + tty->print(" @%3d %s\n", instance_size * wordSize, "--- instance ends ---"); + tty->print(" @%3d %s\n", InstanceMirrorKlass::offset_of_static_fields(), "--- static fields start ---"); + for (AllFieldStream fs(fields, cp); !fs.done(); fs.next()) { + if (fs.access_flags().is_static()) { + tty->print(" @%3d \"%s\" %s\n", + fs.offset(), + fs.name()->as_klass_external_name(), + fs.signature()->as_klass_external_name()); + } + } + tty->print(" @%3d %s\n", static_fields_end, "--- static fields end ---"); + tty->print("\n"); +} + +unsigned int +ClassFileParser::compute_oop_map_count(instanceKlassHandle super, + unsigned int nonstatic_oop_map_count, + int first_nonstatic_oop_offset) { + unsigned int map_count = + super.is_null() ? 0 : super->nonstatic_oop_map_count(); + if (nonstatic_oop_map_count > 0) { + // We have oops to add to map + if (map_count == 0) { + map_count = nonstatic_oop_map_count; + } else { + // Check whether we should add a new map block or whether the last one can + // be extended + OopMapBlock* const first_map = super->start_of_nonstatic_oop_maps(); + OopMapBlock* const last_map = first_map + map_count - 1; + + int next_offset = last_map->offset() + last_map->count() * heapOopSize; + if (next_offset == first_nonstatic_oop_offset) { + // There is no gap bettwen superklass's last oop field and first + // local oop field, merge maps. + nonstatic_oop_map_count -= 1; + } else { + // Superklass didn't end with a oop field, add extra maps + assert(next_offset < first_nonstatic_oop_offset, "just checking"); + } + map_count += nonstatic_oop_map_count; + } + } + return map_count; +} + + +void ClassFileParser::fill_oop_maps(instanceKlassHandle k, + unsigned int nonstatic_oop_map_count, + int* nonstatic_oop_offsets, + unsigned int* nonstatic_oop_counts) { + OopMapBlock* this_oop_map = k->start_of_nonstatic_oop_maps(); + const InstanceKlass* const super = k->superklass(); + const unsigned int super_count = super ? super->nonstatic_oop_map_count() : 0; + if (super_count > 0) { + // Copy maps from superklass + OopMapBlock* super_oop_map = super->start_of_nonstatic_oop_maps(); + for (unsigned int i = 0; i < super_count; ++i) { + *this_oop_map++ = *super_oop_map++; + } + } + + if (nonstatic_oop_map_count > 0) { + if (super_count + nonstatic_oop_map_count > k->nonstatic_oop_map_count()) { + // The counts differ because there is no gap between superklass's last oop + // field and the first local oop field. Extend the last oop map copied + // from the superklass instead of creating new one. + nonstatic_oop_map_count--; + nonstatic_oop_offsets++; + this_oop_map--; + this_oop_map->set_count(this_oop_map->count() + *nonstatic_oop_counts++); + this_oop_map++; + } + + // Add new map blocks, fill them + while (nonstatic_oop_map_count-- > 0) { + this_oop_map->set_offset(*nonstatic_oop_offsets++); + this_oop_map->set_count(*nonstatic_oop_counts++); + this_oop_map++; + } + assert(k->start_of_nonstatic_oop_maps() + k->nonstatic_oop_map_count() == + this_oop_map, "sanity"); + } +} + + +void ClassFileParser::set_precomputed_flags(instanceKlassHandle k) { + Klass* super = k->super(); + + // Check if this klass has an empty finalize method (i.e. one with return bytecode only), + // in which case we don't have to register objects as finalizable + if (!_has_empty_finalizer) { + if (_has_finalizer || + (super != NULL && super->has_finalizer())) { + k->set_has_finalizer(); + } + } + +#ifdef ASSERT + bool f = false; + Method* m = k->lookup_method(vmSymbols::finalize_method_name(), + vmSymbols::void_method_signature()); + if (m != NULL && !m->is_empty_method()) { + f = true; + } + + // Spec doesn't prevent agent from redefinition of empty finalizer. + // Despite the fact that it's generally bad idea and redefined finalizer + // will not work as expected we shouldn't abort vm in this case + if (!k->has_redefined_this_or_super()) { + assert(f == k->has_finalizer(), "inconsistent has_finalizer"); + } +#endif + + // Check if this klass supports the java.lang.Cloneable interface + if (SystemDictionary::Cloneable_klass_loaded()) { + if (k->is_subtype_of(SystemDictionary::Cloneable_klass())) { + k->set_is_cloneable(); + } + } + + // Check if this klass has a vanilla default constructor + if (super == NULL) { + // java.lang.Object has empty default constructor + k->set_has_vanilla_constructor(); + } else { + if (super->has_vanilla_constructor() && + _has_vanilla_constructor) { + k->set_has_vanilla_constructor(); + } +#ifdef ASSERT + bool v = false; + if (super->has_vanilla_constructor()) { + Method* constructor = k->find_method(vmSymbols::object_initializer_name( +), vmSymbols::void_method_signature()); + if (constructor != NULL && constructor->is_vanilla_constructor()) { + v = true; + } + } + assert(v == k->has_vanilla_constructor(), "inconsistent has_vanilla_constructor"); +#endif + } + + // If it cannot be fast-path allocated, set a bit in the layout helper. + // See documentation of InstanceKlass::can_be_fastpath_allocated(). + assert(k->size_helper() > 0, "layout_helper is initialized"); + if ((!RegisterFinalizersAtInit && k->has_finalizer()) + || k->is_abstract() || k->is_interface() + || (k->name() == vmSymbols::java_lang_Class() && k->class_loader() == NULL) + || k->size_helper() >= FastAllocateSizeLimit) { + // Forbid fast-path allocation. + jint lh = Klass::instance_layout_helper(k->size_helper(), true); + k->set_layout_helper(lh); + } +} + +// Attach super classes and interface classes to class loader data +void ClassFileParser::record_defined_class_dependencies(instanceKlassHandle defined_klass, TRAPS) { + ClassLoaderData * defining_loader_data = defined_klass->class_loader_data(); + if (defining_loader_data->is_the_null_class_loader_data()) { + // Dependencies to null class loader data are implicit. + return; + } else { + // add super class dependency + Klass* super = defined_klass->super(); + if (super != NULL) { + defining_loader_data->record_dependency(super, CHECK); + } + + // add super interface dependencies + Array* local_interfaces = defined_klass->local_interfaces(); + if (local_interfaces != NULL) { + int length = local_interfaces->length(); + for (int i = 0; i < length; i++) { + defining_loader_data->record_dependency(local_interfaces->at(i), CHECK); + } + } + } +} + +// utility methods for appending an array with check for duplicates + +void append_interfaces(GrowableArray* result, Array* ifs) { + // iterate over new interfaces + for (int i = 0; i < ifs->length(); i++) { + Klass* e = ifs->at(i); + assert(e->is_klass() && InstanceKlass::cast(e)->is_interface(), "just checking"); + // add new interface + result->append_if_missing(e); + } +} + +Array* ClassFileParser::compute_transitive_interfaces( + instanceKlassHandle super, + Array* local_ifs, TRAPS) { + // Compute maximum size for transitive interfaces + int max_transitive_size = 0; + int super_size = 0; + // Add superclass transitive interfaces size + if (super.not_null()) { + super_size = super->transitive_interfaces()->length(); + max_transitive_size += super_size; + } + // Add local interfaces' super interfaces + int local_size = local_ifs->length(); + for (int i = 0; i < local_size; i++) { + Klass* l = local_ifs->at(i); + max_transitive_size += InstanceKlass::cast(l)->transitive_interfaces()->length(); + } + // Finally add local interfaces + max_transitive_size += local_size; + // Construct array + if (max_transitive_size == 0) { + // no interfaces, use canonicalized array + return Universe::the_empty_klass_array(); + } else if (max_transitive_size == super_size) { + // no new local interfaces added, share superklass' transitive interface array + return super->transitive_interfaces(); + } else if (max_transitive_size == local_size) { + // only local interfaces added, share local interface array + return local_ifs; + } else { + ResourceMark rm; + GrowableArray* result = new GrowableArray(max_transitive_size); + + // Copy down from superclass + if (super.not_null()) { + append_interfaces(result, super->transitive_interfaces()); + } + + // Copy down from local interfaces' superinterfaces + for (int i = 0; i < local_ifs->length(); i++) { + Klass* l = local_ifs->at(i); + append_interfaces(result, InstanceKlass::cast(l)->transitive_interfaces()); + } + // Finally add local interfaces + append_interfaces(result, local_ifs); + + // length will be less than the max_transitive_size if duplicates were removed + int length = result->length(); + assert(length <= max_transitive_size, "just checking"); + Array* new_result = MetadataFactory::new_array(_loader_data, length, CHECK_NULL); + for (int i = 0; i < length; i++) { + Klass* e = result->at(i); + assert(e != NULL, "just checking"); + new_result->at_put(i, e); + } + return new_result; + } +} + +void ClassFileParser::check_super_class_access(instanceKlassHandle this_klass, TRAPS) { + Klass* super = this_klass->super(); + if ((super != NULL) && + (!Reflection::verify_class_access(this_klass(), super, false))) { + ResourceMark rm(THREAD); + Exceptions::fthrow( + THREAD_AND_LOCATION, + vmSymbols::java_lang_IllegalAccessError(), + "class %s cannot access its superclass %s", + this_klass->external_name(), + InstanceKlass::cast(super)->external_name() + ); + return; + } +} + + +void ClassFileParser::check_super_interface_access(instanceKlassHandle this_klass, TRAPS) { + Array* local_interfaces = this_klass->local_interfaces(); + int lng = local_interfaces->length(); + for (int i = lng - 1; i >= 0; i--) { + Klass* k = local_interfaces->at(i); + assert (k != NULL && k->is_interface(), "invalid interface"); + if (!Reflection::verify_class_access(this_klass(), k, false)) { + ResourceMark rm(THREAD); + Exceptions::fthrow( + THREAD_AND_LOCATION, + vmSymbols::java_lang_IllegalAccessError(), + "class %s cannot access its superinterface %s", + this_klass->external_name(), + InstanceKlass::cast(k)->external_name() + ); + return; + } + } +} + + +void ClassFileParser::check_final_method_override(instanceKlassHandle this_klass, TRAPS) { + Array* methods = this_klass->methods(); + int num_methods = methods->length(); + + // go thru each method and check if it overrides a final method + for (int index = 0; index < num_methods; index++) { + Method* m = methods->at(index); + + // skip private, static, and methods + if ((!m->is_private() && !m->is_static()) && + (m->name() != vmSymbols::object_initializer_name())) { + + Symbol* name = m->name(); + Symbol* signature = m->signature(); + Klass* k = this_klass->super(); + Method* super_m = NULL; + while (k != NULL) { + // skip supers that don't have final methods. + if (k->has_final_method()) { + // lookup a matching method in the super class hierarchy + super_m = InstanceKlass::cast(k)->lookup_method(name, signature); + if (super_m == NULL) { + break; // didn't find any match; get out + } + + if (super_m->is_final() && !super_m->is_static() && + // matching method in super is final, and not static + (Reflection::verify_field_access(this_klass(), + super_m->method_holder(), + super_m->method_holder(), + super_m->access_flags(), false)) + // this class can access super final method and therefore override + ) { + ResourceMark rm(THREAD); + Exceptions::fthrow( + THREAD_AND_LOCATION, + vmSymbols::java_lang_VerifyError(), + "class %s overrides final method %s.%s%s", + this_klass->external_name(), + super_m->method_holder()->external_name(), + name->as_C_string(), + signature->as_C_string() + ); + return; + } + + // continue to look from super_m's holder's super. + k = super_m->method_holder()->super(); + continue; + } + + k = k->super(); + } + } + } +} + + +// assumes that this_klass is an interface +void ClassFileParser::check_illegal_static_method(instanceKlassHandle this_klass, TRAPS) { + assert(this_klass->is_interface(), "not an interface"); + Array* methods = this_klass->methods(); + int num_methods = methods->length(); + + for (int index = 0; index < num_methods; index++) { + Method* m = methods->at(index); + // if m is static and not the init method, throw a verify error + if ((m->is_static()) && (m->name() != vmSymbols::class_initializer_name())) { + ResourceMark rm(THREAD); + Exceptions::fthrow( + THREAD_AND_LOCATION, + vmSymbols::java_lang_VerifyError(), + "Illegal static method %s in interface %s", + m->name()->as_C_string(), + this_klass->external_name() + ); + return; + } + } +} + +// utility methods for format checking + +void ClassFileParser::verify_legal_class_modifiers(jint flags, TRAPS) { + if (!_need_verify) { return; } + + const bool is_interface = (flags & JVM_ACC_INTERFACE) != 0; + const bool is_abstract = (flags & JVM_ACC_ABSTRACT) != 0; + const bool is_final = (flags & JVM_ACC_FINAL) != 0; + const bool is_super = (flags & JVM_ACC_SUPER) != 0; + const bool is_enum = (flags & JVM_ACC_ENUM) != 0; + const bool is_annotation = (flags & JVM_ACC_ANNOTATION) != 0; + const bool major_gte_15 = _major_version >= JAVA_1_5_VERSION; + + if ((is_abstract && is_final) || + (is_interface && !is_abstract) || + (is_interface && major_gte_15 && (is_super || is_enum)) || + (!is_interface && major_gte_15 && is_annotation)) { + ResourceMark rm(THREAD); + Exceptions::fthrow( + THREAD_AND_LOCATION, + vmSymbols::java_lang_ClassFormatError(), + "Illegal class modifiers in class %s: 0x%X", + _class_name->as_C_string(), flags + ); + return; + } +} + +bool ClassFileParser::has_illegal_visibility(jint flags) { + const bool is_public = (flags & JVM_ACC_PUBLIC) != 0; + const bool is_protected = (flags & JVM_ACC_PROTECTED) != 0; + const bool is_private = (flags & JVM_ACC_PRIVATE) != 0; + + return ((is_public && is_protected) || + (is_public && is_private) || + (is_protected && is_private)); +} + +bool ClassFileParser::is_supported_version(u2 major, u2 minor) { + u2 max_version = JAVA_MAX_SUPPORTED_VERSION; + return (major >= JAVA_MIN_SUPPORTED_VERSION) && + (major <= max_version) && + ((major != max_version) || + (minor <= JAVA_MAX_SUPPORTED_MINOR_VERSION)); +} + +void ClassFileParser::verify_legal_field_modifiers( + jint flags, bool is_interface, TRAPS) { + if (!_need_verify) { return; } + + const bool is_public = (flags & JVM_ACC_PUBLIC) != 0; + const bool is_protected = (flags & JVM_ACC_PROTECTED) != 0; + const bool is_private = (flags & JVM_ACC_PRIVATE) != 0; + const bool is_static = (flags & JVM_ACC_STATIC) != 0; + const bool is_final = (flags & JVM_ACC_FINAL) != 0; + const bool is_volatile = (flags & JVM_ACC_VOLATILE) != 0; + const bool is_transient = (flags & JVM_ACC_TRANSIENT) != 0; + const bool is_enum = (flags & JVM_ACC_ENUM) != 0; + const bool major_gte_15 = _major_version >= JAVA_1_5_VERSION; + + bool is_illegal = false; + + if (is_interface) { + if (!is_public || !is_static || !is_final || is_private || + is_protected || is_volatile || is_transient || + (major_gte_15 && is_enum)) { + is_illegal = true; + } + } else { // not interface + if (has_illegal_visibility(flags) || (is_final && is_volatile)) { + is_illegal = true; + } + } + + if (is_illegal) { + ResourceMark rm(THREAD); + Exceptions::fthrow( + THREAD_AND_LOCATION, + vmSymbols::java_lang_ClassFormatError(), + "Illegal field modifiers in class %s: 0x%X", + _class_name->as_C_string(), flags); + return; + } +} + +void ClassFileParser::verify_legal_method_modifiers( + jint flags, bool is_interface, Symbol* name, TRAPS) { + if (!_need_verify) { return; } + + const bool is_public = (flags & JVM_ACC_PUBLIC) != 0; + const bool is_private = (flags & JVM_ACC_PRIVATE) != 0; + const bool is_static = (flags & JVM_ACC_STATIC) != 0; + const bool is_final = (flags & JVM_ACC_FINAL) != 0; + const bool is_native = (flags & JVM_ACC_NATIVE) != 0; + const bool is_abstract = (flags & JVM_ACC_ABSTRACT) != 0; + const bool is_bridge = (flags & JVM_ACC_BRIDGE) != 0; + const bool is_strict = (flags & JVM_ACC_STRICT) != 0; + const bool is_synchronized = (flags & JVM_ACC_SYNCHRONIZED) != 0; + const bool is_protected = (flags & JVM_ACC_PROTECTED) != 0; + const bool major_gte_15 = _major_version >= JAVA_1_5_VERSION; + const bool major_gte_8 = _major_version >= JAVA_8_VERSION; + const bool is_initializer = (name == vmSymbols::object_initializer_name()); + + bool is_illegal = false; + + if (is_interface) { + if (major_gte_8) { + // Class file version is JAVA_8_VERSION or later Methods of + // interfaces may set any of the flags except ACC_PROTECTED, + // ACC_FINAL, ACC_NATIVE, and ACC_SYNCHRONIZED; they must + // have exactly one of the ACC_PUBLIC or ACC_PRIVATE flags set. + if ((is_public == is_private) || /* Only one of private and public should be true - XNOR */ + (is_native || is_protected || is_final || is_synchronized) || + // If a specific method of a class or interface has its + // ACC_ABSTRACT flag set, it must not have any of its + // ACC_FINAL, ACC_NATIVE, ACC_PRIVATE, ACC_STATIC, + // ACC_STRICT, or ACC_SYNCHRONIZED flags set. No need to + // check for ACC_FINAL, ACC_NATIVE or ACC_SYNCHRONIZED as + // those flags are illegal irrespective of ACC_ABSTRACT being set or not. + (is_abstract && (is_private || is_static || is_strict))) { + is_illegal = true; + } + } else if (major_gte_15) { + // Class file version in the interval [JAVA_1_5_VERSION, JAVA_8_VERSION) + if (!is_public || is_static || is_final || is_synchronized || + is_native || !is_abstract || is_strict) { + is_illegal = true; + } + } else { + // Class file version is pre-JAVA_1_5_VERSION + if (!is_public || is_static || is_final || is_native || !is_abstract) { + is_illegal = true; + } + } + } else { // not interface + if (is_initializer) { + if (is_static || is_final || is_synchronized || is_native || + is_abstract || (major_gte_15 && is_bridge)) { + is_illegal = true; + } + } else { // not initializer + if (is_abstract) { + if ((is_final || is_native || is_private || is_static || + (major_gte_15 && (is_synchronized || is_strict)))) { + is_illegal = true; + } + } + if (has_illegal_visibility(flags)) { + is_illegal = true; + } + } + } + + if (is_illegal) { + ResourceMark rm(THREAD); + Exceptions::fthrow( + THREAD_AND_LOCATION, + vmSymbols::java_lang_ClassFormatError(), + "Method %s in class %s has illegal modifiers: 0x%X", + name->as_C_string(), _class_name->as_C_string(), flags); + return; + } +} + +void ClassFileParser::verify_legal_utf8(const unsigned char* buffer, int length, TRAPS) { + assert(_need_verify, "only called when _need_verify is true"); + int i = 0; + int count = length >> 2; + for (int k=0; k= 128 (highest bit 1) for v == 0 or v >= 128. + unsigned char res = b0 | b0 - 1 | + b1 | b1 - 1 | + b2 | b2 - 1 | + b3 | b3 - 1; + if (res >= 128) break; + i += 4; + } + for(; i < length; i++) { + unsigned short c; + // no embedded zeros + guarantee_property((buffer[i] != 0), "Illegal UTF8 string in constant pool in class file %s", CHECK); + if(buffer[i] < 128) { + continue; + } + if ((i + 5) < length) { // see if it's legal supplementary character + if (UTF8::is_supplementary_character(&buffer[i])) { + c = UTF8::get_supplementary_character(&buffer[i]); + i += 5; + continue; + } + } + switch (buffer[i] >> 4) { + default: break; + case 0x8: case 0x9: case 0xA: case 0xB: case 0xF: + classfile_parse_error("Illegal UTF8 string in constant pool in class file %s", CHECK); + case 0xC: case 0xD: // 110xxxxx 10xxxxxx + c = (buffer[i] & 0x1F) << 6; + i++; + if ((i < length) && ((buffer[i] & 0xC0) == 0x80)) { + c += buffer[i] & 0x3F; + if (_major_version <= 47 || c == 0 || c >= 0x80) { + // for classes with major > 47, c must a null or a character in its shortest form + break; + } + } + classfile_parse_error("Illegal UTF8 string in constant pool in class file %s", CHECK); + case 0xE: // 1110xxxx 10xxxxxx 10xxxxxx + c = (buffer[i] & 0xF) << 12; + i += 2; + if ((i < length) && ((buffer[i-1] & 0xC0) == 0x80) && ((buffer[i] & 0xC0) == 0x80)) { + c += ((buffer[i-1] & 0x3F) << 6) + (buffer[i] & 0x3F); + if (_major_version <= 47 || c >= 0x800) { + // for classes with major > 47, c must be in its shortest form + break; + } + } + classfile_parse_error("Illegal UTF8 string in constant pool in class file %s", CHECK); + } // end of switch + } // end of for +} + +// Checks if name is a legal class name. +void ClassFileParser::verify_legal_class_name(Symbol* name, TRAPS) { + if (!_need_verify || _relax_verify) { return; } + + char buf[fixed_buffer_size]; + char* bytes = name->as_utf8_flexible_buffer(THREAD, buf, fixed_buffer_size); + unsigned int length = name->utf8_length(); + bool legal = false; + + if (length > 0) { + char* p; + if (bytes[0] == JVM_SIGNATURE_ARRAY) { + p = skip_over_field_signature(bytes, false, length, CHECK); + legal = (p != NULL) && ((p - bytes) == (int)length); + } else if (_major_version < JAVA_1_5_VERSION) { + if (bytes[0] != '<') { + p = skip_over_field_name(bytes, true, length); + legal = (p != NULL) && ((p - bytes) == (int)length); + } + } else { + // 4900761: relax the constraints based on JSR202 spec + // Class names may be drawn from the entire Unicode character set. + // Identifiers between '/' must be unqualified names. + // The utf8 string has been verified when parsing cpool entries. + legal = verify_unqualified_name(bytes, length, LegalClass); + } + } + if (!legal) { + ResourceMark rm(THREAD); + Exceptions::fthrow( + THREAD_AND_LOCATION, + vmSymbols::java_lang_ClassFormatError(), + "Illegal class name \"%s\" in class file %s", bytes, + _class_name->as_C_string() + ); + return; + } +} + +// Checks if name is a legal field name. +void ClassFileParser::verify_legal_field_name(Symbol* name, TRAPS) { + if (!_need_verify || _relax_verify) { return; } + + char buf[fixed_buffer_size]; + char* bytes = name->as_utf8_flexible_buffer(THREAD, buf, fixed_buffer_size); + unsigned int length = name->utf8_length(); + bool legal = false; + + if (length > 0) { + if (_major_version < JAVA_1_5_VERSION) { + if (bytes[0] != '<') { + char* p = skip_over_field_name(bytes, false, length); + legal = (p != NULL) && ((p - bytes) == (int)length); + } + } else { + // 4881221: relax the constraints based on JSR202 spec + legal = verify_unqualified_name(bytes, length, LegalField); + } + } + + if (!legal) { + ResourceMark rm(THREAD); + Exceptions::fthrow( + THREAD_AND_LOCATION, + vmSymbols::java_lang_ClassFormatError(), + "Illegal field name \"%s\" in class %s", bytes, + _class_name->as_C_string() + ); + return; + } +} + +// Checks if name is a legal method name. +void ClassFileParser::verify_legal_method_name(Symbol* name, TRAPS) { + if (!_need_verify || _relax_verify) { return; } + + assert(name != NULL, "method name is null"); + char buf[fixed_buffer_size]; + char* bytes = name->as_utf8_flexible_buffer(THREAD, buf, fixed_buffer_size); + unsigned int length = name->utf8_length(); + bool legal = false; + + if (length > 0) { + if (bytes[0] == '<') { + if (name == vmSymbols::object_initializer_name() || name == vmSymbols::class_initializer_name()) { + legal = true; + } + } else if (_major_version < JAVA_1_5_VERSION) { + char* p; + p = skip_over_field_name(bytes, false, length); + legal = (p != NULL) && ((p - bytes) == (int)length); + } else { + // 4881221: relax the constraints based on JSR202 spec + legal = verify_unqualified_name(bytes, length, LegalMethod); + } + } + + if (!legal) { + ResourceMark rm(THREAD); + Exceptions::fthrow( + THREAD_AND_LOCATION, + vmSymbols::java_lang_ClassFormatError(), + "Illegal method name \"%s\" in class %s", bytes, + _class_name->as_C_string() + ); + return; + } +} + + +// Checks if signature is a legal field signature. +void ClassFileParser::verify_legal_field_signature(Symbol* name, Symbol* signature, TRAPS) { + if (!_need_verify) { return; } + + char buf[fixed_buffer_size]; + char* bytes = signature->as_utf8_flexible_buffer(THREAD, buf, fixed_buffer_size); + unsigned int length = signature->utf8_length(); + char* p = skip_over_field_signature(bytes, false, length, CHECK); + + if (p == NULL || (p - bytes) != (int)length) { + throwIllegalSignature("Field", name, signature, CHECK); + } +} + +// Checks if signature is a legal method signature. +// Returns number of parameters +int ClassFileParser::verify_legal_method_signature(Symbol* name, Symbol* signature, TRAPS) { + if (!_need_verify) { + // make sure caller's args_size will be less than 0 even for non-static + // method so it will be recomputed in compute_size_of_parameters(). + return -2; + } + + unsigned int args_size = 0; + char buf[fixed_buffer_size]; + char* p = signature->as_utf8_flexible_buffer(THREAD, buf, fixed_buffer_size); + unsigned int length = signature->utf8_length(); + char* nextp; + + // The first character must be a '(' + if ((length > 0) && (*p++ == JVM_SIGNATURE_FUNC)) { + length--; + // Skip over legal field signatures + nextp = skip_over_field_signature(p, false, length, CHECK_0); + while ((length > 0) && (nextp != NULL)) { + args_size++; + if (p[0] == 'J' || p[0] == 'D') { + args_size++; + } + length -= nextp - p; + p = nextp; + nextp = skip_over_field_signature(p, false, length, CHECK_0); + } + // The first non-signature thing better be a ')' + if ((length > 0) && (*p++ == JVM_SIGNATURE_ENDFUNC)) { + length--; + if (name->utf8_length() > 0 && name->byte_at(0) == '<') { + // All internal methods must return void + if ((length == 1) && (p[0] == JVM_SIGNATURE_VOID)) { + return args_size; + } + } else { + // Now we better just have a return value + nextp = skip_over_field_signature(p, true, length, CHECK_0); + if (nextp && ((int)length == (nextp - p))) { + return args_size; + } + } + } + } + // Report error + throwIllegalSignature("Method", name, signature, CHECK_0); + return 0; +} + + +// Unqualified names may not contain the characters '.', ';', '[', or '/'. +// Method names also may not contain the characters '<' or '>', unless +// or . Note that method names may not be or in this +// method. Because these names have been checked as special cases before +// calling this method in verify_legal_method_name. +bool ClassFileParser::verify_unqualified_name( + char* name, unsigned int length, int type) { + jchar ch; + + for (char* p = name; p != name + length; ) { + ch = *p; + if (ch < 128) { + p++; + if (ch == '.' || ch == ';' || ch == '[' ) { + return false; // do not permit '.', ';', or '[' + } + if (type != LegalClass && ch == '/') { + return false; // do not permit '/' unless it's class name + } + if (type == LegalMethod && (ch == '<' || ch == '>')) { + return false; // do not permit '<' or '>' in method names + } + } else { + char* tmp_p = UTF8::next(p, &ch); + p = tmp_p; + } + } + return true; +} + + +// Take pointer to a string. Skip over the longest part of the string that could +// be taken as a fieldname. Allow '/' if slash_ok is true. +// Return a pointer to just past the fieldname. +// Return NULL if no fieldname at all was found, or in the case of slash_ok +// being true, we saw consecutive slashes (meaning we were looking for a +// qualified path but found something that was badly-formed). +char* ClassFileParser::skip_over_field_name(char* name, bool slash_ok, unsigned int length) { + char* p; + jchar ch; + jboolean last_is_slash = false; + jboolean not_first_ch = false; + + for (p = name; p != name + length; not_first_ch = true) { + char* old_p = p; + ch = *p; + if (ch < 128) { + p++; + // quick check for ascii + if ((ch >= 'a' && ch <= 'z') || + (ch >= 'A' && ch <= 'Z') || + (ch == '_' || ch == '$') || + (not_first_ch && ch >= '0' && ch <= '9')) { + last_is_slash = false; + continue; + } + if (slash_ok && ch == '/') { + if (last_is_slash) { + return NULL; // Don't permit consecutive slashes + } + last_is_slash = true; + continue; + } + } else { + jint unicode_ch; + char* tmp_p = UTF8::next_character(p, &unicode_ch); + p = tmp_p; + last_is_slash = false; + // Check if ch is Java identifier start or is Java identifier part + // 4672820: call java.lang.Character methods directly without generating separate tables. + EXCEPTION_MARK; + instanceKlassHandle klass (THREAD, SystemDictionary::Character_klass()); + + // return value + JavaValue result(T_BOOLEAN); + // Set up the arguments to isJavaIdentifierStart and isJavaIdentifierPart + JavaCallArguments args; + args.push_int(unicode_ch); + + // public static boolean isJavaIdentifierStart(char ch); + JavaCalls::call_static(&result, + klass, + vmSymbols::isJavaIdentifierStart_name(), + vmSymbols::int_bool_signature(), + &args, + THREAD); + + if (HAS_PENDING_EXCEPTION) { + CLEAR_PENDING_EXCEPTION; + return 0; + } + if (result.get_jboolean()) { + continue; + } + + if (not_first_ch) { + // public static boolean isJavaIdentifierPart(char ch); + JavaCalls::call_static(&result, + klass, + vmSymbols::isJavaIdentifierPart_name(), + vmSymbols::int_bool_signature(), + &args, + THREAD); + + if (HAS_PENDING_EXCEPTION) { + CLEAR_PENDING_EXCEPTION; + return 0; + } + + if (result.get_jboolean()) { + continue; + } + } + } + return (not_first_ch) ? old_p : NULL; + } + return (not_first_ch) ? p : NULL; +} + + +// Take pointer to a string. Skip over the longest part of the string that could +// be taken as a field signature. Allow "void" if void_ok. +// Return a pointer to just past the signature. +// Return NULL if no legal signature is found. +char* ClassFileParser::skip_over_field_signature(char* signature, + bool void_ok, + unsigned int length, + TRAPS) { + unsigned int array_dim = 0; + while (length > 0) { + switch (signature[0]) { + case JVM_SIGNATURE_VOID: if (!void_ok) { return NULL; } + case JVM_SIGNATURE_BOOLEAN: + case JVM_SIGNATURE_BYTE: + case JVM_SIGNATURE_CHAR: + case JVM_SIGNATURE_SHORT: + case JVM_SIGNATURE_INT: + case JVM_SIGNATURE_FLOAT: + case JVM_SIGNATURE_LONG: + case JVM_SIGNATURE_DOUBLE: + return signature + 1; + case JVM_SIGNATURE_CLASS: { + if (_major_version < JAVA_1_5_VERSION) { + // Skip over the class name if one is there + char* p = skip_over_field_name(signature + 1, true, --length); + + // The next character better be a semicolon + if (p && (p - signature) > 1 && p[0] == ';') { + return p + 1; + } + } else { + // 4900761: For class version > 48, any unicode is allowed in class name. + length--; + signature++; + while (length > 0 && signature[0] != ';') { + if (signature[0] == '.') { + classfile_parse_error("Class name contains illegal character '.' in descriptor in class file %s", CHECK_0); + } + length--; + signature++; + } + if (signature[0] == ';') { return signature + 1; } + } + + return NULL; + } + case JVM_SIGNATURE_ARRAY: + array_dim++; + if (array_dim > 255) { + // 4277370: array descriptor is valid only if it represents 255 or fewer dimensions. + classfile_parse_error("Array type descriptor has more than 255 dimensions in class file %s", CHECK_0); + } + // The rest of what's there better be a legal signature + signature++; + length--; + void_ok = false; + break; + + default: + return NULL; + } + } + return NULL; +} diff --git a/hotspot/src/share/vm/classfile/classFileParser.hpp b/hotspot/src/share/vm/classfile/classFileParser.hpp index 6ce366a21f8..b2efa8ceba3 100644 --- a/hotspot/src/share/vm/classfile/classFileParser.hpp +++ b/hotspot/src/share/vm/classfile/classFileParser.hpp @@ -247,7 +247,7 @@ class ClassFileParser VALUE_OBJ_CLASS_SPEC { Array* parse_methods(bool is_interface, AccessFlags* promoted_flags, bool* has_final_method, - bool* has_default_method, + bool* declares_default_methods, TRAPS); intArray* sort_methods(Array* methods); diff --git a/hotspot/src/share/vm/oops/instanceKlass.cpp b/hotspot/src/share/vm/oops/instanceKlass.cpp index 8ea08cd54c7..1ef55c6875d 100644 --- a/hotspot/src/share/vm/oops/instanceKlass.cpp +++ b/hotspot/src/share/vm/oops/instanceKlass.cpp @@ -736,6 +736,41 @@ void InstanceKlass::link_methods(TRAPS) { } } +// Eagerly initialize superinterfaces that declare default methods (concrete instance: any access) +void InstanceKlass::initialize_super_interfaces(instanceKlassHandle this_k, TRAPS) { + if (this_k->has_default_methods()) { + for (int i = 0; i < this_k->local_interfaces()->length(); ++i) { + Klass* iface = this_k->local_interfaces()->at(i); + InstanceKlass* ik = InstanceKlass::cast(iface); + if (ik->should_be_initialized()) { + if (ik->has_default_methods()) { + ik->initialize_super_interfaces(ik, THREAD); + } + // Only initialize() interfaces that "declare" concrete methods. + // has_default_methods drives searching superinterfaces since it + // means has_default_methods in its superinterface hierarchy + if (!HAS_PENDING_EXCEPTION && ik->declares_default_methods()) { + ik->initialize(THREAD); + } + if (HAS_PENDING_EXCEPTION) { + Handle e(THREAD, PENDING_EXCEPTION); + CLEAR_PENDING_EXCEPTION; + { + EXCEPTION_MARK; + // Locks object, set state, and notify all waiting threads + this_k->set_initialization_state_and_notify( + initialization_error, THREAD); + + // ignore any exception thrown, superclass initialization error is + // thrown below + CLEAR_PENDING_EXCEPTION; + } + THROW_OOP(e()); + } + } + } + } +} void InstanceKlass::initialize_impl(instanceKlassHandle this_k, TRAPS) { // Make sure klass is linked (verified) before initialization @@ -815,33 +850,11 @@ void InstanceKlass::initialize_impl(instanceKlassHandle this_k, TRAPS) { } } + // Recursively initialize any superinterfaces that declare default methods + // Only need to recurse if has_default_methods which includes declaring and + // inheriting default methods if (this_k->has_default_methods()) { - // Step 7.5: initialize any interfaces which have default methods - for (int i = 0; i < this_k->local_interfaces()->length(); ++i) { - Klass* iface = this_k->local_interfaces()->at(i); - InstanceKlass* ik = InstanceKlass::cast(iface); - if (ik->has_default_methods() && ik->should_be_initialized()) { - ik->initialize(THREAD); - - if (HAS_PENDING_EXCEPTION) { - Handle e(THREAD, PENDING_EXCEPTION); - CLEAR_PENDING_EXCEPTION; - { - EXCEPTION_MARK; - // Locks object, set state, and notify all waiting threads - this_k->set_initialization_state_and_notify( - initialization_error, THREAD); - - // ignore any exception thrown, superclass initialization error is - // thrown below - CLEAR_PENDING_EXCEPTION; - } - DTRACE_CLASSINIT_PROBE_WAIT( - super__failed, InstanceKlass::cast(this_k()), -1, wait); - THROW_OOP(e()); - } - } - } + this_k->initialize_super_interfaces(this_k, CHECK); } // Step 8 diff --git a/hotspot/src/share/vm/oops/instanceKlass.hpp b/hotspot/src/share/vm/oops/instanceKlass.hpp index e50aa45eb69..64fb16bda64 100644 --- a/hotspot/src/share/vm/oops/instanceKlass.hpp +++ b/hotspot/src/share/vm/oops/instanceKlass.hpp @@ -199,13 +199,14 @@ class InstanceKlass: public Klass { bool _has_unloaded_dependent; enum { - _misc_rewritten = 1 << 0, // methods rewritten. - _misc_has_nonstatic_fields = 1 << 1, // for sizing with UseCompressedOops - _misc_should_verify_class = 1 << 2, // allow caching of preverification - _misc_is_anonymous = 1 << 3, // has embedded _host_klass field - _misc_is_contended = 1 << 4, // marked with contended annotation - _misc_has_default_methods = 1 << 5, // class/superclass/implemented interfaces has default methods - _misc_has_been_redefined = 1 << 6 // class has been redefined + _misc_rewritten = 1 << 0, // methods rewritten. + _misc_has_nonstatic_fields = 1 << 1, // for sizing with UseCompressedOops + _misc_should_verify_class = 1 << 2, // allow caching of preverification + _misc_is_anonymous = 1 << 3, // has embedded _host_klass field + _misc_is_contended = 1 << 4, // marked with contended annotation + _misc_has_default_methods = 1 << 5, // class/superclass/implemented interfaces has default methods + _misc_declares_default_methods = 1 << 6, // directly declares default methods (any access) + _misc_has_been_redefined = 1 << 7 // class has been redefined }; u2 _misc_flags; u2 _minor_version; // minor version number of class file @@ -651,6 +652,17 @@ class InstanceKlass: public Klass { } } + bool declares_default_methods() const { + return (_misc_flags & _misc_declares_default_methods) != 0; + } + void set_declares_default_methods(bool b) { + if (b) { + _misc_flags |= _misc_declares_default_methods; + } else { + _misc_flags &= ~_misc_declares_default_methods; + } + } + // for adding methods, ConstMethod::UNSET_IDNUM means no more ids available inline u2 next_method_idnum(); void set_initial_method_idnum(u2 value) { _idnum_allocated_count = value; } @@ -1022,6 +1034,7 @@ private: static bool link_class_impl (instanceKlassHandle this_k, bool throw_verifyerror, TRAPS); static bool verify_code (instanceKlassHandle this_k, bool throw_verifyerror, TRAPS); static void initialize_impl (instanceKlassHandle this_k, TRAPS); + static void initialize_super_interfaces (instanceKlassHandle this_k, TRAPS); static void eager_initialize_impl (instanceKlassHandle this_k); static void set_initialization_state_and_notify_impl (instanceKlassHandle this_k, ClassState state, TRAPS); static void call_class_initializer_impl (instanceKlassHandle this_k, TRAPS); diff --git a/hotspot/src/share/vm/utilities/dtrace_disabled.hpp b/hotspot/src/share/vm/utilities/dtrace_disabled.hpp index 2906fe22e93..40093592791 100644 --- a/hotspot/src/share/vm/utilities/dtrace_disabled.hpp +++ b/hotspot/src/share/vm/utilities/dtrace_disabled.hpp @@ -27,7 +27,7 @@ /* This file contains dummy provider probes needed when compiling a hotspot * that does not support dtrace probes. This could be because we're building - * on a system that doesn't suuport dtrace or because we're bulding a variant + * on a system that doesn't support dtrace or because we're bulding a variant * of hotspot (like core) where we do not support dtrace */ #if !defined(DTRACE_ENABLED) diff --git a/hotspot/test/runtime/lambda-features/InvokespecialInterface.java b/hotspot/test/runtime/lambda-features/InvokespecialInterface.java index c33dd56ef64..3b32dd7e552 100644 --- a/hotspot/test/runtime/lambda-features/InvokespecialInterface.java +++ b/hotspot/test/runtime/lambda-features/InvokespecialInterface.java @@ -33,11 +33,12 @@ import java.util.function.*; import java.util.*; +public class InvokespecialInterface { interface I { default void imethod() { System.out.println("I::imethod"); } } -class C implements I { +static class C implements I { public void foo() { I.super.imethod(); } // invokespecial InterfaceMethod public void bar() { I i = this; i.imethod(); } // invokeinterface same public void doSomeInvokedynamic() { @@ -48,7 +49,6 @@ class C implements I { } } -public class InvokespecialInterface { public static void main(java.lang.String[] unused) { // need to create C and call I::foo() C c = new C(); diff --git a/hotspot/test/runtime/lambda-features/TestInterfaceInit.java b/hotspot/test/runtime/lambda-features/TestInterfaceInit.java new file mode 100644 index 00000000000..0493a60bb1e --- /dev/null +++ b/hotspot/test/runtime/lambda-features/TestInterfaceInit.java @@ -0,0 +1,87 @@ +/* + * Copyright (c) 2014, Oracle and/or its affiliates. All rights reserved. + * DO NOT ALTER OR REMOVE COPYRIGHT NOTICES OR THIS FILE HEADER. + * + * This code is free software; you can redistribute it and/or modify it + * under the terms of the GNU General Public License version 2 only, as + * published by the Free Software Foundation. + * + * This code is distributed in the hope that it will be useful, but WITHOUT + * ANY WARRANTY; without even the implied warranty of MERCHANTABILITY or + * FITNESS FOR A PARTICULAR PURPOSE. See the GNU General Public License + * version 2 for more details (a copy is included in the LICENSE file that + * accompanied this code). + * + * You should have received a copy of the GNU General Public License version + * 2 along with this work; if not, write to the Free Software Foundation, + * Inc., 51 Franklin St, Fifth Floor, Boston, MA 02110-1301 USA. + * + * Please contact Oracle, 500 Oracle Parkway, Redwood Shores, CA 94065 USA + * or visit www.oracle.com if you need additional information or have any + * questions. + * + */ + +/* + * @test + * @bug 8034275 + * @summary [JDK 8u40] Test interface initialization: only for interfaces declaring default methods + * @run main TestInterfaceInit + */ +import java.util.List; +import java.util.Arrays; +import java.util.ArrayList; + +public class TestInterfaceInit { + + static List> cInitOrder = new ArrayList<>(); + + // Declares a default method and initializes + interface I { + boolean v = TestInterfaceInit.out(I.class); + default void x() {} + } + + // Declares a default method and initializes + interface J extends I { + boolean v = TestInterfaceInit.out(J.class); + default void x() {} + } + // No default method, does not initialize + interface JN extends J { + boolean v = TestInterfaceInit.out(JN.class); + } + + // Declares a default method and initializes + interface K extends I { + boolean v = TestInterfaceInit.out(K.class); + default void x() {} + } + + // No default method, does not initialize + interface KN extends K { + boolean v = TestInterfaceInit.out(KN.class); + } + + interface L extends JN, KN { + boolean v = TestInterfaceInit.out(L.class); + default void x() {} + } + + public static void main(String[] args) { + // Trigger initialization + boolean v = L.v; + + List> expectedCInitOrder = Arrays.asList(I.class,J.class,K.class,L.class); + if (!cInitOrder.equals(expectedCInitOrder)) { + throw new RuntimeException(String.format("Class initialization array %s not equal to expected array %s", cInitOrder, expectedCInitOrder)); + } + } + + static boolean out(Class c) { + System.out.println("#: initializing " + c.getName()); + cInitOrder.add(c); + return true; + } + +} diff --git a/hotspot/test/runtime/lambda-features/TestInterfaceOrder.java b/hotspot/test/runtime/lambda-features/TestInterfaceOrder.java new file mode 100644 index 00000000000..245742ece14 --- /dev/null +++ b/hotspot/test/runtime/lambda-features/TestInterfaceOrder.java @@ -0,0 +1,88 @@ +/* + * Copyright (c) 2014, Oracle and/or its affiliates. All rights reserved. + * DO NOT ALTER OR REMOVE COPYRIGHT NOTICES OR THIS FILE HEADER. + * + * This code is free software; you can redistribute it and/or modify it + * under the terms of the GNU General Public License version 2 only, as + * published by the Free Software Foundation. + * + * This code is distributed in the hope that it will be useful, but WITHOUT + * ANY WARRANTY; without even the implied warranty of MERCHANTABILITY or + * FITNESS FOR A PARTICULAR PURPOSE. See the GNU General Public License + * version 2 for more details (a copy is included in the LICENSE file that + * accompanied this code). + * + * You should have received a copy of the GNU General Public License version + * 2 along with this work; if not, write to the Free Software Foundation, + * Inc., 51 Franklin St, Fifth Floor, Boston, MA 02110-1301 USA. + * + * Please contact Oracle, 500 Oracle Parkway, Redwood Shores, CA 94065 USA + * or visit www.oracle.com if you need additional information or have any + * questions. + * + */ + +/* + * @test + * @bug 8034275 + * @summary [JDK 8u40] Test interface initialization order + * @run main TestInterfaceOrder + */ + +import java.util.List; +import java.util.Arrays; +import java.util.ArrayList; + +public class TestInterfaceOrder { + static List> cInitOrder = new ArrayList<>(); + + public static void main(java.lang.String[] args) { + //Trigger initialization + C c = new C(); + + List> expectedCInitOrder = Arrays.asList(I.class, J.class, A.class, K.class, B.class, L.class, C.class); + if (!cInitOrder.equals(expectedCInitOrder)) { + throw new RuntimeException(String.format("Class initialization order %s not equal to expected order %s", cInitOrder, expectedCInitOrder)); + } + } + + interface I { + boolean v = TestInterfaceOrder.out(I.class); + default void i() {} + } + + interface J extends I { + boolean v = TestInterfaceOrder.out(J.class); + default void j() {} + } + + static class A implements J { + static boolean v = TestInterfaceOrder.out(A.class); + } + + interface K extends I { + boolean v = TestInterfaceOrder.out(K.class); + default void k() {} + } + + static class B extends A implements K { + static boolean v = TestInterfaceOrder.out(B.class); + } + + interface L { + boolean v = TestInterfaceOrder.out(L.class); + default void l() {} + } + + static class C extends B implements L { + static boolean v = TestInterfaceOrder.out(C.class); + } + + + static boolean out(Class c) { + System.out.println("#: initializing " + c.getName()); + cInitOrder.add(c); + return true; + } + +} From 3a3e45ab40993611bdc0795e92bc3d72eeac6878 Mon Sep 17 00:00:00 2001 From: Erik Helin Date: Thu, 23 Oct 2014 11:43:29 +0200 Subject: [PATCH 30/61] 8061630: G1 iterates over JNIHandles two times Reviewed-by: mgerdin, brutisso --- .../src/share/vm/gc_implementation/g1/g1CollectedHeap.cpp | 8 ++------ 1 file changed, 2 insertions(+), 6 deletions(-) diff --git a/hotspot/src/share/vm/gc_implementation/g1/g1CollectedHeap.cpp b/hotspot/src/share/vm/gc_implementation/g1/g1CollectedHeap.cpp index 7ac2782772b..5d1ba94cc27 100644 --- a/hotspot/src/share/vm/gc_implementation/g1/g1CollectedHeap.cpp +++ b/hotspot/src/share/vm/gc_implementation/g1/g1CollectedHeap.cpp @@ -5760,14 +5760,10 @@ void G1CollectedHeap::evacuate_collection_set(EvacuationInfo& evacuation_info) { // not copied during the pause. process_discovered_references(n_workers); - // Weak root processing. - { + if (G1StringDedup::is_enabled()) { G1STWIsAliveClosure is_alive(this); G1KeepAliveClosure keep_alive(this); - JNIHandles::weak_oops_do(&is_alive, &keep_alive); - if (G1StringDedup::is_enabled()) { - G1StringDedup::unlink_or_oops_do(&is_alive, &keep_alive); - } + G1StringDedup::unlink_or_oops_do(&is_alive, &keep_alive); } _allocator->release_gc_alloc_regions(n_workers, evacuation_info); From 1aa3da106723aa92da1ba3267494bbfb83ca23b6 Mon Sep 17 00:00:00 2001 From: Calvin Cheung Date: Thu, 23 Oct 2014 10:08:02 -0700 Subject: [PATCH 31/61] 8038268: VM Crashes in MetaspaceShared::generate_vtable_methods while creating CDS archive with limiting SharedMiscCodeSize Estimate the minimum required size for the misc code region and check if the specified misc code region size meets the minimum size requirement Reviewed-by: jiangli, dholmes --- hotspot/src/share/vm/memory/metaspace.cpp | 10 ++++++++++ hotspot/src/share/vm/memory/metaspaceShared.hpp | 15 ++++++++++----- hotspot/src/share/vm/utilities/debug.cpp | 8 +++++--- hotspot/src/share/vm/utilities/debug.hpp | 3 ++- .../SharedArchiveFile/LimitSharedSizes.java | 9 ++++++--- 5 files changed, 33 insertions(+), 12 deletions(-) diff --git a/hotspot/src/share/vm/memory/metaspace.cpp b/hotspot/src/share/vm/memory/metaspace.cpp index c39c1353fe3..2f5d5843ee2 100644 --- a/hotspot/src/share/vm/memory/metaspace.cpp +++ b/hotspot/src/share/vm/memory/metaspace.cpp @@ -3157,6 +3157,16 @@ void Metaspace::global_initialize() { SharedMiscDataSize = align_size_up(SharedMiscDataSize, max_alignment); SharedMiscCodeSize = align_size_up(SharedMiscCodeSize, max_alignment); + // the min_misc_code_size estimate is based on MetaspaceShared::generate_vtable_methods() + uintx min_misc_code_size = align_size_up( + (MetaspaceShared::num_virtuals * MetaspaceShared::vtbl_list_size) * + (sizeof(void*) + MetaspaceShared::vtbl_method_size) + MetaspaceShared::vtbl_common_code_size, + max_alignment); + + if (SharedMiscCodeSize < min_misc_code_size) { + report_out_of_shared_space(SharedMiscCode); + } + // Initialize with the sum of the shared space sizes. The read-only // and read write metaspace chunks will be allocated out of this and the // remainder is the misc code and data chunks. diff --git a/hotspot/src/share/vm/memory/metaspaceShared.hpp b/hotspot/src/share/vm/memory/metaspaceShared.hpp index cc514c05050..db344359082 100644 --- a/hotspot/src/share/vm/memory/metaspaceShared.hpp +++ b/hotspot/src/share/vm/memory/metaspaceShared.hpp @@ -57,11 +57,16 @@ class MetaspaceShared : AllStatic { static bool _archive_loading_failed; public: enum { - vtbl_list_size = 17, // number of entries in the shared space vtable list. - num_virtuals = 200 // maximum number of virtual functions - // If virtual functions are added to Metadata, - // this number needs to be increased. Also, - // SharedMiscCodeSize will need to be increased. + vtbl_list_size = 17, // number of entries in the shared space vtable list. + num_virtuals = 200, // maximum number of virtual functions + // If virtual functions are added to Metadata, + // this number needs to be increased. Also, + // SharedMiscCodeSize will need to be increased. + // The following 2 sizes were based on + // MetaspaceShared::generate_vtable_methods() + vtbl_method_size = 16, // conservative size of the mov1 and jmp instructions + // for the x64 platform + vtbl_common_code_size = (1*K) // conservative size of the "common_code" for the x64 platform }; enum { diff --git a/hotspot/src/share/vm/utilities/debug.cpp b/hotspot/src/share/vm/utilities/debug.cpp index bb0195d58d1..adacdc4233f 100644 --- a/hotspot/src/share/vm/utilities/debug.cpp +++ b/hotspot/src/share/vm/utilities/debug.cpp @@ -256,16 +256,18 @@ void report_out_of_shared_space(SharedSpaceType shared_space) { static const char* name[] = { "shared read only space", "shared read write space", - "shared miscellaneous data space" + "shared miscellaneous data space", + "shared miscellaneous code space" }; static const char* flag[] = { "SharedReadOnlySize", "SharedReadWriteSize", - "SharedMiscDataSize" + "SharedMiscDataSize", + "SharedMiscCodeSize" }; warning("\nThe %s is not large enough\n" - "to preload requested classes. Use -XX:%s=\n" + "to preload requested classes. Use -XX:%s=\n" "to increase the initial size of %s.\n", name[shared_space], flag[shared_space], name[shared_space]); exit(2); diff --git a/hotspot/src/share/vm/utilities/debug.hpp b/hotspot/src/share/vm/utilities/debug.hpp index 51e516a5bb5..7995e6c085d 100644 --- a/hotspot/src/share/vm/utilities/debug.hpp +++ b/hotspot/src/share/vm/utilities/debug.hpp @@ -245,7 +245,8 @@ template <> struct StaticAssert {}; enum SharedSpaceType { SharedReadOnly, SharedReadWrite, - SharedMiscData + SharedMiscData, + SharedMiscCode }; void report_out_of_shared_space(SharedSpaceType space_type); diff --git a/hotspot/test/runtime/SharedArchiveFile/LimitSharedSizes.java b/hotspot/test/runtime/SharedArchiveFile/LimitSharedSizes.java index 6989a643f59..b2505be0d7d 100644 --- a/hotspot/test/runtime/SharedArchiveFile/LimitSharedSizes.java +++ b/hotspot/test/runtime/SharedArchiveFile/LimitSharedSizes.java @@ -51,9 +51,12 @@ public class LimitSharedSizes { // Known issue, JDK-8038422 (assert() on Windows) // new SharedSizeTestData("-XX:SharedMiscDataSize", "500k", "miscellaneous data"), - // This will cause a VM crash; commenting out for now; see bug JDK-8038268 - // @ignore JDK-8038268 - // new SharedSizeTestData("-XX:SharedMiscCodeSize", "20k", "miscellaneous code"), + // Too small of a misc code size should not cause a vm crash. + // It should result in the following error message: + // The shared miscellaneous code space is not large enough + // to preload requested classes. Use -XX:SharedMiscCodeSize= + // to increase the initial size of shared miscellaneous code space. + new SharedSizeTestData("-XX:SharedMiscCodeSize", "20k", "miscellaneous code"), // these values are larger than default ones, but should // be acceptable and not cause failure From 8f8d87ece5f2496305208a4b0c072de5cea0d810 Mon Sep 17 00:00:00 2001 From: Kim Barrett Date: Thu, 23 Oct 2014 16:19:32 -0400 Subject: [PATCH 32/61] 8061748: Remove check_ct_logs_at_safepoint() Remove unused function and related closure class Reviewed-by: jwilhelm, mgerdin --- .../gc_implementation/g1/g1CollectedHeap.cpp | 77 ------------------- .../gc_implementation/g1/g1CollectedHeap.hpp | 3 - 2 files changed, 80 deletions(-) diff --git a/hotspot/src/share/vm/gc_implementation/g1/g1CollectedHeap.cpp b/hotspot/src/share/vm/gc_implementation/g1/g1CollectedHeap.cpp index 5d1ba94cc27..ebd77eb0b1e 100644 --- a/hotspot/src/share/vm/gc_implementation/g1/g1CollectedHeap.cpp +++ b/hotspot/src/share/vm/gc_implementation/g1/g1CollectedHeap.cpp @@ -127,41 +127,6 @@ public: }; -class ClearLoggedCardTableEntryClosure: public CardTableEntryClosure { - size_t _num_processed; - CardTableModRefBS* _ctbs; - int _histo[256]; - - public: - ClearLoggedCardTableEntryClosure() : - _num_processed(0), _ctbs(G1CollectedHeap::heap()->g1_barrier_set()) - { - for (int i = 0; i < 256; i++) _histo[i] = 0; - } - - bool do_card_ptr(jbyte* card_ptr, uint worker_i) { - unsigned char* ujb = (unsigned char*)card_ptr; - int ind = (int)(*ujb); - _histo[ind]++; - - *card_ptr = (jbyte)CardTableModRefBS::clean_card_val(); - _num_processed++; - - return true; - } - - size_t num_processed() { return _num_processed; } - - void print_histo() { - gclog_or_tty->print_cr("Card table value histogram:"); - for (int i = 0; i < 256; i++) { - if (_histo[i] != 0) { - gclog_or_tty->print_cr(" %d: %d", i, _histo[i]); - } - } - } -}; - class RedirtyLoggedCardTableEntryClosure : public CardTableEntryClosure { private: size_t _num_processed; @@ -475,48 +440,6 @@ bool G1CollectedHeap::is_scavengable(const void* p) { return !hr->is_humongous(); } -void G1CollectedHeap::check_ct_logs_at_safepoint() { - DirtyCardQueueSet& dcqs = JavaThread::dirty_card_queue_set(); - CardTableModRefBS* ct_bs = g1_barrier_set(); - - // Count the dirty cards at the start. - CountNonCleanMemRegionClosure count1(this); - ct_bs->mod_card_iterate(&count1); - int orig_count = count1.n(); - - // First clear the logged cards. - ClearLoggedCardTableEntryClosure clear; - dcqs.apply_closure_to_all_completed_buffers(&clear); - dcqs.iterate_closure_all_threads(&clear, false); - clear.print_histo(); - - // Now ensure that there's no dirty cards. - CountNonCleanMemRegionClosure count2(this); - ct_bs->mod_card_iterate(&count2); - if (count2.n() != 0) { - gclog_or_tty->print_cr("Card table has %d entries; %d originally", - count2.n(), orig_count); - } - guarantee(count2.n() == 0, "Card table should be clean."); - - RedirtyLoggedCardTableEntryClosure redirty; - dcqs.apply_closure_to_all_completed_buffers(&redirty); - dcqs.iterate_closure_all_threads(&redirty, false); - gclog_or_tty->print_cr("Log entries = %d, dirty cards = %d.", - clear.num_processed(), orig_count); - guarantee(redirty.num_processed() == clear.num_processed(), - err_msg("Redirtied "SIZE_FORMAT" cards, bug cleared "SIZE_FORMAT, - redirty.num_processed(), clear.num_processed())); - - CountNonCleanMemRegionClosure count3(this); - ct_bs->mod_card_iterate(&count3); - if (count3.n() != orig_count) { - gclog_or_tty->print_cr("Should have restored them all: orig = %d, final = %d.", - orig_count, count3.n()); - guarantee(count3.n() >= orig_count, "Should have restored them all."); - } -} - // Private class members. G1CollectedHeap* G1CollectedHeap::_g1h; diff --git a/hotspot/src/share/vm/gc_implementation/g1/g1CollectedHeap.hpp b/hotspot/src/share/vm/gc_implementation/g1/g1CollectedHeap.hpp index 1307d4a6efd..f1aaceaacb4 100644 --- a/hotspot/src/share/vm/gc_implementation/g1/g1CollectedHeap.hpp +++ b/hotspot/src/share/vm/gc_implementation/g1/g1CollectedHeap.hpp @@ -797,9 +797,6 @@ protected: // The closure used to refine a single card. RefineCardTableEntryClosure* _refine_cte_cl; - // A function to check the consistency of dirty card logs. - void check_ct_logs_at_safepoint(); - // A DirtyCardQueueSet that is used to hold cards that contain // references into the current collection set. This is used to // update the remembered sets of the regions in the collection From 5306f2430a160a68fb8a24bdf5c437a9f4910479 Mon Sep 17 00:00:00 2001 From: Chris Plummer Date: Thu, 23 Oct 2014 14:43:08 -0700 Subject: [PATCH 33/61] 6191224: (reflect) Misleading detail string in IllegalArgumentException thrown by Array.get The test case shows that an exception is thrown with the message "Argument is not an array", when in fact the argument is an array, but an array of a primitive type is actually what was expected. Fixed by differentiating between failing because an array was expected and failing because an array of a primitive type was expected. Reviewed-by: dholmes, ctornqvi, lfoltan --- hotspot/src/share/vm/prims/jvm.cpp | 4 +- .../runtime/reflect/ArrayGetIntException.java | 76 +++++++++++++++++++ 2 files changed, 79 insertions(+), 1 deletion(-) create mode 100644 hotspot/test/runtime/reflect/ArrayGetIntException.java diff --git a/hotspot/src/share/vm/prims/jvm.cpp b/hotspot/src/share/vm/prims/jvm.cpp index 98be942d9c7..ad58d7bf966 100644 --- a/hotspot/src/share/vm/prims/jvm.cpp +++ b/hotspot/src/share/vm/prims/jvm.cpp @@ -3271,8 +3271,10 @@ static inline arrayOop check_array(JNIEnv *env, jobject arr, bool type_array_onl THROW_0(vmSymbols::java_lang_NullPointerException()); } oop a = JNIHandles::resolve_non_null(arr); - if (!a->is_array() || (type_array_only && !a->is_typeArray())) { + if (!a->is_array()) { THROW_MSG_0(vmSymbols::java_lang_IllegalArgumentException(), "Argument is not an array"); + } else if (type_array_only && !a->is_typeArray()) { + THROW_MSG_0(vmSymbols::java_lang_IllegalArgumentException(), "Argument is not an array of primitive type"); } return arrayOop(a); } diff --git a/hotspot/test/runtime/reflect/ArrayGetIntException.java b/hotspot/test/runtime/reflect/ArrayGetIntException.java new file mode 100644 index 00000000000..e5ee5cb93dc --- /dev/null +++ b/hotspot/test/runtime/reflect/ArrayGetIntException.java @@ -0,0 +1,76 @@ +/* + * Copyright (c) 2014, Oracle and/or its affiliates. All rights reserved. + * DO NOT ALTER OR REMOVE COPYRIGHT NOTICES OR THIS FILE HEADER. + * + * This code is free software; you can redistribute it and/or modify it + * under the terms of the GNU General Public License version 2 only, as + * published by the Free Software Foundation. + * + * This code is distributed in the hope that it will be useful, but WITHOUT + * ANY WARRANTY; without even the implied warranty of MERCHANTABILITY or + * FITNESS FOR A PARTICULAR PURPOSE. See the GNU General Public License + * version 2 for more details (a copy is included in the LICENSE file that + * accompanied this code). + * + * You should have received a copy of the GNU General Public License version + * 2 along with this work; if not, write to the Free Software Foundation, + * Inc., 51 Franklin St, Fifth Floor, Boston, MA 02110-1301 USA. + * + * Please contact Oracle, 500 Oracle Parkway, Redwood Shores, CA 94065 USA + * or visit www.oracle.com if you need additional information or have any + * questions. + */ + +/* + * @test + * @bug 6191224 + * @summary (reflect) Misleading detail string in IllegalArgumentException thrown by Array.get + * @run main ArrayGetIntException + */ +import java.io.*; +import java.lang.reflect.Array; + +public class ArrayGetIntException { + public static void main(String[] args) throws Exception { + Object[] objArray = {new Integer(Integer.MAX_VALUE)}; + + // this access is legal + try { + System.out.println(Array.get(objArray, 0)); + System.out.println("Test #1 PASSES"); + } catch(Exception e) { + failTest("Test #1 FAILS - legal access denied" + e.getMessage()); + } + + // this access is not legal, but needs to generate the proper exception message + try { + System.out.println(Array.getInt(objArray, 0)); + failTest("Test #2 FAILS - no exception"); + } catch(Exception e) { + System.out.println(e); + if (e.getMessage().equals("Argument is not an array of primitive type")) { + System.out.println("Test #2 PASSES"); + } else { + failTest("Test #2 FAILS - incorrect message: " + e.getMessage()); + } + } + + // this access is not legal, but needs to generate the proper exception message + try { + System.out.println(Array.getInt(new Object(), 0)); + failTest("Test #3 FAILS - no exception"); + } catch(Exception e) { + System.out.println(e); + if (e.getMessage().equals("Argument is not an array")) { + System.out.println("Test #3 PASSES"); + } else { + failTest("Test #3 FAILS - incorrect message: " + e.getMessage()); + } + } + } + + private static void failTest(String errStr) { + System.out.println(errStr); + throw new Error(errStr); + } +} From f5c3ac04e425804e8e0a51c815dbdf9ec8d19e7e Mon Sep 17 00:00:00 2001 From: Harold Seigel Date: Fri, 24 Oct 2014 08:56:47 -0400 Subject: [PATCH 34/61] 8061962: classFileParser.cpp.orig got erroneously added to the hotspot source repository Remove the file Reviewed-by: coleenp, ccheung --- .../vm/classfile/classFileParser.cpp.orig | 5274 ----------------- 1 file changed, 5274 deletions(-) delete mode 100644 hotspot/src/share/vm/classfile/classFileParser.cpp.orig diff --git a/hotspot/src/share/vm/classfile/classFileParser.cpp.orig b/hotspot/src/share/vm/classfile/classFileParser.cpp.orig deleted file mode 100644 index 0f2f8d590c4..00000000000 --- a/hotspot/src/share/vm/classfile/classFileParser.cpp.orig +++ /dev/null @@ -1,5274 +0,0 @@ -/* - * Copyright (c) 1997, 2014, Oracle and/or its affiliates. All rights reserved. - * DO NOT ALTER OR REMOVE COPYRIGHT NOTICES OR THIS FILE HEADER. - * - * This code is free software; you can redistribute it and/or modify it - * under the terms of the GNU General Public License version 2 only, as - * published by the Free Software Foundation. - * - * This code is distributed in the hope that it will be useful, but WITHOUT - * ANY WARRANTY; without even the implied warranty of MERCHANTABILITY or - * FITNESS FOR A PARTICULAR PURPOSE. See the GNU General Public License - * version 2 for more details (a copy is included in the LICENSE file that - * accompanied this code). - * - * You should have received a copy of the GNU General Public License version - * 2 along with this work; if not, write to the Free Software Foundation, - * Inc., 51 Franklin St, Fifth Floor, Boston, MA 02110-1301 USA. - * - * Please contact Oracle, 500 Oracle Parkway, Redwood Shores, CA 94065 USA - * or visit www.oracle.com if you need additional information or have any - * questions. - * - */ - -#include "precompiled.hpp" -#include "classfile/classFileParser.hpp" -#include "classfile/classLoader.hpp" -#include "classfile/classLoaderData.hpp" -#include "classfile/classLoaderData.inline.hpp" -#include "classfile/defaultMethods.hpp" -#include "classfile/javaClasses.hpp" -#include "classfile/symbolTable.hpp" -#include "classfile/systemDictionary.hpp" -#if INCLUDE_CDS -#include "classfile/systemDictionaryShared.hpp" -#endif -#include "classfile/verificationType.hpp" -#include "classfile/verifier.hpp" -#include "classfile/vmSymbols.hpp" -#include "memory/allocation.hpp" -#include "memory/gcLocker.hpp" -#include "memory/metadataFactory.hpp" -#include "memory/oopFactory.hpp" -#include "memory/referenceType.hpp" -#include "memory/universe.inline.hpp" -#include "oops/constantPool.hpp" -#include "oops/fieldStreams.hpp" -#include "oops/instanceKlass.hpp" -#include "oops/instanceMirrorKlass.hpp" -#include "oops/klass.inline.hpp" -#include "oops/klassVtable.hpp" -#include "oops/method.hpp" -#include "oops/symbol.hpp" -#include "prims/jvm.h" -#include "prims/jvmtiExport.hpp" -#include "prims/jvmtiThreadState.hpp" -#include "runtime/javaCalls.hpp" -#include "runtime/perfData.hpp" -#include "runtime/reflection.hpp" -#include "runtime/signature.hpp" -#include "runtime/timer.hpp" -#include "services/classLoadingService.hpp" -#include "services/threadService.hpp" -#include "utilities/array.hpp" -#include "utilities/globalDefinitions.hpp" -#include "utilities/ostream.hpp" - -// We generally try to create the oops directly when parsing, rather than -// allocating temporary data structures and copying the bytes twice. A -// temporary area is only needed when parsing utf8 entries in the constant -// pool and when parsing line number tables. - -// We add assert in debug mode when class format is not checked. - -#define JAVA_CLASSFILE_MAGIC 0xCAFEBABE -#define JAVA_MIN_SUPPORTED_VERSION 45 -#define JAVA_MAX_SUPPORTED_VERSION 52 -#define JAVA_MAX_SUPPORTED_MINOR_VERSION 0 - -// Used for two backward compatibility reasons: -// - to check for new additions to the class file format in JDK1.5 -// - to check for bug fixes in the format checker in JDK1.5 -#define JAVA_1_5_VERSION 49 - -// Used for backward compatibility reasons: -// - to check for javac bug fixes that happened after 1.5 -// - also used as the max version when running in jdk6 -#define JAVA_6_VERSION 50 - -// Used for backward compatibility reasons: -// - to check NameAndType_info signatures more aggressively -#define JAVA_7_VERSION 51 - -// Extension method support. -#define JAVA_8_VERSION 52 - -void ClassFileParser::parse_constant_pool_entries(int length, TRAPS) { - // Use a local copy of ClassFileStream. It helps the C++ compiler to optimize - // this function (_current can be allocated in a register, with scalar - // replacement of aggregates). The _current pointer is copied back to - // stream() when this function returns. DON'T call another method within - // this method that uses stream(). - ClassFileStream* cfs0 = stream(); - ClassFileStream cfs1 = *cfs0; - ClassFileStream* cfs = &cfs1; -#ifdef ASSERT - assert(cfs->allocated_on_stack(),"should be local"); - u1* old_current = cfs0->current(); -#endif - Handle class_loader(THREAD, _loader_data->class_loader()); - - // Used for batching symbol allocations. - const char* names[SymbolTable::symbol_alloc_batch_size]; - int lengths[SymbolTable::symbol_alloc_batch_size]; - int indices[SymbolTable::symbol_alloc_batch_size]; - unsigned int hashValues[SymbolTable::symbol_alloc_batch_size]; - int names_count = 0; - - // parsing Index 0 is unused - for (int index = 1; index < length; index++) { - // Each of the following case guarantees one more byte in the stream - // for the following tag or the access_flags following constant pool, - // so we don't need bounds-check for reading tag. - u1 tag = cfs->get_u1_fast(); - switch (tag) { - case JVM_CONSTANT_Class : - { - cfs->guarantee_more(3, CHECK); // name_index, tag/access_flags - u2 name_index = cfs->get_u2_fast(); - _cp->klass_index_at_put(index, name_index); - } - break; - case JVM_CONSTANT_Fieldref : - { - cfs->guarantee_more(5, CHECK); // class_index, name_and_type_index, tag/access_flags - u2 class_index = cfs->get_u2_fast(); - u2 name_and_type_index = cfs->get_u2_fast(); - _cp->field_at_put(index, class_index, name_and_type_index); - } - break; - case JVM_CONSTANT_Methodref : - { - cfs->guarantee_more(5, CHECK); // class_index, name_and_type_index, tag/access_flags - u2 class_index = cfs->get_u2_fast(); - u2 name_and_type_index = cfs->get_u2_fast(); - _cp->method_at_put(index, class_index, name_and_type_index); - } - break; - case JVM_CONSTANT_InterfaceMethodref : - { - cfs->guarantee_more(5, CHECK); // class_index, name_and_type_index, tag/access_flags - u2 class_index = cfs->get_u2_fast(); - u2 name_and_type_index = cfs->get_u2_fast(); - _cp->interface_method_at_put(index, class_index, name_and_type_index); - } - break; - case JVM_CONSTANT_String : - { - cfs->guarantee_more(3, CHECK); // string_index, tag/access_flags - u2 string_index = cfs->get_u2_fast(); - _cp->string_index_at_put(index, string_index); - } - break; - case JVM_CONSTANT_MethodHandle : - case JVM_CONSTANT_MethodType : - if (_major_version < Verifier::INVOKEDYNAMIC_MAJOR_VERSION) { - classfile_parse_error( - "Class file version does not support constant tag %u in class file %s", - tag, CHECK); - } - if (tag == JVM_CONSTANT_MethodHandle) { - cfs->guarantee_more(4, CHECK); // ref_kind, method_index, tag/access_flags - u1 ref_kind = cfs->get_u1_fast(); - u2 method_index = cfs->get_u2_fast(); - _cp->method_handle_index_at_put(index, ref_kind, method_index); - } else if (tag == JVM_CONSTANT_MethodType) { - cfs->guarantee_more(3, CHECK); // signature_index, tag/access_flags - u2 signature_index = cfs->get_u2_fast(); - _cp->method_type_index_at_put(index, signature_index); - } else { - ShouldNotReachHere(); - } - break; - case JVM_CONSTANT_InvokeDynamic : - { - if (_major_version < Verifier::INVOKEDYNAMIC_MAJOR_VERSION) { - classfile_parse_error( - "Class file version does not support constant tag %u in class file %s", - tag, CHECK); - } - cfs->guarantee_more(5, CHECK); // bsm_index, nt, tag/access_flags - u2 bootstrap_specifier_index = cfs->get_u2_fast(); - u2 name_and_type_index = cfs->get_u2_fast(); - if (_max_bootstrap_specifier_index < (int) bootstrap_specifier_index) - _max_bootstrap_specifier_index = (int) bootstrap_specifier_index; // collect for later - _cp->invoke_dynamic_at_put(index, bootstrap_specifier_index, name_and_type_index); - } - break; - case JVM_CONSTANT_Integer : - { - cfs->guarantee_more(5, CHECK); // bytes, tag/access_flags - u4 bytes = cfs->get_u4_fast(); - _cp->int_at_put(index, (jint) bytes); - } - break; - case JVM_CONSTANT_Float : - { - cfs->guarantee_more(5, CHECK); // bytes, tag/access_flags - u4 bytes = cfs->get_u4_fast(); - _cp->float_at_put(index, *(jfloat*)&bytes); - } - break; - case JVM_CONSTANT_Long : - // A mangled type might cause you to overrun allocated memory - guarantee_property(index+1 < length, - "Invalid constant pool entry %u in class file %s", - index, CHECK); - { - cfs->guarantee_more(9, CHECK); // bytes, tag/access_flags - u8 bytes = cfs->get_u8_fast(); - _cp->long_at_put(index, bytes); - } - index++; // Skip entry following eigth-byte constant, see JVM book p. 98 - break; - case JVM_CONSTANT_Double : - // A mangled type might cause you to overrun allocated memory - guarantee_property(index+1 < length, - "Invalid constant pool entry %u in class file %s", - index, CHECK); - { - cfs->guarantee_more(9, CHECK); // bytes, tag/access_flags - u8 bytes = cfs->get_u8_fast(); - _cp->double_at_put(index, *(jdouble*)&bytes); - } - index++; // Skip entry following eigth-byte constant, see JVM book p. 98 - break; - case JVM_CONSTANT_NameAndType : - { - cfs->guarantee_more(5, CHECK); // name_index, signature_index, tag/access_flags - u2 name_index = cfs->get_u2_fast(); - u2 signature_index = cfs->get_u2_fast(); - _cp->name_and_type_at_put(index, name_index, signature_index); - } - break; - case JVM_CONSTANT_Utf8 : - { - cfs->guarantee_more(2, CHECK); // utf8_length - u2 utf8_length = cfs->get_u2_fast(); - u1* utf8_buffer = cfs->get_u1_buffer(); - assert(utf8_buffer != NULL, "null utf8 buffer"); - // Got utf8 string, guarantee utf8_length+1 bytes, set stream position forward. - cfs->guarantee_more(utf8_length+1, CHECK); // utf8 string, tag/access_flags - cfs->skip_u1_fast(utf8_length); - - // Before storing the symbol, make sure it's legal - if (_need_verify) { - verify_legal_utf8((unsigned char*)utf8_buffer, utf8_length, CHECK); - } - - if (has_cp_patch_at(index)) { - Handle patch = clear_cp_patch_at(index); - guarantee_property(java_lang_String::is_instance(patch()), - "Illegal utf8 patch at %d in class file %s", - index, CHECK); - char* str = java_lang_String::as_utf8_string(patch()); - // (could use java_lang_String::as_symbol instead, but might as well batch them) - utf8_buffer = (u1*) str; - utf8_length = (int) strlen(str); - } - - unsigned int hash; - Symbol* result = SymbolTable::lookup_only((char*)utf8_buffer, utf8_length, hash); - if (result == NULL) { - names[names_count] = (char*)utf8_buffer; - lengths[names_count] = utf8_length; - indices[names_count] = index; - hashValues[names_count++] = hash; - if (names_count == SymbolTable::symbol_alloc_batch_size) { - SymbolTable::new_symbols(_loader_data, _cp, names_count, names, lengths, indices, hashValues, CHECK); - names_count = 0; - } - } else { - _cp->symbol_at_put(index, result); - } - } - break; - default: - classfile_parse_error( - "Unknown constant tag %u in class file %s", tag, CHECK); - break; - } - } - - // Allocate the remaining symbols - if (names_count > 0) { - SymbolTable::new_symbols(_loader_data, _cp, names_count, names, lengths, indices, hashValues, CHECK); - } - - // Copy _current pointer of local copy back to stream(). -#ifdef ASSERT - assert(cfs0->current() == old_current, "non-exclusive use of stream()"); -#endif - cfs0->set_current(cfs1.current()); -} - -bool inline valid_cp_range(int index, int length) { return (index > 0 && index < length); } - -inline Symbol* check_symbol_at(constantPoolHandle cp, int index) { - if (valid_cp_range(index, cp->length()) && cp->tag_at(index).is_utf8()) - return cp->symbol_at(index); - else - return NULL; -} - -constantPoolHandle ClassFileParser::parse_constant_pool(TRAPS) { - ClassFileStream* cfs = stream(); - constantPoolHandle nullHandle; - - cfs->guarantee_more(3, CHECK_(nullHandle)); // length, first cp tag - u2 length = cfs->get_u2_fast(); - guarantee_property( - length >= 1, "Illegal constant pool size %u in class file %s", - length, CHECK_(nullHandle)); - ConstantPool* constant_pool = ConstantPool::allocate(_loader_data, length, - CHECK_(nullHandle)); - _cp = constant_pool; // save in case of errors - constantPoolHandle cp (THREAD, constant_pool); - - // parsing constant pool entries - parse_constant_pool_entries(length, CHECK_(nullHandle)); - - int index = 1; // declared outside of loops for portability - - // first verification pass - validate cross references and fixup class and string constants - for (index = 1; index < length; index++) { // Index 0 is unused - jbyte tag = cp->tag_at(index).value(); - switch (tag) { - case JVM_CONSTANT_Class : - ShouldNotReachHere(); // Only JVM_CONSTANT_ClassIndex should be present - break; - case JVM_CONSTANT_Fieldref : - // fall through - case JVM_CONSTANT_Methodref : - // fall through - case JVM_CONSTANT_InterfaceMethodref : { - if (!_need_verify) break; - int klass_ref_index = cp->klass_ref_index_at(index); - int name_and_type_ref_index = cp->name_and_type_ref_index_at(index); - check_property(valid_klass_reference_at(klass_ref_index), - "Invalid constant pool index %u in class file %s", - klass_ref_index, - CHECK_(nullHandle)); - check_property(valid_cp_range(name_and_type_ref_index, length) && - cp->tag_at(name_and_type_ref_index).is_name_and_type(), - "Invalid constant pool index %u in class file %s", - name_and_type_ref_index, - CHECK_(nullHandle)); - break; - } - case JVM_CONSTANT_String : - ShouldNotReachHere(); // Only JVM_CONSTANT_StringIndex should be present - break; - case JVM_CONSTANT_Integer : - break; - case JVM_CONSTANT_Float : - break; - case JVM_CONSTANT_Long : - case JVM_CONSTANT_Double : - index++; - check_property( - (index < length && cp->tag_at(index).is_invalid()), - "Improper constant pool long/double index %u in class file %s", - index, CHECK_(nullHandle)); - break; - case JVM_CONSTANT_NameAndType : { - if (!_need_verify) break; - int name_ref_index = cp->name_ref_index_at(index); - int signature_ref_index = cp->signature_ref_index_at(index); - check_property(valid_symbol_at(name_ref_index), - "Invalid constant pool index %u in class file %s", - name_ref_index, CHECK_(nullHandle)); - check_property(valid_symbol_at(signature_ref_index), - "Invalid constant pool index %u in class file %s", - signature_ref_index, CHECK_(nullHandle)); - break; - } - case JVM_CONSTANT_Utf8 : - break; - case JVM_CONSTANT_UnresolvedClass : // fall-through - case JVM_CONSTANT_UnresolvedClassInError: - ShouldNotReachHere(); // Only JVM_CONSTANT_ClassIndex should be present - break; - case JVM_CONSTANT_ClassIndex : - { - int class_index = cp->klass_index_at(index); - check_property(valid_symbol_at(class_index), - "Invalid constant pool index %u in class file %s", - class_index, CHECK_(nullHandle)); - cp->unresolved_klass_at_put(index, cp->symbol_at(class_index)); - } - break; - case JVM_CONSTANT_StringIndex : - { - int string_index = cp->string_index_at(index); - check_property(valid_symbol_at(string_index), - "Invalid constant pool index %u in class file %s", - string_index, CHECK_(nullHandle)); - Symbol* sym = cp->symbol_at(string_index); - cp->unresolved_string_at_put(index, sym); - } - break; - case JVM_CONSTANT_MethodHandle : - { - int ref_index = cp->method_handle_index_at(index); - check_property( - valid_cp_range(ref_index, length), - "Invalid constant pool index %u in class file %s", - ref_index, CHECK_(nullHandle)); - constantTag tag = cp->tag_at(ref_index); - int ref_kind = cp->method_handle_ref_kind_at(index); - switch (ref_kind) { - case JVM_REF_getField: - case JVM_REF_getStatic: - case JVM_REF_putField: - case JVM_REF_putStatic: - check_property( - tag.is_field(), - "Invalid constant pool index %u in class file %s (not a field)", - ref_index, CHECK_(nullHandle)); - break; - case JVM_REF_invokeVirtual: - case JVM_REF_newInvokeSpecial: - check_property( - tag.is_method(), - "Invalid constant pool index %u in class file %s (not a method)", - ref_index, CHECK_(nullHandle)); - break; - case JVM_REF_invokeStatic: - case JVM_REF_invokeSpecial: - check_property(tag.is_method() || - ((_major_version >= JAVA_8_VERSION) && tag.is_interface_method()), - "Invalid constant pool index %u in class file %s (not a method)", - ref_index, CHECK_(nullHandle)); - break; - case JVM_REF_invokeInterface: - check_property( - tag.is_interface_method(), - "Invalid constant pool index %u in class file %s (not an interface method)", - ref_index, CHECK_(nullHandle)); - break; - default: - classfile_parse_error( - "Bad method handle kind at constant pool index %u in class file %s", - index, CHECK_(nullHandle)); - } - // Keep the ref_index unchanged. It will be indirected at link-time. - } - break; - case JVM_CONSTANT_MethodType : - { - int ref_index = cp->method_type_index_at(index); - check_property(valid_symbol_at(ref_index), - "Invalid constant pool index %u in class file %s", - ref_index, CHECK_(nullHandle)); - } - break; - case JVM_CONSTANT_InvokeDynamic : - { - int name_and_type_ref_index = cp->invoke_dynamic_name_and_type_ref_index_at(index); - check_property(valid_cp_range(name_and_type_ref_index, length) && - cp->tag_at(name_and_type_ref_index).is_name_and_type(), - "Invalid constant pool index %u in class file %s", - name_and_type_ref_index, - CHECK_(nullHandle)); - // bootstrap specifier index must be checked later, when BootstrapMethods attr is available - break; - } - default: - fatal(err_msg("bad constant pool tag value %u", - cp->tag_at(index).value())); - ShouldNotReachHere(); - break; - } // end of switch - } // end of for - - if (_cp_patches != NULL) { - // need to treat this_class specially... - int this_class_index; - { - cfs->guarantee_more(8, CHECK_(nullHandle)); // flags, this_class, super_class, infs_len - u1* mark = cfs->current(); - u2 flags = cfs->get_u2_fast(); - this_class_index = cfs->get_u2_fast(); - cfs->set_current(mark); // revert to mark - } - - for (index = 1; index < length; index++) { // Index 0 is unused - if (has_cp_patch_at(index)) { - guarantee_property(index != this_class_index, - "Illegal constant pool patch to self at %d in class file %s", - index, CHECK_(nullHandle)); - patch_constant_pool(cp, index, cp_patch_at(index), CHECK_(nullHandle)); - } - } - } - - if (!_need_verify) { - return cp; - } - - // second verification pass - checks the strings are of the right format. - // but not yet to the other entries - for (index = 1; index < length; index++) { - jbyte tag = cp->tag_at(index).value(); - switch (tag) { - case JVM_CONSTANT_UnresolvedClass: { - Symbol* class_name = cp->klass_name_at(index); - // check the name, even if _cp_patches will overwrite it - verify_legal_class_name(class_name, CHECK_(nullHandle)); - break; - } - case JVM_CONSTANT_NameAndType: { - if (_need_verify && _major_version >= JAVA_7_VERSION) { - int sig_index = cp->signature_ref_index_at(index); - int name_index = cp->name_ref_index_at(index); - Symbol* name = cp->symbol_at(name_index); - Symbol* sig = cp->symbol_at(sig_index); - if (sig->byte_at(0) == JVM_SIGNATURE_FUNC) { - verify_legal_method_signature(name, sig, CHECK_(nullHandle)); - } else { - verify_legal_field_signature(name, sig, CHECK_(nullHandle)); - } - } - break; - } - case JVM_CONSTANT_InvokeDynamic: - case JVM_CONSTANT_Fieldref: - case JVM_CONSTANT_Methodref: - case JVM_CONSTANT_InterfaceMethodref: { - int name_and_type_ref_index = cp->name_and_type_ref_index_at(index); - // already verified to be utf8 - int name_ref_index = cp->name_ref_index_at(name_and_type_ref_index); - // already verified to be utf8 - int signature_ref_index = cp->signature_ref_index_at(name_and_type_ref_index); - Symbol* name = cp->symbol_at(name_ref_index); - Symbol* signature = cp->symbol_at(signature_ref_index); - if (tag == JVM_CONSTANT_Fieldref) { - verify_legal_field_name(name, CHECK_(nullHandle)); - if (_need_verify && _major_version >= JAVA_7_VERSION) { - // Signature is verified above, when iterating NameAndType_info. - // Need only to be sure it's the right type. - if (signature->byte_at(0) == JVM_SIGNATURE_FUNC) { - throwIllegalSignature( - "Field", name, signature, CHECK_(nullHandle)); - } - } else { - verify_legal_field_signature(name, signature, CHECK_(nullHandle)); - } - } else { - verify_legal_method_name(name, CHECK_(nullHandle)); - if (_need_verify && _major_version >= JAVA_7_VERSION) { - // Signature is verified above, when iterating NameAndType_info. - // Need only to be sure it's the right type. - if (signature->byte_at(0) != JVM_SIGNATURE_FUNC) { - throwIllegalSignature( - "Method", name, signature, CHECK_(nullHandle)); - } - } else { - verify_legal_method_signature(name, signature, CHECK_(nullHandle)); - } - if (tag == JVM_CONSTANT_Methodref) { - // 4509014: If a class method name begins with '<', it must be "". - assert(name != NULL, "method name in constant pool is null"); - unsigned int name_len = name->utf8_length(); - assert(name_len > 0, "bad method name"); // already verified as legal name - if (name->byte_at(0) == '<') { - if (name != vmSymbols::object_initializer_name()) { - classfile_parse_error( - "Bad method name at constant pool index %u in class file %s", - name_ref_index, CHECK_(nullHandle)); - } - } - } - } - break; - } - case JVM_CONSTANT_MethodHandle: { - int ref_index = cp->method_handle_index_at(index); - int ref_kind = cp->method_handle_ref_kind_at(index); - switch (ref_kind) { - case JVM_REF_invokeVirtual: - case JVM_REF_invokeStatic: - case JVM_REF_invokeSpecial: - case JVM_REF_newInvokeSpecial: - { - int name_and_type_ref_index = cp->name_and_type_ref_index_at(ref_index); - int name_ref_index = cp->name_ref_index_at(name_and_type_ref_index); - Symbol* name = cp->symbol_at(name_ref_index); - if (ref_kind == JVM_REF_newInvokeSpecial) { - if (name != vmSymbols::object_initializer_name()) { - classfile_parse_error( - "Bad constructor name at constant pool index %u in class file %s", - name_ref_index, CHECK_(nullHandle)); - } - } else { - if (name == vmSymbols::object_initializer_name()) { - classfile_parse_error( - "Bad method name at constant pool index %u in class file %s", - name_ref_index, CHECK_(nullHandle)); - } - } - } - break; - // Other ref_kinds are already fully checked in previous pass. - } - break; - } - case JVM_CONSTANT_MethodType: { - Symbol* no_name = vmSymbols::type_name(); // place holder - Symbol* signature = cp->method_type_signature_at(index); - verify_legal_method_signature(no_name, signature, CHECK_(nullHandle)); - break; - } - case JVM_CONSTANT_Utf8: { - assert(cp->symbol_at(index)->refcount() != 0, "count corrupted"); - } - } // end of switch - } // end of for - - return cp; -} - - -void ClassFileParser::patch_constant_pool(constantPoolHandle cp, int index, Handle patch, TRAPS) { - BasicType patch_type = T_VOID; - - switch (cp->tag_at(index).value()) { - - case JVM_CONSTANT_UnresolvedClass : - // Patching a class means pre-resolving it. - // The name in the constant pool is ignored. - if (java_lang_Class::is_instance(patch())) { - guarantee_property(!java_lang_Class::is_primitive(patch()), - "Illegal class patch at %d in class file %s", - index, CHECK); - cp->klass_at_put(index, java_lang_Class::as_Klass(patch())); - } else { - guarantee_property(java_lang_String::is_instance(patch()), - "Illegal class patch at %d in class file %s", - index, CHECK); - Symbol* name = java_lang_String::as_symbol(patch(), CHECK); - cp->unresolved_klass_at_put(index, name); - } - break; - - case JVM_CONSTANT_String : - // skip this patch and don't clear it. Needs the oop array for resolved - // references to be created first. - return; - - case JVM_CONSTANT_Integer : patch_type = T_INT; goto patch_prim; - case JVM_CONSTANT_Float : patch_type = T_FLOAT; goto patch_prim; - case JVM_CONSTANT_Long : patch_type = T_LONG; goto patch_prim; - case JVM_CONSTANT_Double : patch_type = T_DOUBLE; goto patch_prim; - patch_prim: - { - jvalue value; - BasicType value_type = java_lang_boxing_object::get_value(patch(), &value); - guarantee_property(value_type == patch_type, - "Illegal primitive patch at %d in class file %s", - index, CHECK); - switch (value_type) { - case T_INT: cp->int_at_put(index, value.i); break; - case T_FLOAT: cp->float_at_put(index, value.f); break; - case T_LONG: cp->long_at_put(index, value.j); break; - case T_DOUBLE: cp->double_at_put(index, value.d); break; - default: assert(false, ""); - } - } - break; - - default: - // %%% TODO: put method handles into CONSTANT_InterfaceMethodref, etc. - guarantee_property(!has_cp_patch_at(index), - "Illegal unexpected patch at %d in class file %s", - index, CHECK); - return; - } - - // On fall-through, mark the patch as used. - clear_cp_patch_at(index); -} - - - -class NameSigHash: public ResourceObj { - public: - Symbol* _name; // name - Symbol* _sig; // signature - NameSigHash* _next; // Next entry in hash table -}; - - -#define HASH_ROW_SIZE 256 - -unsigned int hash(Symbol* name, Symbol* sig) { - unsigned int raw_hash = 0; - raw_hash += ((unsigned int)(uintptr_t)name) >> (LogHeapWordSize + 2); - raw_hash += ((unsigned int)(uintptr_t)sig) >> LogHeapWordSize; - - return (raw_hash + (unsigned int)(uintptr_t)name) % HASH_ROW_SIZE; -} - - -void initialize_hashtable(NameSigHash** table) { - memset((void*)table, 0, sizeof(NameSigHash*) * HASH_ROW_SIZE); -} - -// Return false if the name/sig combination is found in table. -// Return true if no duplicate is found. And name/sig is added as a new entry in table. -// The old format checker uses heap sort to find duplicates. -// NOTE: caller should guarantee that GC doesn't happen during the life cycle -// of table since we don't expect Symbol*'s to move. -bool put_after_lookup(Symbol* name, Symbol* sig, NameSigHash** table) { - assert(name != NULL, "name in constant pool is NULL"); - - // First lookup for duplicates - int index = hash(name, sig); - NameSigHash* entry = table[index]; - while (entry != NULL) { - if (entry->_name == name && entry->_sig == sig) { - return false; - } - entry = entry->_next; - } - - // No duplicate is found, allocate a new entry and fill it. - entry = new NameSigHash(); - entry->_name = name; - entry->_sig = sig; - - // Insert into hash table - entry->_next = table[index]; - table[index] = entry; - - return true; -} - - -Array* ClassFileParser::parse_interfaces(int length, - Handle protection_domain, - Symbol* class_name, - bool* has_default_methods, - TRAPS) { - if (length == 0) { - _local_interfaces = Universe::the_empty_klass_array(); - } else { - ClassFileStream* cfs = stream(); - assert(length > 0, "only called for length>0"); - _local_interfaces = MetadataFactory::new_array(_loader_data, length, NULL, CHECK_NULL); - - int index; - for (index = 0; index < length; index++) { - u2 interface_index = cfs->get_u2(CHECK_NULL); - KlassHandle interf; - check_property( - valid_klass_reference_at(interface_index), - "Interface name has bad constant pool index %u in class file %s", - interface_index, CHECK_NULL); - if (_cp->tag_at(interface_index).is_klass()) { - interf = KlassHandle(THREAD, _cp->resolved_klass_at(interface_index)); - } else { - Symbol* unresolved_klass = _cp->klass_name_at(interface_index); - - // Don't need to check legal name because it's checked when parsing constant pool. - // But need to make sure it's not an array type. - guarantee_property(unresolved_klass->byte_at(0) != JVM_SIGNATURE_ARRAY, - "Bad interface name in class file %s", CHECK_NULL); - Handle class_loader(THREAD, _loader_data->class_loader()); - - // Call resolve_super so classcircularity is checked - Klass* k = SystemDictionary::resolve_super_or_fail(class_name, - unresolved_klass, class_loader, protection_domain, - false, CHECK_NULL); - interf = KlassHandle(THREAD, k); - } - - if (!interf()->is_interface()) { - THROW_MSG_(vmSymbols::java_lang_IncompatibleClassChangeError(), "Implementing class", NULL); - } - if (InstanceKlass::cast(interf())->has_default_methods()) { - *has_default_methods = true; - } - _local_interfaces->at_put(index, interf()); - } - - if (!_need_verify || length <= 1) { - return _local_interfaces; - } - - // Check if there's any duplicates in interfaces - ResourceMark rm(THREAD); - NameSigHash** interface_names = NEW_RESOURCE_ARRAY_IN_THREAD( - THREAD, NameSigHash*, HASH_ROW_SIZE); - initialize_hashtable(interface_names); - bool dup = false; - { - debug_only(No_Safepoint_Verifier nsv;) - for (index = 0; index < length; index++) { - Klass* k = _local_interfaces->at(index); - Symbol* name = InstanceKlass::cast(k)->name(); - // If no duplicates, add (name, NULL) in hashtable interface_names. - if (!put_after_lookup(name, NULL, interface_names)) { - dup = true; - break; - } - } - } - if (dup) { - classfile_parse_error("Duplicate interface name in class file %s", CHECK_NULL); - } - } - return _local_interfaces; -} - - -void ClassFileParser::verify_constantvalue(int constantvalue_index, int signature_index, TRAPS) { - // Make sure the constant pool entry is of a type appropriate to this field - guarantee_property( - (constantvalue_index > 0 && - constantvalue_index < _cp->length()), - "Bad initial value index %u in ConstantValue attribute in class file %s", - constantvalue_index, CHECK); - constantTag value_type = _cp->tag_at(constantvalue_index); - switch ( _cp->basic_type_for_signature_at(signature_index) ) { - case T_LONG: - guarantee_property(value_type.is_long(), "Inconsistent constant value type in class file %s", CHECK); - break; - case T_FLOAT: - guarantee_property(value_type.is_float(), "Inconsistent constant value type in class file %s", CHECK); - break; - case T_DOUBLE: - guarantee_property(value_type.is_double(), "Inconsistent constant value type in class file %s", CHECK); - break; - case T_BYTE: case T_CHAR: case T_SHORT: case T_BOOLEAN: case T_INT: - guarantee_property(value_type.is_int(), "Inconsistent constant value type in class file %s", CHECK); - break; - case T_OBJECT: - guarantee_property((_cp->symbol_at(signature_index)->equals("Ljava/lang/String;") - && value_type.is_string()), - "Bad string initial value in class file %s", CHECK); - break; - default: - classfile_parse_error( - "Unable to set initial value %u in class file %s", - constantvalue_index, CHECK); - } -} - - -// Parse attributes for a field. -void ClassFileParser::parse_field_attributes(u2 attributes_count, - bool is_static, u2 signature_index, - u2* constantvalue_index_addr, - bool* is_synthetic_addr, - u2* generic_signature_index_addr, - ClassFileParser::FieldAnnotationCollector* parsed_annotations, - TRAPS) { - ClassFileStream* cfs = stream(); - assert(attributes_count > 0, "length should be greater than 0"); - u2 constantvalue_index = 0; - u2 generic_signature_index = 0; - bool is_synthetic = false; - u1* runtime_visible_annotations = NULL; - int runtime_visible_annotations_length = 0; - u1* runtime_invisible_annotations = NULL; - int runtime_invisible_annotations_length = 0; - u1* runtime_visible_type_annotations = NULL; - int runtime_visible_type_annotations_length = 0; - u1* runtime_invisible_type_annotations = NULL; - int runtime_invisible_type_annotations_length = 0; - bool runtime_invisible_annotations_exists = false; - bool runtime_invisible_type_annotations_exists = false; - while (attributes_count--) { - cfs->guarantee_more(6, CHECK); // attribute_name_index, attribute_length - u2 attribute_name_index = cfs->get_u2_fast(); - u4 attribute_length = cfs->get_u4_fast(); - check_property(valid_symbol_at(attribute_name_index), - "Invalid field attribute index %u in class file %s", - attribute_name_index, - CHECK); - Symbol* attribute_name = _cp->symbol_at(attribute_name_index); - if (is_static && attribute_name == vmSymbols::tag_constant_value()) { - // ignore if non-static - if (constantvalue_index != 0) { - classfile_parse_error("Duplicate ConstantValue attribute in class file %s", CHECK); - } - check_property( - attribute_length == 2, - "Invalid ConstantValue field attribute length %u in class file %s", - attribute_length, CHECK); - constantvalue_index = cfs->get_u2(CHECK); - if (_need_verify) { - verify_constantvalue(constantvalue_index, signature_index, CHECK); - } - } else if (attribute_name == vmSymbols::tag_synthetic()) { - if (attribute_length != 0) { - classfile_parse_error( - "Invalid Synthetic field attribute length %u in class file %s", - attribute_length, CHECK); - } - is_synthetic = true; - } else if (attribute_name == vmSymbols::tag_deprecated()) { // 4276120 - if (attribute_length != 0) { - classfile_parse_error( - "Invalid Deprecated field attribute length %u in class file %s", - attribute_length, CHECK); - } - } else if (_major_version >= JAVA_1_5_VERSION) { - if (attribute_name == vmSymbols::tag_signature()) { - if (attribute_length != 2) { - classfile_parse_error( - "Wrong size %u for field's Signature attribute in class file %s", - attribute_length, CHECK); - } - generic_signature_index = parse_generic_signature_attribute(CHECK); - } else if (attribute_name == vmSymbols::tag_runtime_visible_annotations()) { - if (runtime_visible_annotations != NULL) { - classfile_parse_error( - "Multiple RuntimeVisibleAnnotations attributes for field in class file %s", CHECK); - } - runtime_visible_annotations_length = attribute_length; - runtime_visible_annotations = cfs->get_u1_buffer(); - assert(runtime_visible_annotations != NULL, "null visible annotations"); - parse_annotations(runtime_visible_annotations, - runtime_visible_annotations_length, - parsed_annotations, - CHECK); - cfs->skip_u1(runtime_visible_annotations_length, CHECK); - } else if (attribute_name == vmSymbols::tag_runtime_invisible_annotations()) { - if (runtime_invisible_annotations_exists) { - classfile_parse_error( - "Multiple RuntimeInvisibleAnnotations attributes for field in class file %s", CHECK); - } - runtime_invisible_annotations_exists = true; - if (PreserveAllAnnotations) { - runtime_invisible_annotations_length = attribute_length; - runtime_invisible_annotations = cfs->get_u1_buffer(); - assert(runtime_invisible_annotations != NULL, "null invisible annotations"); - } - cfs->skip_u1(attribute_length, CHECK); - } else if (attribute_name == vmSymbols::tag_runtime_visible_type_annotations()) { - if (runtime_visible_type_annotations != NULL) { - classfile_parse_error( - "Multiple RuntimeVisibleTypeAnnotations attributes for field in class file %s", CHECK); - } - runtime_visible_type_annotations_length = attribute_length; - runtime_visible_type_annotations = cfs->get_u1_buffer(); - assert(runtime_visible_type_annotations != NULL, "null visible type annotations"); - cfs->skip_u1(runtime_visible_type_annotations_length, CHECK); - } else if (attribute_name == vmSymbols::tag_runtime_invisible_type_annotations()) { - if (runtime_invisible_type_annotations_exists) { - classfile_parse_error( - "Multiple RuntimeInvisibleTypeAnnotations attributes for field in class file %s", CHECK); - } else { - runtime_invisible_type_annotations_exists = true; - } - if (PreserveAllAnnotations) { - runtime_invisible_type_annotations_length = attribute_length; - runtime_invisible_type_annotations = cfs->get_u1_buffer(); - assert(runtime_invisible_type_annotations != NULL, "null invisible type annotations"); - } - cfs->skip_u1(attribute_length, CHECK); - } else { - cfs->skip_u1(attribute_length, CHECK); // Skip unknown attributes - } - } else { - cfs->skip_u1(attribute_length, CHECK); // Skip unknown attributes - } - } - - *constantvalue_index_addr = constantvalue_index; - *is_synthetic_addr = is_synthetic; - *generic_signature_index_addr = generic_signature_index; - AnnotationArray* a = assemble_annotations(runtime_visible_annotations, - runtime_visible_annotations_length, - runtime_invisible_annotations, - runtime_invisible_annotations_length, - CHECK); - parsed_annotations->set_field_annotations(a); - a = assemble_annotations(runtime_visible_type_annotations, - runtime_visible_type_annotations_length, - runtime_invisible_type_annotations, - runtime_invisible_type_annotations_length, - CHECK); - parsed_annotations->set_field_type_annotations(a); - return; -} - - -// Field allocation types. Used for computing field offsets. - -enum FieldAllocationType { - STATIC_OOP, // Oops - STATIC_BYTE, // Boolean, Byte, char - STATIC_SHORT, // shorts - STATIC_WORD, // ints - STATIC_DOUBLE, // aligned long or double - NONSTATIC_OOP, - NONSTATIC_BYTE, - NONSTATIC_SHORT, - NONSTATIC_WORD, - NONSTATIC_DOUBLE, - MAX_FIELD_ALLOCATION_TYPE, - BAD_ALLOCATION_TYPE = -1 -}; - -static FieldAllocationType _basic_type_to_atype[2 * (T_CONFLICT + 1)] = { - BAD_ALLOCATION_TYPE, // 0 - BAD_ALLOCATION_TYPE, // 1 - BAD_ALLOCATION_TYPE, // 2 - BAD_ALLOCATION_TYPE, // 3 - NONSTATIC_BYTE , // T_BOOLEAN = 4, - NONSTATIC_SHORT, // T_CHAR = 5, - NONSTATIC_WORD, // T_FLOAT = 6, - NONSTATIC_DOUBLE, // T_DOUBLE = 7, - NONSTATIC_BYTE, // T_BYTE = 8, - NONSTATIC_SHORT, // T_SHORT = 9, - NONSTATIC_WORD, // T_INT = 10, - NONSTATIC_DOUBLE, // T_LONG = 11, - NONSTATIC_OOP, // T_OBJECT = 12, - NONSTATIC_OOP, // T_ARRAY = 13, - BAD_ALLOCATION_TYPE, // T_VOID = 14, - BAD_ALLOCATION_TYPE, // T_ADDRESS = 15, - BAD_ALLOCATION_TYPE, // T_NARROWOOP = 16, - BAD_ALLOCATION_TYPE, // T_METADATA = 17, - BAD_ALLOCATION_TYPE, // T_NARROWKLASS = 18, - BAD_ALLOCATION_TYPE, // T_CONFLICT = 19, - BAD_ALLOCATION_TYPE, // 0 - BAD_ALLOCATION_TYPE, // 1 - BAD_ALLOCATION_TYPE, // 2 - BAD_ALLOCATION_TYPE, // 3 - STATIC_BYTE , // T_BOOLEAN = 4, - STATIC_SHORT, // T_CHAR = 5, - STATIC_WORD, // T_FLOAT = 6, - STATIC_DOUBLE, // T_DOUBLE = 7, - STATIC_BYTE, // T_BYTE = 8, - STATIC_SHORT, // T_SHORT = 9, - STATIC_WORD, // T_INT = 10, - STATIC_DOUBLE, // T_LONG = 11, - STATIC_OOP, // T_OBJECT = 12, - STATIC_OOP, // T_ARRAY = 13, - BAD_ALLOCATION_TYPE, // T_VOID = 14, - BAD_ALLOCATION_TYPE, // T_ADDRESS = 15, - BAD_ALLOCATION_TYPE, // T_NARROWOOP = 16, - BAD_ALLOCATION_TYPE, // T_METADATA = 17, - BAD_ALLOCATION_TYPE, // T_NARROWKLASS = 18, - BAD_ALLOCATION_TYPE, // T_CONFLICT = 19, -}; - -static FieldAllocationType basic_type_to_atype(bool is_static, BasicType type) { - assert(type >= T_BOOLEAN && type < T_VOID, "only allowable values"); - FieldAllocationType result = _basic_type_to_atype[type + (is_static ? (T_CONFLICT + 1) : 0)]; - assert(result != BAD_ALLOCATION_TYPE, "bad type"); - return result; -} - -class FieldAllocationCount: public ResourceObj { - public: - u2 count[MAX_FIELD_ALLOCATION_TYPE]; - - FieldAllocationCount() { - for (int i = 0; i < MAX_FIELD_ALLOCATION_TYPE; i++) { - count[i] = 0; - } - } - - FieldAllocationType update(bool is_static, BasicType type) { - FieldAllocationType atype = basic_type_to_atype(is_static, type); - // Make sure there is no overflow with injected fields. - assert(count[atype] < 0xFFFF, "More than 65535 fields"); - count[atype]++; - return atype; - } -}; - -Array* ClassFileParser::parse_fields(Symbol* class_name, - bool is_interface, - FieldAllocationCount *fac, - u2* java_fields_count_ptr, TRAPS) { - ClassFileStream* cfs = stream(); - cfs->guarantee_more(2, CHECK_NULL); // length - u2 length = cfs->get_u2_fast(); - *java_fields_count_ptr = length; - - int num_injected = 0; - InjectedField* injected = JavaClasses::get_injected(class_name, &num_injected); - int total_fields = length + num_injected; - - // The field array starts with tuples of shorts - // [access, name index, sig index, initial value index, byte offset]. - // A generic signature slot only exists for field with generic - // signature attribute. And the access flag is set with - // JVM_ACC_FIELD_HAS_GENERIC_SIGNATURE for that field. The generic - // signature slots are at the end of the field array and after all - // other fields data. - // - // f1: [access, name index, sig index, initial value index, low_offset, high_offset] - // f2: [access, name index, sig index, initial value index, low_offset, high_offset] - // ... - // fn: [access, name index, sig index, initial value index, low_offset, high_offset] - // [generic signature index] - // [generic signature index] - // ... - // - // Allocate a temporary resource array for field data. For each field, - // a slot is reserved in the temporary array for the generic signature - // index. After parsing all fields, the data are copied to a permanent - // array and any unused slots will be discarded. - ResourceMark rm(THREAD); - u2* fa = NEW_RESOURCE_ARRAY_IN_THREAD( - THREAD, u2, total_fields * (FieldInfo::field_slots + 1)); - - // The generic signature slots start after all other fields' data. - int generic_signature_slot = total_fields * FieldInfo::field_slots; - int num_generic_signature = 0; - for (int n = 0; n < length; n++) { - cfs->guarantee_more(8, CHECK_NULL); // access_flags, name_index, descriptor_index, attributes_count - - AccessFlags access_flags; - jint flags = cfs->get_u2_fast() & JVM_RECOGNIZED_FIELD_MODIFIERS; - verify_legal_field_modifiers(flags, is_interface, CHECK_NULL); - access_flags.set_flags(flags); - - u2 name_index = cfs->get_u2_fast(); - int cp_size = _cp->length(); - check_property(valid_symbol_at(name_index), - "Invalid constant pool index %u for field name in class file %s", - name_index, - CHECK_NULL); - Symbol* name = _cp->symbol_at(name_index); - verify_legal_field_name(name, CHECK_NULL); - - u2 signature_index = cfs->get_u2_fast(); - check_property(valid_symbol_at(signature_index), - "Invalid constant pool index %u for field signature in class file %s", - signature_index, CHECK_NULL); - Symbol* sig = _cp->symbol_at(signature_index); - verify_legal_field_signature(name, sig, CHECK_NULL); - - u2 constantvalue_index = 0; - bool is_synthetic = false; - u2 generic_signature_index = 0; - bool is_static = access_flags.is_static(); - FieldAnnotationCollector parsed_annotations(_loader_data); - - u2 attributes_count = cfs->get_u2_fast(); - if (attributes_count > 0) { - parse_field_attributes(attributes_count, is_static, signature_index, - &constantvalue_index, &is_synthetic, - &generic_signature_index, &parsed_annotations, - CHECK_NULL); - if (parsed_annotations.field_annotations() != NULL) { - if (_fields_annotations == NULL) { - _fields_annotations = MetadataFactory::new_array( - _loader_data, length, NULL, - CHECK_NULL); - } - _fields_annotations->at_put(n, parsed_annotations.field_annotations()); - parsed_annotations.set_field_annotations(NULL); - } - if (parsed_annotations.field_type_annotations() != NULL) { - if (_fields_type_annotations == NULL) { - _fields_type_annotations = MetadataFactory::new_array( - _loader_data, length, NULL, - CHECK_NULL); - } - _fields_type_annotations->at_put(n, parsed_annotations.field_type_annotations()); - parsed_annotations.set_field_type_annotations(NULL); - } - - if (is_synthetic) { - access_flags.set_is_synthetic(); - } - if (generic_signature_index != 0) { - access_flags.set_field_has_generic_signature(); - fa[generic_signature_slot] = generic_signature_index; - generic_signature_slot ++; - num_generic_signature ++; - } - } - - FieldInfo* field = FieldInfo::from_field_array(fa, n); - field->initialize(access_flags.as_short(), - name_index, - signature_index, - constantvalue_index); - BasicType type = _cp->basic_type_for_signature_at(signature_index); - - // Remember how many oops we encountered and compute allocation type - FieldAllocationType atype = fac->update(is_static, type); - field->set_allocation_type(atype); - - // After field is initialized with type, we can augment it with aux info - if (parsed_annotations.has_any_annotations()) - parsed_annotations.apply_to(field); - } - - int index = length; - if (num_injected != 0) { - for (int n = 0; n < num_injected; n++) { - // Check for duplicates - if (injected[n].may_be_java) { - Symbol* name = injected[n].name(); - Symbol* signature = injected[n].signature(); - bool duplicate = false; - for (int i = 0; i < length; i++) { - FieldInfo* f = FieldInfo::from_field_array(fa, i); - if (name == _cp->symbol_at(f->name_index()) && - signature == _cp->symbol_at(f->signature_index())) { - // Symbol is desclared in Java so skip this one - duplicate = true; - break; - } - } - if (duplicate) { - // These will be removed from the field array at the end - continue; - } - } - - // Injected field - FieldInfo* field = FieldInfo::from_field_array(fa, index); - field->initialize(JVM_ACC_FIELD_INTERNAL, - injected[n].name_index, - injected[n].signature_index, - 0); - - BasicType type = FieldType::basic_type(injected[n].signature()); - - // Remember how many oops we encountered and compute allocation type - FieldAllocationType atype = fac->update(false, type); - field->set_allocation_type(atype); - index++; - } - } - - // Now copy the fields' data from the temporary resource array. - // Sometimes injected fields already exist in the Java source so - // the fields array could be too long. In that case the - // fields array is trimed. Also unused slots that were reserved - // for generic signature indexes are discarded. - Array* fields = MetadataFactory::new_array( - _loader_data, index * FieldInfo::field_slots + num_generic_signature, - CHECK_NULL); - _fields = fields; // save in case of error - { - int i = 0; - for (; i < index * FieldInfo::field_slots; i++) { - fields->at_put(i, fa[i]); - } - for (int j = total_fields * FieldInfo::field_slots; - j < generic_signature_slot; j++) { - fields->at_put(i++, fa[j]); - } - assert(i == fields->length(), ""); - } - - if (_need_verify && length > 1) { - // Check duplicated fields - ResourceMark rm(THREAD); - NameSigHash** names_and_sigs = NEW_RESOURCE_ARRAY_IN_THREAD( - THREAD, NameSigHash*, HASH_ROW_SIZE); - initialize_hashtable(names_and_sigs); - bool dup = false; - { - debug_only(No_Safepoint_Verifier nsv;) - for (AllFieldStream fs(fields, _cp); !fs.done(); fs.next()) { - Symbol* name = fs.name(); - Symbol* sig = fs.signature(); - // If no duplicates, add name/signature in hashtable names_and_sigs. - if (!put_after_lookup(name, sig, names_and_sigs)) { - dup = true; - break; - } - } - } - if (dup) { - classfile_parse_error("Duplicate field name&signature in class file %s", - CHECK_NULL); - } - } - - return fields; -} - - -static void copy_u2_with_conversion(u2* dest, u2* src, int length) { - while (length-- > 0) { - *dest++ = Bytes::get_Java_u2((u1*) (src++)); - } -} - - -u2* ClassFileParser::parse_exception_table(u4 code_length, - u4 exception_table_length, - TRAPS) { - ClassFileStream* cfs = stream(); - - u2* exception_table_start = cfs->get_u2_buffer(); - assert(exception_table_start != NULL, "null exception table"); - cfs->guarantee_more(8 * exception_table_length, CHECK_NULL); // start_pc, end_pc, handler_pc, catch_type_index - // Will check legal target after parsing code array in verifier. - if (_need_verify) { - for (unsigned int i = 0; i < exception_table_length; i++) { - u2 start_pc = cfs->get_u2_fast(); - u2 end_pc = cfs->get_u2_fast(); - u2 handler_pc = cfs->get_u2_fast(); - u2 catch_type_index = cfs->get_u2_fast(); - guarantee_property((start_pc < end_pc) && (end_pc <= code_length), - "Illegal exception table range in class file %s", - CHECK_NULL); - guarantee_property(handler_pc < code_length, - "Illegal exception table handler in class file %s", - CHECK_NULL); - if (catch_type_index != 0) { - guarantee_property(valid_klass_reference_at(catch_type_index), - "Catch type in exception table has bad constant type in class file %s", CHECK_NULL); - } - } - } else { - cfs->skip_u2_fast(exception_table_length * 4); - } - return exception_table_start; -} - -void ClassFileParser::parse_linenumber_table( - u4 code_attribute_length, u4 code_length, - CompressedLineNumberWriteStream** write_stream, TRAPS) { - ClassFileStream* cfs = stream(); - unsigned int num_entries = cfs->get_u2(CHECK); - - // Each entry is a u2 start_pc, and a u2 line_number - unsigned int length_in_bytes = num_entries * (sizeof(u2) + sizeof(u2)); - - // Verify line number attribute and table length - check_property( - code_attribute_length == sizeof(u2) + length_in_bytes, - "LineNumberTable attribute has wrong length in class file %s", CHECK); - - cfs->guarantee_more(length_in_bytes, CHECK); - - if ((*write_stream) == NULL) { - if (length_in_bytes > fixed_buffer_size) { - (*write_stream) = new CompressedLineNumberWriteStream(length_in_bytes); - } else { - (*write_stream) = new CompressedLineNumberWriteStream( - linenumbertable_buffer, fixed_buffer_size); - } - } - - while (num_entries-- > 0) { - u2 bci = cfs->get_u2_fast(); // start_pc - u2 line = cfs->get_u2_fast(); // line_number - guarantee_property(bci < code_length, - "Invalid pc in LineNumberTable in class file %s", CHECK); - (*write_stream)->write_pair(bci, line); - } -} - - -// Class file LocalVariableTable elements. -class Classfile_LVT_Element VALUE_OBJ_CLASS_SPEC { - public: - u2 start_bci; - u2 length; - u2 name_cp_index; - u2 descriptor_cp_index; - u2 slot; -}; - - -class LVT_Hash: public CHeapObj { - public: - LocalVariableTableElement *_elem; // element - LVT_Hash* _next; // Next entry in hash table -}; - -unsigned int hash(LocalVariableTableElement *elem) { - unsigned int raw_hash = elem->start_bci; - - raw_hash = elem->length + raw_hash * 37; - raw_hash = elem->name_cp_index + raw_hash * 37; - raw_hash = elem->slot + raw_hash * 37; - - return raw_hash % HASH_ROW_SIZE; -} - -void initialize_hashtable(LVT_Hash** table) { - for (int i = 0; i < HASH_ROW_SIZE; i++) { - table[i] = NULL; - } -} - -void clear_hashtable(LVT_Hash** table) { - for (int i = 0; i < HASH_ROW_SIZE; i++) { - LVT_Hash* current = table[i]; - LVT_Hash* next; - while (current != NULL) { - next = current->_next; - current->_next = NULL; - delete(current); - current = next; - } - table[i] = NULL; - } -} - -LVT_Hash* LVT_lookup(LocalVariableTableElement *elem, int index, LVT_Hash** table) { - LVT_Hash* entry = table[index]; - - /* - * 3-tuple start_bci/length/slot has to be unique key, - * so the following comparison seems to be redundant: - * && elem->name_cp_index == entry->_elem->name_cp_index - */ - while (entry != NULL) { - if (elem->start_bci == entry->_elem->start_bci - && elem->length == entry->_elem->length - && elem->name_cp_index == entry->_elem->name_cp_index - && elem->slot == entry->_elem->slot - ) { - return entry; - } - entry = entry->_next; - } - return NULL; -} - -// Return false if the local variable is found in table. -// Return true if no duplicate is found. -// And local variable is added as a new entry in table. -bool LVT_put_after_lookup(LocalVariableTableElement *elem, LVT_Hash** table) { - // First lookup for duplicates - int index = hash(elem); - LVT_Hash* entry = LVT_lookup(elem, index, table); - - if (entry != NULL) { - return false; - } - // No duplicate is found, allocate a new entry and fill it. - if ((entry = new LVT_Hash()) == NULL) { - return false; - } - entry->_elem = elem; - - // Insert into hash table - entry->_next = table[index]; - table[index] = entry; - - return true; -} - -void copy_lvt_element(Classfile_LVT_Element *src, LocalVariableTableElement *lvt) { - lvt->start_bci = Bytes::get_Java_u2((u1*) &src->start_bci); - lvt->length = Bytes::get_Java_u2((u1*) &src->length); - lvt->name_cp_index = Bytes::get_Java_u2((u1*) &src->name_cp_index); - lvt->descriptor_cp_index = Bytes::get_Java_u2((u1*) &src->descriptor_cp_index); - lvt->signature_cp_index = 0; - lvt->slot = Bytes::get_Java_u2((u1*) &src->slot); -} - -// Function is used to parse both attributes: -// LocalVariableTable (LVT) and LocalVariableTypeTable (LVTT) -u2* ClassFileParser::parse_localvariable_table(u4 code_length, - u2 max_locals, - u4 code_attribute_length, - u2* localvariable_table_length, - bool isLVTT, - TRAPS) { - ClassFileStream* cfs = stream(); - const char * tbl_name = (isLVTT) ? "LocalVariableTypeTable" : "LocalVariableTable"; - *localvariable_table_length = cfs->get_u2(CHECK_NULL); - unsigned int size = (*localvariable_table_length) * sizeof(Classfile_LVT_Element) / sizeof(u2); - // Verify local variable table attribute has right length - if (_need_verify) { - guarantee_property(code_attribute_length == (sizeof(*localvariable_table_length) + size * sizeof(u2)), - "%s has wrong length in class file %s", tbl_name, CHECK_NULL); - } - u2* localvariable_table_start = cfs->get_u2_buffer(); - assert(localvariable_table_start != NULL, "null local variable table"); - if (!_need_verify) { - cfs->skip_u2_fast(size); - } else { - cfs->guarantee_more(size * 2, CHECK_NULL); - for(int i = 0; i < (*localvariable_table_length); i++) { - u2 start_pc = cfs->get_u2_fast(); - u2 length = cfs->get_u2_fast(); - u2 name_index = cfs->get_u2_fast(); - u2 descriptor_index = cfs->get_u2_fast(); - u2 index = cfs->get_u2_fast(); - // Assign to a u4 to avoid overflow - u4 end_pc = (u4)start_pc + (u4)length; - - if (start_pc >= code_length) { - classfile_parse_error( - "Invalid start_pc %u in %s in class file %s", - start_pc, tbl_name, CHECK_NULL); - } - if (end_pc > code_length) { - classfile_parse_error( - "Invalid length %u in %s in class file %s", - length, tbl_name, CHECK_NULL); - } - int cp_size = _cp->length(); - guarantee_property(valid_symbol_at(name_index), - "Name index %u in %s has bad constant type in class file %s", - name_index, tbl_name, CHECK_NULL); - guarantee_property(valid_symbol_at(descriptor_index), - "Signature index %u in %s has bad constant type in class file %s", - descriptor_index, tbl_name, CHECK_NULL); - - Symbol* name = _cp->symbol_at(name_index); - Symbol* sig = _cp->symbol_at(descriptor_index); - verify_legal_field_name(name, CHECK_NULL); - u2 extra_slot = 0; - if (!isLVTT) { - verify_legal_field_signature(name, sig, CHECK_NULL); - - // 4894874: check special cases for double and long local variables - if (sig == vmSymbols::type_signature(T_DOUBLE) || - sig == vmSymbols::type_signature(T_LONG)) { - extra_slot = 1; - } - } - guarantee_property((index + extra_slot) < max_locals, - "Invalid index %u in %s in class file %s", - index, tbl_name, CHECK_NULL); - } - } - return localvariable_table_start; -} - - -void ClassFileParser::parse_type_array(u2 array_length, u4 code_length, u4* u1_index, u4* u2_index, - u1* u1_array, u2* u2_array, TRAPS) { - ClassFileStream* cfs = stream(); - u2 index = 0; // index in the array with long/double occupying two slots - u4 i1 = *u1_index; - u4 i2 = *u2_index + 1; - for(int i = 0; i < array_length; i++) { - u1 tag = u1_array[i1++] = cfs->get_u1(CHECK); - index++; - if (tag == ITEM_Long || tag == ITEM_Double) { - index++; - } else if (tag == ITEM_Object) { - u2 class_index = u2_array[i2++] = cfs->get_u2(CHECK); - guarantee_property(valid_klass_reference_at(class_index), - "Bad class index %u in StackMap in class file %s", - class_index, CHECK); - } else if (tag == ITEM_Uninitialized) { - u2 offset = u2_array[i2++] = cfs->get_u2(CHECK); - guarantee_property( - offset < code_length, - "Bad uninitialized type offset %u in StackMap in class file %s", - offset, CHECK); - } else { - guarantee_property( - tag <= (u1)ITEM_Uninitialized, - "Unknown variable type %u in StackMap in class file %s", - tag, CHECK); - } - } - u2_array[*u2_index] = index; - *u1_index = i1; - *u2_index = i2; -} - -u1* ClassFileParser::parse_stackmap_table( - u4 code_attribute_length, TRAPS) { - if (code_attribute_length == 0) - return NULL; - - ClassFileStream* cfs = stream(); - u1* stackmap_table_start = cfs->get_u1_buffer(); - assert(stackmap_table_start != NULL, "null stackmap table"); - - // check code_attribute_length first - stream()->skip_u1(code_attribute_length, CHECK_NULL); - - if (!_need_verify && !DumpSharedSpaces) { - return NULL; - } - return stackmap_table_start; -} - -u2* ClassFileParser::parse_checked_exceptions(u2* checked_exceptions_length, - u4 method_attribute_length, - TRAPS) { - ClassFileStream* cfs = stream(); - cfs->guarantee_more(2, CHECK_NULL); // checked_exceptions_length - *checked_exceptions_length = cfs->get_u2_fast(); - unsigned int size = (*checked_exceptions_length) * sizeof(CheckedExceptionElement) / sizeof(u2); - u2* checked_exceptions_start = cfs->get_u2_buffer(); - assert(checked_exceptions_start != NULL, "null checked exceptions"); - if (!_need_verify) { - cfs->skip_u2_fast(size); - } else { - // Verify each value in the checked exception table - u2 checked_exception; - u2 len = *checked_exceptions_length; - cfs->guarantee_more(2 * len, CHECK_NULL); - for (int i = 0; i < len; i++) { - checked_exception = cfs->get_u2_fast(); - check_property( - valid_klass_reference_at(checked_exception), - "Exception name has bad type at constant pool %u in class file %s", - checked_exception, CHECK_NULL); - } - } - // check exceptions attribute length - if (_need_verify) { - guarantee_property(method_attribute_length == (sizeof(*checked_exceptions_length) + - sizeof(u2) * size), - "Exceptions attribute has wrong length in class file %s", CHECK_NULL); - } - return checked_exceptions_start; -} - -void ClassFileParser::throwIllegalSignature( - const char* type, Symbol* name, Symbol* sig, TRAPS) { - ResourceMark rm(THREAD); - Exceptions::fthrow(THREAD_AND_LOCATION, - vmSymbols::java_lang_ClassFormatError(), - "%s \"%s\" in class %s has illegal signature \"%s\"", type, - name->as_C_string(), _class_name->as_C_string(), sig->as_C_string()); -} - -// Skip an annotation. Return >=limit if there is any problem. -int ClassFileParser::skip_annotation(u1* buffer, int limit, int index) { - // annotation := atype:u2 do(nmem:u2) {member:u2 value} - // value := switch (tag:u1) { ... } - index += 2; // skip atype - if ((index += 2) >= limit) return limit; // read nmem - int nmem = Bytes::get_Java_u2(buffer+index-2); - while (--nmem >= 0 && index < limit) { - index += 2; // skip member - index = skip_annotation_value(buffer, limit, index); - } - return index; -} - -// Skip an annotation value. Return >=limit if there is any problem. -int ClassFileParser::skip_annotation_value(u1* buffer, int limit, int index) { - // value := switch (tag:u1) { - // case B, C, I, S, Z, D, F, J, c: con:u2; - // case e: e_class:u2 e_name:u2; - // case s: s_con:u2; - // case [: do(nval:u2) {value}; - // case @: annotation; - // case s: s_con:u2; - // } - if ((index += 1) >= limit) return limit; // read tag - u1 tag = buffer[index-1]; - switch (tag) { - case 'B': case 'C': case 'I': case 'S': case 'Z': - case 'D': case 'F': case 'J': case 'c': case 's': - index += 2; // skip con or s_con - break; - case 'e': - index += 4; // skip e_class, e_name - break; - case '[': - { - if ((index += 2) >= limit) return limit; // read nval - int nval = Bytes::get_Java_u2(buffer+index-2); - while (--nval >= 0 && index < limit) { - index = skip_annotation_value(buffer, limit, index); - } - } - break; - case '@': - index = skip_annotation(buffer, limit, index); - break; - default: - assert(false, "annotation tag"); - return limit; // bad tag byte - } - return index; -} - -// Sift through annotations, looking for those significant to the VM: -void ClassFileParser::parse_annotations(u1* buffer, int limit, - ClassFileParser::AnnotationCollector* coll, - TRAPS) { - // annotations := do(nann:u2) {annotation} - int index = 0; - if ((index += 2) >= limit) return; // read nann - int nann = Bytes::get_Java_u2(buffer+index-2); - enum { // initial annotation layout - atype_off = 0, // utf8 such as 'Ljava/lang/annotation/Retention;' - count_off = 2, // u2 such as 1 (one value) - member_off = 4, // utf8 such as 'value' - tag_off = 6, // u1 such as 'c' (type) or 'e' (enum) - e_tag_val = 'e', - e_type_off = 7, // utf8 such as 'Ljava/lang/annotation/RetentionPolicy;' - e_con_off = 9, // utf8 payload, such as 'SOURCE', 'CLASS', 'RUNTIME' - e_size = 11, // end of 'e' annotation - c_tag_val = 'c', // payload is type - c_con_off = 7, // utf8 payload, such as 'I' - c_size = 9, // end of 'c' annotation - s_tag_val = 's', // payload is String - s_con_off = 7, // utf8 payload, such as 'Ljava/lang/String;' - s_size = 9, - min_size = 6 // smallest possible size (zero members) - }; - while ((--nann) >= 0 && (index-2 + min_size <= limit)) { - int index0 = index; - index = skip_annotation(buffer, limit, index); - u1* abase = buffer + index0; - int atype = Bytes::get_Java_u2(abase + atype_off); - int count = Bytes::get_Java_u2(abase + count_off); - Symbol* aname = check_symbol_at(_cp, atype); - if (aname == NULL) break; // invalid annotation name - Symbol* member = NULL; - if (count >= 1) { - int member_index = Bytes::get_Java_u2(abase + member_off); - member = check_symbol_at(_cp, member_index); - if (member == NULL) break; // invalid member name - } - - // Here is where parsing particular annotations will take place. - AnnotationCollector::ID id = coll->annotation_index(_loader_data, aname); - if (id == AnnotationCollector::_unknown) continue; - coll->set_annotation(id); - - if (id == AnnotationCollector::_sun_misc_Contended) { - // @Contended can optionally specify the contention group. - // - // Contended group defines the equivalence class over the fields: - // the fields within the same contended group are not treated distinct. - // The only exception is default group, which does not incur the - // equivalence. Naturally, contention group for classes is meaningless. - // - // While the contention group is specified as String, annotation - // values are already interned, and we might as well use the constant - // pool index as the group tag. - // - u2 group_index = 0; // default contended group - if (count == 1 - && s_size == (index - index0) // match size - && s_tag_val == *(abase + tag_off) - && member == vmSymbols::value_name()) { - group_index = Bytes::get_Java_u2(abase + s_con_off); - if (_cp->symbol_at(group_index)->utf8_length() == 0) { - group_index = 0; // default contended group - } - } - coll->set_contended_group(group_index); - } - } -} - -ClassFileParser::AnnotationCollector::ID -ClassFileParser::AnnotationCollector::annotation_index(ClassLoaderData* loader_data, - Symbol* name) { - vmSymbols::SID sid = vmSymbols::find_sid(name); - // Privileged code can use all annotations. Other code silently drops some. - const bool privileged = loader_data->is_the_null_class_loader_data() || - loader_data->is_ext_class_loader_data() || - loader_data->is_anonymous(); - switch (sid) { - case vmSymbols::VM_SYMBOL_ENUM_NAME(sun_reflect_CallerSensitive_signature): - if (_location != _in_method) break; // only allow for methods - if (!privileged) break; // only allow in privileged code - return _method_CallerSensitive; - case vmSymbols::VM_SYMBOL_ENUM_NAME(java_lang_invoke_ForceInline_signature): - if (_location != _in_method) break; // only allow for methods - if (!privileged) break; // only allow in privileged code - return _method_ForceInline; - case vmSymbols::VM_SYMBOL_ENUM_NAME(java_lang_invoke_DontInline_signature): - if (_location != _in_method) break; // only allow for methods - if (!privileged) break; // only allow in privileged code - return _method_DontInline; - case vmSymbols::VM_SYMBOL_ENUM_NAME(java_lang_invoke_LambdaForm_Compiled_signature): - if (_location != _in_method) break; // only allow for methods - if (!privileged) break; // only allow in privileged code - return _method_LambdaForm_Compiled; - case vmSymbols::VM_SYMBOL_ENUM_NAME(java_lang_invoke_LambdaForm_Hidden_signature): - if (_location != _in_method) break; // only allow for methods - if (!privileged) break; // only allow in privileged code - return _method_LambdaForm_Hidden; - case vmSymbols::VM_SYMBOL_ENUM_NAME(java_lang_invoke_Stable_signature): - if (_location != _in_field) break; // only allow for fields - if (!privileged) break; // only allow in privileged code - return _field_Stable; - case vmSymbols::VM_SYMBOL_ENUM_NAME(sun_misc_Contended_signature): - if (_location != _in_field && _location != _in_class) break; // only allow for fields and classes - if (!EnableContended || (RestrictContended && !privileged)) break; // honor privileges - return _sun_misc_Contended; - default: break; - } - return AnnotationCollector::_unknown; -} - -void ClassFileParser::FieldAnnotationCollector::apply_to(FieldInfo* f) { - if (is_contended()) - f->set_contended_group(contended_group()); - if (is_stable()) - f->set_stable(true); -} - -ClassFileParser::FieldAnnotationCollector::~FieldAnnotationCollector() { - // If there's an error deallocate metadata for field annotations - MetadataFactory::free_array(_loader_data, _field_annotations); - MetadataFactory::free_array(_loader_data, _field_type_annotations); -} - -void ClassFileParser::MethodAnnotationCollector::apply_to(methodHandle m) { - if (has_annotation(_method_CallerSensitive)) - m->set_caller_sensitive(true); - if (has_annotation(_method_ForceInline)) - m->set_force_inline(true); - if (has_annotation(_method_DontInline)) - m->set_dont_inline(true); - if (has_annotation(_method_LambdaForm_Compiled) && m->intrinsic_id() == vmIntrinsics::_none) - m->set_intrinsic_id(vmIntrinsics::_compiledLambdaForm); - if (has_annotation(_method_LambdaForm_Hidden)) - m->set_hidden(true); -} - -void ClassFileParser::ClassAnnotationCollector::apply_to(instanceKlassHandle k) { - k->set_is_contended(is_contended()); -} - - -#define MAX_ARGS_SIZE 255 -#define MAX_CODE_SIZE 65535 -#define INITIAL_MAX_LVT_NUMBER 256 - -/* Copy class file LVT's/LVTT's into the HotSpot internal LVT. - * - * Rules for LVT's and LVTT's are: - * - There can be any number of LVT's and LVTT's. - * - If there are n LVT's, it is the same as if there was just - * one LVT containing all the entries from the n LVT's. - * - There may be no more than one LVT entry per local variable. - * Two LVT entries are 'equal' if these fields are the same: - * start_pc, length, name, slot - * - There may be no more than one LVTT entry per each LVT entry. - * Each LVTT entry has to match some LVT entry. - * - HotSpot internal LVT keeps natural ordering of class file LVT entries. - */ -void ClassFileParser::copy_localvariable_table(ConstMethod* cm, - int lvt_cnt, - u2* localvariable_table_length, - u2** localvariable_table_start, - int lvtt_cnt, - u2* localvariable_type_table_length, - u2** localvariable_type_table_start, - TRAPS) { - - LVT_Hash** lvt_Hash = NEW_RESOURCE_ARRAY(LVT_Hash*, HASH_ROW_SIZE); - initialize_hashtable(lvt_Hash); - - // To fill LocalVariableTable in - Classfile_LVT_Element* cf_lvt; - LocalVariableTableElement* lvt = cm->localvariable_table_start(); - - for (int tbl_no = 0; tbl_no < lvt_cnt; tbl_no++) { - cf_lvt = (Classfile_LVT_Element *) localvariable_table_start[tbl_no]; - for (int idx = 0; idx < localvariable_table_length[tbl_no]; idx++, lvt++) { - copy_lvt_element(&cf_lvt[idx], lvt); - // If no duplicates, add LVT elem in hashtable lvt_Hash. - if (LVT_put_after_lookup(lvt, lvt_Hash) == false - && _need_verify - && _major_version >= JAVA_1_5_VERSION) { - clear_hashtable(lvt_Hash); - classfile_parse_error("Duplicated LocalVariableTable attribute " - "entry for '%s' in class file %s", - _cp->symbol_at(lvt->name_cp_index)->as_utf8(), - CHECK); - } - } - } - - // To merge LocalVariableTable and LocalVariableTypeTable - Classfile_LVT_Element* cf_lvtt; - LocalVariableTableElement lvtt_elem; - - for (int tbl_no = 0; tbl_no < lvtt_cnt; tbl_no++) { - cf_lvtt = (Classfile_LVT_Element *) localvariable_type_table_start[tbl_no]; - for (int idx = 0; idx < localvariable_type_table_length[tbl_no]; idx++) { - copy_lvt_element(&cf_lvtt[idx], &lvtt_elem); - int index = hash(&lvtt_elem); - LVT_Hash* entry = LVT_lookup(&lvtt_elem, index, lvt_Hash); - if (entry == NULL) { - if (_need_verify) { - clear_hashtable(lvt_Hash); - classfile_parse_error("LVTT entry for '%s' in class file %s " - "does not match any LVT entry", - _cp->symbol_at(lvtt_elem.name_cp_index)->as_utf8(), - CHECK); - } - } else if (entry->_elem->signature_cp_index != 0 && _need_verify) { - clear_hashtable(lvt_Hash); - classfile_parse_error("Duplicated LocalVariableTypeTable attribute " - "entry for '%s' in class file %s", - _cp->symbol_at(lvtt_elem.name_cp_index)->as_utf8(), - CHECK); - } else { - // to add generic signatures into LocalVariableTable - entry->_elem->signature_cp_index = lvtt_elem.descriptor_cp_index; - } - } - } - clear_hashtable(lvt_Hash); -} - - -void ClassFileParser::copy_method_annotations(ConstMethod* cm, - u1* runtime_visible_annotations, - int runtime_visible_annotations_length, - u1* runtime_invisible_annotations, - int runtime_invisible_annotations_length, - u1* runtime_visible_parameter_annotations, - int runtime_visible_parameter_annotations_length, - u1* runtime_invisible_parameter_annotations, - int runtime_invisible_parameter_annotations_length, - u1* runtime_visible_type_annotations, - int runtime_visible_type_annotations_length, - u1* runtime_invisible_type_annotations, - int runtime_invisible_type_annotations_length, - u1* annotation_default, - int annotation_default_length, - TRAPS) { - - AnnotationArray* a; - - if (runtime_visible_annotations_length + - runtime_invisible_annotations_length > 0) { - a = assemble_annotations(runtime_visible_annotations, - runtime_visible_annotations_length, - runtime_invisible_annotations, - runtime_invisible_annotations_length, - CHECK); - cm->set_method_annotations(a); - } - - if (runtime_visible_parameter_annotations_length + - runtime_invisible_parameter_annotations_length > 0) { - a = assemble_annotations(runtime_visible_parameter_annotations, - runtime_visible_parameter_annotations_length, - runtime_invisible_parameter_annotations, - runtime_invisible_parameter_annotations_length, - CHECK); - cm->set_parameter_annotations(a); - } - - if (annotation_default_length > 0) { - a = assemble_annotations(annotation_default, - annotation_default_length, - NULL, - 0, - CHECK); - cm->set_default_annotations(a); - } - - if (runtime_visible_type_annotations_length + - runtime_invisible_type_annotations_length > 0) { - a = assemble_annotations(runtime_visible_type_annotations, - runtime_visible_type_annotations_length, - runtime_invisible_type_annotations, - runtime_invisible_type_annotations_length, - CHECK); - cm->set_type_annotations(a); - } -} - - -// Note: the parse_method below is big and clunky because all parsing of the code and exceptions -// attribute is inlined. This is cumbersome to avoid since we inline most of the parts in the -// Method* to save footprint, so we only know the size of the resulting Method* when the -// entire method attribute is parsed. -// -// The promoted_flags parameter is used to pass relevant access_flags -// from the method back up to the containing klass. These flag values -// are added to klass's access_flags. - -methodHandle ClassFileParser::parse_method(bool is_interface, - AccessFlags *promoted_flags, - TRAPS) { - ClassFileStream* cfs = stream(); - methodHandle nullHandle; - ResourceMark rm(THREAD); - // Parse fixed parts - cfs->guarantee_more(8, CHECK_(nullHandle)); // access_flags, name_index, descriptor_index, attributes_count - - int flags = cfs->get_u2_fast(); - u2 name_index = cfs->get_u2_fast(); - int cp_size = _cp->length(); - check_property( - valid_symbol_at(name_index), - "Illegal constant pool index %u for method name in class file %s", - name_index, CHECK_(nullHandle)); - Symbol* name = _cp->symbol_at(name_index); - verify_legal_method_name(name, CHECK_(nullHandle)); - - u2 signature_index = cfs->get_u2_fast(); - guarantee_property( - valid_symbol_at(signature_index), - "Illegal constant pool index %u for method signature in class file %s", - signature_index, CHECK_(nullHandle)); - Symbol* signature = _cp->symbol_at(signature_index); - - AccessFlags access_flags; - if (name == vmSymbols::class_initializer_name()) { - // We ignore the other access flags for a valid class initializer. - // (JVM Spec 2nd ed., chapter 4.6) - if (_major_version < 51) { // backward compatibility - flags = JVM_ACC_STATIC; - } else if ((flags & JVM_ACC_STATIC) == JVM_ACC_STATIC) { - flags &= JVM_ACC_STATIC | JVM_ACC_STRICT; - } - } else { - verify_legal_method_modifiers(flags, is_interface, name, CHECK_(nullHandle)); - } - - int args_size = -1; // only used when _need_verify is true - if (_need_verify) { - args_size = ((flags & JVM_ACC_STATIC) ? 0 : 1) + - verify_legal_method_signature(name, signature, CHECK_(nullHandle)); - if (args_size > MAX_ARGS_SIZE) { - classfile_parse_error("Too many arguments in method signature in class file %s", CHECK_(nullHandle)); - } - } - - access_flags.set_flags(flags & JVM_RECOGNIZED_METHOD_MODIFIERS); - - // Default values for code and exceptions attribute elements - u2 max_stack = 0; - u2 max_locals = 0; - u4 code_length = 0; - u1* code_start = 0; - u2 exception_table_length = 0; - u2* exception_table_start = NULL; - Array* exception_handlers = Universe::the_empty_int_array(); - u2 checked_exceptions_length = 0; - u2* checked_exceptions_start = NULL; - CompressedLineNumberWriteStream* linenumber_table = NULL; - int linenumber_table_length = 0; - int total_lvt_length = 0; - u2 lvt_cnt = 0; - u2 lvtt_cnt = 0; - bool lvt_allocated = false; - u2 max_lvt_cnt = INITIAL_MAX_LVT_NUMBER; - u2 max_lvtt_cnt = INITIAL_MAX_LVT_NUMBER; - u2* localvariable_table_length; - u2** localvariable_table_start; - u2* localvariable_type_table_length; - u2** localvariable_type_table_start; - u2 method_parameters_length = 0; - u1* method_parameters_data = NULL; - bool method_parameters_seen = false; - bool parsed_code_attribute = false; - bool parsed_checked_exceptions_attribute = false; - bool parsed_stackmap_attribute = false; - // stackmap attribute - JDK1.5 - u1* stackmap_data = NULL; - int stackmap_data_length = 0; - u2 generic_signature_index = 0; - MethodAnnotationCollector parsed_annotations; - u1* runtime_visible_annotations = NULL; - int runtime_visible_annotations_length = 0; - u1* runtime_invisible_annotations = NULL; - int runtime_invisible_annotations_length = 0; - u1* runtime_visible_parameter_annotations = NULL; - int runtime_visible_parameter_annotations_length = 0; - u1* runtime_invisible_parameter_annotations = NULL; - int runtime_invisible_parameter_annotations_length = 0; - u1* runtime_visible_type_annotations = NULL; - int runtime_visible_type_annotations_length = 0; - u1* runtime_invisible_type_annotations = NULL; - int runtime_invisible_type_annotations_length = 0; - bool runtime_invisible_annotations_exists = false; - bool runtime_invisible_type_annotations_exists = false; - bool runtime_invisible_parameter_annotations_exists = false; - u1* annotation_default = NULL; - int annotation_default_length = 0; - - // Parse code and exceptions attribute - u2 method_attributes_count = cfs->get_u2_fast(); - while (method_attributes_count--) { - cfs->guarantee_more(6, CHECK_(nullHandle)); // method_attribute_name_index, method_attribute_length - u2 method_attribute_name_index = cfs->get_u2_fast(); - u4 method_attribute_length = cfs->get_u4_fast(); - check_property( - valid_symbol_at(method_attribute_name_index), - "Invalid method attribute name index %u in class file %s", - method_attribute_name_index, CHECK_(nullHandle)); - - Symbol* method_attribute_name = _cp->symbol_at(method_attribute_name_index); - if (method_attribute_name == vmSymbols::tag_code()) { - // Parse Code attribute - if (_need_verify) { - guarantee_property( - !access_flags.is_native() && !access_flags.is_abstract(), - "Code attribute in native or abstract methods in class file %s", - CHECK_(nullHandle)); - } - if (parsed_code_attribute) { - classfile_parse_error("Multiple Code attributes in class file %s", CHECK_(nullHandle)); - } - parsed_code_attribute = true; - - // Stack size, locals size, and code size - if (_major_version == 45 && _minor_version <= 2) { - cfs->guarantee_more(4, CHECK_(nullHandle)); - max_stack = cfs->get_u1_fast(); - max_locals = cfs->get_u1_fast(); - code_length = cfs->get_u2_fast(); - } else { - cfs->guarantee_more(8, CHECK_(nullHandle)); - max_stack = cfs->get_u2_fast(); - max_locals = cfs->get_u2_fast(); - code_length = cfs->get_u4_fast(); - } - if (_need_verify) { - guarantee_property(args_size <= max_locals, - "Arguments can't fit into locals in class file %s", CHECK_(nullHandle)); - guarantee_property(code_length > 0 && code_length <= MAX_CODE_SIZE, - "Invalid method Code length %u in class file %s", - code_length, CHECK_(nullHandle)); - } - // Code pointer - code_start = cfs->get_u1_buffer(); - assert(code_start != NULL, "null code start"); - cfs->guarantee_more(code_length, CHECK_(nullHandle)); - cfs->skip_u1_fast(code_length); - - // Exception handler table - cfs->guarantee_more(2, CHECK_(nullHandle)); // exception_table_length - exception_table_length = cfs->get_u2_fast(); - if (exception_table_length > 0) { - exception_table_start = - parse_exception_table(code_length, exception_table_length, CHECK_(nullHandle)); - } - - // Parse additional attributes in code attribute - cfs->guarantee_more(2, CHECK_(nullHandle)); // code_attributes_count - u2 code_attributes_count = cfs->get_u2_fast(); - - unsigned int calculated_attribute_length = 0; - - if (_major_version > 45 || (_major_version == 45 && _minor_version > 2)) { - calculated_attribute_length = - sizeof(max_stack) + sizeof(max_locals) + sizeof(code_length); - } else { - // max_stack, locals and length are smaller in pre-version 45.2 classes - calculated_attribute_length = sizeof(u1) + sizeof(u1) + sizeof(u2); - } - calculated_attribute_length += - code_length + - sizeof(exception_table_length) + - sizeof(code_attributes_count) + - exception_table_length * - ( sizeof(u2) + // start_pc - sizeof(u2) + // end_pc - sizeof(u2) + // handler_pc - sizeof(u2) ); // catch_type_index - - while (code_attributes_count--) { - cfs->guarantee_more(6, CHECK_(nullHandle)); // code_attribute_name_index, code_attribute_length - u2 code_attribute_name_index = cfs->get_u2_fast(); - u4 code_attribute_length = cfs->get_u4_fast(); - calculated_attribute_length += code_attribute_length + - sizeof(code_attribute_name_index) + - sizeof(code_attribute_length); - check_property(valid_symbol_at(code_attribute_name_index), - "Invalid code attribute name index %u in class file %s", - code_attribute_name_index, - CHECK_(nullHandle)); - if (LoadLineNumberTables && - _cp->symbol_at(code_attribute_name_index) == vmSymbols::tag_line_number_table()) { - // Parse and compress line number table - parse_linenumber_table(code_attribute_length, code_length, - &linenumber_table, CHECK_(nullHandle)); - - } else if (LoadLocalVariableTables && - _cp->symbol_at(code_attribute_name_index) == vmSymbols::tag_local_variable_table()) { - // Parse local variable table - if (!lvt_allocated) { - localvariable_table_length = NEW_RESOURCE_ARRAY_IN_THREAD( - THREAD, u2, INITIAL_MAX_LVT_NUMBER); - localvariable_table_start = NEW_RESOURCE_ARRAY_IN_THREAD( - THREAD, u2*, INITIAL_MAX_LVT_NUMBER); - localvariable_type_table_length = NEW_RESOURCE_ARRAY_IN_THREAD( - THREAD, u2, INITIAL_MAX_LVT_NUMBER); - localvariable_type_table_start = NEW_RESOURCE_ARRAY_IN_THREAD( - THREAD, u2*, INITIAL_MAX_LVT_NUMBER); - lvt_allocated = true; - } - if (lvt_cnt == max_lvt_cnt) { - max_lvt_cnt <<= 1; - localvariable_table_length = REALLOC_RESOURCE_ARRAY(u2, localvariable_table_length, lvt_cnt, max_lvt_cnt); - localvariable_table_start = REALLOC_RESOURCE_ARRAY(u2*, localvariable_table_start, lvt_cnt, max_lvt_cnt); - } - localvariable_table_start[lvt_cnt] = - parse_localvariable_table(code_length, - max_locals, - code_attribute_length, - &localvariable_table_length[lvt_cnt], - false, // is not LVTT - CHECK_(nullHandle)); - total_lvt_length += localvariable_table_length[lvt_cnt]; - lvt_cnt++; - } else if (LoadLocalVariableTypeTables && - _major_version >= JAVA_1_5_VERSION && - _cp->symbol_at(code_attribute_name_index) == vmSymbols::tag_local_variable_type_table()) { - if (!lvt_allocated) { - localvariable_table_length = NEW_RESOURCE_ARRAY_IN_THREAD( - THREAD, u2, INITIAL_MAX_LVT_NUMBER); - localvariable_table_start = NEW_RESOURCE_ARRAY_IN_THREAD( - THREAD, u2*, INITIAL_MAX_LVT_NUMBER); - localvariable_type_table_length = NEW_RESOURCE_ARRAY_IN_THREAD( - THREAD, u2, INITIAL_MAX_LVT_NUMBER); - localvariable_type_table_start = NEW_RESOURCE_ARRAY_IN_THREAD( - THREAD, u2*, INITIAL_MAX_LVT_NUMBER); - lvt_allocated = true; - } - // Parse local variable type table - if (lvtt_cnt == max_lvtt_cnt) { - max_lvtt_cnt <<= 1; - localvariable_type_table_length = REALLOC_RESOURCE_ARRAY(u2, localvariable_type_table_length, lvtt_cnt, max_lvtt_cnt); - localvariable_type_table_start = REALLOC_RESOURCE_ARRAY(u2*, localvariable_type_table_start, lvtt_cnt, max_lvtt_cnt); - } - localvariable_type_table_start[lvtt_cnt] = - parse_localvariable_table(code_length, - max_locals, - code_attribute_length, - &localvariable_type_table_length[lvtt_cnt], - true, // is LVTT - CHECK_(nullHandle)); - lvtt_cnt++; - } else if (_major_version >= Verifier::STACKMAP_ATTRIBUTE_MAJOR_VERSION && - _cp->symbol_at(code_attribute_name_index) == vmSymbols::tag_stack_map_table()) { - // Stack map is only needed by the new verifier in JDK1.5. - if (parsed_stackmap_attribute) { - classfile_parse_error("Multiple StackMapTable attributes in class file %s", CHECK_(nullHandle)); - } - stackmap_data = parse_stackmap_table(code_attribute_length, CHECK_(nullHandle)); - stackmap_data_length = code_attribute_length; - parsed_stackmap_attribute = true; - } else { - // Skip unknown attributes - cfs->skip_u1(code_attribute_length, CHECK_(nullHandle)); - } - } - // check method attribute length - if (_need_verify) { - guarantee_property(method_attribute_length == calculated_attribute_length, - "Code segment has wrong length in class file %s", CHECK_(nullHandle)); - } - } else if (method_attribute_name == vmSymbols::tag_exceptions()) { - // Parse Exceptions attribute - if (parsed_checked_exceptions_attribute) { - classfile_parse_error("Multiple Exceptions attributes in class file %s", CHECK_(nullHandle)); - } - parsed_checked_exceptions_attribute = true; - checked_exceptions_start = - parse_checked_exceptions(&checked_exceptions_length, - method_attribute_length, - CHECK_(nullHandle)); - } else if (method_attribute_name == vmSymbols::tag_method_parameters()) { - // reject multiple method parameters - if (method_parameters_seen) { - classfile_parse_error("Multiple MethodParameters attributes in class file %s", CHECK_(nullHandle)); - } - method_parameters_seen = true; - method_parameters_length = cfs->get_u1_fast(); - if (method_attribute_length != (method_parameters_length * 4u) + 1u) { - classfile_parse_error( - "Invalid MethodParameters method attribute length %u in class file", - method_attribute_length, CHECK_(nullHandle)); - } - method_parameters_data = cfs->get_u1_buffer(); - cfs->skip_u2_fast(method_parameters_length); - cfs->skip_u2_fast(method_parameters_length); - // ignore this attribute if it cannot be reflected - if (!SystemDictionary::Parameter_klass_loaded()) - method_parameters_length = 0; - } else if (method_attribute_name == vmSymbols::tag_synthetic()) { - if (method_attribute_length != 0) { - classfile_parse_error( - "Invalid Synthetic method attribute length %u in class file %s", - method_attribute_length, CHECK_(nullHandle)); - } - // Should we check that there hasn't already been a synthetic attribute? - access_flags.set_is_synthetic(); - } else if (method_attribute_name == vmSymbols::tag_deprecated()) { // 4276120 - if (method_attribute_length != 0) { - classfile_parse_error( - "Invalid Deprecated method attribute length %u in class file %s", - method_attribute_length, CHECK_(nullHandle)); - } - } else if (_major_version >= JAVA_1_5_VERSION) { - if (method_attribute_name == vmSymbols::tag_signature()) { - if (method_attribute_length != 2) { - classfile_parse_error( - "Invalid Signature attribute length %u in class file %s", - method_attribute_length, CHECK_(nullHandle)); - } - generic_signature_index = parse_generic_signature_attribute(CHECK_(nullHandle)); - } else if (method_attribute_name == vmSymbols::tag_runtime_visible_annotations()) { - if (runtime_visible_annotations != NULL) { - classfile_parse_error( - "Multiple RuntimeVisibleAnnotations attributes for method in class file %s", CHECK_(nullHandle)); - } - runtime_visible_annotations_length = method_attribute_length; - runtime_visible_annotations = cfs->get_u1_buffer(); - assert(runtime_visible_annotations != NULL, "null visible annotations"); - parse_annotations(runtime_visible_annotations, - runtime_visible_annotations_length, &parsed_annotations, - CHECK_(nullHandle)); - cfs->skip_u1(runtime_visible_annotations_length, CHECK_(nullHandle)); - } else if (method_attribute_name == vmSymbols::tag_runtime_invisible_annotations()) { - if (runtime_invisible_annotations_exists) { - classfile_parse_error( - "Multiple RuntimeInvisibleAnnotations attributes for method in class file %s", CHECK_(nullHandle)); - } - runtime_invisible_annotations_exists = true; - if (PreserveAllAnnotations) { - runtime_invisible_annotations_length = method_attribute_length; - runtime_invisible_annotations = cfs->get_u1_buffer(); - assert(runtime_invisible_annotations != NULL, "null invisible annotations"); - } - cfs->skip_u1(method_attribute_length, CHECK_(nullHandle)); - } else if (method_attribute_name == vmSymbols::tag_runtime_visible_parameter_annotations()) { - if (runtime_visible_parameter_annotations != NULL) { - classfile_parse_error( - "Multiple RuntimeVisibleParameterAnnotations attributes for method in class file %s", CHECK_(nullHandle)); - } - runtime_visible_parameter_annotations_length = method_attribute_length; - runtime_visible_parameter_annotations = cfs->get_u1_buffer(); - assert(runtime_visible_parameter_annotations != NULL, "null visible parameter annotations"); - cfs->skip_u1(runtime_visible_parameter_annotations_length, CHECK_(nullHandle)); - } else if (method_attribute_name == vmSymbols::tag_runtime_invisible_parameter_annotations()) { - if (runtime_invisible_parameter_annotations_exists) { - classfile_parse_error( - "Multiple RuntimeInvisibleParameterAnnotations attributes for method in class file %s", CHECK_(nullHandle)); - } - runtime_invisible_parameter_annotations_exists = true; - if (PreserveAllAnnotations) { - runtime_invisible_parameter_annotations_length = method_attribute_length; - runtime_invisible_parameter_annotations = cfs->get_u1_buffer(); - assert(runtime_invisible_parameter_annotations != NULL, "null invisible parameter annotations"); - } - cfs->skip_u1(method_attribute_length, CHECK_(nullHandle)); - } else if (method_attribute_name == vmSymbols::tag_annotation_default()) { - if (annotation_default != NULL) { - classfile_parse_error( - "Multiple AnnotationDefault attributes for method in class file %s", - CHECK_(nullHandle)); - } - annotation_default_length = method_attribute_length; - annotation_default = cfs->get_u1_buffer(); - assert(annotation_default != NULL, "null annotation default"); - cfs->skip_u1(annotation_default_length, CHECK_(nullHandle)); - } else if (method_attribute_name == vmSymbols::tag_runtime_visible_type_annotations()) { - if (runtime_visible_type_annotations != NULL) { - classfile_parse_error( - "Multiple RuntimeVisibleTypeAnnotations attributes for method in class file %s", - CHECK_(nullHandle)); - } - runtime_visible_type_annotations_length = method_attribute_length; - runtime_visible_type_annotations = cfs->get_u1_buffer(); - assert(runtime_visible_type_annotations != NULL, "null visible type annotations"); - // No need for the VM to parse Type annotations - cfs->skip_u1(runtime_visible_type_annotations_length, CHECK_(nullHandle)); - } else if (method_attribute_name == vmSymbols::tag_runtime_invisible_type_annotations()) { - if (runtime_invisible_type_annotations_exists) { - classfile_parse_error( - "Multiple RuntimeInvisibleTypeAnnotations attributes for method in class file %s", - CHECK_(nullHandle)); - } else { - runtime_invisible_type_annotations_exists = true; - } - if (PreserveAllAnnotations) { - runtime_invisible_type_annotations_length = method_attribute_length; - runtime_invisible_type_annotations = cfs->get_u1_buffer(); - assert(runtime_invisible_type_annotations != NULL, "null invisible type annotations"); - } - cfs->skip_u1(method_attribute_length, CHECK_(nullHandle)); - } else { - // Skip unknown attributes - cfs->skip_u1(method_attribute_length, CHECK_(nullHandle)); - } - } else { - // Skip unknown attributes - cfs->skip_u1(method_attribute_length, CHECK_(nullHandle)); - } - } - - if (linenumber_table != NULL) { - linenumber_table->write_terminator(); - linenumber_table_length = linenumber_table->position(); - } - - // Make sure there's at least one Code attribute in non-native/non-abstract method - if (_need_verify) { - guarantee_property(access_flags.is_native() || access_flags.is_abstract() || parsed_code_attribute, - "Absent Code attribute in method that is not native or abstract in class file %s", CHECK_(nullHandle)); - } - - // All sizing information for a Method* is finally available, now create it - InlineTableSizes sizes( - total_lvt_length, - linenumber_table_length, - exception_table_length, - checked_exceptions_length, - method_parameters_length, - generic_signature_index, - runtime_visible_annotations_length + - runtime_invisible_annotations_length, - runtime_visible_parameter_annotations_length + - runtime_invisible_parameter_annotations_length, - runtime_visible_type_annotations_length + - runtime_invisible_type_annotations_length, - annotation_default_length, - 0); - - Method* m = Method::allocate( - _loader_data, code_length, access_flags, &sizes, - ConstMethod::NORMAL, CHECK_(nullHandle)); - - ClassLoadingService::add_class_method_size(m->size()*HeapWordSize); - - // Fill in information from fixed part (access_flags already set) - m->set_constants(_cp); - m->set_name_index(name_index); - m->set_signature_index(signature_index); -#ifdef CC_INTERP - // hmm is there a gc issue here?? - ResultTypeFinder rtf(_cp->symbol_at(signature_index)); - m->set_result_index(rtf.type()); -#endif - - if (args_size >= 0) { - m->set_size_of_parameters(args_size); - } else { - m->compute_size_of_parameters(THREAD); - } -#ifdef ASSERT - if (args_size >= 0) { - m->compute_size_of_parameters(THREAD); - assert(args_size == m->size_of_parameters(), ""); - } -#endif - - // Fill in code attribute information - m->set_max_stack(max_stack); - m->set_max_locals(max_locals); - if (stackmap_data != NULL) { - m->constMethod()->copy_stackmap_data(_loader_data, stackmap_data, - stackmap_data_length, CHECK_NULL); - } - - // Copy byte codes - m->set_code(code_start); - - // Copy line number table - if (linenumber_table != NULL) { - memcpy(m->compressed_linenumber_table(), - linenumber_table->buffer(), linenumber_table_length); - } - - // Copy exception table - if (exception_table_length > 0) { - int size = - exception_table_length * sizeof(ExceptionTableElement) / sizeof(u2); - copy_u2_with_conversion((u2*) m->exception_table_start(), - exception_table_start, size); - } - - // Copy method parameters - if (method_parameters_length > 0) { - MethodParametersElement* elem = m->constMethod()->method_parameters_start(); - for (int i = 0; i < method_parameters_length; i++) { - elem[i].name_cp_index = Bytes::get_Java_u2(method_parameters_data); - method_parameters_data += 2; - elem[i].flags = Bytes::get_Java_u2(method_parameters_data); - method_parameters_data += 2; - } - } - - // Copy checked exceptions - if (checked_exceptions_length > 0) { - int size = checked_exceptions_length * sizeof(CheckedExceptionElement) / sizeof(u2); - copy_u2_with_conversion((u2*) m->checked_exceptions_start(), checked_exceptions_start, size); - } - - // Copy class file LVT's/LVTT's into the HotSpot internal LVT. - if (total_lvt_length > 0) { - promoted_flags->set_has_localvariable_table(); - copy_localvariable_table(m->constMethod(), lvt_cnt, - localvariable_table_length, - localvariable_table_start, - lvtt_cnt, - localvariable_type_table_length, - localvariable_type_table_start, CHECK_NULL); - } - - if (parsed_annotations.has_any_annotations()) - parsed_annotations.apply_to(m); - - // Copy annotations - copy_method_annotations(m->constMethod(), - runtime_visible_annotations, - runtime_visible_annotations_length, - runtime_invisible_annotations, - runtime_invisible_annotations_length, - runtime_visible_parameter_annotations, - runtime_visible_parameter_annotations_length, - runtime_invisible_parameter_annotations, - runtime_invisible_parameter_annotations_length, - runtime_visible_type_annotations, - runtime_visible_type_annotations_length, - runtime_invisible_type_annotations, - runtime_invisible_type_annotations_length, - annotation_default, - annotation_default_length, - CHECK_NULL); - - if (name == vmSymbols::finalize_method_name() && - signature == vmSymbols::void_method_signature()) { - if (m->is_empty_method()) { - _has_empty_finalizer = true; - } else { - _has_finalizer = true; - } - } - if (name == vmSymbols::object_initializer_name() && - signature == vmSymbols::void_method_signature() && - m->is_vanilla_constructor()) { - _has_vanilla_constructor = true; - } - - NOT_PRODUCT(m->verify()); - return m; -} - - -// The promoted_flags parameter is used to pass relevant access_flags -// from the methods back up to the containing klass. These flag values -// are added to klass's access_flags. - -Array* ClassFileParser::parse_methods(bool is_interface, - AccessFlags* promoted_flags, - bool* has_final_method, - bool* has_default_methods, - TRAPS) { - ClassFileStream* cfs = stream(); - cfs->guarantee_more(2, CHECK_NULL); // length - u2 length = cfs->get_u2_fast(); - if (length == 0) { - _methods = Universe::the_empty_method_array(); - } else { - _methods = MetadataFactory::new_array(_loader_data, length, NULL, CHECK_NULL); - - HandleMark hm(THREAD); - for (int index = 0; index < length; index++) { - methodHandle method = parse_method(is_interface, - promoted_flags, - CHECK_NULL); - - if (method->is_final()) { - *has_final_method = true; - } - if (is_interface && !(*has_default_methods) - && !method->is_abstract() && !method->is_static() - && !method->is_private()) { - // default method - *has_default_methods = true; - } - _methods->at_put(index, method()); - } - - if (_need_verify && length > 1) { - // Check duplicated methods - ResourceMark rm(THREAD); - NameSigHash** names_and_sigs = NEW_RESOURCE_ARRAY_IN_THREAD( - THREAD, NameSigHash*, HASH_ROW_SIZE); - initialize_hashtable(names_and_sigs); - bool dup = false; - { - debug_only(No_Safepoint_Verifier nsv;) - for (int i = 0; i < length; i++) { - Method* m = _methods->at(i); - // If no duplicates, add name/signature in hashtable names_and_sigs. - if (!put_after_lookup(m->name(), m->signature(), names_and_sigs)) { - dup = true; - break; - } - } - } - if (dup) { - classfile_parse_error("Duplicate method name&signature in class file %s", - CHECK_NULL); - } - } - } - return _methods; -} - - -intArray* ClassFileParser::sort_methods(Array* methods) { - int length = methods->length(); - // If JVMTI original method ordering or sharing is enabled we have to - // remember the original class file ordering. - // We temporarily use the vtable_index field in the Method* to store the - // class file index, so we can read in after calling qsort. - // Put the method ordering in the shared archive. - if (JvmtiExport::can_maintain_original_method_order() || DumpSharedSpaces) { - for (int index = 0; index < length; index++) { - Method* m = methods->at(index); - assert(!m->valid_vtable_index(), "vtable index should not be set"); - m->set_vtable_index(index); - } - } - // Sort method array by ascending method name (for faster lookups & vtable construction) - // Note that the ordering is not alphabetical, see Symbol::fast_compare - Method::sort_methods(methods); - - intArray* method_ordering = NULL; - // If JVMTI original method ordering or sharing is enabled construct int - // array remembering the original ordering - if (JvmtiExport::can_maintain_original_method_order() || DumpSharedSpaces) { - method_ordering = new intArray(length); - for (int index = 0; index < length; index++) { - Method* m = methods->at(index); - int old_index = m->vtable_index(); - assert(old_index >= 0 && old_index < length, "invalid method index"); - method_ordering->at_put(index, old_index); - m->set_vtable_index(Method::invalid_vtable_index); - } - } - return method_ordering; -} - -// Parse generic_signature attribute for methods and fields -u2 ClassFileParser::parse_generic_signature_attribute(TRAPS) { - ClassFileStream* cfs = stream(); - cfs->guarantee_more(2, CHECK_0); // generic_signature_index - u2 generic_signature_index = cfs->get_u2_fast(); - check_property( - valid_symbol_at(generic_signature_index), - "Invalid Signature attribute at constant pool index %u in class file %s", - generic_signature_index, CHECK_0); - return generic_signature_index; -} - -void ClassFileParser::parse_classfile_sourcefile_attribute(TRAPS) { - ClassFileStream* cfs = stream(); - cfs->guarantee_more(2, CHECK); // sourcefile_index - u2 sourcefile_index = cfs->get_u2_fast(); - check_property( - valid_symbol_at(sourcefile_index), - "Invalid SourceFile attribute at constant pool index %u in class file %s", - sourcefile_index, CHECK); - set_class_sourcefile_index(sourcefile_index); -} - - - -void ClassFileParser::parse_classfile_source_debug_extension_attribute(int length, TRAPS) { - ClassFileStream* cfs = stream(); - u1* sde_buffer = cfs->get_u1_buffer(); - assert(sde_buffer != NULL, "null sde buffer"); - - // Don't bother storing it if there is no way to retrieve it - if (JvmtiExport::can_get_source_debug_extension()) { - assert((length+1) > length, "Overflow checking"); - u1* sde = NEW_RESOURCE_ARRAY_IN_THREAD(THREAD, u1, length+1); - for (int i = 0; i < length; i++) { - sde[i] = sde_buffer[i]; - } - sde[length] = '\0'; - set_class_sde_buffer((char*)sde, length); - } - // Got utf8 string, set stream position forward - cfs->skip_u1(length, CHECK); -} - - -// Inner classes can be static, private or protected (classic VM does this) -#define RECOGNIZED_INNER_CLASS_MODIFIERS (JVM_RECOGNIZED_CLASS_MODIFIERS | JVM_ACC_PRIVATE | JVM_ACC_PROTECTED | JVM_ACC_STATIC) - -// Return number of classes in the inner classes attribute table -u2 ClassFileParser::parse_classfile_inner_classes_attribute(u1* inner_classes_attribute_start, - bool parsed_enclosingmethod_attribute, - u2 enclosing_method_class_index, - u2 enclosing_method_method_index, - TRAPS) { - ClassFileStream* cfs = stream(); - u1* current_mark = cfs->current(); - u2 length = 0; - if (inner_classes_attribute_start != NULL) { - cfs->set_current(inner_classes_attribute_start); - cfs->guarantee_more(2, CHECK_0); // length - length = cfs->get_u2_fast(); - } - - // 4-tuples of shorts of inner classes data and 2 shorts of enclosing - // method data: - // [inner_class_info_index, - // outer_class_info_index, - // inner_name_index, - // inner_class_access_flags, - // ... - // enclosing_method_class_index, - // enclosing_method_method_index] - int size = length * 4 + (parsed_enclosingmethod_attribute ? 2 : 0); - Array* inner_classes = MetadataFactory::new_array(_loader_data, size, CHECK_0); - _inner_classes = inner_classes; - - int index = 0; - int cp_size = _cp->length(); - cfs->guarantee_more(8 * length, CHECK_0); // 4-tuples of u2 - for (int n = 0; n < length; n++) { - // Inner class index - u2 inner_class_info_index = cfs->get_u2_fast(); - check_property( - inner_class_info_index == 0 || - valid_klass_reference_at(inner_class_info_index), - "inner_class_info_index %u has bad constant type in class file %s", - inner_class_info_index, CHECK_0); - // Outer class index - u2 outer_class_info_index = cfs->get_u2_fast(); - check_property( - outer_class_info_index == 0 || - valid_klass_reference_at(outer_class_info_index), - "outer_class_info_index %u has bad constant type in class file %s", - outer_class_info_index, CHECK_0); - // Inner class name - u2 inner_name_index = cfs->get_u2_fast(); - check_property( - inner_name_index == 0 || valid_symbol_at(inner_name_index), - "inner_name_index %u has bad constant type in class file %s", - inner_name_index, CHECK_0); - if (_need_verify) { - guarantee_property(inner_class_info_index != outer_class_info_index, - "Class is both outer and inner class in class file %s", CHECK_0); - } - // Access flags - AccessFlags inner_access_flags; - jint flags = cfs->get_u2_fast() & RECOGNIZED_INNER_CLASS_MODIFIERS; - if ((flags & JVM_ACC_INTERFACE) && _major_version < JAVA_6_VERSION) { - // Set abstract bit for old class files for backward compatibility - flags |= JVM_ACC_ABSTRACT; - } - verify_legal_class_modifiers(flags, CHECK_0); - inner_access_flags.set_flags(flags); - - inner_classes->at_put(index++, inner_class_info_index); - inner_classes->at_put(index++, outer_class_info_index); - inner_classes->at_put(index++, inner_name_index); - inner_classes->at_put(index++, inner_access_flags.as_short()); - } - - // 4347400: make sure there's no duplicate entry in the classes array - if (_need_verify && _major_version >= JAVA_1_5_VERSION) { - for(int i = 0; i < length * 4; i += 4) { - for(int j = i + 4; j < length * 4; j += 4) { - guarantee_property((inner_classes->at(i) != inner_classes->at(j) || - inner_classes->at(i+1) != inner_classes->at(j+1) || - inner_classes->at(i+2) != inner_classes->at(j+2) || - inner_classes->at(i+3) != inner_classes->at(j+3)), - "Duplicate entry in InnerClasses in class file %s", - CHECK_0); - } - } - } - - // Set EnclosingMethod class and method indexes. - if (parsed_enclosingmethod_attribute) { - inner_classes->at_put(index++, enclosing_method_class_index); - inner_classes->at_put(index++, enclosing_method_method_index); - } - assert(index == size, "wrong size"); - - // Restore buffer's current position. - cfs->set_current(current_mark); - - return length; -} - -void ClassFileParser::parse_classfile_synthetic_attribute(TRAPS) { - set_class_synthetic_flag(true); -} - -void ClassFileParser::parse_classfile_signature_attribute(TRAPS) { - ClassFileStream* cfs = stream(); - u2 signature_index = cfs->get_u2(CHECK); - check_property( - valid_symbol_at(signature_index), - "Invalid constant pool index %u in Signature attribute in class file %s", - signature_index, CHECK); - set_class_generic_signature_index(signature_index); -} - -void ClassFileParser::parse_classfile_bootstrap_methods_attribute(u4 attribute_byte_length, TRAPS) { - ClassFileStream* cfs = stream(); - u1* current_start = cfs->current(); - - guarantee_property(attribute_byte_length >= sizeof(u2), - "Invalid BootstrapMethods attribute length %u in class file %s", - attribute_byte_length, - CHECK); - - cfs->guarantee_more(attribute_byte_length, CHECK); - - int attribute_array_length = cfs->get_u2_fast(); - - guarantee_property(_max_bootstrap_specifier_index < attribute_array_length, - "Short length on BootstrapMethods in class file %s", - CHECK); - - - // The attribute contains a counted array of counted tuples of shorts, - // represending bootstrap specifiers: - // length*{bootstrap_method_index, argument_count*{argument_index}} - int operand_count = (attribute_byte_length - sizeof(u2)) / sizeof(u2); - // operand_count = number of shorts in attr, except for leading length - - // The attribute is copied into a short[] array. - // The array begins with a series of short[2] pairs, one for each tuple. - int index_size = (attribute_array_length * 2); - - Array* operands = MetadataFactory::new_array(_loader_data, index_size + operand_count, CHECK); - - // Eagerly assign operands so they will be deallocated with the constant - // pool if there is an error. - _cp->set_operands(operands); - - int operand_fill_index = index_size; - int cp_size = _cp->length(); - - for (int n = 0; n < attribute_array_length; n++) { - // Store a 32-bit offset into the header of the operand array. - ConstantPool::operand_offset_at_put(operands, n, operand_fill_index); - - // Read a bootstrap specifier. - cfs->guarantee_more(sizeof(u2) * 2, CHECK); // bsm, argc - u2 bootstrap_method_index = cfs->get_u2_fast(); - u2 argument_count = cfs->get_u2_fast(); - check_property( - valid_cp_range(bootstrap_method_index, cp_size) && - _cp->tag_at(bootstrap_method_index).is_method_handle(), - "bootstrap_method_index %u has bad constant type in class file %s", - bootstrap_method_index, - CHECK); - - guarantee_property((operand_fill_index + 1 + argument_count) < operands->length(), - "Invalid BootstrapMethods num_bootstrap_methods or num_bootstrap_arguments value in class file %s", - CHECK); - - operands->at_put(operand_fill_index++, bootstrap_method_index); - operands->at_put(operand_fill_index++, argument_count); - - cfs->guarantee_more(sizeof(u2) * argument_count, CHECK); // argv[argc] - for (int j = 0; j < argument_count; j++) { - u2 argument_index = cfs->get_u2_fast(); - check_property( - valid_cp_range(argument_index, cp_size) && - _cp->tag_at(argument_index).is_loadable_constant(), - "argument_index %u has bad constant type in class file %s", - argument_index, - CHECK); - operands->at_put(operand_fill_index++, argument_index); - } - } - - u1* current_end = cfs->current(); - guarantee_property(current_end == current_start + attribute_byte_length, - "Bad length on BootstrapMethods in class file %s", - CHECK); -} - -void ClassFileParser::parse_classfile_attributes(ClassFileParser::ClassAnnotationCollector* parsed_annotations, - TRAPS) { - ClassFileStream* cfs = stream(); - // Set inner classes attribute to default sentinel - _inner_classes = Universe::the_empty_short_array(); - cfs->guarantee_more(2, CHECK); // attributes_count - u2 attributes_count = cfs->get_u2_fast(); - bool parsed_sourcefile_attribute = false; - bool parsed_innerclasses_attribute = false; - bool parsed_enclosingmethod_attribute = false; - bool parsed_bootstrap_methods_attribute = false; - u1* runtime_visible_annotations = NULL; - int runtime_visible_annotations_length = 0; - u1* runtime_invisible_annotations = NULL; - int runtime_invisible_annotations_length = 0; - u1* runtime_visible_type_annotations = NULL; - int runtime_visible_type_annotations_length = 0; - u1* runtime_invisible_type_annotations = NULL; - int runtime_invisible_type_annotations_length = 0; - bool runtime_invisible_type_annotations_exists = false; - bool runtime_invisible_annotations_exists = false; - bool parsed_source_debug_ext_annotations_exist = false; - u1* inner_classes_attribute_start = NULL; - u4 inner_classes_attribute_length = 0; - u2 enclosing_method_class_index = 0; - u2 enclosing_method_method_index = 0; - // Iterate over attributes - while (attributes_count--) { - cfs->guarantee_more(6, CHECK); // attribute_name_index, attribute_length - u2 attribute_name_index = cfs->get_u2_fast(); - u4 attribute_length = cfs->get_u4_fast(); - check_property( - valid_symbol_at(attribute_name_index), - "Attribute name has bad constant pool index %u in class file %s", - attribute_name_index, CHECK); - Symbol* tag = _cp->symbol_at(attribute_name_index); - if (tag == vmSymbols::tag_source_file()) { - // Check for SourceFile tag - if (_need_verify) { - guarantee_property(attribute_length == 2, "Wrong SourceFile attribute length in class file %s", CHECK); - } - if (parsed_sourcefile_attribute) { - classfile_parse_error("Multiple SourceFile attributes in class file %s", CHECK); - } else { - parsed_sourcefile_attribute = true; - } - parse_classfile_sourcefile_attribute(CHECK); - } else if (tag == vmSymbols::tag_source_debug_extension()) { - // Check for SourceDebugExtension tag - if (parsed_source_debug_ext_annotations_exist) { - classfile_parse_error( - "Multiple SourceDebugExtension attributes in class file %s", CHECK); - } - parsed_source_debug_ext_annotations_exist = true; - parse_classfile_source_debug_extension_attribute((int)attribute_length, CHECK); - } else if (tag == vmSymbols::tag_inner_classes()) { - // Check for InnerClasses tag - if (parsed_innerclasses_attribute) { - classfile_parse_error("Multiple InnerClasses attributes in class file %s", CHECK); - } else { - parsed_innerclasses_attribute = true; - } - inner_classes_attribute_start = cfs->get_u1_buffer(); - inner_classes_attribute_length = attribute_length; - cfs->skip_u1(inner_classes_attribute_length, CHECK); - } else if (tag == vmSymbols::tag_synthetic()) { - // Check for Synthetic tag - // Shouldn't we check that the synthetic flags wasn't already set? - not required in spec - if (attribute_length != 0) { - classfile_parse_error( - "Invalid Synthetic classfile attribute length %u in class file %s", - attribute_length, CHECK); - } - parse_classfile_synthetic_attribute(CHECK); - } else if (tag == vmSymbols::tag_deprecated()) { - // Check for Deprecatd tag - 4276120 - if (attribute_length != 0) { - classfile_parse_error( - "Invalid Deprecated classfile attribute length %u in class file %s", - attribute_length, CHECK); - } - } else if (_major_version >= JAVA_1_5_VERSION) { - if (tag == vmSymbols::tag_signature()) { - if (attribute_length != 2) { - classfile_parse_error( - "Wrong Signature attribute length %u in class file %s", - attribute_length, CHECK); - } - parse_classfile_signature_attribute(CHECK); - } else if (tag == vmSymbols::tag_runtime_visible_annotations()) { - if (runtime_visible_annotations != NULL) { - classfile_parse_error( - "Multiple RuntimeVisibleAnnotations attributes in class file %s", CHECK); - } - runtime_visible_annotations_length = attribute_length; - runtime_visible_annotations = cfs->get_u1_buffer(); - assert(runtime_visible_annotations != NULL, "null visible annotations"); - parse_annotations(runtime_visible_annotations, - runtime_visible_annotations_length, - parsed_annotations, - CHECK); - cfs->skip_u1(runtime_visible_annotations_length, CHECK); - } else if (tag == vmSymbols::tag_runtime_invisible_annotations()) { - if (runtime_invisible_annotations_exists) { - classfile_parse_error( - "Multiple RuntimeInvisibleAnnotations attributes in class file %s", CHECK); - } - runtime_invisible_annotations_exists = true; - if (PreserveAllAnnotations) { - runtime_invisible_annotations_length = attribute_length; - runtime_invisible_annotations = cfs->get_u1_buffer(); - assert(runtime_invisible_annotations != NULL, "null invisible annotations"); - } - cfs->skip_u1(attribute_length, CHECK); - } else if (tag == vmSymbols::tag_enclosing_method()) { - if (parsed_enclosingmethod_attribute) { - classfile_parse_error("Multiple EnclosingMethod attributes in class file %s", CHECK); - } else { - parsed_enclosingmethod_attribute = true; - } - guarantee_property(attribute_length == 4, - "Wrong EnclosingMethod attribute length %u in class file %s", - attribute_length, CHECK); - cfs->guarantee_more(4, CHECK); // class_index, method_index - enclosing_method_class_index = cfs->get_u2_fast(); - enclosing_method_method_index = cfs->get_u2_fast(); - if (enclosing_method_class_index == 0) { - classfile_parse_error("Invalid class index in EnclosingMethod attribute in class file %s", CHECK); - } - // Validate the constant pool indices and types - check_property(valid_klass_reference_at(enclosing_method_class_index), - "Invalid or out-of-bounds class index in EnclosingMethod attribute in class file %s", CHECK); - if (enclosing_method_method_index != 0 && - (!_cp->is_within_bounds(enclosing_method_method_index) || - !_cp->tag_at(enclosing_method_method_index).is_name_and_type())) { - classfile_parse_error("Invalid or out-of-bounds method index in EnclosingMethod attribute in class file %s", CHECK); - } - } else if (tag == vmSymbols::tag_bootstrap_methods() && - _major_version >= Verifier::INVOKEDYNAMIC_MAJOR_VERSION) { - if (parsed_bootstrap_methods_attribute) - classfile_parse_error("Multiple BootstrapMethods attributes in class file %s", CHECK); - parsed_bootstrap_methods_attribute = true; - parse_classfile_bootstrap_methods_attribute(attribute_length, CHECK); - } else if (tag == vmSymbols::tag_runtime_visible_type_annotations()) { - if (runtime_visible_type_annotations != NULL) { - classfile_parse_error( - "Multiple RuntimeVisibleTypeAnnotations attributes in class file %s", CHECK); - } - runtime_visible_type_annotations_length = attribute_length; - runtime_visible_type_annotations = cfs->get_u1_buffer(); - assert(runtime_visible_type_annotations != NULL, "null visible type annotations"); - // No need for the VM to parse Type annotations - cfs->skip_u1(runtime_visible_type_annotations_length, CHECK); - } else if (tag == vmSymbols::tag_runtime_invisible_type_annotations()) { - if (runtime_invisible_type_annotations_exists) { - classfile_parse_error( - "Multiple RuntimeInvisibleTypeAnnotations attributes in class file %s", CHECK); - } else { - runtime_invisible_type_annotations_exists = true; - } - if (PreserveAllAnnotations) { - runtime_invisible_type_annotations_length = attribute_length; - runtime_invisible_type_annotations = cfs->get_u1_buffer(); - assert(runtime_invisible_type_annotations != NULL, "null invisible type annotations"); - } - cfs->skip_u1(attribute_length, CHECK); - } else { - // Unknown attribute - cfs->skip_u1(attribute_length, CHECK); - } - } else { - // Unknown attribute - cfs->skip_u1(attribute_length, CHECK); - } - } - _annotations = assemble_annotations(runtime_visible_annotations, - runtime_visible_annotations_length, - runtime_invisible_annotations, - runtime_invisible_annotations_length, - CHECK); - _type_annotations = assemble_annotations(runtime_visible_type_annotations, - runtime_visible_type_annotations_length, - runtime_invisible_type_annotations, - runtime_invisible_type_annotations_length, - CHECK); - - if (parsed_innerclasses_attribute || parsed_enclosingmethod_attribute) { - u2 num_of_classes = parse_classfile_inner_classes_attribute( - inner_classes_attribute_start, - parsed_innerclasses_attribute, - enclosing_method_class_index, - enclosing_method_method_index, - CHECK); - if (parsed_innerclasses_attribute &&_need_verify && _major_version >= JAVA_1_5_VERSION) { - guarantee_property( - inner_classes_attribute_length == sizeof(num_of_classes) + 4 * sizeof(u2) * num_of_classes, - "Wrong InnerClasses attribute length in class file %s", CHECK); - } - } - - if (_max_bootstrap_specifier_index >= 0) { - guarantee_property(parsed_bootstrap_methods_attribute, - "Missing BootstrapMethods attribute in class file %s", CHECK); - } -} - -void ClassFileParser::apply_parsed_class_attributes(instanceKlassHandle k) { - if (_synthetic_flag) - k->set_is_synthetic(); - if (_sourcefile_index != 0) { - k->set_source_file_name_index(_sourcefile_index); - } - if (_generic_signature_index != 0) { - k->set_generic_signature_index(_generic_signature_index); - } - if (_sde_buffer != NULL) { - k->set_source_debug_extension(_sde_buffer, _sde_length); - } -} - -// Transfer ownership of metadata allocated to the InstanceKlass. -void ClassFileParser::apply_parsed_class_metadata( - instanceKlassHandle this_klass, - int java_fields_count, TRAPS) { - // Assign annotations if needed - if (_annotations != NULL || _type_annotations != NULL || - _fields_annotations != NULL || _fields_type_annotations != NULL) { - Annotations* annotations = Annotations::allocate(_loader_data, CHECK); - annotations->set_class_annotations(_annotations); - annotations->set_class_type_annotations(_type_annotations); - annotations->set_fields_annotations(_fields_annotations); - annotations->set_fields_type_annotations(_fields_type_annotations); - this_klass->set_annotations(annotations); - } - - _cp->set_pool_holder(this_klass()); - this_klass->set_constants(_cp); - this_klass->set_fields(_fields, java_fields_count); - this_klass->set_methods(_methods); - this_klass->set_inner_classes(_inner_classes); - this_klass->set_local_interfaces(_local_interfaces); - this_klass->set_transitive_interfaces(_transitive_interfaces); - - // Clear out these fields so they don't get deallocated by the destructor - clear_class_metadata(); -} - -AnnotationArray* ClassFileParser::assemble_annotations(u1* runtime_visible_annotations, - int runtime_visible_annotations_length, - u1* runtime_invisible_annotations, - int runtime_invisible_annotations_length, TRAPS) { - AnnotationArray* annotations = NULL; - if (runtime_visible_annotations != NULL || - runtime_invisible_annotations != NULL) { - annotations = MetadataFactory::new_array(_loader_data, - runtime_visible_annotations_length + - runtime_invisible_annotations_length, - CHECK_(annotations)); - if (runtime_visible_annotations != NULL) { - for (int i = 0; i < runtime_visible_annotations_length; i++) { - annotations->at_put(i, runtime_visible_annotations[i]); - } - } - if (runtime_invisible_annotations != NULL) { - for (int i = 0; i < runtime_invisible_annotations_length; i++) { - int append = runtime_visible_annotations_length+i; - annotations->at_put(append, runtime_invisible_annotations[i]); - } - } - } - return annotations; -} - -instanceKlassHandle ClassFileParser::parse_super_class(int super_class_index, - TRAPS) { - instanceKlassHandle super_klass; - if (super_class_index == 0) { - check_property(_class_name == vmSymbols::java_lang_Object(), - "Invalid superclass index %u in class file %s", - super_class_index, - CHECK_NULL); - } else { - check_property(valid_klass_reference_at(super_class_index), - "Invalid superclass index %u in class file %s", - super_class_index, - CHECK_NULL); - // The class name should be legal because it is checked when parsing constant pool. - // However, make sure it is not an array type. - bool is_array = false; - if (_cp->tag_at(super_class_index).is_klass()) { - super_klass = instanceKlassHandle(THREAD, _cp->resolved_klass_at(super_class_index)); - if (_need_verify) - is_array = super_klass->oop_is_array(); - } else if (_need_verify) { - is_array = (_cp->klass_name_at(super_class_index)->byte_at(0) == JVM_SIGNATURE_ARRAY); - } - if (_need_verify) { - guarantee_property(!is_array, - "Bad superclass name in class file %s", CHECK_NULL); - } - } - return super_klass; -} - - -// Values needed for oopmap and InstanceKlass creation -class FieldLayoutInfo : public StackObj { - public: - int* nonstatic_oop_offsets; - unsigned int* nonstatic_oop_counts; - unsigned int nonstatic_oop_map_count; - unsigned int total_oop_map_count; - int instance_size; - int nonstatic_field_size; - int static_field_size; - bool has_nonstatic_fields; -}; - -// Layout fields and fill in FieldLayoutInfo. Could use more refactoring! -void ClassFileParser::layout_fields(Handle class_loader, - FieldAllocationCount* fac, - ClassAnnotationCollector* parsed_annotations, - FieldLayoutInfo* info, - TRAPS) { - - // Field size and offset computation - int nonstatic_field_size = _super_klass() == NULL ? 0 : _super_klass()->nonstatic_field_size(); - int next_static_oop_offset; - int next_static_double_offset; - int next_static_word_offset; - int next_static_short_offset; - int next_static_byte_offset; - int next_nonstatic_oop_offset; - int next_nonstatic_double_offset; - int next_nonstatic_word_offset; - int next_nonstatic_short_offset; - int next_nonstatic_byte_offset; - int first_nonstatic_oop_offset; - int next_nonstatic_field_offset; - int next_nonstatic_padded_offset; - - // Count the contended fields by type. - // - // We ignore static fields, because @Contended is not supported for them. - // The layout code below will also ignore the static fields. - int nonstatic_contended_count = 0; - FieldAllocationCount fac_contended; - for (AllFieldStream fs(_fields, _cp); !fs.done(); fs.next()) { - FieldAllocationType atype = (FieldAllocationType) fs.allocation_type(); - if (fs.is_contended()) { - fac_contended.count[atype]++; - if (!fs.access_flags().is_static()) { - nonstatic_contended_count++; - } - } - } - - - // Calculate the starting byte offsets - next_static_oop_offset = InstanceMirrorKlass::offset_of_static_fields(); - next_static_double_offset = next_static_oop_offset + - ((fac->count[STATIC_OOP]) * heapOopSize); - if ( fac->count[STATIC_DOUBLE] && - (Universe::field_type_should_be_aligned(T_DOUBLE) || - Universe::field_type_should_be_aligned(T_LONG)) ) { - next_static_double_offset = align_size_up(next_static_double_offset, BytesPerLong); - } - - next_static_word_offset = next_static_double_offset + - ((fac->count[STATIC_DOUBLE]) * BytesPerLong); - next_static_short_offset = next_static_word_offset + - ((fac->count[STATIC_WORD]) * BytesPerInt); - next_static_byte_offset = next_static_short_offset + - ((fac->count[STATIC_SHORT]) * BytesPerShort); - - int nonstatic_fields_start = instanceOopDesc::base_offset_in_bytes() + - nonstatic_field_size * heapOopSize; - - next_nonstatic_field_offset = nonstatic_fields_start; - - bool is_contended_class = parsed_annotations->is_contended(); - - // Class is contended, pad before all the fields - if (is_contended_class) { - next_nonstatic_field_offset += ContendedPaddingWidth; - } - - // Compute the non-contended fields count. - // The packing code below relies on these counts to determine if some field - // can be squeezed into the alignment gap. Contended fields are obviously - // exempt from that. - unsigned int nonstatic_double_count = fac->count[NONSTATIC_DOUBLE] - fac_contended.count[NONSTATIC_DOUBLE]; - unsigned int nonstatic_word_count = fac->count[NONSTATIC_WORD] - fac_contended.count[NONSTATIC_WORD]; - unsigned int nonstatic_short_count = fac->count[NONSTATIC_SHORT] - fac_contended.count[NONSTATIC_SHORT]; - unsigned int nonstatic_byte_count = fac->count[NONSTATIC_BYTE] - fac_contended.count[NONSTATIC_BYTE]; - unsigned int nonstatic_oop_count = fac->count[NONSTATIC_OOP] - fac_contended.count[NONSTATIC_OOP]; - - // Total non-static fields count, including every contended field - unsigned int nonstatic_fields_count = fac->count[NONSTATIC_DOUBLE] + fac->count[NONSTATIC_WORD] + - fac->count[NONSTATIC_SHORT] + fac->count[NONSTATIC_BYTE] + - fac->count[NONSTATIC_OOP]; - - bool super_has_nonstatic_fields = - (_super_klass() != NULL && _super_klass->has_nonstatic_fields()); - bool has_nonstatic_fields = super_has_nonstatic_fields || (nonstatic_fields_count != 0); - - - // Prepare list of oops for oop map generation. - // - // "offset" and "count" lists are describing the set of contiguous oop - // regions. offset[i] is the start of the i-th region, which then has - // count[i] oops following. Before we know how many regions are required, - // we pessimistically allocate the maps to fit all the oops into the - // distinct regions. - // - // TODO: We add +1 to always allocate non-zero resource arrays; we need - // to figure out if we still need to do this. - int* nonstatic_oop_offsets; - unsigned int* nonstatic_oop_counts; - unsigned int nonstatic_oop_map_count = 0; - unsigned int max_nonstatic_oop_maps = fac->count[NONSTATIC_OOP] + 1; - - nonstatic_oop_offsets = NEW_RESOURCE_ARRAY_IN_THREAD( - THREAD, int, max_nonstatic_oop_maps); - nonstatic_oop_counts = NEW_RESOURCE_ARRAY_IN_THREAD( - THREAD, unsigned int, max_nonstatic_oop_maps); - - first_nonstatic_oop_offset = 0; // will be set for first oop field - - bool compact_fields = CompactFields; - int allocation_style = FieldsAllocationStyle; - if( allocation_style < 0 || allocation_style > 2 ) { // Out of range? - assert(false, "0 <= FieldsAllocationStyle <= 2"); - allocation_style = 1; // Optimistic - } - - // The next classes have predefined hard-coded fields offsets - // (see in JavaClasses::compute_hard_coded_offsets()). - // Use default fields allocation order for them. - if( (allocation_style != 0 || compact_fields ) && class_loader.is_null() && - (_class_name == vmSymbols::java_lang_AssertionStatusDirectives() || - _class_name == vmSymbols::java_lang_Class() || - _class_name == vmSymbols::java_lang_ClassLoader() || - _class_name == vmSymbols::java_lang_ref_Reference() || - _class_name == vmSymbols::java_lang_ref_SoftReference() || - _class_name == vmSymbols::java_lang_StackTraceElement() || - _class_name == vmSymbols::java_lang_String() || - _class_name == vmSymbols::java_lang_Throwable() || - _class_name == vmSymbols::java_lang_Boolean() || - _class_name == vmSymbols::java_lang_Character() || - _class_name == vmSymbols::java_lang_Float() || - _class_name == vmSymbols::java_lang_Double() || - _class_name == vmSymbols::java_lang_Byte() || - _class_name == vmSymbols::java_lang_Short() || - _class_name == vmSymbols::java_lang_Integer() || - _class_name == vmSymbols::java_lang_Long())) { - allocation_style = 0; // Allocate oops first - compact_fields = false; // Don't compact fields - } - - // Rearrange fields for a given allocation style - if( allocation_style == 0 ) { - // Fields order: oops, longs/doubles, ints, shorts/chars, bytes, padded fields - next_nonstatic_oop_offset = next_nonstatic_field_offset; - next_nonstatic_double_offset = next_nonstatic_oop_offset + - (nonstatic_oop_count * heapOopSize); - } else if( allocation_style == 1 ) { - // Fields order: longs/doubles, ints, shorts/chars, bytes, oops, padded fields - next_nonstatic_double_offset = next_nonstatic_field_offset; - } else if( allocation_style == 2 ) { - // Fields allocation: oops fields in super and sub classes are together. - if( nonstatic_field_size > 0 && _super_klass() != NULL && - _super_klass->nonstatic_oop_map_size() > 0 ) { - unsigned int map_count = _super_klass->nonstatic_oop_map_count(); - OopMapBlock* first_map = _super_klass->start_of_nonstatic_oop_maps(); - OopMapBlock* last_map = first_map + map_count - 1; - int next_offset = last_map->offset() + (last_map->count() * heapOopSize); - if (next_offset == next_nonstatic_field_offset) { - allocation_style = 0; // allocate oops first - next_nonstatic_oop_offset = next_nonstatic_field_offset; - next_nonstatic_double_offset = next_nonstatic_oop_offset + - (nonstatic_oop_count * heapOopSize); - } - } - if( allocation_style == 2 ) { - allocation_style = 1; // allocate oops last - next_nonstatic_double_offset = next_nonstatic_field_offset; - } - } else { - ShouldNotReachHere(); - } - - int nonstatic_oop_space_count = 0; - int nonstatic_word_space_count = 0; - int nonstatic_short_space_count = 0; - int nonstatic_byte_space_count = 0; - int nonstatic_oop_space_offset; - int nonstatic_word_space_offset; - int nonstatic_short_space_offset; - int nonstatic_byte_space_offset; - - // Try to squeeze some of the fields into the gaps due to - // long/double alignment. - if( nonstatic_double_count > 0 ) { - int offset = next_nonstatic_double_offset; - next_nonstatic_double_offset = align_size_up(offset, BytesPerLong); - if( compact_fields && offset != next_nonstatic_double_offset ) { - // Allocate available fields into the gap before double field. - int length = next_nonstatic_double_offset - offset; - assert(length == BytesPerInt, ""); - nonstatic_word_space_offset = offset; - if( nonstatic_word_count > 0 ) { - nonstatic_word_count -= 1; - nonstatic_word_space_count = 1; // Only one will fit - length -= BytesPerInt; - offset += BytesPerInt; - } - nonstatic_short_space_offset = offset; - while( length >= BytesPerShort && nonstatic_short_count > 0 ) { - nonstatic_short_count -= 1; - nonstatic_short_space_count += 1; - length -= BytesPerShort; - offset += BytesPerShort; - } - nonstatic_byte_space_offset = offset; - while( length > 0 && nonstatic_byte_count > 0 ) { - nonstatic_byte_count -= 1; - nonstatic_byte_space_count += 1; - length -= 1; - } - // Allocate oop field in the gap if there are no other fields for that. - nonstatic_oop_space_offset = offset; - if( length >= heapOopSize && nonstatic_oop_count > 0 && - allocation_style != 0 ) { // when oop fields not first - nonstatic_oop_count -= 1; - nonstatic_oop_space_count = 1; // Only one will fit - length -= heapOopSize; - offset += heapOopSize; - } - } - } - - next_nonstatic_word_offset = next_nonstatic_double_offset + - (nonstatic_double_count * BytesPerLong); - next_nonstatic_short_offset = next_nonstatic_word_offset + - (nonstatic_word_count * BytesPerInt); - next_nonstatic_byte_offset = next_nonstatic_short_offset + - (nonstatic_short_count * BytesPerShort); - next_nonstatic_padded_offset = next_nonstatic_byte_offset + - nonstatic_byte_count; - - // let oops jump before padding with this allocation style - if( allocation_style == 1 ) { - next_nonstatic_oop_offset = next_nonstatic_padded_offset; - if( nonstatic_oop_count > 0 ) { - next_nonstatic_oop_offset = align_size_up(next_nonstatic_oop_offset, heapOopSize); - } - next_nonstatic_padded_offset = next_nonstatic_oop_offset + (nonstatic_oop_count * heapOopSize); - } - - // Iterate over fields again and compute correct offsets. - // The field allocation type was temporarily stored in the offset slot. - // oop fields are located before non-oop fields (static and non-static). - for (AllFieldStream fs(_fields, _cp); !fs.done(); fs.next()) { - - // skip already laid out fields - if (fs.is_offset_set()) continue; - - // contended instance fields are handled below - if (fs.is_contended() && !fs.access_flags().is_static()) continue; - - int real_offset; - FieldAllocationType atype = (FieldAllocationType) fs.allocation_type(); - - // pack the rest of the fields - switch (atype) { - case STATIC_OOP: - real_offset = next_static_oop_offset; - next_static_oop_offset += heapOopSize; - break; - case STATIC_BYTE: - real_offset = next_static_byte_offset; - next_static_byte_offset += 1; - break; - case STATIC_SHORT: - real_offset = next_static_short_offset; - next_static_short_offset += BytesPerShort; - break; - case STATIC_WORD: - real_offset = next_static_word_offset; - next_static_word_offset += BytesPerInt; - break; - case STATIC_DOUBLE: - real_offset = next_static_double_offset; - next_static_double_offset += BytesPerLong; - break; - case NONSTATIC_OOP: - if( nonstatic_oop_space_count > 0 ) { - real_offset = nonstatic_oop_space_offset; - nonstatic_oop_space_offset += heapOopSize; - nonstatic_oop_space_count -= 1; - } else { - real_offset = next_nonstatic_oop_offset; - next_nonstatic_oop_offset += heapOopSize; - } - // Update oop maps - if( nonstatic_oop_map_count > 0 && - nonstatic_oop_offsets[nonstatic_oop_map_count - 1] == - real_offset - - int(nonstatic_oop_counts[nonstatic_oop_map_count - 1]) * - heapOopSize ) { - // Extend current oop map - assert(nonstatic_oop_map_count - 1 < max_nonstatic_oop_maps, "range check"); - nonstatic_oop_counts[nonstatic_oop_map_count - 1] += 1; - } else { - // Create new oop map - assert(nonstatic_oop_map_count < max_nonstatic_oop_maps, "range check"); - nonstatic_oop_offsets[nonstatic_oop_map_count] = real_offset; - nonstatic_oop_counts [nonstatic_oop_map_count] = 1; - nonstatic_oop_map_count += 1; - if( first_nonstatic_oop_offset == 0 ) { // Undefined - first_nonstatic_oop_offset = real_offset; - } - } - break; - case NONSTATIC_BYTE: - if( nonstatic_byte_space_count > 0 ) { - real_offset = nonstatic_byte_space_offset; - nonstatic_byte_space_offset += 1; - nonstatic_byte_space_count -= 1; - } else { - real_offset = next_nonstatic_byte_offset; - next_nonstatic_byte_offset += 1; - } - break; - case NONSTATIC_SHORT: - if( nonstatic_short_space_count > 0 ) { - real_offset = nonstatic_short_space_offset; - nonstatic_short_space_offset += BytesPerShort; - nonstatic_short_space_count -= 1; - } else { - real_offset = next_nonstatic_short_offset; - next_nonstatic_short_offset += BytesPerShort; - } - break; - case NONSTATIC_WORD: - if( nonstatic_word_space_count > 0 ) { - real_offset = nonstatic_word_space_offset; - nonstatic_word_space_offset += BytesPerInt; - nonstatic_word_space_count -= 1; - } else { - real_offset = next_nonstatic_word_offset; - next_nonstatic_word_offset += BytesPerInt; - } - break; - case NONSTATIC_DOUBLE: - real_offset = next_nonstatic_double_offset; - next_nonstatic_double_offset += BytesPerLong; - break; - default: - ShouldNotReachHere(); - } - fs.set_offset(real_offset); - } - - - // Handle the contended cases. - // - // Each contended field should not intersect the cache line with another contended field. - // In the absence of alignment information, we end up with pessimistically separating - // the fields with full-width padding. - // - // Additionally, this should not break alignment for the fields, so we round the alignment up - // for each field. - if (nonstatic_contended_count > 0) { - - // if there is at least one contended field, we need to have pre-padding for them - next_nonstatic_padded_offset += ContendedPaddingWidth; - - // collect all contended groups - BitMap bm(_cp->size()); - for (AllFieldStream fs(_fields, _cp); !fs.done(); fs.next()) { - // skip already laid out fields - if (fs.is_offset_set()) continue; - - if (fs.is_contended()) { - bm.set_bit(fs.contended_group()); - } - } - - int current_group = -1; - while ((current_group = (int)bm.get_next_one_offset(current_group + 1)) != (int)bm.size()) { - - for (AllFieldStream fs(_fields, _cp); !fs.done(); fs.next()) { - - // skip already laid out fields - if (fs.is_offset_set()) continue; - - // skip non-contended fields and fields from different group - if (!fs.is_contended() || (fs.contended_group() != current_group)) continue; - - // handle statics below - if (fs.access_flags().is_static()) continue; - - int real_offset; - FieldAllocationType atype = (FieldAllocationType) fs.allocation_type(); - - switch (atype) { - case NONSTATIC_BYTE: - next_nonstatic_padded_offset = align_size_up(next_nonstatic_padded_offset, 1); - real_offset = next_nonstatic_padded_offset; - next_nonstatic_padded_offset += 1; - break; - - case NONSTATIC_SHORT: - next_nonstatic_padded_offset = align_size_up(next_nonstatic_padded_offset, BytesPerShort); - real_offset = next_nonstatic_padded_offset; - next_nonstatic_padded_offset += BytesPerShort; - break; - - case NONSTATIC_WORD: - next_nonstatic_padded_offset = align_size_up(next_nonstatic_padded_offset, BytesPerInt); - real_offset = next_nonstatic_padded_offset; - next_nonstatic_padded_offset += BytesPerInt; - break; - - case NONSTATIC_DOUBLE: - next_nonstatic_padded_offset = align_size_up(next_nonstatic_padded_offset, BytesPerLong); - real_offset = next_nonstatic_padded_offset; - next_nonstatic_padded_offset += BytesPerLong; - break; - - case NONSTATIC_OOP: - next_nonstatic_padded_offset = align_size_up(next_nonstatic_padded_offset, heapOopSize); - real_offset = next_nonstatic_padded_offset; - next_nonstatic_padded_offset += heapOopSize; - - // Create new oop map - assert(nonstatic_oop_map_count < max_nonstatic_oop_maps, "range check"); - nonstatic_oop_offsets[nonstatic_oop_map_count] = real_offset; - nonstatic_oop_counts [nonstatic_oop_map_count] = 1; - nonstatic_oop_map_count += 1; - if( first_nonstatic_oop_offset == 0 ) { // Undefined - first_nonstatic_oop_offset = real_offset; - } - break; - - default: - ShouldNotReachHere(); - } - - if (fs.contended_group() == 0) { - // Contended group defines the equivalence class over the fields: - // the fields within the same contended group are not inter-padded. - // The only exception is default group, which does not incur the - // equivalence, and so requires intra-padding. - next_nonstatic_padded_offset += ContendedPaddingWidth; - } - - fs.set_offset(real_offset); - } // for - - // Start laying out the next group. - // Note that this will effectively pad the last group in the back; - // this is expected to alleviate memory contention effects for - // subclass fields and/or adjacent object. - // If this was the default group, the padding is already in place. - if (current_group != 0) { - next_nonstatic_padded_offset += ContendedPaddingWidth; - } - } - - // handle static fields - } - - // Entire class is contended, pad in the back. - // This helps to alleviate memory contention effects for subclass fields - // and/or adjacent object. - if (is_contended_class) { - next_nonstatic_padded_offset += ContendedPaddingWidth; - } - - int notaligned_nonstatic_fields_end = next_nonstatic_padded_offset; - - int nonstatic_fields_end = align_size_up(notaligned_nonstatic_fields_end, heapOopSize); - int instance_end = align_size_up(notaligned_nonstatic_fields_end, wordSize); - int static_fields_end = align_size_up(next_static_byte_offset, wordSize); - - int static_field_size = (static_fields_end - - InstanceMirrorKlass::offset_of_static_fields()) / wordSize; - nonstatic_field_size = nonstatic_field_size + - (nonstatic_fields_end - nonstatic_fields_start) / heapOopSize; - - int instance_size = align_object_size(instance_end / wordSize); - - assert(instance_size == align_object_size(align_size_up( - (instanceOopDesc::base_offset_in_bytes() + nonstatic_field_size*heapOopSize), - wordSize) / wordSize), "consistent layout helper value"); - - // Invariant: nonstatic_field end/start should only change if there are - // nonstatic fields in the class, or if the class is contended. We compare - // against the non-aligned value, so that end alignment will not fail the - // assert without actually having the fields. - assert((notaligned_nonstatic_fields_end == nonstatic_fields_start) || - is_contended_class || - (nonstatic_fields_count > 0), "double-check nonstatic start/end"); - - // Number of non-static oop map blocks allocated at end of klass. - const unsigned int total_oop_map_count = - compute_oop_map_count(_super_klass, nonstatic_oop_map_count, - first_nonstatic_oop_offset); - -#ifndef PRODUCT - if (PrintFieldLayout) { - print_field_layout(_class_name, - _fields, - _cp, - instance_size, - nonstatic_fields_start, - nonstatic_fields_end, - static_fields_end); - } - -#endif - // Pass back information needed for InstanceKlass creation - info->nonstatic_oop_offsets = nonstatic_oop_offsets; - info->nonstatic_oop_counts = nonstatic_oop_counts; - info->nonstatic_oop_map_count = nonstatic_oop_map_count; - info->total_oop_map_count = total_oop_map_count; - info->instance_size = instance_size; - info->static_field_size = static_field_size; - info->nonstatic_field_size = nonstatic_field_size; - info->has_nonstatic_fields = has_nonstatic_fields; -} - - -instanceKlassHandle ClassFileParser::parseClassFile(Symbol* name, - ClassLoaderData* loader_data, - Handle protection_domain, - KlassHandle host_klass, - GrowableArray* cp_patches, - TempNewSymbol& parsed_name, - bool verify, - TRAPS) { - - // When a retransformable agent is attached, JVMTI caches the - // class bytes that existed before the first retransformation. - // If RedefineClasses() was used before the retransformable - // agent attached, then the cached class bytes may not be the - // original class bytes. - JvmtiCachedClassFileData *cached_class_file = NULL; - Handle class_loader(THREAD, loader_data->class_loader()); - bool has_default_methods = false; - ResourceMark rm(THREAD); - - ClassFileStream* cfs = stream(); - // Timing - assert(THREAD->is_Java_thread(), "must be a JavaThread"); - JavaThread* jt = (JavaThread*) THREAD; - - PerfClassTraceTime ctimer(ClassLoader::perf_class_parse_time(), - ClassLoader::perf_class_parse_selftime(), - NULL, - jt->get_thread_stat()->perf_recursion_counts_addr(), - jt->get_thread_stat()->perf_timers_addr(), - PerfClassTraceTime::PARSE_CLASS); - - init_parsed_class_attributes(loader_data); - - if (JvmtiExport::should_post_class_file_load_hook()) { - // Get the cached class file bytes (if any) from the class that - // is being redefined or retransformed. We use jvmti_thread_state() - // instead of JvmtiThreadState::state_for(jt) so we don't allocate - // a JvmtiThreadState any earlier than necessary. This will help - // avoid the bug described by 7126851. - JvmtiThreadState *state = jt->jvmti_thread_state(); - if (state != NULL) { - KlassHandle *h_class_being_redefined = - state->get_class_being_redefined(); - if (h_class_being_redefined != NULL) { - instanceKlassHandle ikh_class_being_redefined = - instanceKlassHandle(THREAD, (*h_class_being_redefined)()); - cached_class_file = ikh_class_being_redefined->get_cached_class_file(); - } - } - - unsigned char* ptr = cfs->buffer(); - unsigned char* end_ptr = cfs->buffer() + cfs->length(); - - JvmtiExport::post_class_file_load_hook(name, class_loader(), protection_domain, - &ptr, &end_ptr, &cached_class_file); - - if (ptr != cfs->buffer()) { - // JVMTI agent has modified class file data. - // Set new class file stream using JVMTI agent modified - // class file data. - cfs = new ClassFileStream(ptr, end_ptr - ptr, cfs->source()); - set_stream(cfs); - } - } - - _host_klass = host_klass; - _cp_patches = cp_patches; - - instanceKlassHandle nullHandle; - - // Figure out whether we can skip format checking (matching classic VM behavior) - if (DumpSharedSpaces) { - // verify == true means it's a 'remote' class (i.e., non-boot class) - // Verification decision is based on BytecodeVerificationRemote flag - // for those classes. - _need_verify = (verify) ? BytecodeVerificationRemote : - BytecodeVerificationLocal; - } else { - _need_verify = Verifier::should_verify_for(class_loader(), verify); - } - - // Set the verify flag in stream - cfs->set_verify(_need_verify); - - // Save the class file name for easier error message printing. - _class_name = (name != NULL) ? name : vmSymbols::unknown_class_name(); - - cfs->guarantee_more(8, CHECK_(nullHandle)); // magic, major, minor - // Magic value - u4 magic = cfs->get_u4_fast(); - guarantee_property(magic == JAVA_CLASSFILE_MAGIC, - "Incompatible magic value %u in class file %s", - magic, CHECK_(nullHandle)); - - // Version numbers - u2 minor_version = cfs->get_u2_fast(); - u2 major_version = cfs->get_u2_fast(); - - if (DumpSharedSpaces && major_version < JAVA_1_5_VERSION) { - ResourceMark rm; - warning("Pre JDK 1.5 class not supported by CDS: %u.%u %s", - major_version, minor_version, name->as_C_string()); - Exceptions::fthrow( - THREAD_AND_LOCATION, - vmSymbols::java_lang_UnsupportedClassVersionError(), - "Unsupported major.minor version for dump time %u.%u", - major_version, - minor_version); - } - - // Check version numbers - we check this even with verifier off - if (!is_supported_version(major_version, minor_version)) { - if (name == NULL) { - Exceptions::fthrow( - THREAD_AND_LOCATION, - vmSymbols::java_lang_UnsupportedClassVersionError(), - "Unsupported class file version %u.%u, " - "this version of the Java Runtime only recognizes class file versions up to %u.%u", - major_version, - minor_version, - JAVA_MAX_SUPPORTED_VERSION, - JAVA_MAX_SUPPORTED_MINOR_VERSION); - } else { - ResourceMark rm(THREAD); - Exceptions::fthrow( - THREAD_AND_LOCATION, - vmSymbols::java_lang_UnsupportedClassVersionError(), - "%s has been compiled by a more recent version of the Java Runtime (class file version %u.%u), " - "this version of the Java Runtime only recognizes class file versions up to %u.%u", - name->as_C_string(), - major_version, - minor_version, - JAVA_MAX_SUPPORTED_VERSION, - JAVA_MAX_SUPPORTED_MINOR_VERSION); - } - return nullHandle; - } - - _major_version = major_version; - _minor_version = minor_version; - - - // Check if verification needs to be relaxed for this class file - // Do not restrict it to jdk1.0 or jdk1.1 to maintain backward compatibility (4982376) - _relax_verify = Verifier::relax_verify_for(class_loader()); - - // Constant pool - constantPoolHandle cp = parse_constant_pool(CHECK_(nullHandle)); - - int cp_size = cp->length(); - - cfs->guarantee_more(8, CHECK_(nullHandle)); // flags, this_class, super_class, infs_len - - // Access flags - AccessFlags access_flags; - jint flags = cfs->get_u2_fast() & JVM_RECOGNIZED_CLASS_MODIFIERS; - - if ((flags & JVM_ACC_INTERFACE) && _major_version < JAVA_6_VERSION) { - // Set abstract bit for old class files for backward compatibility - flags |= JVM_ACC_ABSTRACT; - } - verify_legal_class_modifiers(flags, CHECK_(nullHandle)); - access_flags.set_flags(flags); - - // This class and superclass - u2 this_class_index = cfs->get_u2_fast(); - check_property( - valid_cp_range(this_class_index, cp_size) && - cp->tag_at(this_class_index).is_unresolved_klass(), - "Invalid this class index %u in constant pool in class file %s", - this_class_index, CHECK_(nullHandle)); - - Symbol* class_name = cp->klass_name_at(this_class_index); - assert(class_name != NULL, "class_name can't be null"); - - // It's important to set parsed_name *before* resolving the super class. - // (it's used for cleanup by the caller if parsing fails) - parsed_name = class_name; - // parsed_name is returned and can be used if there's an error, so add to - // its reference count. Caller will decrement the refcount. - parsed_name->increment_refcount(); - - // Update _class_name which could be null previously to be class_name - _class_name = class_name; - - // Don't need to check whether this class name is legal or not. - // It has been checked when constant pool is parsed. - // However, make sure it is not an array type. - if (_need_verify) { - guarantee_property(class_name->byte_at(0) != JVM_SIGNATURE_ARRAY, - "Bad class name in class file %s", - CHECK_(nullHandle)); - } - - Klass* preserve_this_klass; // for storing result across HandleMark - - // release all handles when parsing is done - { HandleMark hm(THREAD); - - // Checks if name in class file matches requested name - if (name != NULL && class_name != name) { - ResourceMark rm(THREAD); - Exceptions::fthrow( - THREAD_AND_LOCATION, - vmSymbols::java_lang_NoClassDefFoundError(), - "%s (wrong name: %s)", - name->as_C_string(), - class_name->as_C_string() - ); - return nullHandle; - } - - if (TraceClassLoadingPreorder) { - tty->print("[Loading %s", (name != NULL) ? name->as_klass_external_name() : "NoName"); - if (cfs->source() != NULL) tty->print(" from %s", cfs->source()); - tty->print_cr("]"); - } -#if INCLUDE_CDS - if (DumpLoadedClassList != NULL && cfs->source() != NULL && classlist_file->is_open()) { - // Only dump the classes that can be stored into CDS archive - if (SystemDictionaryShared::is_sharing_possible(loader_data)) { - if (name != NULL) { - ResourceMark rm(THREAD); - classlist_file->print_cr("%s", name->as_C_string()); - classlist_file->flush(); - } - } - } -#endif - - u2 super_class_index = cfs->get_u2_fast(); - instanceKlassHandle super_klass = parse_super_class(super_class_index, - CHECK_NULL); - - // Interfaces - u2 itfs_len = cfs->get_u2_fast(); - Array* local_interfaces = - parse_interfaces(itfs_len, protection_domain, _class_name, - &has_default_methods, CHECK_(nullHandle)); - - u2 java_fields_count = 0; - // Fields (offsets are filled in later) - FieldAllocationCount fac; - Array* fields = parse_fields(class_name, - access_flags.is_interface(), - &fac, &java_fields_count, - CHECK_(nullHandle)); - // Methods - bool has_final_method = false; - AccessFlags promoted_flags; - promoted_flags.set_flags(0); - Array* methods = parse_methods(access_flags.is_interface(), - &promoted_flags, - &has_final_method, - &has_default_methods, - CHECK_(nullHandle)); - - // Additional attributes - ClassAnnotationCollector parsed_annotations; - parse_classfile_attributes(&parsed_annotations, CHECK_(nullHandle)); - - // Make sure this is the end of class file stream - guarantee_property(cfs->at_eos(), "Extra bytes at the end of class file %s", CHECK_(nullHandle)); - - // We check super class after class file is parsed and format is checked - if (super_class_index > 0 && super_klass.is_null()) { - Symbol* sk = cp->klass_name_at(super_class_index); - if (access_flags.is_interface()) { - // Before attempting to resolve the superclass, check for class format - // errors not checked yet. - guarantee_property(sk == vmSymbols::java_lang_Object(), - "Interfaces must have java.lang.Object as superclass in class file %s", - CHECK_(nullHandle)); - } - Klass* k = SystemDictionary::resolve_super_or_fail(class_name, sk, - class_loader, - protection_domain, - true, - CHECK_(nullHandle)); - - KlassHandle kh (THREAD, k); - super_klass = instanceKlassHandle(THREAD, kh()); - } - if (super_klass.not_null()) { - - if (super_klass->has_default_methods()) { - has_default_methods = true; - } - - if (super_klass->is_interface()) { - ResourceMark rm(THREAD); - Exceptions::fthrow( - THREAD_AND_LOCATION, - vmSymbols::java_lang_IncompatibleClassChangeError(), - "class %s has interface %s as super class", - class_name->as_klass_external_name(), - super_klass->external_name() - ); - return nullHandle; - } - // Make sure super class is not final - if (super_klass->is_final()) { - THROW_MSG_(vmSymbols::java_lang_VerifyError(), "Cannot inherit from final class", nullHandle); - } - } - - // save super klass for error handling. - _super_klass = super_klass; - - // Compute the transitive list of all unique interfaces implemented by this class - _transitive_interfaces = - compute_transitive_interfaces(super_klass, local_interfaces, CHECK_(nullHandle)); - - // sort methods - intArray* method_ordering = sort_methods(methods); - - // promote flags from parse_methods() to the klass' flags - access_flags.add_promoted_flags(promoted_flags.as_int()); - - // Size of Java vtable (in words) - int vtable_size = 0; - int itable_size = 0; - int num_miranda_methods = 0; - - GrowableArray all_mirandas(20); - - klassVtable::compute_vtable_size_and_num_mirandas( - &vtable_size, &num_miranda_methods, &all_mirandas, super_klass(), methods, - access_flags, class_loader, class_name, local_interfaces, - CHECK_(nullHandle)); - - // Size of Java itable (in words) - itable_size = access_flags.is_interface() ? 0 : klassItable::compute_itable_size(_transitive_interfaces); - - FieldLayoutInfo info; - layout_fields(class_loader, &fac, &parsed_annotations, &info, CHECK_NULL); - - int total_oop_map_size2 = - InstanceKlass::nonstatic_oop_map_size(info.total_oop_map_count); - - // Compute reference type - ReferenceType rt; - if (super_klass() == NULL) { - rt = REF_NONE; - } else { - rt = super_klass->reference_type(); - } - - // We can now create the basic Klass* for this klass - _klass = InstanceKlass::allocate_instance_klass(loader_data, - vtable_size, - itable_size, - info.static_field_size, - total_oop_map_size2, - rt, - access_flags, - name, - super_klass(), - !host_klass.is_null(), - CHECK_(nullHandle)); - instanceKlassHandle this_klass (THREAD, _klass); - - assert(this_klass->static_field_size() == info.static_field_size, "sanity"); - assert(this_klass->nonstatic_oop_map_count() == info.total_oop_map_count, - "sanity"); - - // Fill in information already parsed - this_klass->set_should_verify_class(verify); - jint lh = Klass::instance_layout_helper(info.instance_size, false); - this_klass->set_layout_helper(lh); - assert(this_klass->oop_is_instance(), "layout is correct"); - assert(this_klass->size_helper() == info.instance_size, "correct size_helper"); - // Not yet: supers are done below to support the new subtype-checking fields - //this_klass->set_super(super_klass()); - this_klass->set_class_loader_data(loader_data); - this_klass->set_nonstatic_field_size(info.nonstatic_field_size); - this_klass->set_has_nonstatic_fields(info.has_nonstatic_fields); - this_klass->set_static_oop_field_count(fac.count[STATIC_OOP]); - - apply_parsed_class_metadata(this_klass, java_fields_count, CHECK_NULL); - - if (has_final_method) { - this_klass->set_has_final_method(); - } - this_klass->copy_method_ordering(method_ordering, CHECK_NULL); - // The InstanceKlass::_methods_jmethod_ids cache - // is managed on the assumption that the initial cache - // size is equal to the number of methods in the class. If - // that changes, then InstanceKlass::idnum_can_increment() - // has to be changed accordingly. - this_klass->set_initial_method_idnum(methods->length()); - this_klass->set_name(cp->klass_name_at(this_class_index)); - if (is_anonymous()) // I am well known to myself - cp->klass_at_put(this_class_index, this_klass()); // eagerly resolve - - this_klass->set_minor_version(minor_version); - this_klass->set_major_version(major_version); - this_klass->set_has_default_methods(has_default_methods); - - if (!host_klass.is_null()) { - assert (this_klass->is_anonymous(), "should be the same"); - this_klass->set_host_klass(host_klass()); - } - - // Set up Method*::intrinsic_id as soon as we know the names of methods. - // (We used to do this lazily, but now we query it in Rewriter, - // which is eagerly done for every method, so we might as well do it now, - // when everything is fresh in memory.) - if (Method::klass_id_for_intrinsics(this_klass()) != vmSymbols::NO_SID) { - for (int j = 0; j < methods->length(); j++) { - methods->at(j)->init_intrinsic_id(); - } - } - - if (cached_class_file != NULL) { - // JVMTI: we have an InstanceKlass now, tell it about the cached bytes - this_klass->set_cached_class_file(cached_class_file); - } - - // Fill in field values obtained by parse_classfile_attributes - if (parsed_annotations.has_any_annotations()) - parsed_annotations.apply_to(this_klass); - apply_parsed_class_attributes(this_klass); - - // Miranda methods - if ((num_miranda_methods > 0) || - // if this class introduced new miranda methods or - (super_klass.not_null() && (super_klass->has_miranda_methods())) - // super class exists and this class inherited miranda methods - ) { - this_klass->set_has_miranda_methods(); // then set a flag - } - - // Fill in information needed to compute superclasses. - this_klass->initialize_supers(super_klass(), CHECK_(nullHandle)); - - // Initialize itable offset tables - klassItable::setup_itable_offset_table(this_klass); - - // Compute transitive closure of interfaces this class implements - // Do final class setup - fill_oop_maps(this_klass, info.nonstatic_oop_map_count, info.nonstatic_oop_offsets, info.nonstatic_oop_counts); - - // Fill in has_finalizer, has_vanilla_constructor, and layout_helper - set_precomputed_flags(this_klass); - - // reinitialize modifiers, using the InnerClasses attribute - int computed_modifiers = this_klass->compute_modifier_flags(CHECK_(nullHandle)); - this_klass->set_modifier_flags(computed_modifiers); - - // check if this class can access its super class - check_super_class_access(this_klass, CHECK_(nullHandle)); - - // check if this class can access its superinterfaces - check_super_interface_access(this_klass, CHECK_(nullHandle)); - - // check if this class overrides any final method - check_final_method_override(this_klass, CHECK_(nullHandle)); - - // check that if this class is an interface then it doesn't have static methods - if (this_klass->is_interface()) { - /* An interface in a JAVA 8 classfile can be static */ - if (_major_version < JAVA_8_VERSION) { - check_illegal_static_method(this_klass, CHECK_(nullHandle)); - } - } - - // Allocate mirror and initialize static fields - java_lang_Class::create_mirror(this_klass, class_loader, protection_domain, - CHECK_(nullHandle)); - - // Generate any default methods - default methods are interface methods - // that have a default implementation. This is new with Lambda project. - if (has_default_methods ) { - DefaultMethods::generate_default_methods( - this_klass(), &all_mirandas, CHECK_(nullHandle)); - } - - // Update the loader_data graph. - record_defined_class_dependencies(this_klass, CHECK_NULL); - - ClassLoadingService::notify_class_loaded(InstanceKlass::cast(this_klass()), - false /* not shared class */); - - if (TraceClassLoading) { - ResourceMark rm; - // print in a single call to reduce interleaving of output - if (cfs->source() != NULL) { - tty->print("[Loaded %s from %s]\n", this_klass->external_name(), - cfs->source()); - } else if (class_loader.is_null()) { - Klass* caller = - THREAD->is_Java_thread() - ? ((JavaThread*)THREAD)->security_get_caller_class(1) - : NULL; - // caller can be NULL, for example, during a JVMTI VM_Init hook - if (caller != NULL) { - tty->print("[Loaded %s by instance of %s]\n", - this_klass->external_name(), - InstanceKlass::cast(caller)->external_name()); - } else { - tty->print("[Loaded %s]\n", this_klass->external_name()); - } - } else { - tty->print("[Loaded %s from %s]\n", this_klass->external_name(), - InstanceKlass::cast(class_loader->klass())->external_name()); - } - } - - if (TraceClassResolution) { - ResourceMark rm; - // print out the superclass. - const char * from = this_klass()->external_name(); - if (this_klass->java_super() != NULL) { - tty->print("RESOLVE %s %s (super)\n", from, InstanceKlass::cast(this_klass->java_super())->external_name()); - } - // print out each of the interface classes referred to by this class. - Array* local_interfaces = this_klass->local_interfaces(); - if (local_interfaces != NULL) { - int length = local_interfaces->length(); - for (int i = 0; i < length; i++) { - Klass* k = local_interfaces->at(i); - InstanceKlass* to_class = InstanceKlass::cast(k); - const char * to = to_class->external_name(); - tty->print("RESOLVE %s %s (interface)\n", from, to); - } - } - } - - // preserve result across HandleMark - preserve_this_klass = this_klass(); - } - - // Create new handle outside HandleMark (might be needed for - // Extended Class Redefinition) - instanceKlassHandle this_klass (THREAD, preserve_this_klass); - debug_only(this_klass->verify();) - - // Clear class if no error has occurred so destructor doesn't deallocate it - _klass = NULL; - return this_klass; -} - -// Destructor to clean up if there's an error -ClassFileParser::~ClassFileParser() { - MetadataFactory::free_metadata(_loader_data, _cp); - MetadataFactory::free_array(_loader_data, _fields); - - // Free methods - InstanceKlass::deallocate_methods(_loader_data, _methods); - - // beware of the Universe::empty_blah_array!! - if (_inner_classes != Universe::the_empty_short_array()) { - MetadataFactory::free_array(_loader_data, _inner_classes); - } - - // Free interfaces - InstanceKlass::deallocate_interfaces(_loader_data, _super_klass(), - _local_interfaces, _transitive_interfaces); - - MetadataFactory::free_array(_loader_data, _annotations); - MetadataFactory::free_array(_loader_data, _type_annotations); - Annotations::free_contents(_loader_data, _fields_annotations); - Annotations::free_contents(_loader_data, _fields_type_annotations); - - clear_class_metadata(); - - // deallocate the klass if already created. Don't directly deallocate, but add - // to the deallocate list so that the klass is removed from the CLD::_klasses list - // at a safepoint. - if (_klass != NULL) { - _loader_data->add_to_deallocate_list(_klass); - } - _klass = NULL; -} - -void ClassFileParser::print_field_layout(Symbol* name, - Array* fields, - constantPoolHandle cp, - int instance_size, - int instance_fields_start, - int instance_fields_end, - int static_fields_end) { - tty->print("%s: field layout\n", name->as_klass_external_name()); - tty->print(" @%3d %s\n", instance_fields_start, "--- instance fields start ---"); - for (AllFieldStream fs(fields, cp); !fs.done(); fs.next()) { - if (!fs.access_flags().is_static()) { - tty->print(" @%3d \"%s\" %s\n", - fs.offset(), - fs.name()->as_klass_external_name(), - fs.signature()->as_klass_external_name()); - } - } - tty->print(" @%3d %s\n", instance_fields_end, "--- instance fields end ---"); - tty->print(" @%3d %s\n", instance_size * wordSize, "--- instance ends ---"); - tty->print(" @%3d %s\n", InstanceMirrorKlass::offset_of_static_fields(), "--- static fields start ---"); - for (AllFieldStream fs(fields, cp); !fs.done(); fs.next()) { - if (fs.access_flags().is_static()) { - tty->print(" @%3d \"%s\" %s\n", - fs.offset(), - fs.name()->as_klass_external_name(), - fs.signature()->as_klass_external_name()); - } - } - tty->print(" @%3d %s\n", static_fields_end, "--- static fields end ---"); - tty->print("\n"); -} - -unsigned int -ClassFileParser::compute_oop_map_count(instanceKlassHandle super, - unsigned int nonstatic_oop_map_count, - int first_nonstatic_oop_offset) { - unsigned int map_count = - super.is_null() ? 0 : super->nonstatic_oop_map_count(); - if (nonstatic_oop_map_count > 0) { - // We have oops to add to map - if (map_count == 0) { - map_count = nonstatic_oop_map_count; - } else { - // Check whether we should add a new map block or whether the last one can - // be extended - OopMapBlock* const first_map = super->start_of_nonstatic_oop_maps(); - OopMapBlock* const last_map = first_map + map_count - 1; - - int next_offset = last_map->offset() + last_map->count() * heapOopSize; - if (next_offset == first_nonstatic_oop_offset) { - // There is no gap bettwen superklass's last oop field and first - // local oop field, merge maps. - nonstatic_oop_map_count -= 1; - } else { - // Superklass didn't end with a oop field, add extra maps - assert(next_offset < first_nonstatic_oop_offset, "just checking"); - } - map_count += nonstatic_oop_map_count; - } - } - return map_count; -} - - -void ClassFileParser::fill_oop_maps(instanceKlassHandle k, - unsigned int nonstatic_oop_map_count, - int* nonstatic_oop_offsets, - unsigned int* nonstatic_oop_counts) { - OopMapBlock* this_oop_map = k->start_of_nonstatic_oop_maps(); - const InstanceKlass* const super = k->superklass(); - const unsigned int super_count = super ? super->nonstatic_oop_map_count() : 0; - if (super_count > 0) { - // Copy maps from superklass - OopMapBlock* super_oop_map = super->start_of_nonstatic_oop_maps(); - for (unsigned int i = 0; i < super_count; ++i) { - *this_oop_map++ = *super_oop_map++; - } - } - - if (nonstatic_oop_map_count > 0) { - if (super_count + nonstatic_oop_map_count > k->nonstatic_oop_map_count()) { - // The counts differ because there is no gap between superklass's last oop - // field and the first local oop field. Extend the last oop map copied - // from the superklass instead of creating new one. - nonstatic_oop_map_count--; - nonstatic_oop_offsets++; - this_oop_map--; - this_oop_map->set_count(this_oop_map->count() + *nonstatic_oop_counts++); - this_oop_map++; - } - - // Add new map blocks, fill them - while (nonstatic_oop_map_count-- > 0) { - this_oop_map->set_offset(*nonstatic_oop_offsets++); - this_oop_map->set_count(*nonstatic_oop_counts++); - this_oop_map++; - } - assert(k->start_of_nonstatic_oop_maps() + k->nonstatic_oop_map_count() == - this_oop_map, "sanity"); - } -} - - -void ClassFileParser::set_precomputed_flags(instanceKlassHandle k) { - Klass* super = k->super(); - - // Check if this klass has an empty finalize method (i.e. one with return bytecode only), - // in which case we don't have to register objects as finalizable - if (!_has_empty_finalizer) { - if (_has_finalizer || - (super != NULL && super->has_finalizer())) { - k->set_has_finalizer(); - } - } - -#ifdef ASSERT - bool f = false; - Method* m = k->lookup_method(vmSymbols::finalize_method_name(), - vmSymbols::void_method_signature()); - if (m != NULL && !m->is_empty_method()) { - f = true; - } - - // Spec doesn't prevent agent from redefinition of empty finalizer. - // Despite the fact that it's generally bad idea and redefined finalizer - // will not work as expected we shouldn't abort vm in this case - if (!k->has_redefined_this_or_super()) { - assert(f == k->has_finalizer(), "inconsistent has_finalizer"); - } -#endif - - // Check if this klass supports the java.lang.Cloneable interface - if (SystemDictionary::Cloneable_klass_loaded()) { - if (k->is_subtype_of(SystemDictionary::Cloneable_klass())) { - k->set_is_cloneable(); - } - } - - // Check if this klass has a vanilla default constructor - if (super == NULL) { - // java.lang.Object has empty default constructor - k->set_has_vanilla_constructor(); - } else { - if (super->has_vanilla_constructor() && - _has_vanilla_constructor) { - k->set_has_vanilla_constructor(); - } -#ifdef ASSERT - bool v = false; - if (super->has_vanilla_constructor()) { - Method* constructor = k->find_method(vmSymbols::object_initializer_name( -), vmSymbols::void_method_signature()); - if (constructor != NULL && constructor->is_vanilla_constructor()) { - v = true; - } - } - assert(v == k->has_vanilla_constructor(), "inconsistent has_vanilla_constructor"); -#endif - } - - // If it cannot be fast-path allocated, set a bit in the layout helper. - // See documentation of InstanceKlass::can_be_fastpath_allocated(). - assert(k->size_helper() > 0, "layout_helper is initialized"); - if ((!RegisterFinalizersAtInit && k->has_finalizer()) - || k->is_abstract() || k->is_interface() - || (k->name() == vmSymbols::java_lang_Class() && k->class_loader() == NULL) - || k->size_helper() >= FastAllocateSizeLimit) { - // Forbid fast-path allocation. - jint lh = Klass::instance_layout_helper(k->size_helper(), true); - k->set_layout_helper(lh); - } -} - -// Attach super classes and interface classes to class loader data -void ClassFileParser::record_defined_class_dependencies(instanceKlassHandle defined_klass, TRAPS) { - ClassLoaderData * defining_loader_data = defined_klass->class_loader_data(); - if (defining_loader_data->is_the_null_class_loader_data()) { - // Dependencies to null class loader data are implicit. - return; - } else { - // add super class dependency - Klass* super = defined_klass->super(); - if (super != NULL) { - defining_loader_data->record_dependency(super, CHECK); - } - - // add super interface dependencies - Array* local_interfaces = defined_klass->local_interfaces(); - if (local_interfaces != NULL) { - int length = local_interfaces->length(); - for (int i = 0; i < length; i++) { - defining_loader_data->record_dependency(local_interfaces->at(i), CHECK); - } - } - } -} - -// utility methods for appending an array with check for duplicates - -void append_interfaces(GrowableArray* result, Array* ifs) { - // iterate over new interfaces - for (int i = 0; i < ifs->length(); i++) { - Klass* e = ifs->at(i); - assert(e->is_klass() && InstanceKlass::cast(e)->is_interface(), "just checking"); - // add new interface - result->append_if_missing(e); - } -} - -Array* ClassFileParser::compute_transitive_interfaces( - instanceKlassHandle super, - Array* local_ifs, TRAPS) { - // Compute maximum size for transitive interfaces - int max_transitive_size = 0; - int super_size = 0; - // Add superclass transitive interfaces size - if (super.not_null()) { - super_size = super->transitive_interfaces()->length(); - max_transitive_size += super_size; - } - // Add local interfaces' super interfaces - int local_size = local_ifs->length(); - for (int i = 0; i < local_size; i++) { - Klass* l = local_ifs->at(i); - max_transitive_size += InstanceKlass::cast(l)->transitive_interfaces()->length(); - } - // Finally add local interfaces - max_transitive_size += local_size; - // Construct array - if (max_transitive_size == 0) { - // no interfaces, use canonicalized array - return Universe::the_empty_klass_array(); - } else if (max_transitive_size == super_size) { - // no new local interfaces added, share superklass' transitive interface array - return super->transitive_interfaces(); - } else if (max_transitive_size == local_size) { - // only local interfaces added, share local interface array - return local_ifs; - } else { - ResourceMark rm; - GrowableArray* result = new GrowableArray(max_transitive_size); - - // Copy down from superclass - if (super.not_null()) { - append_interfaces(result, super->transitive_interfaces()); - } - - // Copy down from local interfaces' superinterfaces - for (int i = 0; i < local_ifs->length(); i++) { - Klass* l = local_ifs->at(i); - append_interfaces(result, InstanceKlass::cast(l)->transitive_interfaces()); - } - // Finally add local interfaces - append_interfaces(result, local_ifs); - - // length will be less than the max_transitive_size if duplicates were removed - int length = result->length(); - assert(length <= max_transitive_size, "just checking"); - Array* new_result = MetadataFactory::new_array(_loader_data, length, CHECK_NULL); - for (int i = 0; i < length; i++) { - Klass* e = result->at(i); - assert(e != NULL, "just checking"); - new_result->at_put(i, e); - } - return new_result; - } -} - -void ClassFileParser::check_super_class_access(instanceKlassHandle this_klass, TRAPS) { - Klass* super = this_klass->super(); - if ((super != NULL) && - (!Reflection::verify_class_access(this_klass(), super, false))) { - ResourceMark rm(THREAD); - Exceptions::fthrow( - THREAD_AND_LOCATION, - vmSymbols::java_lang_IllegalAccessError(), - "class %s cannot access its superclass %s", - this_klass->external_name(), - InstanceKlass::cast(super)->external_name() - ); - return; - } -} - - -void ClassFileParser::check_super_interface_access(instanceKlassHandle this_klass, TRAPS) { - Array* local_interfaces = this_klass->local_interfaces(); - int lng = local_interfaces->length(); - for (int i = lng - 1; i >= 0; i--) { - Klass* k = local_interfaces->at(i); - assert (k != NULL && k->is_interface(), "invalid interface"); - if (!Reflection::verify_class_access(this_klass(), k, false)) { - ResourceMark rm(THREAD); - Exceptions::fthrow( - THREAD_AND_LOCATION, - vmSymbols::java_lang_IllegalAccessError(), - "class %s cannot access its superinterface %s", - this_klass->external_name(), - InstanceKlass::cast(k)->external_name() - ); - return; - } - } -} - - -void ClassFileParser::check_final_method_override(instanceKlassHandle this_klass, TRAPS) { - Array* methods = this_klass->methods(); - int num_methods = methods->length(); - - // go thru each method and check if it overrides a final method - for (int index = 0; index < num_methods; index++) { - Method* m = methods->at(index); - - // skip private, static, and methods - if ((!m->is_private() && !m->is_static()) && - (m->name() != vmSymbols::object_initializer_name())) { - - Symbol* name = m->name(); - Symbol* signature = m->signature(); - Klass* k = this_klass->super(); - Method* super_m = NULL; - while (k != NULL) { - // skip supers that don't have final methods. - if (k->has_final_method()) { - // lookup a matching method in the super class hierarchy - super_m = InstanceKlass::cast(k)->lookup_method(name, signature); - if (super_m == NULL) { - break; // didn't find any match; get out - } - - if (super_m->is_final() && !super_m->is_static() && - // matching method in super is final, and not static - (Reflection::verify_field_access(this_klass(), - super_m->method_holder(), - super_m->method_holder(), - super_m->access_flags(), false)) - // this class can access super final method and therefore override - ) { - ResourceMark rm(THREAD); - Exceptions::fthrow( - THREAD_AND_LOCATION, - vmSymbols::java_lang_VerifyError(), - "class %s overrides final method %s.%s%s", - this_klass->external_name(), - super_m->method_holder()->external_name(), - name->as_C_string(), - signature->as_C_string() - ); - return; - } - - // continue to look from super_m's holder's super. - k = super_m->method_holder()->super(); - continue; - } - - k = k->super(); - } - } - } -} - - -// assumes that this_klass is an interface -void ClassFileParser::check_illegal_static_method(instanceKlassHandle this_klass, TRAPS) { - assert(this_klass->is_interface(), "not an interface"); - Array* methods = this_klass->methods(); - int num_methods = methods->length(); - - for (int index = 0; index < num_methods; index++) { - Method* m = methods->at(index); - // if m is static and not the init method, throw a verify error - if ((m->is_static()) && (m->name() != vmSymbols::class_initializer_name())) { - ResourceMark rm(THREAD); - Exceptions::fthrow( - THREAD_AND_LOCATION, - vmSymbols::java_lang_VerifyError(), - "Illegal static method %s in interface %s", - m->name()->as_C_string(), - this_klass->external_name() - ); - return; - } - } -} - -// utility methods for format checking - -void ClassFileParser::verify_legal_class_modifiers(jint flags, TRAPS) { - if (!_need_verify) { return; } - - const bool is_interface = (flags & JVM_ACC_INTERFACE) != 0; - const bool is_abstract = (flags & JVM_ACC_ABSTRACT) != 0; - const bool is_final = (flags & JVM_ACC_FINAL) != 0; - const bool is_super = (flags & JVM_ACC_SUPER) != 0; - const bool is_enum = (flags & JVM_ACC_ENUM) != 0; - const bool is_annotation = (flags & JVM_ACC_ANNOTATION) != 0; - const bool major_gte_15 = _major_version >= JAVA_1_5_VERSION; - - if ((is_abstract && is_final) || - (is_interface && !is_abstract) || - (is_interface && major_gte_15 && (is_super || is_enum)) || - (!is_interface && major_gte_15 && is_annotation)) { - ResourceMark rm(THREAD); - Exceptions::fthrow( - THREAD_AND_LOCATION, - vmSymbols::java_lang_ClassFormatError(), - "Illegal class modifiers in class %s: 0x%X", - _class_name->as_C_string(), flags - ); - return; - } -} - -bool ClassFileParser::has_illegal_visibility(jint flags) { - const bool is_public = (flags & JVM_ACC_PUBLIC) != 0; - const bool is_protected = (flags & JVM_ACC_PROTECTED) != 0; - const bool is_private = (flags & JVM_ACC_PRIVATE) != 0; - - return ((is_public && is_protected) || - (is_public && is_private) || - (is_protected && is_private)); -} - -bool ClassFileParser::is_supported_version(u2 major, u2 minor) { - u2 max_version = JAVA_MAX_SUPPORTED_VERSION; - return (major >= JAVA_MIN_SUPPORTED_VERSION) && - (major <= max_version) && - ((major != max_version) || - (minor <= JAVA_MAX_SUPPORTED_MINOR_VERSION)); -} - -void ClassFileParser::verify_legal_field_modifiers( - jint flags, bool is_interface, TRAPS) { - if (!_need_verify) { return; } - - const bool is_public = (flags & JVM_ACC_PUBLIC) != 0; - const bool is_protected = (flags & JVM_ACC_PROTECTED) != 0; - const bool is_private = (flags & JVM_ACC_PRIVATE) != 0; - const bool is_static = (flags & JVM_ACC_STATIC) != 0; - const bool is_final = (flags & JVM_ACC_FINAL) != 0; - const bool is_volatile = (flags & JVM_ACC_VOLATILE) != 0; - const bool is_transient = (flags & JVM_ACC_TRANSIENT) != 0; - const bool is_enum = (flags & JVM_ACC_ENUM) != 0; - const bool major_gte_15 = _major_version >= JAVA_1_5_VERSION; - - bool is_illegal = false; - - if (is_interface) { - if (!is_public || !is_static || !is_final || is_private || - is_protected || is_volatile || is_transient || - (major_gte_15 && is_enum)) { - is_illegal = true; - } - } else { // not interface - if (has_illegal_visibility(flags) || (is_final && is_volatile)) { - is_illegal = true; - } - } - - if (is_illegal) { - ResourceMark rm(THREAD); - Exceptions::fthrow( - THREAD_AND_LOCATION, - vmSymbols::java_lang_ClassFormatError(), - "Illegal field modifiers in class %s: 0x%X", - _class_name->as_C_string(), flags); - return; - } -} - -void ClassFileParser::verify_legal_method_modifiers( - jint flags, bool is_interface, Symbol* name, TRAPS) { - if (!_need_verify) { return; } - - const bool is_public = (flags & JVM_ACC_PUBLIC) != 0; - const bool is_private = (flags & JVM_ACC_PRIVATE) != 0; - const bool is_static = (flags & JVM_ACC_STATIC) != 0; - const bool is_final = (flags & JVM_ACC_FINAL) != 0; - const bool is_native = (flags & JVM_ACC_NATIVE) != 0; - const bool is_abstract = (flags & JVM_ACC_ABSTRACT) != 0; - const bool is_bridge = (flags & JVM_ACC_BRIDGE) != 0; - const bool is_strict = (flags & JVM_ACC_STRICT) != 0; - const bool is_synchronized = (flags & JVM_ACC_SYNCHRONIZED) != 0; - const bool is_protected = (flags & JVM_ACC_PROTECTED) != 0; - const bool major_gte_15 = _major_version >= JAVA_1_5_VERSION; - const bool major_gte_8 = _major_version >= JAVA_8_VERSION; - const bool is_initializer = (name == vmSymbols::object_initializer_name()); - - bool is_illegal = false; - - if (is_interface) { - if (major_gte_8) { - // Class file version is JAVA_8_VERSION or later Methods of - // interfaces may set any of the flags except ACC_PROTECTED, - // ACC_FINAL, ACC_NATIVE, and ACC_SYNCHRONIZED; they must - // have exactly one of the ACC_PUBLIC or ACC_PRIVATE flags set. - if ((is_public == is_private) || /* Only one of private and public should be true - XNOR */ - (is_native || is_protected || is_final || is_synchronized) || - // If a specific method of a class or interface has its - // ACC_ABSTRACT flag set, it must not have any of its - // ACC_FINAL, ACC_NATIVE, ACC_PRIVATE, ACC_STATIC, - // ACC_STRICT, or ACC_SYNCHRONIZED flags set. No need to - // check for ACC_FINAL, ACC_NATIVE or ACC_SYNCHRONIZED as - // those flags are illegal irrespective of ACC_ABSTRACT being set or not. - (is_abstract && (is_private || is_static || is_strict))) { - is_illegal = true; - } - } else if (major_gte_15) { - // Class file version in the interval [JAVA_1_5_VERSION, JAVA_8_VERSION) - if (!is_public || is_static || is_final || is_synchronized || - is_native || !is_abstract || is_strict) { - is_illegal = true; - } - } else { - // Class file version is pre-JAVA_1_5_VERSION - if (!is_public || is_static || is_final || is_native || !is_abstract) { - is_illegal = true; - } - } - } else { // not interface - if (is_initializer) { - if (is_static || is_final || is_synchronized || is_native || - is_abstract || (major_gte_15 && is_bridge)) { - is_illegal = true; - } - } else { // not initializer - if (is_abstract) { - if ((is_final || is_native || is_private || is_static || - (major_gte_15 && (is_synchronized || is_strict)))) { - is_illegal = true; - } - } - if (has_illegal_visibility(flags)) { - is_illegal = true; - } - } - } - - if (is_illegal) { - ResourceMark rm(THREAD); - Exceptions::fthrow( - THREAD_AND_LOCATION, - vmSymbols::java_lang_ClassFormatError(), - "Method %s in class %s has illegal modifiers: 0x%X", - name->as_C_string(), _class_name->as_C_string(), flags); - return; - } -} - -void ClassFileParser::verify_legal_utf8(const unsigned char* buffer, int length, TRAPS) { - assert(_need_verify, "only called when _need_verify is true"); - int i = 0; - int count = length >> 2; - for (int k=0; k= 128 (highest bit 1) for v == 0 or v >= 128. - unsigned char res = b0 | b0 - 1 | - b1 | b1 - 1 | - b2 | b2 - 1 | - b3 | b3 - 1; - if (res >= 128) break; - i += 4; - } - for(; i < length; i++) { - unsigned short c; - // no embedded zeros - guarantee_property((buffer[i] != 0), "Illegal UTF8 string in constant pool in class file %s", CHECK); - if(buffer[i] < 128) { - continue; - } - if ((i + 5) < length) { // see if it's legal supplementary character - if (UTF8::is_supplementary_character(&buffer[i])) { - c = UTF8::get_supplementary_character(&buffer[i]); - i += 5; - continue; - } - } - switch (buffer[i] >> 4) { - default: break; - case 0x8: case 0x9: case 0xA: case 0xB: case 0xF: - classfile_parse_error("Illegal UTF8 string in constant pool in class file %s", CHECK); - case 0xC: case 0xD: // 110xxxxx 10xxxxxx - c = (buffer[i] & 0x1F) << 6; - i++; - if ((i < length) && ((buffer[i] & 0xC0) == 0x80)) { - c += buffer[i] & 0x3F; - if (_major_version <= 47 || c == 0 || c >= 0x80) { - // for classes with major > 47, c must a null or a character in its shortest form - break; - } - } - classfile_parse_error("Illegal UTF8 string in constant pool in class file %s", CHECK); - case 0xE: // 1110xxxx 10xxxxxx 10xxxxxx - c = (buffer[i] & 0xF) << 12; - i += 2; - if ((i < length) && ((buffer[i-1] & 0xC0) == 0x80) && ((buffer[i] & 0xC0) == 0x80)) { - c += ((buffer[i-1] & 0x3F) << 6) + (buffer[i] & 0x3F); - if (_major_version <= 47 || c >= 0x800) { - // for classes with major > 47, c must be in its shortest form - break; - } - } - classfile_parse_error("Illegal UTF8 string in constant pool in class file %s", CHECK); - } // end of switch - } // end of for -} - -// Checks if name is a legal class name. -void ClassFileParser::verify_legal_class_name(Symbol* name, TRAPS) { - if (!_need_verify || _relax_verify) { return; } - - char buf[fixed_buffer_size]; - char* bytes = name->as_utf8_flexible_buffer(THREAD, buf, fixed_buffer_size); - unsigned int length = name->utf8_length(); - bool legal = false; - - if (length > 0) { - char* p; - if (bytes[0] == JVM_SIGNATURE_ARRAY) { - p = skip_over_field_signature(bytes, false, length, CHECK); - legal = (p != NULL) && ((p - bytes) == (int)length); - } else if (_major_version < JAVA_1_5_VERSION) { - if (bytes[0] != '<') { - p = skip_over_field_name(bytes, true, length); - legal = (p != NULL) && ((p - bytes) == (int)length); - } - } else { - // 4900761: relax the constraints based on JSR202 spec - // Class names may be drawn from the entire Unicode character set. - // Identifiers between '/' must be unqualified names. - // The utf8 string has been verified when parsing cpool entries. - legal = verify_unqualified_name(bytes, length, LegalClass); - } - } - if (!legal) { - ResourceMark rm(THREAD); - Exceptions::fthrow( - THREAD_AND_LOCATION, - vmSymbols::java_lang_ClassFormatError(), - "Illegal class name \"%s\" in class file %s", bytes, - _class_name->as_C_string() - ); - return; - } -} - -// Checks if name is a legal field name. -void ClassFileParser::verify_legal_field_name(Symbol* name, TRAPS) { - if (!_need_verify || _relax_verify) { return; } - - char buf[fixed_buffer_size]; - char* bytes = name->as_utf8_flexible_buffer(THREAD, buf, fixed_buffer_size); - unsigned int length = name->utf8_length(); - bool legal = false; - - if (length > 0) { - if (_major_version < JAVA_1_5_VERSION) { - if (bytes[0] != '<') { - char* p = skip_over_field_name(bytes, false, length); - legal = (p != NULL) && ((p - bytes) == (int)length); - } - } else { - // 4881221: relax the constraints based on JSR202 spec - legal = verify_unqualified_name(bytes, length, LegalField); - } - } - - if (!legal) { - ResourceMark rm(THREAD); - Exceptions::fthrow( - THREAD_AND_LOCATION, - vmSymbols::java_lang_ClassFormatError(), - "Illegal field name \"%s\" in class %s", bytes, - _class_name->as_C_string() - ); - return; - } -} - -// Checks if name is a legal method name. -void ClassFileParser::verify_legal_method_name(Symbol* name, TRAPS) { - if (!_need_verify || _relax_verify) { return; } - - assert(name != NULL, "method name is null"); - char buf[fixed_buffer_size]; - char* bytes = name->as_utf8_flexible_buffer(THREAD, buf, fixed_buffer_size); - unsigned int length = name->utf8_length(); - bool legal = false; - - if (length > 0) { - if (bytes[0] == '<') { - if (name == vmSymbols::object_initializer_name() || name == vmSymbols::class_initializer_name()) { - legal = true; - } - } else if (_major_version < JAVA_1_5_VERSION) { - char* p; - p = skip_over_field_name(bytes, false, length); - legal = (p != NULL) && ((p - bytes) == (int)length); - } else { - // 4881221: relax the constraints based on JSR202 spec - legal = verify_unqualified_name(bytes, length, LegalMethod); - } - } - - if (!legal) { - ResourceMark rm(THREAD); - Exceptions::fthrow( - THREAD_AND_LOCATION, - vmSymbols::java_lang_ClassFormatError(), - "Illegal method name \"%s\" in class %s", bytes, - _class_name->as_C_string() - ); - return; - } -} - - -// Checks if signature is a legal field signature. -void ClassFileParser::verify_legal_field_signature(Symbol* name, Symbol* signature, TRAPS) { - if (!_need_verify) { return; } - - char buf[fixed_buffer_size]; - char* bytes = signature->as_utf8_flexible_buffer(THREAD, buf, fixed_buffer_size); - unsigned int length = signature->utf8_length(); - char* p = skip_over_field_signature(bytes, false, length, CHECK); - - if (p == NULL || (p - bytes) != (int)length) { - throwIllegalSignature("Field", name, signature, CHECK); - } -} - -// Checks if signature is a legal method signature. -// Returns number of parameters -int ClassFileParser::verify_legal_method_signature(Symbol* name, Symbol* signature, TRAPS) { - if (!_need_verify) { - // make sure caller's args_size will be less than 0 even for non-static - // method so it will be recomputed in compute_size_of_parameters(). - return -2; - } - - unsigned int args_size = 0; - char buf[fixed_buffer_size]; - char* p = signature->as_utf8_flexible_buffer(THREAD, buf, fixed_buffer_size); - unsigned int length = signature->utf8_length(); - char* nextp; - - // The first character must be a '(' - if ((length > 0) && (*p++ == JVM_SIGNATURE_FUNC)) { - length--; - // Skip over legal field signatures - nextp = skip_over_field_signature(p, false, length, CHECK_0); - while ((length > 0) && (nextp != NULL)) { - args_size++; - if (p[0] == 'J' || p[0] == 'D') { - args_size++; - } - length -= nextp - p; - p = nextp; - nextp = skip_over_field_signature(p, false, length, CHECK_0); - } - // The first non-signature thing better be a ')' - if ((length > 0) && (*p++ == JVM_SIGNATURE_ENDFUNC)) { - length--; - if (name->utf8_length() > 0 && name->byte_at(0) == '<') { - // All internal methods must return void - if ((length == 1) && (p[0] == JVM_SIGNATURE_VOID)) { - return args_size; - } - } else { - // Now we better just have a return value - nextp = skip_over_field_signature(p, true, length, CHECK_0); - if (nextp && ((int)length == (nextp - p))) { - return args_size; - } - } - } - } - // Report error - throwIllegalSignature("Method", name, signature, CHECK_0); - return 0; -} - - -// Unqualified names may not contain the characters '.', ';', '[', or '/'. -// Method names also may not contain the characters '<' or '>', unless -// or . Note that method names may not be or in this -// method. Because these names have been checked as special cases before -// calling this method in verify_legal_method_name. -bool ClassFileParser::verify_unqualified_name( - char* name, unsigned int length, int type) { - jchar ch; - - for (char* p = name; p != name + length; ) { - ch = *p; - if (ch < 128) { - p++; - if (ch == '.' || ch == ';' || ch == '[' ) { - return false; // do not permit '.', ';', or '[' - } - if (type != LegalClass && ch == '/') { - return false; // do not permit '/' unless it's class name - } - if (type == LegalMethod && (ch == '<' || ch == '>')) { - return false; // do not permit '<' or '>' in method names - } - } else { - char* tmp_p = UTF8::next(p, &ch); - p = tmp_p; - } - } - return true; -} - - -// Take pointer to a string. Skip over the longest part of the string that could -// be taken as a fieldname. Allow '/' if slash_ok is true. -// Return a pointer to just past the fieldname. -// Return NULL if no fieldname at all was found, or in the case of slash_ok -// being true, we saw consecutive slashes (meaning we were looking for a -// qualified path but found something that was badly-formed). -char* ClassFileParser::skip_over_field_name(char* name, bool slash_ok, unsigned int length) { - char* p; - jchar ch; - jboolean last_is_slash = false; - jboolean not_first_ch = false; - - for (p = name; p != name + length; not_first_ch = true) { - char* old_p = p; - ch = *p; - if (ch < 128) { - p++; - // quick check for ascii - if ((ch >= 'a' && ch <= 'z') || - (ch >= 'A' && ch <= 'Z') || - (ch == '_' || ch == '$') || - (not_first_ch && ch >= '0' && ch <= '9')) { - last_is_slash = false; - continue; - } - if (slash_ok && ch == '/') { - if (last_is_slash) { - return NULL; // Don't permit consecutive slashes - } - last_is_slash = true; - continue; - } - } else { - jint unicode_ch; - char* tmp_p = UTF8::next_character(p, &unicode_ch); - p = tmp_p; - last_is_slash = false; - // Check if ch is Java identifier start or is Java identifier part - // 4672820: call java.lang.Character methods directly without generating separate tables. - EXCEPTION_MARK; - instanceKlassHandle klass (THREAD, SystemDictionary::Character_klass()); - - // return value - JavaValue result(T_BOOLEAN); - // Set up the arguments to isJavaIdentifierStart and isJavaIdentifierPart - JavaCallArguments args; - args.push_int(unicode_ch); - - // public static boolean isJavaIdentifierStart(char ch); - JavaCalls::call_static(&result, - klass, - vmSymbols::isJavaIdentifierStart_name(), - vmSymbols::int_bool_signature(), - &args, - THREAD); - - if (HAS_PENDING_EXCEPTION) { - CLEAR_PENDING_EXCEPTION; - return 0; - } - if (result.get_jboolean()) { - continue; - } - - if (not_first_ch) { - // public static boolean isJavaIdentifierPart(char ch); - JavaCalls::call_static(&result, - klass, - vmSymbols::isJavaIdentifierPart_name(), - vmSymbols::int_bool_signature(), - &args, - THREAD); - - if (HAS_PENDING_EXCEPTION) { - CLEAR_PENDING_EXCEPTION; - return 0; - } - - if (result.get_jboolean()) { - continue; - } - } - } - return (not_first_ch) ? old_p : NULL; - } - return (not_first_ch) ? p : NULL; -} - - -// Take pointer to a string. Skip over the longest part of the string that could -// be taken as a field signature. Allow "void" if void_ok. -// Return a pointer to just past the signature. -// Return NULL if no legal signature is found. -char* ClassFileParser::skip_over_field_signature(char* signature, - bool void_ok, - unsigned int length, - TRAPS) { - unsigned int array_dim = 0; - while (length > 0) { - switch (signature[0]) { - case JVM_SIGNATURE_VOID: if (!void_ok) { return NULL; } - case JVM_SIGNATURE_BOOLEAN: - case JVM_SIGNATURE_BYTE: - case JVM_SIGNATURE_CHAR: - case JVM_SIGNATURE_SHORT: - case JVM_SIGNATURE_INT: - case JVM_SIGNATURE_FLOAT: - case JVM_SIGNATURE_LONG: - case JVM_SIGNATURE_DOUBLE: - return signature + 1; - case JVM_SIGNATURE_CLASS: { - if (_major_version < JAVA_1_5_VERSION) { - // Skip over the class name if one is there - char* p = skip_over_field_name(signature + 1, true, --length); - - // The next character better be a semicolon - if (p && (p - signature) > 1 && p[0] == ';') { - return p + 1; - } - } else { - // 4900761: For class version > 48, any unicode is allowed in class name. - length--; - signature++; - while (length > 0 && signature[0] != ';') { - if (signature[0] == '.') { - classfile_parse_error("Class name contains illegal character '.' in descriptor in class file %s", CHECK_0); - } - length--; - signature++; - } - if (signature[0] == ';') { return signature + 1; } - } - - return NULL; - } - case JVM_SIGNATURE_ARRAY: - array_dim++; - if (array_dim > 255) { - // 4277370: array descriptor is valid only if it represents 255 or fewer dimensions. - classfile_parse_error("Array type descriptor has more than 255 dimensions in class file %s", CHECK_0); - } - // The rest of what's there better be a legal signature - signature++; - length--; - void_ok = false; - break; - - default: - return NULL; - } - } - return NULL; -} From b9c70becabf79fa5d0597f6ed5f780e4595618ff Mon Sep 17 00:00:00 2001 From: Andrey Zakharov Date: Mon, 27 Oct 2014 07:52:49 -0700 Subject: [PATCH 35/61] 8059614: [TESTBUG] Test for UseNUMA enable UseNUMAInterleaving Tests that UseNUMAInterleaving enabled for all collectors by ergonomics, on all platforms when UseNUMA feature is enabled. Reviewed-by: jmasa, dfazunen --- .../gc/arguments/TestUseNUMAInterleaving.java | 60 +++++++++++++++++++ 1 file changed, 60 insertions(+) create mode 100644 hotspot/test/gc/arguments/TestUseNUMAInterleaving.java diff --git a/hotspot/test/gc/arguments/TestUseNUMAInterleaving.java b/hotspot/test/gc/arguments/TestUseNUMAInterleaving.java new file mode 100644 index 00000000000..edc6f9faf2f --- /dev/null +++ b/hotspot/test/gc/arguments/TestUseNUMAInterleaving.java @@ -0,0 +1,60 @@ +/* + * Copyright (c) 2014, Oracle and/or its affiliates. All rights reserved. + * DO NOT ALTER OR REMOVE COPYRIGHT NOTICES OR THIS FILE HEADER. + * + * This code is free software; you can redistribute it and/or modify it + * under the terms of the GNU General Public License version 2 only, as + * published by the Free Software Foundation. + * + * This code is distributed in the hope that it will be useful, but WITHOUT + * ANY WARRANTY; without even the implied warranty of MERCHANTABILITY or + * FITNESS FOR A PARTICULAR PURPOSE. See the GNU General Public License + * version 2 for more details (a copy is included in the LICENSE file that + * accompanied this code). + * + * You should have received a copy of the GNU General Public License version + * 2 along with this work; if not, write to the Free Software Foundation, + * Inc., 51 Franklin St, Fifth Floor, Boston, MA 02110-1301 USA. + * + * Please contact Oracle, 500 Oracle Parkway, Redwood Shores, CA 94065 USA + * or visit www.oracle.com if you need additional information or have any + * questions. + */ + +/** + * @test TestUseNUMAInterleaving + * @summary Tests that UseNUMAInterleaving enabled for all collectors by + * ergonomics, on all platforms when UseNUMA feature is enabled. + * @bug 8059614 + * @key gc + * @library /testlibrary + * @run driver TestUseNUMAInterleaving + */ +import com.oracle.java.testlibrary.ProcessTools; +import com.oracle.java.testlibrary.OutputAnalyzer; + +public class TestUseNUMAInterleaving { + + public static void main(String[] args) throws Exception { + String[] vmargs = new String[]{ + "-XX:+UseNUMA", + "-XX:+PrintFlagsFinal", + "-version" + }; + ProcessBuilder pb = ProcessTools.createJavaProcessBuilder(true, vmargs); + OutputAnalyzer output = new OutputAnalyzer(pb.start()); + + boolean isNUMAEnabled + = Boolean.parseBoolean(output.firstMatch(NUMA_FLAG_PATTERN, 1)); + + if (isNUMAEnabled) { + output.shouldMatch("\\bUseNUMAInterleaving\\b.*?=.*?true"); + System.out.println(output.getStdout()); + } else { + System.out.println(output.firstMatch(NUMA_FLAG_PATTERN)); + System.out.println(output.firstMatch(NUMA_FLAG_PATTERN, 1)); + } + } + + private static final String NUMA_FLAG_PATTERN = "\\bUseNUMA\\b.*?=.*?([a-z]+)"; +} From 1e7b7a410e2db8ec5bf8b79d681d00e1896173b9 Mon Sep 17 00:00:00 2001 From: Tobias Hartmann Date: Tue, 28 Oct 2014 09:17:36 +0100 Subject: [PATCH 36/61] 8061983: [TESTBUG] compiler/whitebox/MakeMethodNotCompilableTest.java fails with "must not be in queue" Added a method checkNotCompiled(boolean isOsr) to either check if the method is OSR compiled or to check if it is non-OSR compiled. Reviewed-by: kvn --- .../whitebox/CompilerWhiteBoxTest.java | 31 +++++++++++-------- .../whitebox/MakeMethodNotCompilableTest.java | 7 +++-- 2 files changed, 22 insertions(+), 16 deletions(-) diff --git a/hotspot/test/compiler/whitebox/CompilerWhiteBoxTest.java b/hotspot/test/compiler/whitebox/CompilerWhiteBoxTest.java index 86eb174b6d8..efacb470d89 100644 --- a/hotspot/test/compiler/whitebox/CompilerWhiteBoxTest.java +++ b/hotspot/test/compiler/whitebox/CompilerWhiteBoxTest.java @@ -195,7 +195,6 @@ public abstract class CompilerWhiteBoxTest { * is compiled, or if {@linkplain #method} has zero * compilation level. */ - protected final void checkNotCompiled(int compLevel) { if (WHITE_BOX.isMethodQueuedForCompilation(method)) { throw new RuntimeException(method + " must not be in queue"); @@ -216,24 +215,30 @@ public abstract class CompilerWhiteBoxTest { * compilation level. */ protected final void checkNotCompiled() { - if (WHITE_BOX.isMethodCompiled(method, false)) { - throw new RuntimeException(method + " must be not compiled"); - } - if (WHITE_BOX.getMethodCompilationLevel(method, false) != 0) { - throw new RuntimeException(method + " comp_level must be == 0"); - } - checkNotOsrCompiled(); + checkNotCompiled(true); + checkNotCompiled(false); } - protected final void checkNotOsrCompiled() { + /** + * Checks, that {@linkplain #method} is not (OSR-)compiled. + * + * @param isOsr Check for OSR compilation if true + * @throws RuntimeException if {@linkplain #method} is in compiler queue or + * is compiled, or if {@linkplain #method} has zero + * compilation level. + */ + protected final void checkNotCompiled(boolean isOsr) { + waitBackgroundCompilation(); if (WHITE_BOX.isMethodQueuedForCompilation(method)) { throw new RuntimeException(method + " must not be in queue"); } - if (WHITE_BOX.isMethodCompiled(method, true)) { - throw new RuntimeException(method + " must be not osr_compiled"); + if (WHITE_BOX.isMethodCompiled(method, isOsr)) { + throw new RuntimeException(method + " must not be " + + (isOsr ? "osr_" : "") + "compiled"); } - if (WHITE_BOX.getMethodCompilationLevel(method, true) != 0) { - throw new RuntimeException(method + " osr_comp_level must be == 0"); + if (WHITE_BOX.getMethodCompilationLevel(method, isOsr) != 0) { + throw new RuntimeException(method + (isOsr ? " osr_" : " ") + + "comp_level must be == 0"); } } diff --git a/hotspot/test/compiler/whitebox/MakeMethodNotCompilableTest.java b/hotspot/test/compiler/whitebox/MakeMethodNotCompilableTest.java index e93702bf7f9..6a79d8a5dba 100644 --- a/hotspot/test/compiler/whitebox/MakeMethodNotCompilableTest.java +++ b/hotspot/test/compiler/whitebox/MakeMethodNotCompilableTest.java @@ -132,14 +132,15 @@ public class MakeMethodNotCompilableTest extends CompilerWhiteBoxTest { throw new RuntimeException(method + " is not compilable after clearMethodState()"); } - + // Make method not (OSR-)compilable (depending on testCase.isOsr()) makeNotCompilable(); if (isCompilable()) { throw new RuntimeException(method + " must be not compilable"); } - + // Try to (OSR-)compile method compile(); - checkNotOsrCompiled(); + // Method should not be (OSR-)compiled + checkNotCompiled(testCase.isOsr()); if (isCompilable()) { throw new RuntimeException(method + " must be not compilable"); } From 0d3acc8838ae83c5ef2725300f7af0995fc9cbc4 Mon Sep 17 00:00:00 2001 From: "Daniel D. Daugherty" Date: Wed, 29 Oct 2014 09:19:59 -0700 Subject: [PATCH 37/61] 8061552: Contended Locking speedup PlatformEvent unpark bucket JEP-143/JDK-8046133 - optimization #2 - speedup PlatformEvent unpark bucket. Co-authored-by: Dave Dice Co-authored-by: Karen Kinnear Reviewed-by: acorn, dice, dholmes --- hotspot/src/os/bsd/vm/os_bsd.cpp | 46 ++++++++++++----- hotspot/src/os/linux/vm/os_linux.cpp | 46 ++++++++++++----- hotspot/src/os/solaris/vm/os_solaris.cpp | 66 +++++++++++++++--------- hotspot/src/os/windows/vm/os_windows.cpp | 51 +++++++++++++----- 4 files changed, 147 insertions(+), 62 deletions(-) diff --git a/hotspot/src/os/bsd/vm/os_bsd.cpp b/hotspot/src/os/bsd/vm/os_bsd.cpp index 0d8ba0a2367..24367e9c27f 100644 --- a/hotspot/src/os/bsd/vm/os_bsd.cpp +++ b/hotspot/src/os/bsd/vm/os_bsd.cpp @@ -4118,7 +4118,18 @@ void os::pause() { } -// Refer to the comments in os_solaris.cpp park-unpark. +// Refer to the comments in os_solaris.cpp park-unpark. The next two +// comment paragraphs are worth repeating here: +// +// Assumption: +// Only one parker can exist on an event, which is why we allocate +// them per-thread. Multiple unparkers can coexist. +// +// _Event serves as a restricted-range semaphore. +// -1 : thread is blocked, i.e. there is a waiter +// 0 : neutral: thread is running or ready, +// could have been signaled after a wait started +// 1 : signaled - thread is running or ready // // Beware -- Some versions of NPTL embody a flaw where pthread_cond_timedwait() can // hang indefinitely. For instance NPTL 0.60 on 2.4.21-4ELsmp is vulnerable. @@ -4203,6 +4214,11 @@ static struct timespec* compute_abstime(struct timespec* abstime, } void os::PlatformEvent::park() { // AKA "down()" + // Transitions for _Event: + // -1 => -1 : illegal + // 1 => 0 : pass - return immediately + // 0 => -1 : block; then set _Event to 0 before returning + // Invariant: Only the thread associated with the Event/PlatformEvent // may call park(). // TODO: assert that _Assoc != NULL or _Assoc == Self @@ -4240,6 +4256,11 @@ void os::PlatformEvent::park() { // AKA "down()" } int os::PlatformEvent::park(jlong millis) { + // Transitions for _Event: + // -1 => -1 : illegal + // 1 => 0 : pass - return immediately + // 0 => -1 : block; then set _Event to 0 before returning + guarantee(_nParked == 0, "invariant"); int v; @@ -4303,11 +4324,11 @@ int os::PlatformEvent::park(jlong millis) { void os::PlatformEvent::unpark() { // Transitions for _Event: - // 0 :=> 1 - // 1 :=> 1 - // -1 :=> either 0 or 1; must signal target thread - // That is, we can safely transition _Event from -1 to either - // 0 or 1. + // 0 => 1 : just return + // 1 => 1 : just return + // -1 => either 0 or 1; must signal target thread + // That is, we can safely transition _Event from -1 to either + // 0 or 1. // See also: "Semaphores in Plan 9" by Mullender & Cox // // Note: Forcing a transition from "-1" to "1" on an unpark() means @@ -4330,15 +4351,16 @@ void os::PlatformEvent::unpark() { status = pthread_mutex_unlock(_mutex); assert_status(status == 0, status, "mutex_unlock"); if (AnyWaiters != 0) { + // Note that we signal() *after* dropping the lock for "immortal" Events. + // This is safe and avoids a common class of futile wakeups. In rare + // circumstances this can cause a thread to return prematurely from + // cond_{timed}wait() but the spurious wakeup is benign and the victim + // will simply re-test the condition and re-park itself. + // This provides particular benefit if the underlying platform does not + // provide wait morphing. status = pthread_cond_signal(_cond); assert_status(status == 0, status, "cond_signal"); } - - // Note that we signal() _after dropping the lock for "immortal" Events. - // This is safe and avoids a common class of futile wakeups. In rare - // circumstances this can cause a thread to return prematurely from - // cond_{timed}wait() but the spurious wakeup is benign and the victim will - // simply re-test the condition and re-park itself. } diff --git a/hotspot/src/os/linux/vm/os_linux.cpp b/hotspot/src/os/linux/vm/os_linux.cpp index 186d5a811a6..55c00068387 100644 --- a/hotspot/src/os/linux/vm/os_linux.cpp +++ b/hotspot/src/os/linux/vm/os_linux.cpp @@ -5415,7 +5415,18 @@ void os::pause() { } -// Refer to the comments in os_solaris.cpp park-unpark. +// Refer to the comments in os_solaris.cpp park-unpark. The next two +// comment paragraphs are worth repeating here: +// +// Assumption: +// Only one parker can exist on an event, which is why we allocate +// them per-thread. Multiple unparkers can coexist. +// +// _Event serves as a restricted-range semaphore. +// -1 : thread is blocked, i.e. there is a waiter +// 0 : neutral: thread is running or ready, +// could have been signaled after a wait started +// 1 : signaled - thread is running or ready // // Beware -- Some versions of NPTL embody a flaw where pthread_cond_timedwait() can // hang indefinitely. For instance NPTL 0.60 on 2.4.21-4ELsmp is vulnerable. @@ -5514,6 +5525,11 @@ static struct timespec* compute_abstime(timespec* abstime, jlong millis) { } void os::PlatformEvent::park() { // AKA "down()" + // Transitions for _Event: + // -1 => -1 : illegal + // 1 => 0 : pass - return immediately + // 0 => -1 : block; then set _Event to 0 before returning + // Invariant: Only the thread associated with the Event/PlatformEvent // may call park(). // TODO: assert that _Assoc != NULL or _Assoc == Self @@ -5551,6 +5567,11 @@ void os::PlatformEvent::park() { // AKA "down()" } int os::PlatformEvent::park(jlong millis) { + // Transitions for _Event: + // -1 => -1 : illegal + // 1 => 0 : pass - return immediately + // 0 => -1 : block; then set _Event to 0 before returning + guarantee(_nParked == 0, "invariant"); int v; @@ -5614,11 +5635,11 @@ int os::PlatformEvent::park(jlong millis) { void os::PlatformEvent::unpark() { // Transitions for _Event: - // 0 :=> 1 - // 1 :=> 1 - // -1 :=> either 0 or 1; must signal target thread - // That is, we can safely transition _Event from -1 to either - // 0 or 1. + // 0 => 1 : just return + // 1 => 1 : just return + // -1 => either 0 or 1; must signal target thread + // That is, we can safely transition _Event from -1 to either + // 0 or 1. // See also: "Semaphores in Plan 9" by Mullender & Cox // // Note: Forcing a transition from "-1" to "1" on an unpark() means @@ -5641,15 +5662,16 @@ void os::PlatformEvent::unpark() { status = pthread_mutex_unlock(_mutex); assert_status(status == 0, status, "mutex_unlock"); if (AnyWaiters != 0) { + // Note that we signal() *after* dropping the lock for "immortal" Events. + // This is safe and avoids a common class of futile wakeups. In rare + // circumstances this can cause a thread to return prematurely from + // cond_{timed}wait() but the spurious wakeup is benign and the victim + // will simply re-test the condition and re-park itself. + // This provides particular benefit if the underlying platform does not + // provide wait morphing. status = pthread_cond_signal(_cond); assert_status(status == 0, status, "cond_signal"); } - - // Note that we signal() _after dropping the lock for "immortal" Events. - // This is safe and avoids a common class of futile wakeups. In rare - // circumstances this can cause a thread to return prematurely from - // cond_{timed}wait() but the spurious wakeup is benign and the victim will - // simply re-test the condition and re-park itself. } diff --git a/hotspot/src/os/solaris/vm/os_solaris.cpp b/hotspot/src/os/solaris/vm/os_solaris.cpp index dddb4e7e567..6ff3fd0d129 100644 --- a/hotspot/src/os/solaris/vm/os_solaris.cpp +++ b/hotspot/src/os/solaris/vm/os_solaris.cpp @@ -5372,31 +5372,32 @@ extern "C" { // to immediately return 0 your code should still work, // albeit degenerating to a spin loop. // -// An interesting optimization for park() is to use a trylock() -// to attempt to acquire the mutex. If the trylock() fails -// then we know that a concurrent unpark() operation is in-progress. -// in that case the park() code could simply set _count to 0 -// and return immediately. The subsequent park() operation *might* -// return immediately. That's harmless as the caller of park() is -// expected to loop. By using trylock() we will have avoided a -// avoided a context switch caused by contention on the per-thread mutex. +// In a sense, park()-unpark() just provides more polite spinning +// and polling with the key difference over naive spinning being +// that a parked thread needs to be explicitly unparked() in order +// to wake up and to poll the underlying condition. // -// TODO-FIXME: -// 1. Reconcile Doug's JSR166 j.u.c park-unpark with the -// objectmonitor implementation. -// 2. Collapse the JSR166 parker event, and the -// objectmonitor ParkEvent into a single "Event" construct. -// 3. In park() and unpark() add: -// assert (Thread::current() == AssociatedWith). -// 4. add spurious wakeup injection on a -XX:EarlyParkReturn=N switch. -// 1-out-of-N park() operations will return immediately. +// Assumption: +// Only one parker can exist on an event, which is why we allocate +// them per-thread. Multiple unparkers can coexist. // // _Event transitions in park() // -1 => -1 : illegal // 1 => 0 : pass - return immediately -// 0 => -1 : block +// 0 => -1 : block; then set _Event to 0 before returning +// +// _Event transitions in unpark() +// 0 => 1 : just return +// 1 => 1 : just return +// -1 => either 0 or 1; must signal target thread +// That is, we can safely transition _Event from -1 to either +// 0 or 1. // // _Event serves as a restricted-range semaphore. +// -1 : thread is blocked, i.e. there is a waiter +// 0 : neutral: thread is running or ready, +// could have been signaled after a wait started +// 1 : signaled - thread is running or ready // // Another possible encoding of _Event would be with // explicit "PARKED" == 01b and "SIGNALED" == 10b bits. @@ -5456,6 +5457,11 @@ static timestruc_t* compute_abstime(timestruc_t* abstime, jlong millis) { } void os::PlatformEvent::park() { // AKA: down() + // Transitions for _Event: + // -1 => -1 : illegal + // 1 => 0 : pass - return immediately + // 0 => -1 : block; then set _Event to 0 before returning + // Invariant: Only the thread associated with the Event/PlatformEvent // may call park(). assert(_nParked == 0, "invariant"); @@ -5497,6 +5503,11 @@ void os::PlatformEvent::park() { // AKA: down() } int os::PlatformEvent::park(jlong millis) { + // Transitions for _Event: + // -1 => -1 : illegal + // 1 => 0 : pass - return immediately + // 0 => -1 : block; then set _Event to 0 before returning + guarantee(_nParked == 0, "invariant"); int v; for (;;) { @@ -5542,11 +5553,11 @@ int os::PlatformEvent::park(jlong millis) { void os::PlatformEvent::unpark() { // Transitions for _Event: - // 0 :=> 1 - // 1 :=> 1 - // -1 :=> either 0 or 1; must signal target thread - // That is, we can safely transition _Event from -1 to either - // 0 or 1. + // 0 => 1 : just return + // 1 => 1 : just return + // -1 => either 0 or 1; must signal target thread + // That is, we can safely transition _Event from -1 to either + // 0 or 1. // See also: "Semaphores in Plan 9" by Mullender & Cox // // Note: Forcing a transition from "-1" to "1" on an unpark() means @@ -5566,8 +5577,13 @@ void os::PlatformEvent::unpark() { assert_status(status == 0, status, "mutex_unlock"); guarantee(AnyWaiters == 0 || AnyWaiters == 1, "invariant"); if (AnyWaiters != 0) { - // We intentional signal *after* dropping the lock - // to avoid a common class of futile wakeups. + // Note that we signal() *after* dropping the lock for "immortal" Events. + // This is safe and avoids a common class of futile wakeups. In rare + // circumstances this can cause a thread to return prematurely from + // cond_{timed}wait() but the spurious wakeup is benign and the victim + // will simply re-test the condition and re-park itself. + // This provides particular benefit if the underlying platform does not + // provide wait morphing. status = os::Solaris::cond_signal(_cond); assert_status(status == 0, status, "cond_signal"); } diff --git a/hotspot/src/os/windows/vm/os_windows.cpp b/hotspot/src/os/windows/vm/os_windows.cpp index cc3f8f75832..922af512856 100644 --- a/hotspot/src/os/windows/vm/os_windows.cpp +++ b/hotspot/src/os/windows/vm/os_windows.cpp @@ -4792,27 +4792,46 @@ bool os::WatcherThreadCrashProtection::call(os::CrashProtectionCallback& cb) { // 3. Collapse the interrupt_event, the JSR166 parker event, and the objectmonitor ParkEvent // into a single win32 CreateEvent() handle. // +// Assumption: +// Only one parker can exist on an event, which is why we allocate +// them per-thread. Multiple unparkers can coexist. +// // _Event transitions in park() // -1 => -1 : illegal // 1 => 0 : pass - return immediately -// 0 => -1 : block +// 0 => -1 : block; then set _Event to 0 before returning // -// _Event serves as a restricted-range semaphore : -// -1 : thread is blocked -// 0 : neutral - thread is running or ready -// 1 : signaled - thread is running or ready +// _Event transitions in unpark() +// 0 => 1 : just return +// 1 => 1 : just return +// -1 => either 0 or 1; must signal target thread +// That is, we can safely transition _Event from -1 to either +// 0 or 1. +// +// _Event serves as a restricted-range semaphore. +// -1 : thread is blocked, i.e. there is a waiter +// 0 : neutral: thread is running or ready, +// could have been signaled after a wait started +// 1 : signaled - thread is running or ready +// +// Another possible encoding of _Event would be with +// explicit "PARKED" == 01b and "SIGNALED" == 10b bits. // -// Another possible encoding of _Event would be -// with explicit "PARKED" and "SIGNALED" bits. int os::PlatformEvent::park(jlong Millis) { + // Transitions for _Event: + // -1 => -1 : illegal + // 1 => 0 : pass - return immediately + // 0 => -1 : block; then set _Event to 0 before returning + guarantee(_ParkHandle != NULL , "Invariant"); guarantee(Millis > 0 , "Invariant"); - int v; // CONSIDER: defer assigning a CreateEvent() handle to the Event until // the initial park() operation. + // Consider: use atomic decrement instead of CAS-loop + int v; for (;;) { v = _Event; if (Atomic::cmpxchg(v-1, &_Event, v) == v) break; @@ -4860,9 +4879,15 @@ int os::PlatformEvent::park(jlong Millis) { } void os::PlatformEvent::park() { + // Transitions for _Event: + // -1 => -1 : illegal + // 1 => 0 : pass - return immediately + // 0 => -1 : block; then set _Event to 0 before returning + guarantee(_ParkHandle != NULL, "Invariant"); // Invariant: Only the thread associated with the Event/PlatformEvent // may call park(). + // Consider: use atomic decrement instead of CAS-loop int v; for (;;) { v = _Event; @@ -4891,11 +4916,11 @@ void os::PlatformEvent::unpark() { guarantee(_ParkHandle != NULL, "Invariant"); // Transitions for _Event: - // 0 :=> 1 - // 1 :=> 1 - // -1 :=> either 0 or 1; must signal target thread - // That is, we can safely transition _Event from -1 to either - // 0 or 1. + // 0 => 1 : just return + // 1 => 1 : just return + // -1 => either 0 or 1; must signal target thread + // That is, we can safely transition _Event from -1 to either + // 0 or 1. // See also: "Semaphores in Plan 9" by Mullender & Cox // // Note: Forcing a transition from "-1" to "1" on an unpark() means From 14e05b48582bed6e3ab42daf99ea82bec901d59c Mon Sep 17 00:00:00 2001 From: Ivan Gerasimov Date: Wed, 29 Oct 2014 09:53:56 -0700 Subject: [PATCH 38/61] 8059533: (process) Make exiting process wait for exiting threads [win] Reviewed-by: dholmes, dcubed --- hotspot/src/os/windows/vm/os_windows.cpp | 160 ++++++++++++++++------- 1 file changed, 113 insertions(+), 47 deletions(-) diff --git a/hotspot/src/os/windows/vm/os_windows.cpp b/hotspot/src/os/windows/vm/os_windows.cpp index 922af512856..e63a2eb32de 100644 --- a/hotspot/src/os/windows/vm/os_windows.cpp +++ b/hotspot/src/os/windows/vm/os_windows.cpp @@ -436,9 +436,9 @@ static unsigned __stdcall java_start(Thread* thread) { } // Diagnostic code to investigate JDK-6573254 - int res = 90115; // non-java thread + int res = 50115; // non-java thread if (thread->is_Java_thread()) { - res = 60115; // java thread + res = 40115; // java thread } // Install a win32 structured exception handler around every thread created @@ -3740,68 +3740,134 @@ HINSTANCE os::win32::load_Windows_dll(const char* name, char *ebuf, return NULL; } -#define MIN_EXIT_MUTEXES 1 -#define MAX_EXIT_MUTEXES 16 +#define MAX_EXIT_HANDLES 16 +#define EXIT_TIMEOUT 1000 /* 1 sec */ -struct ExitMutexes { - DWORD count; - HANDLE handles[MAX_EXIT_MUTEXES]; -}; - -static BOOL CALLBACK init_muts_call(PINIT_ONCE, PVOID ppmuts, PVOID*) { - static ExitMutexes muts; - - muts.count = os::processor_count(); - if (muts.count < MIN_EXIT_MUTEXES) { - muts.count = MIN_EXIT_MUTEXES; - } else if (muts.count > MAX_EXIT_MUTEXES) { - muts.count = MAX_EXIT_MUTEXES; - } - - for (DWORD i = 0; i < muts.count; ++i) { - muts.handles[i] = CreateMutex(NULL, FALSE, NULL); - if (muts.handles[i] == NULL) { - return FALSE; - } - } - *((ExitMutexes**)ppmuts) = &muts; +static BOOL CALLBACK init_crit_sect_call(PINIT_ONCE, PVOID pcrit_sect, PVOID*) { + InitializeCriticalSection((CRITICAL_SECTION*)pcrit_sect); return TRUE; } int os::win32::exit_process_or_thread(Ept what, int exit_code) { - if (os::win32::has_exit_bug()) { - static INIT_ONCE init_once_muts = INIT_ONCE_STATIC_INIT; - static ExitMutexes* pmuts; + // Basic approach: + // - Each exiting thread registers its intent to exit and then does so. + // - A thread trying to terminate the process must wait for all + // threads currently exiting to complete their exit. - if (!InitOnceExecuteOnce(&init_once_muts, init_muts_call, &pmuts, NULL)) { - warning("ExitMutex initialization failed in %s: %d\n", __FILE__, __LINE__); - } else if (WaitForMultipleObjects(pmuts->count, pmuts->handles, - (what != EPT_THREAD), // exiting process waits for all mutexes - INFINITE) == WAIT_FAILED) { - warning("ExitMutex acquisition failed in %s: %d\n", __FILE__, __LINE__); + if (os::win32::has_exit_bug()) { + // The array holds handles of the threads that have started exiting by calling + // _endthreadex(). + // Should be large enough to avoid blocking the exiting thread due to lack of + // a free slot. + static HANDLE handles[MAX_EXIT_HANDLES]; + static int handle_count = 0; + + static INIT_ONCE init_once_crit_sect = INIT_ONCE_STATIC_INIT; + static CRITICAL_SECTION crit_sect; + int i, j; + DWORD res; + HANDLE hproc, hthr; + + // The first thread that reached this point, initializes the critical section. + if (!InitOnceExecuteOnce(&init_once_crit_sect, init_crit_sect_call, &crit_sect, NULL)) { + warning("crit_sect initialization failed in %s: %d\n", __FILE__, __LINE__); + } else { + EnterCriticalSection(&crit_sect); + + if (what == EPT_THREAD) { + // Remove from the array those handles of the threads that have completed exiting. + for (i = 0, j = 0; i < handle_count; ++i) { + res = WaitForSingleObject(handles[i], 0 /* don't wait */); + if (res == WAIT_TIMEOUT) { + handles[j++] = handles[i]; + } else { + if (res != WAIT_OBJECT_0) { + warning("WaitForSingleObject failed in %s: %d\n", __FILE__, __LINE__); + // Don't keep the handle, if we failed waiting for it. + } + CloseHandle(handles[i]); + } + } + + // If there's no free slot in the array of the kept handles, we'll have to + // wait until at least one thread completes exiting. + if ((handle_count = j) == MAX_EXIT_HANDLES) { + res = WaitForMultipleObjects(MAX_EXIT_HANDLES, handles, FALSE, EXIT_TIMEOUT); + if (res >= WAIT_OBJECT_0 && res < (WAIT_OBJECT_0 + MAX_EXIT_HANDLES)) { + i = (res - WAIT_OBJECT_0); + handle_count = MAX_EXIT_HANDLES - 1; + for (; i < handle_count; ++i) { + handles[i] = handles[i + 1]; + } + } else { + warning("WaitForMultipleObjects failed in %s: %d\n", __FILE__, __LINE__); + // Don't keep handles, if we failed waiting for them. + for (i = 0; i < MAX_EXIT_HANDLES; ++i) { + CloseHandle(handles[i]); + } + handle_count = 0; + } + } + + // Store a duplicate of the current thread handle in the array of handles. + hproc = GetCurrentProcess(); + hthr = GetCurrentThread(); + if (!DuplicateHandle(hproc, hthr, hproc, &handles[handle_count], + 0, FALSE, DUPLICATE_SAME_ACCESS)) { + warning("DuplicateHandle failed in %s: %d\n", __FILE__, __LINE__); + } else { + ++handle_count; + } + + // The current exiting thread has stored its handle in the array, and now + // should leave the critical section before calling _endthreadex(). + + } else { // what != EPT_THREAD + if (handle_count > 0) { + // Before ending the process, make sure all the threads that had called + // _endthreadex() completed. + res = WaitForMultipleObjects(handle_count, handles, TRUE, EXIT_TIMEOUT); + if (res == WAIT_FAILED) { + warning("WaitForMultipleObjects failed in %s: %d\n", __FILE__, __LINE__); + } + for (i = 0; i < handle_count; ++i) { + CloseHandle(handles[i]); + } + handle_count = 0; + } + + // End the process, not leaving critical section. + // This makes sure no other thread executes exit-related code at the same + // time, thus a race is avoided. + if (what == EPT_PROCESS) { + ::exit(exit_code); + } else { + _exit(exit_code); + } + } + + LeaveCriticalSection(&crit_sect); } } - switch (what) { - case EPT_THREAD: + // We are here if either + // - there's no 'race at exit' bug on this OS release; + // - initialization of the critical section failed (unlikely); + // - the current thread has stored its handle and left the critical section. + if (what == EPT_THREAD) { _endthreadex((unsigned)exit_code); - break; - - case EPT_PROCESS: + } else if (what == EPT_PROCESS) { ::exit(exit_code); - break; - - case EPT_PROCESS_DIE: + } else { _exit(exit_code); - break; } - // should not reach here + // Should not reach here return exit_code; } -#undef MIN_EXIT_MUTEXES -#undef MAX_EXIT_MUTEXES +#undef MAX_EXIT_HANDLES +#undef EXIT_TIMEOUT void os::win32::setmode_streams() { _setmode(_fileno(stdin), _O_BINARY); From b301b207b30bac2cbac2ce635b2b6db59be25e6c Mon Sep 17 00:00:00 2001 From: Alex Schenkman Date: Tue, 28 Oct 2014 12:28:58 +0100 Subject: [PATCH 39/61] 8062135: serviceability/threads/TestFalseDeadLock.java should be quarantined Reviewed-by: sla --- hotspot/test/serviceability/threads/TestFalseDeadLock.java | 1 + 1 file changed, 1 insertion(+) diff --git a/hotspot/test/serviceability/threads/TestFalseDeadLock.java b/hotspot/test/serviceability/threads/TestFalseDeadLock.java index 7ee0fe1116f..113a09d1d25 100644 --- a/hotspot/test/serviceability/threads/TestFalseDeadLock.java +++ b/hotspot/test/serviceability/threads/TestFalseDeadLock.java @@ -27,6 +27,7 @@ import java.util.Random; /* * @test + * @ignore 8061157 * @bug 8016304 * @summary Make sure no deadlock is reported for this program which has no deadlocks. * @run main/othervm TestFalseDeadLock From 4c036f57309bd323f50d39e61802e02efe8c7c58 Mon Sep 17 00:00:00 2001 From: Coleen Phillimore Date: Thu, 30 Oct 2014 18:38:42 -0400 Subject: [PATCH 40/61] 8037842: Failing to allocate MethodCounters and MDO causes a serious performance drop Stop allocating compiler profiling metadata when metaspace is full. Reviewed-by: kvn, anoll --- .../share/vm/classfile/classLoaderData.cpp | 8 +++++- .../share/vm/classfile/classLoaderData.hpp | 6 +++++ .../src/share/vm/compiler/compileBroker.cpp | 20 ++++++++++++++ .../src/share/vm/compiler/compileBroker.hpp | 5 +++- hotspot/src/share/vm/oops/method.cpp | 27 +++++++++++++++++-- 5 files changed, 62 insertions(+), 4 deletions(-) diff --git a/hotspot/src/share/vm/classfile/classLoaderData.cpp b/hotspot/src/share/vm/classfile/classLoaderData.cpp index 380c3dea10c..ff7b3533cba 100644 --- a/hotspot/src/share/vm/classfile/classLoaderData.cpp +++ b/hotspot/src/share/vm/classfile/classLoaderData.cpp @@ -553,6 +553,7 @@ ClassLoaderData* ClassLoaderDataGraph::_saved_unloading = NULL; ClassLoaderData* ClassLoaderDataGraph::_saved_head = NULL; bool ClassLoaderDataGraph::_should_purge = false; +bool ClassLoaderDataGraph::_metaspace_oom = false; // Add a new class loader data node to the list. Assign the newly created // ClassLoaderData into the java/lang/ClassLoader object as a hidden field @@ -804,12 +805,17 @@ void ClassLoaderDataGraph::purge() { ClassLoaderData* list = _unloading; _unloading = NULL; ClassLoaderData* next = list; + bool classes_unloaded = false; while (next != NULL) { ClassLoaderData* purge_me = next; next = purge_me->next(); delete purge_me; + classes_unloaded = true; + } + if (classes_unloaded) { + Metaspace::purge(); + set_metaspace_oom(false); } - Metaspace::purge(); } void ClassLoaderDataGraph::post_class_unload_events(void) { diff --git a/hotspot/src/share/vm/classfile/classLoaderData.hpp b/hotspot/src/share/vm/classfile/classLoaderData.hpp index 231c135f435..17eab14b672 100644 --- a/hotspot/src/share/vm/classfile/classLoaderData.hpp +++ b/hotspot/src/share/vm/classfile/classLoaderData.hpp @@ -68,6 +68,9 @@ class ClassLoaderDataGraph : public AllStatic { static ClassLoaderData* _saved_head; static ClassLoaderData* _saved_unloading; static bool _should_purge; + // OOM has been seen in metaspace allocation. Used to prevent some + // allocations until class unloading + static bool _metaspace_oom; static ClassLoaderData* add(Handle class_loader, bool anonymous, TRAPS); static void post_class_unload_events(void); @@ -107,6 +110,9 @@ class ClassLoaderDataGraph : public AllStatic { } } + static bool has_metaspace_oom() { return _metaspace_oom; } + static void set_metaspace_oom(bool value) { _metaspace_oom = value; } + static void free_deallocate_lists(); static void dump_on(outputStream * const out) PRODUCT_RETURN; diff --git a/hotspot/src/share/vm/compiler/compileBroker.cpp b/hotspot/src/share/vm/compiler/compileBroker.cpp index 1eccfde6fd0..62ef6029c9f 100644 --- a/hotspot/src/share/vm/compiler/compileBroker.cpp +++ b/hotspot/src/share/vm/compiler/compileBroker.cpp @@ -187,6 +187,14 @@ class CompilationLog : public StringEventLog { lm.print("\n"); log(thread, "%s", (const char*)lm); } + + void log_metaspace_failure(const char* reason) { + ResourceMark rm; + StringLogMessage lm; + lm.print("%4d COMPILE PROFILING SKIPPED: %s", -1, reason); + lm.print("\n"); + log(JavaThread::current(), "%s", (const char*)lm); + } }; static CompilationLog* _compilation_log = NULL; @@ -1843,6 +1851,18 @@ void CompileBroker::init_compiler_thread_log() { warning("Cannot open log file: %s", file_name); } +void CompileBroker::log_metaspace_failure() { + const char* message = "some methods may not be compiled because metaspace " + "is out of memory"; + if (_compilation_log != NULL) { + _compilation_log->log_metaspace_failure(message); + } + if (PrintCompilation) { + tty->print_cr("COMPILE PROFILING SKIPPED: %s", message); + } +} + + // ------------------------------------------------------------------ // CompileBroker::set_should_block // diff --git a/hotspot/src/share/vm/compiler/compileBroker.hpp b/hotspot/src/share/vm/compiler/compileBroker.hpp index c199cb1480d..2433df196c6 100644 --- a/hotspot/src/share/vm/compiler/compileBroker.hpp +++ b/hotspot/src/share/vm/compiler/compileBroker.hpp @@ -1,5 +1,5 @@ /* - * Copyright (c) 1999, 2013, Oracle and/or its affiliates. All rights reserved. + * Copyright (c) 1999, 2014, Oracle and/or its affiliates. All rights reserved. * DO NOT ALTER OR REMOVE COPYRIGHT NOTICES OR THIS FILE HEADER. * * This code is free software; you can redistribute it and/or modify it @@ -473,6 +473,9 @@ class CompileBroker: AllStatic { static int get_sum_nmethod_code_size() { return _sum_nmethod_code_size; } static long get_peak_compilation_time() { return _peak_compilation_time; } static long get_total_compilation_time() { return _t_total_compilation.milliseconds(); } + + // Log that compilation profiling is skipped because metaspace is full. + static void log_metaspace_failure(); }; #endif // SHARE_VM_COMPILER_COMPILEBROKER_HPP diff --git a/hotspot/src/share/vm/oops/method.cpp b/hotspot/src/share/vm/oops/method.cpp index ef0349eeb26..dc26304685a 100644 --- a/hotspot/src/share/vm/oops/method.cpp +++ b/hotspot/src/share/vm/oops/method.cpp @@ -368,6 +368,13 @@ void Method::print_invocation_count() { // Build a MethodData* object to hold information about this method // collected in the interpreter. void Method::build_interpreter_method_data(methodHandle method, TRAPS) { + // Do not profile the method if metaspace has hit an OOM previously + // allocating profiling data. Callers clear pending exception so don't + // add one here. + if (ClassLoaderDataGraph::has_metaspace_oom()) { + return; + } + // Do not profile method if current thread holds the pending list lock, // which avoids deadlock for acquiring the MethodData_lock. if (InstanceRefKlass::owns_pending_list_lock((JavaThread*)THREAD)) { @@ -379,7 +386,13 @@ void Method::build_interpreter_method_data(methodHandle method, TRAPS) { MutexLocker ml(MethodData_lock, THREAD); if (method->method_data() == NULL) { ClassLoaderData* loader_data = method->method_holder()->class_loader_data(); - MethodData* method_data = MethodData::allocate(loader_data, method, CHECK); + MethodData* method_data = MethodData::allocate(loader_data, method, THREAD); + if (HAS_PENDING_EXCEPTION) { + CompileBroker::log_metaspace_failure(); + ClassLoaderDataGraph::set_metaspace_oom(true); + return; // return the exception (which is cleared) + } + method->set_method_data(method_data); if (PrintMethodData && (Verbose || WizardMode)) { ResourceMark rm(THREAD); @@ -392,9 +405,19 @@ void Method::build_interpreter_method_data(methodHandle method, TRAPS) { } MethodCounters* Method::build_method_counters(Method* m, TRAPS) { + // Do not profile the method if metaspace has hit an OOM previously + if (ClassLoaderDataGraph::has_metaspace_oom()) { + return NULL; + } + methodHandle mh(m); ClassLoaderData* loader_data = mh->method_holder()->class_loader_data(); - MethodCounters* counters = MethodCounters::allocate(loader_data, CHECK_NULL); + MethodCounters* counters = MethodCounters::allocate(loader_data, THREAD); + if (HAS_PENDING_EXCEPTION) { + CompileBroker::log_metaspace_failure(); + ClassLoaderDataGraph::set_metaspace_oom(true); + return NULL; // return the exception (which is cleared) + } if (!mh->init_method_counters(counters)) { MetadataFactory::free_metadata(loader_data, counters); } From 24c29c4db4ec8cb410c4b2929b8ed112683f6120 Mon Sep 17 00:00:00 2001 From: Vladimir Kempik Date: Tue, 28 Oct 2014 18:41:34 +0400 Subject: [PATCH 41/61] 8059216: Make PrintGCApplicationStoppedTime print information about stopping threads Reviewed-by: dholmes, brutisso --- hotspot/src/share/vm/services/runtimeService.cpp | 11 +++++++++-- hotspot/src/share/vm/services/runtimeService.hpp | 1 + 2 files changed, 10 insertions(+), 2 deletions(-) diff --git a/hotspot/src/share/vm/services/runtimeService.cpp b/hotspot/src/share/vm/services/runtimeService.cpp index e2b829c41f5..413261b6572 100644 --- a/hotspot/src/share/vm/services/runtimeService.cpp +++ b/hotspot/src/share/vm/services/runtimeService.cpp @@ -38,6 +38,7 @@ PerfCounter* RuntimeService::_sync_time_ticks = NULL; PerfCounter* RuntimeService::_total_safepoints = NULL; PerfCounter* RuntimeService::_safepoint_time_ticks = NULL; PerfCounter* RuntimeService::_application_time_ticks = NULL; +double RuntimeService::_last_safepoint_sync_time_sec = 0.0; void RuntimeService::init() { // Make sure the VM version is initialized @@ -96,6 +97,7 @@ void RuntimeService::record_safepoint_begin() { // update the time stamp to begin recording safepoint time _safepoint_timer.update(); + _last_safepoint_sync_time_sec = 0.0; if (UsePerfData) { _total_safepoints->inc(); if (_app_timer.is_updated()) { @@ -108,6 +110,9 @@ void RuntimeService::record_safepoint_synchronized() { if (UsePerfData) { _sync_time_ticks->inc(_safepoint_timer.ticks_since_update()); } + if (PrintGCApplicationStoppedTime) { + _last_safepoint_sync_time_sec = last_safepoint_time_sec(); + } } void RuntimeService::record_safepoint_end() { @@ -119,8 +124,10 @@ void RuntimeService::record_safepoint_end() { gclog_or_tty->date_stamp(PrintGCDateStamps); gclog_or_tty->stamp(PrintGCTimeStamps); gclog_or_tty->print_cr("Total time for which application threads " - "were stopped: %3.7f seconds", - last_safepoint_time_sec()); + "were stopped: %3.7f seconds, " + "Stopping threads took: %3.7f seconds", + last_safepoint_time_sec(), + _last_safepoint_sync_time_sec); } // update the time stamp to begin recording app time diff --git a/hotspot/src/share/vm/services/runtimeService.hpp b/hotspot/src/share/vm/services/runtimeService.hpp index 90981ee2ebe..228f6645f3a 100644 --- a/hotspot/src/share/vm/services/runtimeService.hpp +++ b/hotspot/src/share/vm/services/runtimeService.hpp @@ -37,6 +37,7 @@ private: static TimeStamp _safepoint_timer; static TimeStamp _app_timer; + static double _last_safepoint_sync_time_sec; public: static void init(); From 1c866d843306e4e85601df2f15afd86ef035e8b5 Mon Sep 17 00:00:00 2001 From: Tobias Hartmann Date: Tue, 28 Oct 2014 16:44:39 +0100 Subject: [PATCH 42/61] 8062250: [TESTBUG] compiler/codecache/CheckSegmentedCodeCache.java fails after CodeCacheMinimumFreeSpace removal Adapted calculation of minimum code cache size after CodeCacheMinimumFreeSpace was removed by JDK-8046809. Reviewed-by: kvn, anoll --- hotspot/test/TEST.groups | 1 + hotspot/test/compiler/codecache/CheckSegmentedCodeCache.java | 5 ++--- 2 files changed, 3 insertions(+), 3 deletions(-) diff --git a/hotspot/test/TEST.groups b/hotspot/test/TEST.groups index 01cd4dbcecb..051e2e3fa3b 100644 --- a/hotspot/test/TEST.groups +++ b/hotspot/test/TEST.groups @@ -444,6 +444,7 @@ hotspot_compiler_3 = \ compiler/arraycopy/TestMissingControl.java \ compiler/ciReplay/TestVM_no_comp_level.sh \ compiler/classUnloading/anonymousClass/TestAnonymousClassUnloading.java \ + compiler/codecache/CheckSegmentedCodeCache.java \ compiler/codecache/CheckUpperLimit.java \ compiler/codegen/ \ compiler/cpuflags/RestoreMXCSR.java \ diff --git a/hotspot/test/compiler/codecache/CheckSegmentedCodeCache.java b/hotspot/test/compiler/codecache/CheckSegmentedCodeCache.java index 9784b4835a3..da739765bea 100644 --- a/hotspot/test/compiler/codecache/CheckSegmentedCodeCache.java +++ b/hotspot/test/compiler/codecache/CheckSegmentedCodeCache.java @@ -139,9 +139,8 @@ public class CheckSegmentedCodeCache { // Fails if not enough space for VM internal code long minUseSpace = WHITE_BOX.getUintxVMFlag("CodeCacheMinimumUseSpace"); - long minFreeSpace = WHITE_BOX.getUintxVMFlag("CodeCacheMinimumFreeSpace"); - // minimum size: (CodeCacheMinimumUseSpace DEBUG_ONLY(* 3)) + CodeCacheMinimumFreeSpace - long minSize = (Platform.isDebugBuild() ? 3 : 1) * minUseSpace + minFreeSpace; + // minimum size: CodeCacheMinimumUseSpace DEBUG_ONLY(* 3) + long minSize = (Platform.isDebugBuild() ? 3 : 1) * minUseSpace; pb = ProcessTools.createJavaProcessBuilder("-XX:+SegmentedCodeCache", "-XX:ReservedCodeCacheSize=" + minSize, "-XX:InitialCodeCacheSize=100K"); From 897d6c5c9bd538c9dd4dca3214295e67ec23acb5 Mon Sep 17 00:00:00 2001 From: Nils Eliasson Date: Tue, 28 Oct 2014 20:16:08 +0100 Subject: [PATCH 43/61] 8061250: serviceability/dcmd/compiler/CompilerQueueTest.java failed Fixed logging to avoid parsing mistake and added test case. Reviewed-by: kvn, twisti --- .../test/serviceability/dcmd/compiler/CompilerQueueTest.java | 5 ++++- 1 file changed, 4 insertions(+), 1 deletion(-) diff --git a/hotspot/test/serviceability/dcmd/compiler/CompilerQueueTest.java b/hotspot/test/serviceability/dcmd/compiler/CompilerQueueTest.java index b2923dfb69a..1a96dd8c200 100644 --- a/hotspot/test/serviceability/dcmd/compiler/CompilerQueueTest.java +++ b/hotspot/test/serviceability/dcmd/compiler/CompilerQueueTest.java @@ -27,6 +27,7 @@ * @library .. * @build DcmdUtil CompilerQueueTest * @run main CompilerQueueTest + * @run main/othervm -XX:-TieredCompilation CompilerQueueTest * @run main/othervm -Xint CompilerQueueTest * @summary Test of diagnostic command Compiler.queue */ @@ -87,7 +88,9 @@ public class CompilerQueueTest { } private static void validateMethodLine(String str) throws Exception { - String name = str.substring(19); + // Skip until package/class name begins. Trim to remove whitespace that + // may differ. + String name = str.substring(14).trim(); int sep = name.indexOf("::"); if (sep == -1) { throw new Exception("Failed dcmd queue, didn't find separator :: in: " + name); From 63080521d711e8ac98411c3a89be3fb557e7c0ea Mon Sep 17 00:00:00 2001 From: Coleen Phillimore Date: Tue, 28 Oct 2014 17:02:08 -0400 Subject: [PATCH 44/61] 8058093: Test nsk/stress/jck60/jck60014: assert in src/share/vm/oops/constantPool.cpp: should not be resolved otherwise 8044209: nsk/split_verifier/security/coglio06 fails with exit code 97 - missing 'prohibited package name' Fix resolution error saving. Reviewed-by: lfoltan, sspitsyn, hseigel, ctornqvi --- hotspot/src/share/vm/oops/constantPool.cpp | 49 ++++++++++++------- hotspot/src/share/vm/oops/constantPool.hpp | 11 ++++- .../src/share/vm/runtime/deoptimization.cpp | 2 +- 3 files changed, 41 insertions(+), 21 deletions(-) diff --git a/hotspot/src/share/vm/oops/constantPool.cpp b/hotspot/src/share/vm/oops/constantPool.cpp index fb474cec05b..d547398dfae 100644 --- a/hotspot/src/share/vm/oops/constantPool.cpp +++ b/hotspot/src/share/vm/oops/constantPool.cpp @@ -206,7 +206,8 @@ void ConstantPool::trace_class_resolution(constantPoolHandle this_cp, KlassHandl } } -Klass* ConstantPool::klass_at_impl(constantPoolHandle this_cp, int which, TRAPS) { +Klass* ConstantPool::klass_at_impl(constantPoolHandle this_cp, int which, + bool save_resolution_error, TRAPS) { assert(THREAD->is_Java_thread(), "must be a Java thread"); // A resolved constantPool entry will contain a Klass*, otherwise a Symbol*. @@ -249,7 +250,18 @@ Klass* ConstantPool::klass_at_impl(constantPoolHandle this_cp, int which, TRAPS) // Failed to resolve class. We must record the errors so that subsequent attempts // to resolve this constant pool entry fail with the same error (JVMS 5.4.3). if (HAS_PENDING_EXCEPTION) { - save_and_throw_exception(this_cp, which, constantTag(JVM_CONSTANT_UnresolvedClass), CHECK_0); + if (save_resolution_error) { + save_and_throw_exception(this_cp, which, constantTag(JVM_CONSTANT_UnresolvedClass), CHECK_NULL); + // If CHECK_NULL above doesn't return the exception, that means that + // some other thread has beaten us and has resolved the class. + // To preserve old behavior, we return the resolved class. + entry = this_cp->resolved_klass_at(which); + assert(entry.is_resolved(), "must be resolved if exception was cleared"); + assert(entry.get_klass()->is_klass(), "must be resolved to a klass"); + return entry.get_klass(); + } else { + return NULL; // return the pending exception + } } // Make this class loader depend upon the class loader owning the class reference @@ -260,10 +272,10 @@ Klass* ConstantPool::klass_at_impl(constantPoolHandle this_cp, int which, TRAPS) // skip resolving the constant pool so that this code gets // called the next time some bytecodes refer to this class. trace_class_resolution(this_cp, k); - return k(); - } else { - this_cp->klass_at_put(which, k()); - } + return k(); + } else { + this_cp->klass_at_put(which, k()); + } entry = this_cp->resolved_klass_at(which); assert(entry.is_resolved() && entry.get_klass()->is_klass(), "must be resolved at this point"); @@ -573,24 +585,25 @@ void ConstantPool::save_and_throw_exception(constantPoolHandle this_cp, int whic Symbol* message = exception_message(this_cp, which, tag, PENDING_EXCEPTION); SystemDictionary::add_resolution_error(this_cp, which, error, message); // CAS in the tag. If a thread beat us to registering this error that's fine. - // If another thread resolved the reference, this is an error. The resolution - // must deterministically get an error. So why do we save this? - // We save this because jvmti can add classes to the bootclass path after this - // error, so it needs to get the same error if the error is first. + // If another thread resolved the reference, this is a race condition. This + // thread may have had a security manager or something temporary. + // This doesn't deterministically get an error. So why do we save this? + // We save this because jvmti can add classes to the bootclass path after + // this error, so it needs to get the same error if the error is first. jbyte old_tag = Atomic::cmpxchg((jbyte)error_tag, (jbyte*)this_cp->tag_addr_at(which), (jbyte)tag.value()); - assert(old_tag == error_tag || old_tag == tag.value(), "should not be resolved otherwise"); + if (old_tag != error_tag && old_tag != tag.value()) { + // MethodHandles and MethodType doesn't change to resolved version. + assert(this_cp->tag_at(which).is_klass(), "Wrong tag value"); + // Forget the exception and use the resolved class. + CLEAR_PENDING_EXCEPTION; + } } else { // some other thread put this in error state throw_resolution_error(this_cp, which, CHECK); } - - // This exits with some pending exception - assert(HAS_PENDING_EXCEPTION, "should not be cleared"); } - - // Called to resolve constants in the constant pool and return an oop. // Some constant pool entries cache their resolved oop. This is also // called to create oops from constants to use in arguments for invokedynamic @@ -627,7 +640,7 @@ oop ConstantPool::resolve_constant_at_impl(constantPoolHandle this_cp, int index case JVM_CONSTANT_Class: { assert(cache_index == _no_index_sentinel, "should not have been set"); - Klass* resolved = klass_at_impl(this_cp, index, CHECK_NULL); + Klass* resolved = klass_at_impl(this_cp, index, true, CHECK_NULL); // ldc wants the java mirror. result_oop = resolved->java_mirror(); break; @@ -660,7 +673,7 @@ oop ConstantPool::resolve_constant_at_impl(constantPoolHandle this_cp, int index ref_kind, index, this_cp->method_handle_index_at(index), callee_index, name->as_C_string(), signature->as_C_string()); KlassHandle callee; - { Klass* k = klass_at_impl(this_cp, callee_index, CHECK_NULL); + { Klass* k = klass_at_impl(this_cp, callee_index, true, CHECK_NULL); callee = KlassHandle(THREAD, k); } KlassHandle klass(THREAD, this_cp->pool_holder()); diff --git a/hotspot/src/share/vm/oops/constantPool.hpp b/hotspot/src/share/vm/oops/constantPool.hpp index 5e26ec5e622..18b86aa7ac6 100644 --- a/hotspot/src/share/vm/oops/constantPool.hpp +++ b/hotspot/src/share/vm/oops/constantPool.hpp @@ -336,7 +336,13 @@ class ConstantPool : public Metadata { Klass* klass_at(int which, TRAPS) { constantPoolHandle h_this(THREAD, this); - return klass_at_impl(h_this, which, CHECK_NULL); + return klass_at_impl(h_this, which, true, CHECK_NULL); + } + + // Version of klass_at that doesn't save the resolution error, called during deopt + Klass* klass_at_ignore_error(int which, TRAPS) { + constantPoolHandle h_this(THREAD, this); + return klass_at_impl(h_this, which, false, CHECK_NULL); } Symbol* klass_name_at(int which); // Returns the name, w/o resolving. @@ -793,7 +799,8 @@ class ConstantPool : public Metadata { // Implementation of methods that needs an exposed 'this' pointer, in order to // handle GC while executing the method - static Klass* klass_at_impl(constantPoolHandle this_cp, int which, TRAPS); + static Klass* klass_at_impl(constantPoolHandle this_cp, int which, + bool save_resolution_error, TRAPS); static oop string_at_impl(constantPoolHandle this_cp, int which, int obj_index, TRAPS); static void trace_class_resolution(constantPoolHandle this_cp, KlassHandle k); diff --git a/hotspot/src/share/vm/runtime/deoptimization.cpp b/hotspot/src/share/vm/runtime/deoptimization.cpp index b94b7142b7e..95587bff533 100644 --- a/hotspot/src/share/vm/runtime/deoptimization.cpp +++ b/hotspot/src/share/vm/runtime/deoptimization.cpp @@ -1173,7 +1173,7 @@ Deoptimization::get_method_data(JavaThread* thread, methodHandle m, void Deoptimization::load_class_by_index(constantPoolHandle constant_pool, int index, TRAPS) { // in case of an unresolved klass entry, load the class. if (constant_pool->tag_at(index).is_unresolved_klass()) { - Klass* tk = constant_pool->klass_at(index, CHECK); + Klass* tk = constant_pool->klass_at_ignore_error(index, CHECK); return; } From 0aa09022fa336a9775d26e2db59a32287980e305 Mon Sep 17 00:00:00 2001 From: Goetz Lindenmaier Date: Wed, 29 Oct 2014 10:13:24 +0100 Subject: [PATCH 45/61] 8062370: Various minor code improvements A lot of fixes useful to improve the code quality. Reviewed-by: coleenp, dholmes --- .../src/cpu/sparc/vm/interpreterRT_sparc.cpp | 2 +- .../src/cpu/x86/vm/c1_LIRAssembler_x86.cpp | 8 +++---- hotspot/src/cpu/x86/vm/c1_Runtime1_x86.cpp | 2 +- .../src/cpu/x86/vm/interpreterRT_x86_32.cpp | 2 +- .../src/cpu/x86/vm/interpreterRT_x86_64.cpp | 2 +- .../src/cpu/zero/vm/interpreterRT_zero.cpp | 2 +- hotspot/src/os/aix/vm/os_aix.cpp | 3 ++- hotspot/src/os/aix/vm/perfMemory_aix.cpp | 4 ++++ hotspot/src/os/bsd/vm/os_bsd.cpp | 1 + hotspot/src/os/bsd/vm/perfMemory_bsd.cpp | 4 ++++ hotspot/src/os/linux/vm/os_linux.cpp | 13 +++++++--- hotspot/src/os/linux/vm/perfMemory_linux.cpp | 4 ++++ hotspot/src/os/posix/vm/os_posix.cpp | 5 +++- hotspot/src/os/solaris/vm/os_solaris.cpp | 1 + .../src/os/solaris/vm/perfMemory_solaris.cpp | 4 ++++ .../os/windows/vm/attachListener_windows.cpp | 5 +++- hotspot/src/os/windows/vm/os_windows.cpp | 24 +++++++++++++++---- .../src/share/vm/memory/metaspaceShared.cpp | 13 ++++++---- hotspot/src/share/vm/oops/constMethod.hpp | 2 +- hotspot/src/share/vm/oops/instanceKlass.cpp | 2 +- hotspot/src/share/vm/opto/mulnode.cpp | 2 +- hotspot/src/share/vm/prims/jni.cpp | 10 ++++---- hotspot/src/share/vm/prims/jvm.cpp | 9 ++++++- hotspot/src/share/vm/prims/unsafe.cpp | 3 +-- hotspot/src/share/vm/runtime/globals.cpp | 11 ++++----- hotspot/src/share/vm/runtime/java.cpp | 20 ++++++++++++---- hotspot/src/share/vm/runtime/signature.cpp | 2 +- hotspot/src/share/vm/runtime/signature.hpp | 2 +- hotspot/src/share/vm/runtime/thread.cpp | 2 +- hotspot/src/share/vm/services/management.cpp | 4 ++-- .../src/share/vm/services/threadService.cpp | 2 +- .../share/vm/utilities/globalDefinitions.hpp | 2 +- .../vm/utilities/globalDefinitions_visCPP.hpp | 8 +++---- hotspot/src/share/vm/utilities/ostream.cpp | 21 +++++++++++----- hotspot/src/share/vm/utilities/vmError.cpp | 4 +++- 35 files changed, 141 insertions(+), 64 deletions(-) diff --git a/hotspot/src/cpu/sparc/vm/interpreterRT_sparc.cpp b/hotspot/src/cpu/sparc/vm/interpreterRT_sparc.cpp index 8cbe422a4af..0e1d6c992cd 100644 --- a/hotspot/src/cpu/sparc/vm/interpreterRT_sparc.cpp +++ b/hotspot/src/cpu/sparc/vm/interpreterRT_sparc.cpp @@ -237,7 +237,7 @@ IRT_ENTRY(address, InterpreterRuntime::slow_signature_handler( // handle arguments // Warning: We use reg arg slot 00 temporarily to return the RegArgSignature // back to the code that pops the arguments into the CPU registers - SlowSignatureHandler(m, (address)from, m->is_static() ? to+2 : to+1, to).iterate(UCONST64(-1)); + SlowSignatureHandler(m, (address)from, m->is_static() ? to+2 : to+1, to).iterate((uint64_t)CONST64(-1)); // return result handler return Interpreter::result_handler(m->result_type()); IRT_END diff --git a/hotspot/src/cpu/x86/vm/c1_LIRAssembler_x86.cpp b/hotspot/src/cpu/x86/vm/c1_LIRAssembler_x86.cpp index 62bb56fe97f..6235c90df13 100644 --- a/hotspot/src/cpu/x86/vm/c1_LIRAssembler_x86.cpp +++ b/hotspot/src/cpu/x86/vm/c1_LIRAssembler_x86.cpp @@ -60,10 +60,10 @@ static jlong* double_quadword(jlong *adr, jlong lo, jlong hi) { static jlong fp_signmask_pool[(4+1)*2]; // 4*128bits(data) + 128bits(alignment) // Static initialization during VM startup. -static jlong *float_signmask_pool = double_quadword(&fp_signmask_pool[1*2], CONST64(0x7FFFFFFF7FFFFFFF), CONST64(0x7FFFFFFF7FFFFFFF)); -static jlong *double_signmask_pool = double_quadword(&fp_signmask_pool[2*2], CONST64(0x7FFFFFFFFFFFFFFF), CONST64(0x7FFFFFFFFFFFFFFF)); -static jlong *float_signflip_pool = double_quadword(&fp_signmask_pool[3*2], CONST64(0x8000000080000000), CONST64(0x8000000080000000)); -static jlong *double_signflip_pool = double_quadword(&fp_signmask_pool[4*2], CONST64(0x8000000000000000), CONST64(0x8000000000000000)); +static jlong *float_signmask_pool = double_quadword(&fp_signmask_pool[1*2], CONST64(0x7FFFFFFF7FFFFFFF), CONST64(0x7FFFFFFF7FFFFFFF)); +static jlong *double_signmask_pool = double_quadword(&fp_signmask_pool[2*2], CONST64(0x7FFFFFFFFFFFFFFF), CONST64(0x7FFFFFFFFFFFFFFF)); +static jlong *float_signflip_pool = double_quadword(&fp_signmask_pool[3*2], (jlong)UCONST64(0x8000000080000000), (jlong)UCONST64(0x8000000080000000)); +static jlong *double_signflip_pool = double_quadword(&fp_signmask_pool[4*2], (jlong)UCONST64(0x8000000000000000), (jlong)UCONST64(0x8000000000000000)); diff --git a/hotspot/src/cpu/x86/vm/c1_Runtime1_x86.cpp b/hotspot/src/cpu/x86/vm/c1_Runtime1_x86.cpp index 580964a7cd9..a0d54665375 100644 --- a/hotspot/src/cpu/x86/vm/c1_Runtime1_x86.cpp +++ b/hotspot/src/cpu/x86/vm/c1_Runtime1_x86.cpp @@ -1597,7 +1597,7 @@ OopMapSet* Runtime1::generate_code_for(StubID id, StubAssembler* sasm) { __ movl(rdx, 0x80000000); __ xorl(rax, rax); #else - __ mov64(rax, CONST64(0x8000000000000000)); + __ mov64(rax, UCONST64(0x8000000000000000)); #endif // _LP64 __ jmp(do_return); diff --git a/hotspot/src/cpu/x86/vm/interpreterRT_x86_32.cpp b/hotspot/src/cpu/x86/vm/interpreterRT_x86_32.cpp index eb66640c338..0e68dd011d3 100644 --- a/hotspot/src/cpu/x86/vm/interpreterRT_x86_32.cpp +++ b/hotspot/src/cpu/x86/vm/interpreterRT_x86_32.cpp @@ -135,7 +135,7 @@ IRT_ENTRY(address, InterpreterRuntime::slow_signature_handler(JavaThread* thread methodHandle m(thread, (Method*)method); assert(m->is_native(), "sanity check"); // handle arguments - SlowSignatureHandler(m, (address)from, to + 1).iterate(UCONST64(-1)); + SlowSignatureHandler(m, (address)from, to + 1).iterate((uint64_t)CONST64(-1)); // return result handler return Interpreter::result_handler(m->result_type()); IRT_END diff --git a/hotspot/src/cpu/x86/vm/interpreterRT_x86_64.cpp b/hotspot/src/cpu/x86/vm/interpreterRT_x86_64.cpp index 959ed6e3208..40cc9d71aa7 100644 --- a/hotspot/src/cpu/x86/vm/interpreterRT_x86_64.cpp +++ b/hotspot/src/cpu/x86/vm/interpreterRT_x86_64.cpp @@ -487,7 +487,7 @@ IRT_ENTRY(address, assert(m->is_native(), "sanity check"); // handle arguments - SlowSignatureHandler(m, (address)from, to + 1).iterate(UCONST64(-1)); + SlowSignatureHandler(m, (address)from, to + 1).iterate((uint64_t)CONST64(-1)); // return result handler return Interpreter::result_handler(m->result_type()); diff --git a/hotspot/src/cpu/zero/vm/interpreterRT_zero.cpp b/hotspot/src/cpu/zero/vm/interpreterRT_zero.cpp index e23e3eaa93b..8fb45375262 100644 --- a/hotspot/src/cpu/zero/vm/interpreterRT_zero.cpp +++ b/hotspot/src/cpu/zero/vm/interpreterRT_zero.cpp @@ -155,7 +155,7 @@ IRT_ENTRY(address, intptr_t *buf = (intptr_t *) stack->alloc(required_words * wordSize); SlowSignatureHandlerGenerator sshg(methodHandle(thread, method), buf); - sshg.generate(UCONST64(-1)); + sshg.generate((uint64_t)CONST64(-1)); SignatureHandler *handler = sshg.handler(); handler->finalize(); diff --git a/hotspot/src/os/aix/vm/os_aix.cpp b/hotspot/src/os/aix/vm/os_aix.cpp index fc873a11eed..c59a0fb193b 100644 --- a/hotspot/src/os/aix/vm/os_aix.cpp +++ b/hotspot/src/os/aix/vm/os_aix.cpp @@ -1641,7 +1641,8 @@ void os::jvm_path(char *buf, jint buflen) { char* rp = realpath((char *)dlinfo.dli_fname, buf); assert(rp != NULL, "error in realpath(): maybe the 'path' argument is too long?"); - strcpy(saved_jvm_path, buf); + strncpy(saved_jvm_path, buf, sizeof(saved_jvm_path)); + saved_jvm_path[sizeof(saved_jvm_path) - 1] = '\0'; } void os::print_jni_name_prefix_on(outputStream* st, int args_size) { diff --git a/hotspot/src/os/aix/vm/perfMemory_aix.cpp b/hotspot/src/os/aix/vm/perfMemory_aix.cpp index 36644f0f679..8850fe705e2 100644 --- a/hotspot/src/os/aix/vm/perfMemory_aix.cpp +++ b/hotspot/src/os/aix/vm/perfMemory_aix.cpp @@ -506,6 +506,7 @@ static void cleanup_sharedmem_resources(const char* dirname) { if (!is_directory_secure(dirname)) { // the directory is not a secure directory + os::closedir(dirp); return; } @@ -853,6 +854,9 @@ static void mmap_attach_shared(const char* user, int vmid, PerfMemory::PerfMemor // if (!is_directory_secure(dirname)) { FREE_C_HEAP_ARRAY(char, dirname, mtInternal); + if (luser != user) { + FREE_C_HEAP_ARRAY(char, luser, mtInternal); + } THROW_MSG(vmSymbols::java_lang_IllegalArgumentException(), "Process not found"); } diff --git a/hotspot/src/os/bsd/vm/os_bsd.cpp b/hotspot/src/os/bsd/vm/os_bsd.cpp index 24367e9c27f..6e9ef90a067 100644 --- a/hotspot/src/os/bsd/vm/os_bsd.cpp +++ b/hotspot/src/os/bsd/vm/os_bsd.cpp @@ -1875,6 +1875,7 @@ void os::jvm_path(char *buf, jint buflen) { } strncpy(saved_jvm_path, buf, MAXPATHLEN); + saved_jvm_path[MAXPATHLEN - 1] = '\0'; } void os::print_jni_name_prefix_on(outputStream* st, int args_size) { diff --git a/hotspot/src/os/bsd/vm/perfMemory_bsd.cpp b/hotspot/src/os/bsd/vm/perfMemory_bsd.cpp index 631366e2944..5cd6cf4e3dd 100644 --- a/hotspot/src/os/bsd/vm/perfMemory_bsd.cpp +++ b/hotspot/src/os/bsd/vm/perfMemory_bsd.cpp @@ -506,6 +506,7 @@ static void cleanup_sharedmem_resources(const char* dirname) { if (!is_directory_secure(dirname)) { // the directory is not a secure directory + os::closedir(dirp); return; } @@ -872,6 +873,9 @@ static void mmap_attach_shared(const char* user, int vmid, PerfMemory::PerfMemor // if (!is_directory_secure(dirname)) { FREE_C_HEAP_ARRAY(char, dirname, mtInternal); + if (luser != user) { + FREE_C_HEAP_ARRAY(char, luser, mtInternal); + } THROW_MSG(vmSymbols::java_lang_IllegalArgumentException(), "Process not found"); } diff --git a/hotspot/src/os/linux/vm/os_linux.cpp b/hotspot/src/os/linux/vm/os_linux.cpp index 55c00068387..8b7a71f14f9 100644 --- a/hotspot/src/os/linux/vm/os_linux.cpp +++ b/hotspot/src/os/linux/vm/os_linux.cpp @@ -384,7 +384,10 @@ void os::init_system_properties_values() { // Found the full path to libjvm.so. // Now cut the path to /jre if we can. - *(strrchr(buf, '/')) = '\0'; // Get rid of /libjvm.so. + pslash = strrchr(buf, '/'); + if (pslash != NULL) { + *pslash = '\0'; // Get rid of /libjvm.so. + } pslash = strrchr(buf, '/'); if (pslash != NULL) { *pslash = '\0'; // Get rid of /{client|server|hotspot}. @@ -1223,7 +1226,7 @@ void os::Linux::capture_initial_stack(size_t max_size) { i = 0; if (s) { // Skip blank chars - do s++; while (isspace(*s)); + do { s++; } while (s && isspace(*s)); #define _UFM UINTX_FORMAT #define _DFM INTX_FORMAT @@ -2372,6 +2375,9 @@ void os::jvm_path(char *buf, jint buflen) { // Check the current module name "libjvm.so". p = strrchr(buf, '/'); + if (p == NULL) { + return; + } assert(strstr(p, "/libjvm") == p, "invalid library name"); rp = realpath(java_home_var, buf); @@ -2405,6 +2411,7 @@ void os::jvm_path(char *buf, jint buflen) { } strncpy(saved_jvm_path, buf, MAXPATHLEN); + saved_jvm_path[MAXPATHLEN - 1] = '\0'; } void os::print_jni_name_prefix_on(outputStream* st, int args_size) { @@ -5354,7 +5361,7 @@ static jlong slow_thread_cpu_time(Thread *thread, bool user_sys_cpu_time) { if (s == NULL) return -1; // Skip blank chars - do s++; while (isspace(*s)); + do { s++; } while (s && isspace(*s)); count = sscanf(s,"%c %d %d %d %d %d %lu %lu %lu %lu %lu %lu %lu", &cdummy, &idummy, &idummy, &idummy, &idummy, &idummy, diff --git a/hotspot/src/os/linux/vm/perfMemory_linux.cpp b/hotspot/src/os/linux/vm/perfMemory_linux.cpp index 6d92575563e..3fad2964ab8 100644 --- a/hotspot/src/os/linux/vm/perfMemory_linux.cpp +++ b/hotspot/src/os/linux/vm/perfMemory_linux.cpp @@ -506,6 +506,7 @@ static void cleanup_sharedmem_resources(const char* dirname) { if (!is_directory_secure(dirname)) { // the directory is not a secure directory + os::closedir(dirp); return; } @@ -872,6 +873,9 @@ static void mmap_attach_shared(const char* user, int vmid, PerfMemory::PerfMemor // if (!is_directory_secure(dirname)) { FREE_C_HEAP_ARRAY(char, dirname, mtInternal); + if (luser != user) { + FREE_C_HEAP_ARRAY(char, luser, mtInternal); + } THROW_MSG(vmSymbols::java_lang_IllegalArgumentException(), "Process not found"); } diff --git a/hotspot/src/os/posix/vm/os_posix.cpp b/hotspot/src/os/posix/vm/os_posix.cpp index e5c99a8914a..beb8754198f 100644 --- a/hotspot/src/os/posix/vm/os_posix.cpp +++ b/hotspot/src/os/posix/vm/os_posix.cpp @@ -663,7 +663,10 @@ const char* os::Posix::get_signal_name(int sig, char* out, size_t outlen) { } } - jio_snprintf(out, outlen, ret); + if (out && outlen > 0) { + strncpy(out, ret, outlen); + out[outlen - 1] = '\0'; + } return out; } diff --git a/hotspot/src/os/solaris/vm/os_solaris.cpp b/hotspot/src/os/solaris/vm/os_solaris.cpp index 6ff3fd0d129..39dceeef475 100644 --- a/hotspot/src/os/solaris/vm/os_solaris.cpp +++ b/hotspot/src/os/solaris/vm/os_solaris.cpp @@ -2221,6 +2221,7 @@ void os::jvm_path(char *buf, jint buflen) { } strncpy(saved_jvm_path, buf, MAXPATHLEN); + saved_jvm_path[MAXPATHLEN - 1] = '\0'; } diff --git a/hotspot/src/os/solaris/vm/perfMemory_solaris.cpp b/hotspot/src/os/solaris/vm/perfMemory_solaris.cpp index 7f956338e6b..9c348d9b2d1 100644 --- a/hotspot/src/os/solaris/vm/perfMemory_solaris.cpp +++ b/hotspot/src/os/solaris/vm/perfMemory_solaris.cpp @@ -545,6 +545,7 @@ static void cleanup_sharedmem_resources(const char* dirname) { if (!is_directory_secure(dirname)) { // the directory is not a secure directory + os::closedir(dirp); return; } @@ -890,6 +891,9 @@ static void mmap_attach_shared(const char* user, int vmid, PerfMemory::PerfMemor // if (!is_directory_secure(dirname)) { FREE_C_HEAP_ARRAY(char, dirname, mtInternal); + if (luser != user) { + FREE_C_HEAP_ARRAY(char, luser, mtInternal); + } THROW_MSG(vmSymbols::java_lang_IllegalArgumentException(), "Process not found"); } diff --git a/hotspot/src/os/windows/vm/attachListener_windows.cpp b/hotspot/src/os/windows/vm/attachListener_windows.cpp index 34a454f6363..3b3d0ca9d08 100644 --- a/hotspot/src/os/windows/vm/attachListener_windows.cpp +++ b/hotspot/src/os/windows/vm/attachListener_windows.cpp @@ -30,6 +30,7 @@ #include #include // SIGBREAK +#include // The AttachListener thread services a queue of operations. It blocks in the dequeue // function until an operation is enqueued. A client enqueues an operation by creating @@ -269,6 +270,7 @@ HANDLE Win32AttachOperation::open_pipe() { if (hPipe != INVALID_HANDLE_VALUE) { // shouldn't happen as there is a pipe created per operation if (::GetLastError() == ERROR_PIPE_BUSY) { + ::CloseHandle(hPipe); return INVALID_HANDLE_VALUE; } } @@ -313,7 +315,8 @@ void Win32AttachOperation::complete(jint result, bufferedStream* result_stream) BOOL fSuccess; char msg[32]; - sprintf(msg, "%d\n", result); + _snprintf(msg, sizeof(msg), "%d\n", result); + msg[sizeof(msg) - 1] = '\0'; fSuccess = write_pipe(hPipe, msg, (int)strlen(msg)); if (fSuccess) { diff --git a/hotspot/src/os/windows/vm/os_windows.cpp b/hotspot/src/os/windows/vm/os_windows.cpp index 10c5a4079cb..6d121a2cb43 100644 --- a/hotspot/src/os/windows/vm/os_windows.cpp +++ b/hotspot/src/os/windows/vm/os_windows.cpp @@ -96,7 +96,7 @@ #include // for timer info max values which include all bits -#define ALL_64_BITS CONST64(0xFFFFFFFFFFFFFFFF) +#define ALL_64_BITS CONST64(-1) // For DLL loading/load error detection // Values of PE COFF @@ -211,6 +211,7 @@ void os::init_system_properties_values() { } strcpy(home_path, home_dir); Arguments::set_java_home(home_path); + FREE_C_HEAP_ARRAY(char, home_path, mtInternal); dll_path = NEW_C_HEAP_ARRAY(char, strlen(home_dir) + strlen(bin) + 1, mtInternal); @@ -220,6 +221,7 @@ void os::init_system_properties_values() { strcpy(dll_path, home_dir); strcat(dll_path, bin); Arguments::set_dll_dir(dll_path); + FREE_C_HEAP_ARRAY(char, dll_path, mtInternal); if (!set_boot_path('\\', ';')) { return; @@ -297,6 +299,9 @@ void os::init_system_properties_values() { char * buf = NEW_C_HEAP_ARRAY(char, len, mtInternal); sprintf(buf, "%s%s", Arguments::get_java_home(), ENDORSED_DIR); Arguments::set_endorsed_dirs(buf); + // (Arguments::set_endorsed_dirs() calls SystemProperty::set_value(), which + // duplicates the input.) + FREE_C_HEAP_ARRAY(char, buf, mtInternal); #undef ENDORSED_DIR } @@ -1834,6 +1839,7 @@ void os::jvm_path(char *buf, jint buflen) { GetModuleFileName(vm_lib_handle, buf, buflen); } strncpy(saved_jvm_path, buf, MAX_PATH); + saved_jvm_path[MAX_PATH - 1] = '\0'; } @@ -3746,8 +3752,12 @@ HINSTANCE os::win32::load_Windows_dll(const char* name, char *ebuf, // search system directory if ((size = GetSystemDirectory(path, pathLen)) > 0) { - strcat(path, "\\"); - strcat(path, name); + if (size >= pathLen) { + return NULL; // truncated + } + if (jio_snprintf(path + size, pathLen - size, "\\%s", name) == -1) { + return NULL; // truncated + } if ((result = (HINSTANCE)os::dll_load(path, ebuf, ebuflen)) != NULL) { return result; } @@ -3755,8 +3765,12 @@ HINSTANCE os::win32::load_Windows_dll(const char* name, char *ebuf, // try Windows directory if ((size = GetWindowsDirectory(path, pathLen)) > 0) { - strcat(path, "\\"); - strcat(path, name); + if (size >= pathLen) { + return NULL; // truncated + } + if (jio_snprintf(path + size, pathLen - size, "\\%s", name) == -1) { + return NULL; // truncated + } if ((result = (HINSTANCE)os::dll_load(path, ebuf, ebuflen)) != NULL) { return result; } diff --git a/hotspot/src/share/vm/memory/metaspaceShared.cpp b/hotspot/src/share/vm/memory/metaspaceShared.cpp index ab0d5de72b0..f71baaed660 100644 --- a/hotspot/src/share/vm/memory/metaspaceShared.cpp +++ b/hotspot/src/share/vm/memory/metaspaceShared.cpp @@ -714,12 +714,17 @@ void MetaspaceShared::preload_and_dump(TRAPS) { int class_list_path_len = (int)strlen(class_list_path_str); if (class_list_path_len >= 3) { if (strcmp(class_list_path_str + class_list_path_len - 3, "lib") != 0) { - strcat(class_list_path_str, os::file_separator()); - strcat(class_list_path_str, "lib"); + if (class_list_path_len < JVM_MAXPATHLEN - 4) { + strncat(class_list_path_str, os::file_separator(), 1); + strncat(class_list_path_str, "lib", 3); + } } } - strcat(class_list_path_str, os::file_separator()); - strcat(class_list_path_str, "classlist"); + class_list_path_len = (int)strlen(class_list_path_str); + if (class_list_path_len < JVM_MAXPATHLEN - 10) { + strncat(class_list_path_str, os::file_separator(), 1); + strncat(class_list_path_str, "classlist", 9); + } class_list_path = class_list_path_str; } else { class_list_path = SharedClassListFile; diff --git a/hotspot/src/share/vm/oops/constMethod.hpp b/hotspot/src/share/vm/oops/constMethod.hpp index 8a8de131420..830a8f98a72 100644 --- a/hotspot/src/share/vm/oops/constMethod.hpp +++ b/hotspot/src/share/vm/oops/constMethod.hpp @@ -277,7 +277,7 @@ public: bool has_stackmap_table() const { return _stackmap_data != NULL; } void init_fingerprint() { - const uint64_t initval = CONST64(0x8000000000000000); + const uint64_t initval = UCONST64(0x8000000000000000); _fingerprint = initval; } diff --git a/hotspot/src/share/vm/oops/instanceKlass.cpp b/hotspot/src/share/vm/oops/instanceKlass.cpp index 800971b4df5..8414dbe2090 100644 --- a/hotspot/src/share/vm/oops/instanceKlass.cpp +++ b/hotspot/src/share/vm/oops/instanceKlass.cpp @@ -2499,7 +2499,7 @@ const char* InstanceKlass::signature_name() const { // If this is an anonymous class, append a hash to make the name unique if (is_anonymous()) { intptr_t hash = (java_mirror() != NULL) ? java_mirror()->identity_hash() : 0; - sprintf(hash_buf, "/" UINTX_FORMAT, (uintx)hash); + jio_snprintf(hash_buf, sizeof(hash_buf), "/" UINTX_FORMAT, (uintx)hash); hash_len = (int)strlen(hash_buf); } diff --git a/hotspot/src/share/vm/opto/mulnode.cpp b/hotspot/src/share/vm/opto/mulnode.cpp index 1406f8364a6..d4730e978e9 100644 --- a/hotspot/src/share/vm/opto/mulnode.cpp +++ b/hotspot/src/share/vm/opto/mulnode.cpp @@ -610,7 +610,7 @@ Node *AndLNode::Ideal(PhaseGVN *phase, bool can_reshape) { // convert masks which would cause a sign extension of the integer // value. This check includes UI2L masks (0x00000000FFFFFFFF) which // would be optimized away later in Identity. - if (op == Op_ConvI2L && (mask & CONST64(0xFFFFFFFF80000000)) == 0) { + if (op == Op_ConvI2L && (mask & UCONST64(0xFFFFFFFF80000000)) == 0) { Node* andi = new AndINode(in1->in(1), phase->intcon(mask)); andi = phase->transform(andi); return new ConvI2LNode(andi); diff --git a/hotspot/src/share/vm/prims/jni.cpp b/hotspot/src/share/vm/prims/jni.cpp index 7b6974e639a..3e730fdeab8 100644 --- a/hotspot/src/share/vm/prims/jni.cpp +++ b/hotspot/src/share/vm/prims/jni.cpp @@ -951,8 +951,9 @@ class JNI_ArgumentPusherVaArg : public JNI_ArgumentPusher { // Optimized path if we have the bitvector form of signature void iterate( uint64_t fingerprint ) { - if ( fingerprint == UCONST64(-1) ) SignatureIterator::iterate();// Must be too many arguments - else { + if (fingerprint == (uint64_t)CONST64(-1)) { + SignatureIterator::iterate(); // Must be too many arguments + } else { _return_type = (BasicType)((fingerprint >> static_feature_size) & result_feature_mask); @@ -1022,8 +1023,9 @@ class JNI_ArgumentPusherArray : public JNI_ArgumentPusher { // Optimized path if we have the bitvector form of signature void iterate( uint64_t fingerprint ) { - if ( fingerprint == UCONST64(-1) ) SignatureIterator::iterate(); // Must be too many arguments - else { + if (fingerprint == (uint64_t)CONST64(-1)) { + SignatureIterator::iterate(); // Must be too many arguments + } else { _return_type = (BasicType)((fingerprint >> static_feature_size) & result_feature_mask); assert(fingerprint, "Fingerprint should not be 0"); diff --git a/hotspot/src/share/vm/prims/jvm.cpp b/hotspot/src/share/vm/prims/jvm.cpp index ad58d7bf966..a9eab534820 100644 --- a/hotspot/src/share/vm/prims/jvm.cpp +++ b/hotspot/src/share/vm/prims/jvm.cpp @@ -2583,7 +2583,14 @@ ATTRIBUTE_PRINTF(3, 0) int jio_vsnprintf(char *str, size_t count, const char *fmt, va_list args) { // see bug 4399518, 4417214 if ((intptr_t)count <= 0) return -1; - return vsnprintf(str, count, fmt, args); + + int result = vsnprintf(str, count, fmt, args); + if ((result > 0 && (size_t)result >= count) || result == -1) { + str[count - 1] = '\0'; + result = -1; + } + + return result; } ATTRIBUTE_PRINTF(3, 0) diff --git a/hotspot/src/share/vm/prims/unsafe.cpp b/hotspot/src/share/vm/prims/unsafe.cpp index c0e4f30d2a2..f465e61589e 100644 --- a/hotspot/src/share/vm/prims/unsafe.cpp +++ b/hotspot/src/share/vm/prims/unsafe.cpp @@ -802,8 +802,7 @@ UNSAFE_END static inline void throw_new(JNIEnv *env, const char *ename) { char buf[100]; - strcpy(buf, "java/lang/"); - strcat(buf, ename); + jio_snprintf(buf, 100, "%s%s", "java/lang/", ename); jclass cls = env->FindClass(buf); if (env->ExceptionCheck()) { env->ExceptionClear(); diff --git a/hotspot/src/share/vm/runtime/globals.cpp b/hotspot/src/share/vm/runtime/globals.cpp index 81bf15d0f0c..8d77691a282 100644 --- a/hotspot/src/share/vm/runtime/globals.cpp +++ b/hotspot/src/share/vm/runtime/globals.cpp @@ -28,6 +28,7 @@ #include "runtime/arguments.hpp" #include "runtime/globals.hpp" #include "runtime/globals_extension.hpp" +#include "runtime/os.hpp" #include "utilities/ostream.hpp" #include "utilities/macros.hpp" #include "utilities/top.hpp" @@ -818,15 +819,12 @@ bool CommandLineFlags::ccstrAtPut(const char* name, size_t len, ccstr* value, Fl trace_flag_changed(name, old_value, *value, origin); char* new_value = NULL; if (*value != NULL) { - new_value = NEW_C_HEAP_ARRAY(char, strlen(*value)+1, mtInternal); - strcpy(new_value, *value); + new_value = os::strdup_check_oom(*value); } result->set_ccstr(new_value); if (result->is_default() && old_value != NULL) { // Prior value is NOT heap allocated, but was a literal constant. - char* old_value_to_free = NEW_C_HEAP_ARRAY(char, strlen(old_value)+1, mtInternal); - strcpy(old_value_to_free, old_value); - old_value = old_value_to_free; + old_value = os::strdup_check_oom(old_value); } *value = old_value; result->set_origin(origin); @@ -838,8 +836,7 @@ void CommandLineFlagsEx::ccstrAtPut(CommandLineFlagWithType flag, ccstr value, F guarantee(faddr != NULL && faddr->is_ccstr(), "wrong flag type"); ccstr old_value = faddr->get_ccstr(); trace_flag_changed(faddr->_name, old_value, value, origin); - char* new_value = NEW_C_HEAP_ARRAY(char, strlen(value)+1, mtInternal); - strcpy(new_value, value); + char* new_value = os::strdup_check_oom(value); faddr->set_ccstr(new_value); if (!faddr->is_default() && old_value != NULL) { // Prior value is heap allocated so free it. diff --git a/hotspot/src/share/vm/runtime/java.cpp b/hotspot/src/share/vm/runtime/java.cpp index 586414a53d4..2e14b4a3e17 100644 --- a/hotspot/src/share/vm/runtime/java.cpp +++ b/hotspot/src/share/vm/runtime/java.cpp @@ -705,25 +705,35 @@ int JDK_Version::compare(const JDK_Version& other) const { } void JDK_Version::to_string(char* buffer, size_t buflen) const { + assert(buffer && buflen > 0, "call with useful buffer"); size_t index = 0; + if (!is_valid()) { jio_snprintf(buffer, buflen, "%s", "(uninitialized)"); } else if (is_partially_initialized()) { jio_snprintf(buffer, buflen, "%s", "(uninitialized) pre-1.6.0"); } else { - index += jio_snprintf( + int rc = jio_snprintf( &buffer[index], buflen - index, "%d.%d", _major, _minor); + if (rc == -1) return; + index += rc; if (_micro > 0) { - index += jio_snprintf(&buffer[index], buflen - index, ".%d", _micro); + rc = jio_snprintf(&buffer[index], buflen - index, ".%d", _micro); } if (_update > 0) { - index += jio_snprintf(&buffer[index], buflen - index, "_%02d", _update); + rc = jio_snprintf(&buffer[index], buflen - index, "_%02d", _update); + if (rc == -1) return; + index += rc; } if (_special > 0) { - index += jio_snprintf(&buffer[index], buflen - index, "%c", _special); + rc = jio_snprintf(&buffer[index], buflen - index, "%c", _special); + if (rc == -1) return; + index += rc; } if (_build > 0) { - index += jio_snprintf(&buffer[index], buflen - index, "-b%02d", _build); + rc = jio_snprintf(&buffer[index], buflen - index, "-b%02d", _build); + if (rc == -1) return; + index += rc; } } } diff --git a/hotspot/src/share/vm/runtime/signature.cpp b/hotspot/src/share/vm/runtime/signature.cpp index a92f5e73b28..425a3705b7e 100644 --- a/hotspot/src/share/vm/runtime/signature.cpp +++ b/hotspot/src/share/vm/runtime/signature.cpp @@ -158,7 +158,7 @@ void SignatureIterator::iterate_parameters( uint64_t fingerprint ) { uint64_t saved_fingerprint = fingerprint; // Check for too many arguments - if ( fingerprint == UCONST64(-1) ) { + if (fingerprint == (uint64_t)CONST64(-1)) { SignatureIterator::iterate_parameters(); return; } diff --git a/hotspot/src/share/vm/runtime/signature.hpp b/hotspot/src/share/vm/runtime/signature.hpp index 9c2e532a1fc..98151c64d57 100644 --- a/hotspot/src/share/vm/runtime/signature.hpp +++ b/hotspot/src/share/vm/runtime/signature.hpp @@ -243,7 +243,7 @@ class Fingerprinter: public SignatureIterator { } if (mh->size_of_parameters() > max_size_of_parameters ) { - _fingerprint = UCONST64(-1); + _fingerprint = (uint64_t)CONST64(-1); mh->constMethod()->set_fingerprint(_fingerprint); return _fingerprint; } diff --git a/hotspot/src/share/vm/runtime/thread.cpp b/hotspot/src/share/vm/runtime/thread.cpp index 8266c545cf1..306871ee497 100644 --- a/hotspot/src/share/vm/runtime/thread.cpp +++ b/hotspot/src/share/vm/runtime/thread.cpp @@ -3642,7 +3642,7 @@ static OnLoadEntry_t lookup_on_load(AgentLibrary* agent, if (!agent->valid()) { char buffer[JVM_MAXPATHLEN]; - char ebuf[1024]; + char ebuf[1024] = ""; const char *name = agent->name(); const char *msg = "Could not find agent library "; diff --git a/hotspot/src/share/vm/services/management.cpp b/hotspot/src/share/vm/services/management.cpp index f8c9ada457a..fbe4901a3f7 100644 --- a/hotspot/src/share/vm/services/management.cpp +++ b/hotspot/src/share/vm/services/management.cpp @@ -1333,7 +1333,7 @@ JVM_ENTRY(jobjectArray, jmm_DumpThreads(JNIEnv *env, jlongArray thread_ids, jboo GrowableArray* locked_monitors = frame->locked_monitors(); for (j = 0; j < len; j++) { oop monitor = locked_monitors->at(j); - assert(monitor != NULL && monitor->is_instance(), "must be a Java object"); + assert(monitor != NULL, "must be a Java object"); monitors_array->obj_at_put(count, monitor); depths_array->int_at_put(count, depth); count++; @@ -1343,7 +1343,7 @@ JVM_ENTRY(jobjectArray, jmm_DumpThreads(JNIEnv *env, jlongArray thread_ids, jboo GrowableArray* jni_locked_monitors = stacktrace->jni_locked_monitors(); for (j = 0; j < jni_locked_monitors->length(); j++) { oop object = jni_locked_monitors->at(j); - assert(object != NULL && object->is_instance(), "must be a Java object"); + assert(object != NULL, "must be a Java object"); monitors_array->obj_at_put(count, object); // Monitor locked via JNI MonitorEnter call doesn't have stack depth info depths_array->int_at_put(count, -1); diff --git a/hotspot/src/share/vm/services/threadService.cpp b/hotspot/src/share/vm/services/threadService.cpp index 74d3ea1383a..1995450bbf0 100644 --- a/hotspot/src/share/vm/services/threadService.cpp +++ b/hotspot/src/share/vm/services/threadService.cpp @@ -597,7 +597,7 @@ bool ThreadStackTrace::is_owned_monitor_on_stack(oop object) { GrowableArray* locked_monitors = frame->locked_monitors(); for (int j = 0; j < len; j++) { oop monitor = locked_monitors->at(j); - assert(monitor != NULL && monitor->is_instance(), "must be a Java object"); + assert(monitor != NULL, "must be a Java object"); if (monitor == object) { found = true; break; diff --git a/hotspot/src/share/vm/utilities/globalDefinitions.hpp b/hotspot/src/share/vm/utilities/globalDefinitions.hpp index e27cb166209..318c62b4708 100644 --- a/hotspot/src/share/vm/utilities/globalDefinitions.hpp +++ b/hotspot/src/share/vm/utilities/globalDefinitions.hpp @@ -1048,7 +1048,7 @@ const int badHandleValue = 0xBC; // value used to zap const int badResourceValue = 0xAB; // value used to zap resource area const int freeBlockPad = 0xBA; // value used to pad freed blocks. const int uninitBlockPad = 0xF1; // value used to zap newly malloc'd blocks. -const intptr_t badJNIHandleVal = (intptr_t) CONST64(0xFEFEFEFEFEFEFEFE); // value used to zap jni handle area +const intptr_t badJNIHandleVal = (intptr_t) UCONST64(0xFEFEFEFEFEFEFEFE); // value used to zap jni handle area const juint badHeapWordVal = 0xBAADBABE; // value used to zap heap after GC const juint badMetaWordVal = 0xBAADFADE; // value used to zap metadata heap after GC const int badCodeHeapNewVal= 0xCC; // value used to zap Code heap at allocation diff --git a/hotspot/src/share/vm/utilities/globalDefinitions_visCPP.hpp b/hotspot/src/share/vm/utilities/globalDefinitions_visCPP.hpp index 46e8f9e8e93..1be86e1b832 100644 --- a/hotspot/src/share/vm/utilities/globalDefinitions_visCPP.hpp +++ b/hotspot/src/share/vm/utilities/globalDefinitions_visCPP.hpp @@ -151,11 +151,11 @@ inline int g_isfinite(jdouble f) { return _finite(f); } // Constant for jlong (specifying an long long constant is C++ compiler specific) // Build a 64bit integer constant on with Visual C++ -#define CONST64(x) (x ## i64) -#define UCONST64(x) ((uint64_t)CONST64(x)) +#define CONST64(x) (x ## i64) +#define UCONST64(x) (x ## ui64) -const jlong min_jlong = CONST64(0x8000000000000000); -const jlong max_jlong = CONST64(0x7fffffffffffffff); +const jlong min_jlong = (jlong)UCONST64(0x8000000000000000); +const jlong max_jlong = CONST64(0x7fffffffffffffff); //---------------------------------------------------------------------------------------------------- // Miscellaneous diff --git a/hotspot/src/share/vm/utilities/ostream.cpp b/hotspot/src/share/vm/utilities/ostream.cpp index ceb5774fe81..f6880d7ac86 100644 --- a/hotspot/src/share/vm/utilities/ostream.cpp +++ b/hotspot/src/share/vm/utilities/ostream.cpp @@ -76,6 +76,8 @@ const char* outputStream::do_vsnprintf(char* buffer, size_t buflen, const char* format, va_list ap, bool add_cr, size_t& result_len) { + assert(buflen >= 2, "buffer too small"); + const char* result; if (add_cr) buflen--; if (!strchr(format, '%')) { @@ -88,14 +90,21 @@ const char* outputStream::do_vsnprintf(char* buffer, size_t buflen, result = va_arg(ap, const char*); result_len = strlen(result); if (add_cr && result_len >= buflen) result_len = buflen-1; // truncate - } else if (vsnprintf(buffer, buflen, format, ap) >= 0) { - result = buffer; - result_len = strlen(result); } else { - DEBUG_ONLY(warning("increase O_BUFLEN in ostream.hpp -- output truncated");) + // Handle truncation: + // posix: upon truncation, vsnprintf returns number of bytes which + // would have been written (excluding terminating zero) had the buffer + // been large enough + // windows: upon truncation, vsnprintf returns -1 + const int written = vsnprintf(buffer, buflen, format, ap); result = buffer; - result_len = buflen - 1; - buffer[result_len] = 0; + if (written < (int) buflen && written >= 0) { + result_len = written; + } else { + DEBUG_ONLY(warning("increase O_BUFLEN in ostream.hpp -- output truncated");) + result_len = buflen - 1; + buffer[result_len] = 0; + } } if (add_cr) { if (result != buffer) { diff --git a/hotspot/src/share/vm/utilities/vmError.cpp b/hotspot/src/share/vm/utilities/vmError.cpp index 37a363570aa..5957d74adaa 100644 --- a/hotspot/src/share/vm/utilities/vmError.cpp +++ b/hotspot/src/share/vm/utilities/vmError.cpp @@ -975,11 +975,13 @@ void VMError::report_and_die() { // Run error reporting to determine whether or not to report the crash. if (!transmit_report_done && should_report_bug(first_error->_id)) { transmit_report_done = true; - FILE* hs_err = os::open(log.fd(), "r"); + const int fd2 = ::dup(log.fd()); + FILE* const hs_err = ::fdopen(fd2, "r"); if (NULL != hs_err) { ErrorReporter er; er.call(hs_err, buffer, O_BUFLEN); } + ::fclose(hs_err); } if (log.fd() != defaultStream::output_fd()) { From 8aa05f7690d7f2556386133012bf3db4d8df99ac Mon Sep 17 00:00:00 2001 From: Albert Noll Date: Wed, 29 Oct 2014 15:42:48 +0100 Subject: [PATCH 46/61] 8062284: Sweeper thread should not be visible when calling Thread.getAllStackTraces() Make thread not visible when calling Thread.getAllStackTraces() Reviewed-by: kvn, shade --- hotspot/src/share/vm/runtime/thread.hpp | 3 +++ 1 file changed, 3 insertions(+) diff --git a/hotspot/src/share/vm/runtime/thread.hpp b/hotspot/src/share/vm/runtime/thread.hpp index a8bbe82e0c4..c39b2eff624 100644 --- a/hotspot/src/share/vm/runtime/thread.hpp +++ b/hotspot/src/share/vm/runtime/thread.hpp @@ -1767,6 +1767,9 @@ class CodeCacheSweeperThread : public JavaThread { _scanned_nmethod = nm; } + // Hide sweeper thread from external view. + bool is_hidden_from_external_view() const { return true; } + bool is_Code_cache_sweeper_thread() const { return true; } // GC support // Apply "f->do_oop" to all root oops in "this". From fe1762fbd615858cd888124371a4f3dff9ccf267 Mon Sep 17 00:00:00 2001 From: Tobias Hartmann Date: Thu, 30 Oct 2014 13:03:30 +0100 Subject: [PATCH 47/61] 8061817: Whitebox.deoptimizeMethod() does not deoptimize all OSR versions of method Fixed Whitebox.deoptimizeMethod() to deoptimize all OSR versions of the method. Reviewed-by: kvn, iignatyev --- hotspot/src/share/vm/oops/instanceKlass.cpp | 16 ++++ hotspot/src/share/vm/oops/instanceKlass.hpp | 1 + hotspot/src/share/vm/oops/method.hpp | 4 + hotspot/src/share/vm/prims/whitebox.cpp | 15 +-- .../whitebox/DeoptimizeMultipleOSRTest.java | 95 +++++++++++++++++++ 5 files changed, 119 insertions(+), 12 deletions(-) create mode 100644 hotspot/test/compiler/whitebox/DeoptimizeMultipleOSRTest.java diff --git a/hotspot/src/share/vm/oops/instanceKlass.cpp b/hotspot/src/share/vm/oops/instanceKlass.cpp index 38c2c8727d6..be0ee64d850 100644 --- a/hotspot/src/share/vm/oops/instanceKlass.cpp +++ b/hotspot/src/share/vm/oops/instanceKlass.cpp @@ -2845,6 +2845,22 @@ void InstanceKlass::remove_osr_nmethod(nmethod* n) { } } +int InstanceKlass::mark_osr_nmethods(const Method* m) { + // This is a short non-blocking critical region, so the no safepoint check is ok. + MutexLockerEx ml(OsrList_lock, Mutex::_no_safepoint_check_flag); + nmethod* osr = osr_nmethods_head(); + int found = 0; + while (osr != NULL) { + assert(osr->is_osr_method(), "wrong kind of nmethod found in chain"); + if (osr->method() == m) { + osr->mark_for_deoptimization(); + found++; + } + osr = osr->osr_link(); + } + return found; +} + nmethod* InstanceKlass::lookup_osr_nmethod(const Method* m, int bci, int comp_level, bool match_level) const { // This is a short non-blocking critical region, so the no safepoint check is ok. MutexLockerEx ml(OsrList_lock, Mutex::_no_safepoint_check_flag); diff --git a/hotspot/src/share/vm/oops/instanceKlass.hpp b/hotspot/src/share/vm/oops/instanceKlass.hpp index e50aa45eb69..87050615f01 100644 --- a/hotspot/src/share/vm/oops/instanceKlass.hpp +++ b/hotspot/src/share/vm/oops/instanceKlass.hpp @@ -742,6 +742,7 @@ class InstanceKlass: public Klass { void set_osr_nmethods_head(nmethod* h) { _osr_nmethods_head = h; }; void add_osr_nmethod(nmethod* n); void remove_osr_nmethod(nmethod* n); + int mark_osr_nmethods(const Method* m); nmethod* lookup_osr_nmethod(const Method* m, int bci, int level, bool match_level) const; // Breakpoint support (see methods on Method* for details) diff --git a/hotspot/src/share/vm/oops/method.hpp b/hotspot/src/share/vm/oops/method.hpp index 9ffc9eea1ba..89a5916e944 100644 --- a/hotspot/src/share/vm/oops/method.hpp +++ b/hotspot/src/share/vm/oops/method.hpp @@ -813,6 +813,10 @@ class Method : public Metadata { return method_holder()->lookup_osr_nmethod(this, InvocationEntryBci, level, match_level) != NULL; } + int mark_osr_nmethods() { + return method_holder()->mark_osr_nmethods(this); + } + nmethod* lookup_osr_nmethod_for(int bci, int level, bool match_level) { return method_holder()->lookup_osr_nmethod(this, bci, level, match_level); } diff --git a/hotspot/src/share/vm/prims/whitebox.cpp b/hotspot/src/share/vm/prims/whitebox.cpp index 5ea1b11e28a..c4cf7088e69 100644 --- a/hotspot/src/share/vm/prims/whitebox.cpp +++ b/hotspot/src/share/vm/prims/whitebox.cpp @@ -386,19 +386,10 @@ WB_ENTRY(jint, WB_DeoptimizeMethod(JNIEnv* env, jobject o, jobject method, jbool CHECK_JNI_EXCEPTION_(env, result); MutexLockerEx mu(Compile_lock); methodHandle mh(THREAD, Method::checked_resolve_jmethod_id(jmid)); - nmethod* code; if (is_osr) { - int bci = InvocationEntryBci; - while ((code = mh->lookup_osr_nmethod_for(bci, CompLevel_none, false)) != NULL) { - code->mark_for_deoptimization(); - ++result; - bci = code->osr_entry_bci() + 1; - } - } else { - code = mh->code(); - } - if (code != NULL) { - code->mark_for_deoptimization(); + result += mh->mark_osr_nmethods(); + } else if (mh->code() != NULL) { + mh->code()->mark_for_deoptimization(); ++result; } result += CodeCache::mark_for_deoptimization(mh()); diff --git a/hotspot/test/compiler/whitebox/DeoptimizeMultipleOSRTest.java b/hotspot/test/compiler/whitebox/DeoptimizeMultipleOSRTest.java new file mode 100644 index 00000000000..f81d199a8d0 --- /dev/null +++ b/hotspot/test/compiler/whitebox/DeoptimizeMultipleOSRTest.java @@ -0,0 +1,95 @@ +/* + * Copyright (c) 2013, 2014, Oracle and/or its affiliates. All rights reserved. + * DO NOT ALTER OR REMOVE COPYRIGHT NOTICES OR THIS FILE HEADER. + * + * This code is free software; you can redistribute it and/or modify it + * under the terms of the GNU General Public License version 2 only, as + * published by the Free Software Foundation. + * + * This code is distributed in the hope that it will be useful, but WITHOUT + * ANY WARRANTY; without even the implied warranty of MERCHANTABILITY or + * FITNESS FOR A PARTICULAR PURPOSE. See the GNU General Public License + * version 2 for more details (a copy is included in the LICENSE file that + * accompanied this code). + * + * You should have received a copy of the GNU General Public License version + * 2 along with this work; if not, write to the Free Software Foundation, + * Inc., 51 Franklin St, Fifth Floor, Boston, MA 02110-1301 USA. + * + * Please contact Oracle, 500 Oracle Parkway, Redwood Shores, CA 94065 USA + * or visit www.oracle.com if you need additional information or have any + * questions. + */ + +import sun.hotspot.WhiteBox; +import java.lang.reflect.Executable; +import java.lang.reflect.Method; + +/* + * @test DeoptimizeMultipleOSRTest + * @bug 8061817 + * @library /testlibrary /testlibrary/whitebox + * @build DeoptimizeMultipleOSRTest + * @run main ClassFileInstaller sun.hotspot.WhiteBox + * sun.hotspot.WhiteBox$WhiteBoxPermission + * @run main/othervm -Xbootclasspath/a:. -XX:+UnlockDiagnosticVMOptions -XX:+WhiteBoxAPI -XX:CompileCommand=compileonly,DeoptimizeMultipleOSRTest::triggerOSR DeoptimizeMultipleOSRTest + * @summary testing of WB::deoptimizeMethod() + */ +public class DeoptimizeMultipleOSRTest { + private static final WhiteBox WHITE_BOX = WhiteBox.getWhiteBox(); + private static final long BACKEDGE_THRESHOLD = 150000; + private Method method; + private int counter = 0; + + public static void main(String[] args) throws Exception { + DeoptimizeMultipleOSRTest test = new DeoptimizeMultipleOSRTest(); + test.test(); + } + + /** + * Triggers two different OSR compilations for the same method and + * checks if WhiteBox.deoptimizeMethod() deoptimizes both. + * + * @throws Exception + */ + public void test() throws Exception { + method = DeoptimizeMultipleOSRTest.class.getDeclaredMethod("triggerOSR", boolean.class, long.class); + // Trigger two OSR compiled versions + triggerOSR(true, BACKEDGE_THRESHOLD); + triggerOSR(false, BACKEDGE_THRESHOLD); + // Wait for compilation + CompilerWhiteBoxTest.waitBackgroundCompilation(method); + // Deoptimize + WHITE_BOX.deoptimizeMethod(method, true); + if (WHITE_BOX.isMethodCompiled(method, true)) { + throw new AssertionError("Not all OSR compiled versions were deoptimized"); + } + } + + /** + * Triggers OSR compilations by executing loops. + * + * @param first Determines which loop to execute + * @param limit The number of loop iterations + */ + public void triggerOSR(boolean first, long limit) { + if (limit != 1) { + // Warmup method to avoid uncommon traps + for (int i = 0; i < limit; ++i) { + triggerOSR(first, 1); + } + CompilerWhiteBoxTest.waitBackgroundCompilation(method); + } + if (first) { + // Trigger OSR compilation 1 + for (int i = 0; i < limit; ++i) { + counter++; + } + } else { + // Trigger OSR compilation 2 + for (int i = 0; i < limit; ++i) { + counter++; + } + } + } +} From f27723c08b0ac9f3c30103504a54736af4e9b287 Mon Sep 17 00:00:00 2001 From: David Buck Date: Fri, 31 Oct 2014 09:37:17 -0700 Subject: [PATCH 48/61] 8060169: Update the Crash Reporting URL in the Java crash log Update the URL for HotSpot bug reports. Reviewed-by: dcubed, rdurbin --- hotspot/src/share/vm/runtime/arguments.cpp | 2 +- 1 file changed, 1 insertion(+), 1 deletion(-) diff --git a/hotspot/src/share/vm/runtime/arguments.cpp b/hotspot/src/share/vm/runtime/arguments.cpp index 346208fa427..bda5316850a 100644 --- a/hotspot/src/share/vm/runtime/arguments.cpp +++ b/hotspot/src/share/vm/runtime/arguments.cpp @@ -54,7 +54,7 @@ #endif // INCLUDE_ALL_GCS // Note: This is a special bug reporting site for the JVM -#define DEFAULT_VENDOR_URL_BUG "http://bugreport.sun.com/bugreport/crash.jsp" +#define DEFAULT_VENDOR_URL_BUG "http://bugreport.java.com/bugreport/crash.jsp" #define DEFAULT_JAVA_LAUNCHER "generic" // Disable options not supported in this release, with a warning if they From f52a43892ac360b1eb25d487f3f3a034d8727cde Mon Sep 17 00:00:00 2001 From: Jaroslav Bachorik Date: Mon, 3 Nov 2014 11:19:43 +0100 Subject: [PATCH 49/61] 8061616: HotspotDiagnosticMXBean.getVMOption() throws IllegalArgumentException for flags of type double Reviewed-by: mchung, sla --- hotspot/src/share/vm/services/jmm.h | 5 +++-- hotspot/src/share/vm/services/management.cpp | 3 +++ .../test/testlibrary_tests/whitebox/vm_flags/DoubleTest.java | 2 +- 3 files changed, 7 insertions(+), 3 deletions(-) diff --git a/hotspot/src/share/vm/services/jmm.h b/hotspot/src/share/vm/services/jmm.h index de9d78b7f91..40dfb4e7325 100644 --- a/hotspot/src/share/vm/services/jmm.h +++ b/hotspot/src/share/vm/services/jmm.h @@ -1,5 +1,5 @@ /* - * Copyright (c) 2003, 2013, Oracle and/or its affiliates. All rights reserved. + * Copyright (c) 2003, 2014, Oracle and/or its affiliates. All rights reserved. * DO NOT ALTER OR REMOVE COPYRIGHT NOTICES OR THIS FILE HEADER. * * This code is free software; you can redistribute it and/or modify it @@ -143,7 +143,8 @@ typedef enum { JMM_VMGLOBAL_TYPE_UNKNOWN = 0, JMM_VMGLOBAL_TYPE_JBOOLEAN = 1, JMM_VMGLOBAL_TYPE_JSTRING = 2, - JMM_VMGLOBAL_TYPE_JLONG = 3 + JMM_VMGLOBAL_TYPE_JLONG = 3, + JMM_VMGLOBAL_TYPE_JDOUBLE = 4 } jmmVMGlobalType; typedef enum { diff --git a/hotspot/src/share/vm/services/management.cpp b/hotspot/src/share/vm/services/management.cpp index ba5e5f40882..f8c9ada457a 100644 --- a/hotspot/src/share/vm/services/management.cpp +++ b/hotspot/src/share/vm/services/management.cpp @@ -1572,6 +1572,9 @@ bool add_global_entry(JNIEnv* env, Handle name, jmmVMGlobal *global, Flag *flag, } else if (flag->is_uint64_t()) { global->value.j = (jlong)flag->get_uint64_t(); global->type = JMM_VMGLOBAL_TYPE_JLONG; + } else if (flag->is_double()) { + global->value.d = (jdouble)flag->get_double(); + global->type = JMM_VMGLOBAL_TYPE_JDOUBLE; } else if (flag->is_size_t()) { global->value.j = (jlong)flag->get_size_t(); global->type = JMM_VMGLOBAL_TYPE_JLONG; diff --git a/hotspot/test/testlibrary_tests/whitebox/vm_flags/DoubleTest.java b/hotspot/test/testlibrary_tests/whitebox/vm_flags/DoubleTest.java index 0b320e7b21b..08fb73d87cf 100644 --- a/hotspot/test/testlibrary_tests/whitebox/vm_flags/DoubleTest.java +++ b/hotspot/test/testlibrary_tests/whitebox/vm_flags/DoubleTest.java @@ -34,7 +34,7 @@ */ public class DoubleTest { - private static final String FLAG_NAME = null; + private static final String FLAG_NAME = "CompileThresholdScaling"; private static final Double[] TESTS = {0d, -0d, -1d, 1d, Double.MAX_VALUE, Double.MIN_VALUE, Double.NaN, Double.NEGATIVE_INFINITY, Double.POSITIVE_INFINITY}; From f048251de8a22cc5a450edc7417c89b6e188bb04 Mon Sep 17 00:00:00 2001 From: Christian Tornqvist Date: Mon, 3 Nov 2014 11:34:13 -0800 Subject: [PATCH 50/61] 8059803: Update use of GetVersionEx to get correct Windows version in hs_err files Update use of GetVersionEx to get correct Windows version in hs_err files Reviewed-by: dcubed, gtriantafill --- hotspot/make/windows/makefiles/compile.make | 2 +- hotspot/src/os/windows/vm/os_windows.cpp | 182 ++++++++++-------- hotspot/src/os/windows/vm/os_windows.hpp | 1 - .../ProjectCreator/WinGammaPlatformVC10.java | 2 +- 4 files changed, 104 insertions(+), 83 deletions(-) diff --git a/hotspot/make/windows/makefiles/compile.make b/hotspot/make/windows/makefiles/compile.make index a4d1c0d4c3e..8523bfd2eb6 100644 --- a/hotspot/make/windows/makefiles/compile.make +++ b/hotspot/make/windows/makefiles/compile.make @@ -158,7 +158,7 @@ LD=link.exe !endif LD_FLAGS= $(LD_FLAGS) kernel32.lib user32.lib gdi32.lib winspool.lib \ comdlg32.lib advapi32.lib shell32.lib ole32.lib oleaut32.lib \ - uuid.lib Wsock32.lib winmm.lib /nologo /machine:$(MACHINE) /opt:REF \ + uuid.lib Wsock32.lib winmm.lib version.lib /nologo /machine:$(MACHINE) /opt:REF \ /opt:ICF,8 !if "$(ENABLE_FULL_DEBUG_SYMBOLS)" == "1" LD_FLAGS= $(LD_FLAGS) /map /debug diff --git a/hotspot/src/os/windows/vm/os_windows.cpp b/hotspot/src/os/windows/vm/os_windows.cpp index e63a2eb32de..10c5a4079cb 100644 --- a/hotspot/src/os/windows/vm/os_windows.cpp +++ b/hotspot/src/os/windows/vm/os_windows.cpp @@ -1610,96 +1610,123 @@ void os::print_os_info(outputStream* st) { void os::win32::print_windows_version(outputStream* st) { OSVERSIONINFOEX osvi; - SYSTEM_INFO si; + VS_FIXEDFILEINFO *file_info; + TCHAR kernel32_path[MAX_PATH]; + UINT len, ret; + // Use the GetVersionEx information to see if we're on a server or + // workstation edition of Windows. Starting with Windows 8.1 we can't + // trust the OS version information returned by this API. ZeroMemory(&osvi, sizeof(OSVERSIONINFOEX)); osvi.dwOSVersionInfoSize = sizeof(OSVERSIONINFOEX); - if (!GetVersionEx((OSVERSIONINFO *)&osvi)) { - st->print_cr("N/A"); + st->print_cr("Call to GetVersionEx failed"); + return; + } + bool is_workstation = (osvi.wProductType == VER_NT_WORKSTATION); + + // Get the full path to \Windows\System32\kernel32.dll and use that for + // determining what version of Windows we're running on. + len = MAX_PATH - (UINT)strlen("\\kernel32.dll") - 1; + ret = GetSystemDirectory(kernel32_path, len); + if (ret == 0 || ret > len) { + st->print_cr("Call to GetSystemDirectory failed"); + return; + } + strncat(kernel32_path, "\\kernel32.dll", MAX_PATH - ret); + + DWORD version_size = GetFileVersionInfoSize(kernel32_path, NULL); + if (version_size == 0) { + st->print_cr("Call to GetFileVersionInfoSize failed"); return; } - int os_vers = osvi.dwMajorVersion * 1000 + osvi.dwMinorVersion; + LPTSTR version_info = (LPTSTR)os::malloc(version_size, mtInternal); + if (version_info == NULL) { + st->print_cr("Failed to allocate version_info"); + return; + } - ZeroMemory(&si, sizeof(SYSTEM_INFO)); - if (os_vers >= 5002) { - // Retrieve SYSTEM_INFO from GetNativeSystemInfo call so that we could - // find out whether we are running on 64 bit processor or not. - if (os::Kernel32Dll::GetNativeSystemInfoAvailable()) { - os::Kernel32Dll::GetNativeSystemInfo(&si); + if (!GetFileVersionInfo(kernel32_path, NULL, version_size, version_info)) { + os::free(version_info); + st->print_cr("Call to GetFileVersionInfo failed"); + return; + } + + if (!VerQueryValue(version_info, TEXT("\\"), (LPVOID*)&file_info, &len)) { + os::free(version_info); + st->print_cr("Call to VerQueryValue failed"); + return; + } + + int major_version = HIWORD(file_info->dwProductVersionMS); + int minor_version = LOWORD(file_info->dwProductVersionMS); + int build_number = HIWORD(file_info->dwProductVersionLS); + int build_minor = LOWORD(file_info->dwProductVersionLS); + int os_vers = major_version * 1000 + minor_version; + os::free(version_info); + + st->print(" Windows "); + switch (os_vers) { + + case 6000: + if (is_workstation) { + st->print("Vista"); } else { - GetSystemInfo(&si); + st->print("Server 2008"); } + break; + + case 6001: + if (is_workstation) { + st->print("7"); + } else { + st->print("Server 2008 R2"); + } + break; + + case 6002: + if (is_workstation) { + st->print("8"); + } else { + st->print("Server 2012"); + } + break; + + case 6003: + if (is_workstation) { + st->print("8.1"); + } else { + st->print("Server 2012 R2"); + } + break; + + case 6004: + if (is_workstation) { + st->print("10"); + } else { + // The server version name of Windows 10 is not known at this time + st->print("%d.%d", major_version, minor_version); + } + break; + + default: + // Unrecognized windows, print out its major and minor versions + st->print("%d.%d", major_version, minor_version); + break; } - if (osvi.dwPlatformId == VER_PLATFORM_WIN32_NT) { - switch (os_vers) { - case 3051: st->print(" Windows NT 3.51"); break; - case 4000: st->print(" Windows NT 4.0"); break; - case 5000: st->print(" Windows 2000"); break; - case 5001: st->print(" Windows XP"); break; - case 5002: - if (osvi.wProductType == VER_NT_WORKSTATION && - si.wProcessorArchitecture == PROCESSOR_ARCHITECTURE_AMD64) { - st->print(" Windows XP x64 Edition"); - } else { - st->print(" Windows Server 2003 family"); - } - break; - - case 6000: - if (osvi.wProductType == VER_NT_WORKSTATION) { - st->print(" Windows Vista"); - } else { - st->print(" Windows Server 2008"); - } - break; - - case 6001: - if (osvi.wProductType == VER_NT_WORKSTATION) { - st->print(" Windows 7"); - } else { - st->print(" Windows Server 2008 R2"); - } - break; - - case 6002: - if (osvi.wProductType == VER_NT_WORKSTATION) { - st->print(" Windows 8"); - } else { - st->print(" Windows Server 2012"); - } - break; - - case 6003: - if (osvi.wProductType == VER_NT_WORKSTATION) { - st->print(" Windows 8.1"); - } else { - st->print(" Windows Server 2012 R2"); - } - break; - - default: // future os - // Unrecognized windows, print out its major and minor versions - st->print(" Windows NT %d.%d", osvi.dwMajorVersion, osvi.dwMinorVersion); - } - } else { - switch (os_vers) { - case 4000: st->print(" Windows 95"); break; - case 4010: st->print(" Windows 98"); break; - case 4090: st->print(" Windows Me"); break; - default: // future windows, print out its major and minor versions - st->print(" Windows %d.%d", osvi.dwMajorVersion, osvi.dwMinorVersion); - } - } - - if (os_vers >= 6000 && si.wProcessorArchitecture == PROCESSOR_ARCHITECTURE_AMD64) { + // Retrieve SYSTEM_INFO from GetNativeSystemInfo call so that we could + // find out whether we are running on 64 bit processor or not + SYSTEM_INFO si; + ZeroMemory(&si, sizeof(SYSTEM_INFO)); + os::Kernel32Dll::GetNativeSystemInfo(&si); + if (si.wProcessorArchitecture == PROCESSOR_ARCHITECTURE_AMD64) { st->print(" , 64 bit"); } - st->print(" Build %d", osvi.dwBuildNumber); - st->print(" %s", osvi.szCSDVersion); // service pack + st->print(" Build %d", build_number); + st->print(" (%d.%d.%d.%d)", major_version, minor_version, build_number, build_minor); st->cr(); } @@ -5394,11 +5421,6 @@ inline BOOL os::Kernel32Dll::Module32Next(HANDLE hSnapshot, return ::Module32Next(hSnapshot, lpme); } - -inline BOOL os::Kernel32Dll::GetNativeSystemInfoAvailable() { - return true; -} - inline void os::Kernel32Dll::GetNativeSystemInfo(LPSYSTEM_INFO lpSystemInfo) { ::GetNativeSystemInfo(lpSystemInfo); } diff --git a/hotspot/src/os/windows/vm/os_windows.hpp b/hotspot/src/os/windows/vm/os_windows.hpp index eb299ab36c9..9ef4d1d50b4 100644 --- a/hotspot/src/os/windows/vm/os_windows.hpp +++ b/hotspot/src/os/windows/vm/os_windows.hpp @@ -210,7 +210,6 @@ public: static BOOL Module32First(HANDLE,LPMODULEENTRY32); static BOOL Module32Next(HANDLE,LPMODULEENTRY32); - static BOOL GetNativeSystemInfoAvailable(); static void GetNativeSystemInfo(LPSYSTEM_INFO); // NUMA calls diff --git a/hotspot/src/share/tools/ProjectCreator/WinGammaPlatformVC10.java b/hotspot/src/share/tools/ProjectCreator/WinGammaPlatformVC10.java index 6d7ef1efcbe..543b0ddc88b 100644 --- a/hotspot/src/share/tools/ProjectCreator/WinGammaPlatformVC10.java +++ b/hotspot/src/share/tools/ProjectCreator/WinGammaPlatformVC10.java @@ -411,7 +411,7 @@ class CompilerInterfaceVC10 extends CompilerInterface { "/export:jio_vsnprintf "+ "/export:JVM_GetVersionInfo "+ "/export:JVM_InitAgentProperties"); - addAttr(rv, "AdditionalDependencies", "kernel32.lib;user32.lib;gdi32.lib;winspool.lib;comdlg32.lib;advapi32.lib;shell32.lib;ole32.lib;oleaut32.lib;uuid.lib;Wsock32.lib;winmm.lib;psapi.lib"); + addAttr(rv, "AdditionalDependencies", "kernel32.lib;user32.lib;gdi32.lib;winspool.lib;comdlg32.lib;advapi32.lib;shell32.lib;ole32.lib;oleaut32.lib;uuid.lib;Wsock32.lib;winmm.lib;psapi.lib;version.lib"); addAttr(rv, "OutputFile", outDll); addAttr(rv, "SuppressStartupBanner", "true"); addAttr(rv, "ModuleDefinitionFile", outDir+Util.sep+"vm.def"); From 8db9a55e68b09482553f08ed1b55c70c58e56e9d Mon Sep 17 00:00:00 2001 From: Igor Veresov Date: Tue, 4 Nov 2014 07:09:34 -1000 Subject: [PATCH 51/61] 8062591: SPARC PICL causes significantly longer startup times Optimize traversals of the PICL tree Reviewed-by: kvn --- .../vm/vm_version_solaris_sparc.cpp | 93 +++++++++++-------- 1 file changed, 52 insertions(+), 41 deletions(-) diff --git a/hotspot/src/os_cpu/solaris_sparc/vm/vm_version_solaris_sparc.cpp b/hotspot/src/os_cpu/solaris_sparc/vm/vm_version_solaris_sparc.cpp index b023ee4e0f3..2b1033496d7 100644 --- a/hotspot/src/os_cpu/solaris_sparc/vm/vm_version_solaris_sparc.cpp +++ b/hotspot/src/os_cpu/solaris_sparc/vm/vm_version_solaris_sparc.cpp @@ -36,8 +36,7 @@ #include #include -extern "C" static int PICL_get_l1_data_cache_line_size_helper(picl_nodehdl_t nodeh, void *result); -extern "C" static int PICL_get_l2_cache_line_size_helper(picl_nodehdl_t nodeh, void *result); +extern "C" static int PICL_visit_cpu_helper(picl_nodehdl_t nodeh, void *result); // Functions from the library we need (signatures should match those in picl.h) extern "C" { @@ -130,60 +129,74 @@ class PICL { bool is_inconsistent() { return _state == INCONSISTENT; } void set_inconsistent() { _state = INCONSISTENT; } - static int visit(picl_nodehdl_t nodeh, const char* name, void *arg) { - UniqueValueVisitor *state = static_cast(arg); - PICL* picl = state->_picl; - assert(!state->is_inconsistent(), "Precondition"); + void visit(picl_nodehdl_t nodeh, const char* name) { + assert(!is_inconsistent(), "Precondition"); int curr; - if (picl->get_int_property(nodeh, name, &curr) == PICL_SUCCESS) { - if (!state->is_assigned()) { // first iteration - state->set_value(curr); - } else if (curr != state->value()) { // following iterations - state->set_inconsistent(); + if (_picl->get_int_property(nodeh, name, &curr) == PICL_SUCCESS) { + if (!is_assigned()) { // first iteration + set_value(curr); + } else if (curr != value()) { // following iterations + set_inconsistent(); } } - if (state->is_inconsistent()) { + } + }; + + class CPUVisitor { + UniqueValueVisitor _l1_visitor; + UniqueValueVisitor _l2_visitor; + int _limit; // number of times visit() can be run + public: + CPUVisitor(PICL *picl, int limit) : _l1_visitor(picl), _l2_visitor(picl), _limit(limit) {} + static int visit(picl_nodehdl_t nodeh, void *arg) { + CPUVisitor *cpu_visitor = static_cast(arg); + UniqueValueVisitor* l1_visitor = cpu_visitor->l1_visitor(); + UniqueValueVisitor* l2_visitor = cpu_visitor->l2_visitor(); + if (!l1_visitor->is_inconsistent()) { + l1_visitor->visit(nodeh, "l1-dcache-line-size"); + } + if (!l2_visitor->is_inconsistent()) { + l2_visitor->visit(nodeh, "l2-cache-line-size"); + } + + if (l1_visitor->is_inconsistent() && l2_visitor->is_inconsistent()) { + return PICL_WALK_TERMINATE; + } + cpu_visitor->_limit--; + if (cpu_visitor->_limit <= 0) { return PICL_WALK_TERMINATE; } return PICL_WALK_CONTINUE; } + UniqueValueVisitor* l1_visitor() { return &_l1_visitor; } + UniqueValueVisitor* l2_visitor() { return &_l2_visitor; } }; - int _L1_data_cache_line_size; int _L2_cache_line_size; public: - static int get_l1_data_cache_line_size(picl_nodehdl_t nodeh, void *state) { - return UniqueValueVisitor::visit(nodeh, "l1-dcache-line-size", state); - } - static int get_l2_cache_line_size(picl_nodehdl_t nodeh, void *state) { - return UniqueValueVisitor::visit(nodeh, "l2-cache-line-size", state); + static int visit_cpu(picl_nodehdl_t nodeh, void *state) { + return CPUVisitor::visit(nodeh, state); } - PICL() : _L1_data_cache_line_size(0), _L2_cache_line_size(0), _dl_handle(NULL) { + PICL(bool is_fujitsu) : _L1_data_cache_line_size(0), _L2_cache_line_size(0), _dl_handle(NULL) { if (!open_library()) { return; } if (_picl_initialize() == PICL_SUCCESS) { picl_nodehdl_t rooth; if (_picl_get_root(&rooth) == PICL_SUCCESS) { - UniqueValueVisitor L1_state(this); - // Visit all "cpu" class instances - _picl_walk_tree_by_class(rooth, "cpu", &L1_state, PICL_get_l1_data_cache_line_size_helper); - if (L1_state.is_initial()) { // Still initial, iteration found no values - // Try walk all "core" class instances, it might be a Fujitsu machine - _picl_walk_tree_by_class(rooth, "core", &L1_state, PICL_get_l1_data_cache_line_size_helper); + const char* cpu_class = "cpu"; + // If it's a Fujitsu machine, it's a "core" + if (is_fujitsu) { + cpu_class = "core"; } - if (L1_state.is_assigned()) { // Is there a value? - _L1_data_cache_line_size = L1_state.value(); + CPUVisitor cpu_visitor(this, os::processor_count()); + _picl_walk_tree_by_class(rooth, cpu_class, &cpu_visitor, PICL_visit_cpu_helper); + if (cpu_visitor.l1_visitor()->is_assigned()) { // Is there a value? + _L1_data_cache_line_size = cpu_visitor.l1_visitor()->value(); } - - UniqueValueVisitor L2_state(this); - _picl_walk_tree_by_class(rooth, "cpu", &L2_state, PICL_get_l2_cache_line_size_helper); - if (L2_state.is_initial()) { - _picl_walk_tree_by_class(rooth, "core", &L2_state, PICL_get_l2_cache_line_size_helper); - } - if (L2_state.is_assigned()) { - _L2_cache_line_size = L2_state.value(); + if (cpu_visitor.l2_visitor()->is_assigned()) { + _L2_cache_line_size = cpu_visitor.l2_visitor()->value(); } } _picl_shutdown(); @@ -195,11 +208,9 @@ public: unsigned int L2_cache_line_size() const { return _L2_cache_line_size; } }; -extern "C" static int PICL_get_l1_data_cache_line_size_helper(picl_nodehdl_t nodeh, void *result) { - return PICL::get_l1_data_cache_line_size(nodeh, result); -} -extern "C" static int PICL_get_l2_cache_line_size_helper(picl_nodehdl_t nodeh, void *result) { - return PICL::get_l2_cache_line_size(nodeh, result); + +extern "C" static int PICL_visit_cpu_helper(picl_nodehdl_t nodeh, void *result) { + return PICL::visit_cpu(nodeh, result); } template @@ -418,7 +429,7 @@ int VM_Version::platform_features(int features) { } // Figure out cache line sizes using PICL - PICL picl; + PICL picl((features & sparc64_family_m) != 0); _L1_data_cache_line_size = picl.L1_data_cache_line_size(); _L2_cache_line_size = picl.L2_cache_line_size(); From d934df8a8401e1f3b4ce6a92f30e795ce8379095 Mon Sep 17 00:00:00 2001 From: Christian Tornqvist Date: Wed, 5 Nov 2014 13:18:51 -0800 Subject: [PATCH 52/61] 8061733: [TESTBUG] Exclude tests that have issues with Jigsaw M2 changes [TESTBUG] Exclude tests that have issues with Jigsaw M2 changes Reviewed-by: lfoltan, gtriantafill --- hotspot/test/runtime/7194254/Test7194254.java | 1 + 1 file changed, 1 insertion(+) diff --git a/hotspot/test/runtime/7194254/Test7194254.java b/hotspot/test/runtime/7194254/Test7194254.java index 356077b3bd7..08f55e55b22 100644 --- a/hotspot/test/runtime/7194254/Test7194254.java +++ b/hotspot/test/runtime/7194254/Test7194254.java @@ -27,6 +27,7 @@ * @summary Creates several threads with different java priorities and checks * whether jstack reports correct priorities for them. * + * @ignore 8060219 * @run main Test7194254 */ From 76971f377bdf10102a9f75205d7acdf316c8905d Mon Sep 17 00:00:00 2001 From: Christian Tornqvist Date: Wed, 5 Nov 2014 13:20:09 -0800 Subject: [PATCH 53/61] 8058251: assert(_count > 0) failed: Negative counter when running runtime/NMT/MallocTrackingVerify.java Fixed an issue when overflowing the MallocSite hash table bucket Reviewed-by: coleenp, gtriantafill --- hotspot/src/share/vm/prims/whitebox.cpp | 4 +- hotspot/src/share/vm/runtime/os.cpp | 17 ----- .../src/share/vm/services/mallocTracker.cpp | 30 ++------ .../src/share/vm/services/mallocTracker.hpp | 70 +++++-------------- .../vm/services/mallocTracker.inline.hpp | 7 -- hotspot/test/TEST.groups | 1 - .../test/runtime/NMT/UnsafeMallocLimit.java | 50 ------------- .../test/runtime/NMT/UnsafeMallocLimit2.java | 54 -------------- 8 files changed, 27 insertions(+), 206 deletions(-) delete mode 100644 hotspot/test/runtime/NMT/UnsafeMallocLimit.java delete mode 100644 hotspot/test/runtime/NMT/UnsafeMallocLimit2.java diff --git a/hotspot/src/share/vm/prims/whitebox.cpp b/hotspot/src/share/vm/prims/whitebox.cpp index c4cf7088e69..edb50cafeda 100644 --- a/hotspot/src/share/vm/prims/whitebox.cpp +++ b/hotspot/src/share/vm/prims/whitebox.cpp @@ -282,7 +282,7 @@ WB_END // NMT picks it up correctly WB_ENTRY(jlong, WB_NMTMalloc(JNIEnv* env, jobject o, jlong size)) jlong addr = 0; - addr = (jlong)(uintptr_t)os::malloc(size, mtTest); + addr = (jlong)(uintptr_t)os::malloc(size, mtTest); return addr; WB_END @@ -291,7 +291,7 @@ WB_END WB_ENTRY(jlong, WB_NMTMallocWithPseudoStack(JNIEnv* env, jobject o, jlong size, jint pseudo_stack)) address pc = (address)(size_t)pseudo_stack; NativeCallStack stack(&pc, 1); - return (jlong)os::malloc(size, mtTest, stack); + return (jlong)(uintptr_t)os::malloc(size, mtTest, stack); WB_END // Free the memory allocated by NMTAllocTest diff --git a/hotspot/src/share/vm/runtime/os.cpp b/hotspot/src/share/vm/runtime/os.cpp index 8d7450b1d97..1e632f4d543 100644 --- a/hotspot/src/share/vm/runtime/os.cpp +++ b/hotspot/src/share/vm/runtime/os.cpp @@ -571,17 +571,6 @@ void* os::malloc(size_t size, MEMFLAGS memflags, const NativeCallStack& stack) { NOT_PRODUCT(inc_stat_counter(&num_mallocs, 1)); NOT_PRODUCT(inc_stat_counter(&alloc_bytes, size)); -#if INCLUDE_NMT - // NMT can not track malloc allocation size > MAX_MALLOC_SIZE, which is - // (1GB - 1) on 32-bit system. It is not an issue on 64-bit system, where - // MAX_MALLOC_SIZE = ((1 << 62) - 1). - // VM code does not have such large malloc allocation. However, it can come - // Unsafe call. - if (MemTracker::tracking_level() >= NMT_summary && size > MAX_MALLOC_SIZE) { - return NULL; - } -#endif - #ifdef ASSERT // checking for the WatcherThread and crash_protection first // since os::malloc can be called when the libjvm.{dll,so} is @@ -652,12 +641,6 @@ void* os::realloc(void *memblock, size_t size, MEMFLAGS flags) { } void* os::realloc(void *memblock, size_t size, MEMFLAGS memflags, const NativeCallStack& stack) { -#if INCLUDE_NMT - // See comments in os::malloc() above - if (MemTracker::tracking_level() >= NMT_summary && size > MAX_MALLOC_SIZE) { - return NULL; - } -#endif #ifndef ASSERT NOT_PRODUCT(inc_stat_counter(&num_mallocs, 1)); diff --git a/hotspot/src/share/vm/services/mallocTracker.cpp b/hotspot/src/share/vm/services/mallocTracker.cpp index a5d8d1f7ffd..dc4f08f94a6 100644 --- a/hotspot/src/share/vm/services/mallocTracker.cpp +++ b/hotspot/src/share/vm/services/mallocTracker.cpp @@ -72,7 +72,7 @@ void MallocHeader::release() const { MallocMemorySummary::record_free(size(), flags()); MallocMemorySummary::record_free_malloc_header(sizeof(MallocHeader)); - if (tracking_level() == NMT_detail) { + if (MemTracker::tracking_level() == NMT_detail) { MallocSiteTable::deallocation_at(size(), _bucket_idx, _pos_idx); } } @@ -128,36 +128,18 @@ void* MallocTracker::record_malloc(void* malloc_base, size_t size, MEMFLAGS flag } // Uses placement global new operator to initialize malloc header - switch(level) { - case NMT_off: - return malloc_base; - case NMT_minimal: { - MallocHeader* hdr = ::new (malloc_base) MallocHeader(); - break; - } - case NMT_summary: { - assert(size <= MAX_MALLOC_SIZE, "malloc size overrun for NMT"); - header = ::new (malloc_base) MallocHeader(size, flags); - break; - } - case NMT_detail: { - assert(size <= MAX_MALLOC_SIZE, "malloc size overrun for NMT"); - header = ::new (malloc_base) MallocHeader(size, flags, stack); - break; - } - default: - ShouldNotReachHere(); + + if (level == NMT_off) { + return malloc_base; } + + header = ::new (malloc_base)MallocHeader(size, flags, stack, level); memblock = (void*)((char*)malloc_base + sizeof(MallocHeader)); // The alignment check: 8 bytes alignment for 32 bit systems. // 16 bytes alignment for 64-bit systems. assert(((size_t)memblock & (sizeof(size_t) * 2 - 1)) == 0, "Alignment check"); - // Sanity check - assert(get_memory_tracking_level(memblock) == level, - "Wrong tracking level"); - #ifdef ASSERT if (level > NMT_minimal) { // Read back diff --git a/hotspot/src/share/vm/services/mallocTracker.hpp b/hotspot/src/share/vm/services/mallocTracker.hpp index 6d7efabea8d..00f1b0027d5 100644 --- a/hotspot/src/share/vm/services/mallocTracker.hpp +++ b/hotspot/src/share/vm/services/mallocTracker.hpp @@ -239,68 +239,46 @@ class MallocMemorySummary : AllStatic { class MallocHeader VALUE_OBJ_CLASS_SPEC { #ifdef _LP64 - size_t _size : 62; - size_t _level : 2; + size_t _size : 64; size_t _flags : 8; size_t _pos_idx : 16; size_t _bucket_idx: 40; #define MAX_MALLOCSITE_TABLE_SIZE ((size_t)1 << 40) #define MAX_BUCKET_LENGTH ((size_t)(1 << 16)) -#define MAX_MALLOC_SIZE (((size_t)1 << 62) - 1) #else - size_t _size : 30; - size_t _level : 2; + size_t _size : 32; size_t _flags : 8; size_t _pos_idx : 8; size_t _bucket_idx: 16; #define MAX_MALLOCSITE_TABLE_SIZE ((size_t)(1 << 16)) #define MAX_BUCKET_LENGTH ((size_t)(1 << 8)) -// Max malloc size = 1GB - 1 on 32 bit system, such has total 4GB memory -#define MAX_MALLOC_SIZE ((size_t)(1 << 30) - 1) #endif // _LP64 public: - // Summary tracking header - MallocHeader(size_t size, MEMFLAGS flags) { + MallocHeader(size_t size, MEMFLAGS flags, const NativeCallStack& stack, NMT_TrackingLevel level) { assert(sizeof(MallocHeader) == sizeof(void*) * 2, "Wrong header size"); - _level = NMT_summary; - _flags = flags; - set_size(size); - MallocMemorySummary::record_malloc(size, flags); - MallocMemorySummary::record_new_malloc_header(sizeof(MallocHeader)); - } - // Detail tracking header - MallocHeader(size_t size, MEMFLAGS flags, const NativeCallStack& stack) { - assert(sizeof(MallocHeader) == sizeof(void*) * 2, - "Wrong header size"); - - _level = NMT_detail; - _flags = flags; - set_size(size); - size_t bucket_idx; - size_t pos_idx; - if (record_malloc_site(stack, size, &bucket_idx, &pos_idx)) { - assert(bucket_idx <= MAX_MALLOCSITE_TABLE_SIZE, "Overflow bucket index"); - assert(pos_idx <= MAX_BUCKET_LENGTH, "Overflow bucket position index"); - _bucket_idx = bucket_idx; - _pos_idx = pos_idx; + if (level == NMT_minimal) { + return; } + + _flags = flags; + set_size(size); + if (level == NMT_detail) { + size_t bucket_idx; + size_t pos_idx; + if (record_malloc_site(stack, size, &bucket_idx, &pos_idx)) { + assert(bucket_idx <= MAX_MALLOCSITE_TABLE_SIZE, "Overflow bucket index"); + assert(pos_idx <= MAX_BUCKET_LENGTH, "Overflow bucket position index"); + _bucket_idx = bucket_idx; + _pos_idx = pos_idx; + } + } + MallocMemorySummary::record_malloc(size, flags); MallocMemorySummary::record_new_malloc_header(sizeof(MallocHeader)); } - // Minimal tracking header - MallocHeader() { - assert(sizeof(MallocHeader) == sizeof(void*) * 2, - "Wrong header size"); - - _level = (unsigned short)NMT_minimal; - } - - inline NMT_TrackingLevel tracking_level() const { - return (NMT_TrackingLevel)_level; - } inline size_t size() const { return _size; } inline MEMFLAGS flags() const { return (MEMFLAGS)_flags; } @@ -311,7 +289,6 @@ class MallocHeader VALUE_OBJ_CLASS_SPEC { private: inline void set_size(size_t size) { - assert(size <= MAX_MALLOC_SIZE, "Malloc size too large, should use virtual memory?"); _size = size; } bool record_malloc_site(const NativeCallStack& stack, size_t size, @@ -347,10 +324,6 @@ class MallocTracker : AllStatic { // Record free on specified memory block static void* record_free(void* memblock); - // Get tracking level of specified memory block - static inline NMT_TrackingLevel get_memory_tracking_level(void* memblock); - - // Offset memory address to header address static inline void* get_base(void* memblock); static inline void* get_base(void* memblock, NMT_TrackingLevel level) { @@ -361,16 +334,12 @@ class MallocTracker : AllStatic { // Get memory size static inline size_t get_size(void* memblock) { MallocHeader* header = malloc_header(memblock); - assert(header->tracking_level() >= NMT_summary, - "Wrong tracking level"); return header->size(); } // Get memory type static inline MEMFLAGS get_flags(void* memblock) { MallocHeader* header = malloc_header(memblock); - assert(header->tracking_level() >= NMT_summary, - "Wrong tracking level"); return header->flags(); } @@ -394,7 +363,6 @@ class MallocTracker : AllStatic { static inline MallocHeader* malloc_header(void *memblock) { assert(memblock != NULL, "NULL pointer"); MallocHeader* header = (MallocHeader*)((char*)memblock - sizeof(MallocHeader)); - assert(header->tracking_level() >= NMT_minimal, "Bad header"); return header; } }; diff --git a/hotspot/src/share/vm/services/mallocTracker.inline.hpp b/hotspot/src/share/vm/services/mallocTracker.inline.hpp index 338295b6566..e8203bbc54e 100644 --- a/hotspot/src/share/vm/services/mallocTracker.inline.hpp +++ b/hotspot/src/share/vm/services/mallocTracker.inline.hpp @@ -28,13 +28,6 @@ #include "services/mallocTracker.hpp" #include "services/memTracker.hpp" -inline NMT_TrackingLevel MallocTracker::get_memory_tracking_level(void* memblock) { - assert(memblock != NULL, "Sanity check"); - if (MemTracker::tracking_level() == NMT_off) return NMT_off; - MallocHeader* header = malloc_header(memblock); - return header->tracking_level(); -} - inline void* MallocTracker::get_base(void* memblock){ return get_base(memblock, MemTracker::tracking_level()); } diff --git a/hotspot/test/TEST.groups b/hotspot/test/TEST.groups index 051e2e3fa3b..577c04abd84 100644 --- a/hotspot/test/TEST.groups +++ b/hotspot/test/TEST.groups @@ -87,7 +87,6 @@ needs_jdk = \ runtime/NMT/SummarySanityCheck.java \ runtime/NMT/ThreadedMallocTestType.java \ runtime/NMT/ThreadedVirtualAllocTestType.java \ - runtime/NMT/UnsafeMallocLimit.java \ runtime/NMT/VirtualAllocCommitUncommitRecommit.java \ runtime/NMT/VirtualAllocTestType.java \ runtime/RedefineObject/TestRedefineObject.java \ diff --git a/hotspot/test/runtime/NMT/UnsafeMallocLimit.java b/hotspot/test/runtime/NMT/UnsafeMallocLimit.java deleted file mode 100644 index 1df1f8eb37b..00000000000 --- a/hotspot/test/runtime/NMT/UnsafeMallocLimit.java +++ /dev/null @@ -1,50 +0,0 @@ -/* - * Copyright (c) 2014, Oracle and/or its affiliates. All rights reserved. - * DO NOT ALTER OR REMOVE COPYRIGHT NOTICES OR THIS FILE HEADER. - * - * This code is free software; you can redistribute it and/or modify it - * under the terms of the GNU General Public License version 2 only, as - * published by the Free Software Foundation. - * - * This code is distributed in the hope that it will be useful, but WITHOUT - * ANY WARRANTY; without even the implied warranty of MERCHANTABILITY or - * FITNESS FOR A PARTICULAR PURPOSE. See the GNU General Public License - * version 2 for more details (a copy is included in the LICENSE file that - * accompanied this code). - * - * You should have received a copy of the GNU General Public License version - * 2 along with this work; if not, write to the Free Software Foundation, - * Inc., 51 Franklin St, Fifth Floor, Boston, MA 02110-1301 USA. - * - * Please contact Oracle, 500 Oracle Parkway, Redwood Shores, CA 94065 USA - * or visit www.oracle.com if you need additional information or have any - * questions. - */ - -/* - * @test - * @bug 8055289 - * @library /testlibrary - * @build UnsafeMallocLimit - * @run main/othervm -Xmx32m -XX:NativeMemoryTracking=summary UnsafeMallocLimit - */ - -import com.oracle.java.testlibrary.*; -import sun.misc.Unsafe; - -public class UnsafeMallocLimit { - - public static void main(String args[]) throws Exception { - if (Platform.is32bit()) { - Unsafe unsafe = Utils.getUnsafe(); - try { - unsafe.allocateMemory(1 << 30); - throw new RuntimeException("Did not get expected OOME"); - } catch (OutOfMemoryError e) { - // Expected exception - } - } else { - System.out.println("Test only valid on 32-bit platforms"); - } - } -} diff --git a/hotspot/test/runtime/NMT/UnsafeMallocLimit2.java b/hotspot/test/runtime/NMT/UnsafeMallocLimit2.java deleted file mode 100644 index 003c8e8ca80..00000000000 --- a/hotspot/test/runtime/NMT/UnsafeMallocLimit2.java +++ /dev/null @@ -1,54 +0,0 @@ -/* - * Copyright (c) 2014, Oracle and/or its affiliates. All rights reserved. - * DO NOT ALTER OR REMOVE COPYRIGHT NOTICES OR THIS FILE HEADER. - * - * This code is free software; you can redistribute it and/or modify it - * under the terms of the GNU General Public License version 2 only, as - * published by the Free Software Foundation. - * - * This code is distributed in the hope that it will be useful, but WITHOUT - * ANY WARRANTY; without even the implied warranty of MERCHANTABILITY or - * FITNESS FOR A PARTICULAR PURPOSE. See the GNU General Public License - * version 2 for more details (a copy is included in the LICENSE file that - * accompanied this code). - * - * You should have received a copy of the GNU General Public License version - * 2 along with this work; if not, write to the Free Software Foundation, - * Inc., 51 Franklin St, Fifth Floor, Boston, MA 02110-1301 USA. - * - * Please contact Oracle, 500 Oracle Parkway, Redwood Shores, CA 94065 USA - * or visit www.oracle.com if you need additional information or have any - * questions. - */ - -/* - * @test - * @bug 8058818 - * @library /testlibrary - * @build UnsafeMallocLimit2 - * @run main/othervm -Xmx32m -XX:NativeMemoryTracking=off UnsafeMallocLimit2 - */ - -import com.oracle.java.testlibrary.*; -import sun.misc.Unsafe; - -public class UnsafeMallocLimit2 { - - public static void main(String args[]) throws Exception { - if (Platform.is32bit()) { - Unsafe unsafe = Utils.getUnsafe(); - try { - // Allocate greater than MALLOC_MAX and likely won't fail to allocate, - // so it hits the NMT code that asserted. - // Test that this doesn't cause an assertion with NMT off. - // The option above overrides if all the tests are run with NMT on. - unsafe.allocateMemory(0x40000000); - System.out.println("Allocation succeeded"); - } catch (OutOfMemoryError e) { - System.out.println("Allocation failed"); - } - } else { - System.out.println("Test only valid on 32-bit platforms"); - } - } -} From b4138cce106976d1a6005357ad0f98162bde9186 Mon Sep 17 00:00:00 2001 From: George Triantafillou Date: Wed, 5 Nov 2014 08:22:17 -0800 Subject: [PATCH 54/61] 8061969: [TESTBUG] MallocSiteHashOverflow.java should be enabled for 32-bit platforms Reviewed-by: ctornqvi, coleenp --- hotspot/src/share/vm/prims/whitebox.cpp | 17 ++++---- hotspot/test/TEST.ROOT | 1 + .../runtime/NMT/MallocSiteHashOverflow.java | 41 +++++++++++++------ .../whitebox/sun/hotspot/WhiteBox.java | 2 +- 4 files changed, 37 insertions(+), 24 deletions(-) diff --git a/hotspot/src/share/vm/prims/whitebox.cpp b/hotspot/src/share/vm/prims/whitebox.cpp index edb50cafeda..2913046b9e1 100644 --- a/hotspot/src/share/vm/prims/whitebox.cpp +++ b/hotspot/src/share/vm/prims/whitebox.cpp @@ -326,15 +326,6 @@ WB_ENTRY(jboolean, WB_NMTIsDetailSupported(JNIEnv* env)) return MemTracker::tracking_level() == NMT_detail; WB_END -WB_ENTRY(void, WB_NMTOverflowHashBucket(JNIEnv* env, jobject o, jlong num)) - address pc = (address)1; - for (jlong index = 0; index < num; index ++) { - NativeCallStack stack(&pc, 1); - os::malloc(0, mtTest, stack); - pc += MallocSiteTable::hash_buckets(); - } -WB_END - WB_ENTRY(jboolean, WB_NMTChangeTrackingLevel(JNIEnv* env)) // Test that we can downgrade NMT levels but not upgrade them. if (MemTracker::tracking_level() == NMT_off) { @@ -365,6 +356,12 @@ WB_ENTRY(jboolean, WB_NMTChangeTrackingLevel(JNIEnv* env)) return MemTracker::tracking_level() == NMT_minimal; } WB_END + +WB_ENTRY(jint, WB_NMTGetHashSize(JNIEnv* env, jobject o)) + int hash_size = MallocSiteTable::hash_buckets(); + assert(hash_size > 0, "NMT hash_size should be > 0"); + return (jint)hash_size; +WB_END #endif // INCLUDE_NMT static jmethodID reflected_method_to_jmid(JavaThread* thread, JNIEnv* env, jobject method) { @@ -998,9 +995,9 @@ static JNINativeMethod methods[] = { {CC"NMTCommitMemory", CC"(JJ)V", (void*)&WB_NMTCommitMemory }, {CC"NMTUncommitMemory", CC"(JJ)V", (void*)&WB_NMTUncommitMemory }, {CC"NMTReleaseMemory", CC"(JJ)V", (void*)&WB_NMTReleaseMemory }, - {CC"NMTOverflowHashBucket", CC"(J)V", (void*)&WB_NMTOverflowHashBucket}, {CC"NMTIsDetailSupported",CC"()Z", (void*)&WB_NMTIsDetailSupported}, {CC"NMTChangeTrackingLevel", CC"()Z", (void*)&WB_NMTChangeTrackingLevel}, + {CC"NMTGetHashSize", CC"()I", (void*)&WB_NMTGetHashSize }, #endif // INCLUDE_NMT {CC"deoptimizeAll", CC"()V", (void*)&WB_DeoptimizeAll }, {CC"deoptimizeMethod", CC"(Ljava/lang/reflect/Executable;Z)I", diff --git a/hotspot/test/TEST.ROOT b/hotspot/test/TEST.ROOT index 6bf9e9a9009..d9414f507e1 100644 --- a/hotspot/test/TEST.ROOT +++ b/hotspot/test/TEST.ROOT @@ -30,3 +30,4 @@ keys=cte_test jcmd nmt regression gc stress groups=TEST.groups [closed/TEST.groups] +requires.properties=sun.arch.data.model diff --git a/hotspot/test/runtime/NMT/MallocSiteHashOverflow.java b/hotspot/test/runtime/NMT/MallocSiteHashOverflow.java index 4868731526a..0e3109b52bb 100644 --- a/hotspot/test/runtime/NMT/MallocSiteHashOverflow.java +++ b/hotspot/test/runtime/NMT/MallocSiteHashOverflow.java @@ -24,41 +24,56 @@ /* * @test * @summary Test corner case that overflows malloc site hashtable bucket + * @requires sun.arch.data.model == "32" * @key nmt jcmd stress * @library /testlibrary /testlibrary/whitebox - * @ignore - This test is disabled since it will stress NMT and timeout during normal testing + * @ignore 8062870 * @build MallocSiteHashOverflow * @run main ClassFileInstaller sun.hotspot.WhiteBox - * @run main/othervm/timeout=480 -Xbootclasspath/a:. -XX:+UnlockDiagnosticVMOptions -XX:+WhiteBoxAPI -XX:NativeMemoryTracking=detail MallocSiteHashOverflow + * @run main/othervm -Xbootclasspath/a:. -XX:+UnlockDiagnosticVMOptions -XX:+WhiteBoxAPI -XX:NativeMemoryTracking=detail MallocSiteHashOverflow */ import com.oracle.java.testlibrary.*; import sun.hotspot.WhiteBox; public class MallocSiteHashOverflow { - private static long K = 1024; - public static void main(String args[]) throws Exception { - String vm_name = System.getProperty("java.vm.name"); + public static void main(String args[]) throws Exception { + + // Size of entries based on malloc tracking header defined in mallocTracker.hpp // For 32-bit systems, create 257 malloc sites with the same hash bucket to overflow a hash bucket - // For 64-bit systems, create 64K + 1 malloc sites with the same hash bucket to overflow a hash bucket long entries = 257; - if (Platform.is64bit()) { - entries = 64 * K + 1; - } OutputAnalyzer output; WhiteBox wb = WhiteBox.getWhiteBox(); + int MAX_HASH_SIZE = wb.NMTGetHashSize(); // Grab my own PID String pid = Integer.toString(ProcessTools.getProcessId()); ProcessBuilder pb = new ProcessBuilder(); - wb.NMTOverflowHashBucket(entries); - - // Run 'jcmd VM.native_memory summary' + // Verify that current tracking level is "detail" pb.command(new String[] { JDKToolFinder.getJDKTool("jcmd"), pid, "VM.native_memory", "statistics"}); output = new OutputAnalyzer(pb.start()); - output.shouldContain("Tracking level has been downgraded due to lack of resources"); + output.shouldContain("Native Memory Tracking Statistics"); + + // Attempt to cause NMT to downgrade tracking level by allocating small amounts + // of memory with random pseudo call stack + int pc = 1; + for (int i = 0; i < entries; i++) { + long addr = wb.NMTMallocWithPseudoStack(1, pc); + if (addr == 0) { + throw new RuntimeException("NMTMallocWithPseudoStack: out of memory"); + } + // We free memory here since it doesn't affect pseudo malloc alloc site hash table entries + wb.NMTFree(addr); + pc += MAX_HASH_SIZE; + if (i == entries) { + // Verify that tracking has been downgraded + pb.command(new String[] { JDKToolFinder.getJDKTool("jcmd"), pid, "VM.native_memory", "statistics"}); + output = new OutputAnalyzer(pb.start()); + output.shouldContain("Tracking level has been downgraded due to lack of resources"); + } + } } } diff --git a/hotspot/test/testlibrary/whitebox/sun/hotspot/WhiteBox.java b/hotspot/test/testlibrary/whitebox/sun/hotspot/WhiteBox.java index 0d4975d6dae..a5a07947954 100644 --- a/hotspot/test/testlibrary/whitebox/sun/hotspot/WhiteBox.java +++ b/hotspot/test/testlibrary/whitebox/sun/hotspot/WhiteBox.java @@ -98,10 +98,10 @@ public class WhiteBox { public native void NMTCommitMemory(long addr, long size); public native void NMTUncommitMemory(long addr, long size); public native void NMTReleaseMemory(long addr, long size); - public native void NMTOverflowHashBucket(long num); public native long NMTMallocWithPseudoStack(long size, int index); public native boolean NMTIsDetailSupported(); public native boolean NMTChangeTrackingLevel(); + public native int NMTGetHashSize(); // Compiler public native void deoptimizeAll(); From 7a414a2c7d95268ddfcbf0e403cb6587d0a3e94b Mon Sep 17 00:00:00 2001 From: Chris Plummer Date: Wed, 5 Nov 2014 13:00:59 -0800 Subject: [PATCH 55/61] 8043770: File leak in MemNotifyThread::start() in hotspot.src.os.linux.vm.os_linux.cpp Fixed by removing all code related to LowMemoryProtection, which removed offending code. Reviewed-by: dholmes, minqi --- hotspot/src/os/aix/vm/os_aix.cpp | 5 - hotspot/src/os/bsd/vm/os_bsd.cpp | 3 - hotspot/src/os/linux/vm/os_linux.cpp | 116 ----------------------- hotspot/src/os/solaris/vm/os_solaris.cpp | 4 - hotspot/src/os/windows/vm/os_windows.cpp | 4 - hotspot/src/share/vm/runtime/globals.hpp | 3 - hotspot/src/share/vm/runtime/os.hpp | 1 - hotspot/src/share/vm/runtime/thread.cpp | 3 - 8 files changed, 139 deletions(-) diff --git a/hotspot/src/os/aix/vm/os_aix.cpp b/hotspot/src/os/aix/vm/os_aix.cpp index fc873a11eed..551c44d8f0e 100644 --- a/hotspot/src/os/aix/vm/os_aix.cpp +++ b/hotspot/src/os/aix/vm/os_aix.cpp @@ -3829,11 +3829,6 @@ jint os::init_2(void) { return JNI_OK; } -// this is called at the end of vm_initialization -void os::init_3(void) { - return; -} - // Mark the polling page as unreadable void os::make_polling_page_unreadable(void) { if (!guard_memory((char*)_polling_page, Aix::page_size())) { diff --git a/hotspot/src/os/bsd/vm/os_bsd.cpp b/hotspot/src/os/bsd/vm/os_bsd.cpp index 24367e9c27f..b2f4c81c2d1 100644 --- a/hotspot/src/os/bsd/vm/os_bsd.cpp +++ b/hotspot/src/os/bsd/vm/os_bsd.cpp @@ -3635,9 +3635,6 @@ jint os::init_2(void) { return JNI_OK; } -// this is called at the end of vm_initialization -void os::init_3(void) { } - // Mark the polling page as unreadable void os::make_polling_page_unreadable(void) { if (!guard_memory((char*)_polling_page, Bsd::page_size())) { diff --git a/hotspot/src/os/linux/vm/os_linux.cpp b/hotspot/src/os/linux/vm/os_linux.cpp index 55c00068387..201f6cd3c67 100644 --- a/hotspot/src/os/linux/vm/os_linux.cpp +++ b/hotspot/src/os/linux/vm/os_linux.cpp @@ -163,35 +163,6 @@ static pthread_mutex_t dl_mutex; // Declarations static void unpackTime(timespec* absTime, bool isAbsolute, jlong time); -#ifdef JAVASE_EMBEDDED -class MemNotifyThread: public Thread { - friend class VMStructs; - public: - virtual void run(); - - private: - static MemNotifyThread* _memnotify_thread; - int _fd; - - public: - - // Constructor - MemNotifyThread(int fd); - - // Tester - bool is_memnotify_thread() const { return true; } - - // Printing - char* name() const { return (char*)"Linux MemNotify Thread"; } - - // Returns the single instance of the MemNotifyThread - static MemNotifyThread* memnotify_thread() { return _memnotify_thread; } - - // Create and start the single instance of MemNotifyThread - static void start(); -}; -#endif // JAVASE_EMBEDDED - // utility functions static int SR_initialize(); @@ -4866,17 +4837,6 @@ jint os::init_2(void) { return JNI_OK; } -// this is called at the end of vm_initialization -void os::init_3(void) { -#ifdef JAVASE_EMBEDDED - // Start the MemNotifyThread - if (LowMemoryProtection) { - MemNotifyThread::start(); - } - return; -#endif -} - // Mark the polling page as unreadable void os::make_polling_page_unreadable(void) { if (!guard_memory((char*)_polling_page, Linux::page_size())) { @@ -6033,82 +5993,6 @@ int os::get_core_path(char* buffer, size_t bufferSize) { return strlen(buffer); } -#ifdef JAVASE_EMBEDDED -// -// A thread to watch the '/dev/mem_notify' device, which will tell us when the OS is running low on memory. -// -MemNotifyThread* MemNotifyThread::_memnotify_thread = NULL; - -// ctor -// -MemNotifyThread::MemNotifyThread(int fd): Thread() { - assert(memnotify_thread() == NULL, "we can only allocate one MemNotifyThread"); - _fd = fd; - - if (os::create_thread(this, os::os_thread)) { - _memnotify_thread = this; - os::set_priority(this, NearMaxPriority); - os::start_thread(this); - } -} - -// Where all the work gets done -// -void MemNotifyThread::run() { - assert(this == memnotify_thread(), "expected the singleton MemNotifyThread"); - - // Set up the select arguments - fd_set rfds; - if (_fd != -1) { - FD_ZERO(&rfds); - FD_SET(_fd, &rfds); - } - - // Now wait for the mem_notify device to wake up - while (1) { - // Wait for the mem_notify device to signal us.. - int rc = select(_fd+1, _fd != -1 ? &rfds : NULL, NULL, NULL, NULL); - if (rc == -1) { - perror("select!\n"); - break; - } else if (rc) { - //ssize_t free_before = os::available_memory(); - //tty->print ("Notified: Free: %dK \n",os::available_memory()/1024); - - // The kernel is telling us there is not much memory left... - // try to do something about that - - // If we are not already in a GC, try one. - if (!Universe::heap()->is_gc_active()) { - Universe::heap()->collect(GCCause::_allocation_failure); - - //ssize_t free_after = os::available_memory(); - //tty->print ("Post-Notify: Free: %dK\n",free_after/1024); - //tty->print ("GC freed: %dK\n", (free_after - free_before)/1024); - } - // We might want to do something like the following if we find the GC's are not helping... - // Universe::heap()->size_policy()->set_gc_time_limit_exceeded(true); - } - } -} - -// See if the /dev/mem_notify device exists, and if so, start a thread to monitor it. -// -void MemNotifyThread::start() { - int fd; - fd = open("/dev/mem_notify", O_RDONLY, 0); - if (fd < 0) { - return; - } - - if (memnotify_thread() == NULL) { - new MemNotifyThread(fd); - } -} - -#endif // JAVASE_EMBEDDED - - /////////////// Unit tests /////////////// #ifndef PRODUCT diff --git a/hotspot/src/os/solaris/vm/os_solaris.cpp b/hotspot/src/os/solaris/vm/os_solaris.cpp index 6ff3fd0d129..fc5accc5aa0 100644 --- a/hotspot/src/os/solaris/vm/os_solaris.cpp +++ b/hotspot/src/os/solaris/vm/os_solaris.cpp @@ -4761,10 +4761,6 @@ jint os::init_2(void) { return JNI_OK; } -void os::init_3(void) { - return; -} - // Mark the polling page as unreadable void os::make_polling_page_unreadable(void) { if (mprotect((char *)_polling_page, page_size, PROT_NONE) != 0) { diff --git a/hotspot/src/os/windows/vm/os_windows.cpp b/hotspot/src/os/windows/vm/os_windows.cpp index 10c5a4079cb..e15d503c8a7 100644 --- a/hotspot/src/os/windows/vm/os_windows.cpp +++ b/hotspot/src/os/windows/vm/os_windows.cpp @@ -4140,10 +4140,6 @@ jint os::init_2(void) { return JNI_OK; } -void os::init_3(void) { - return; -} - // Mark the polling page as unreadable void os::make_polling_page_unreadable(void) { DWORD old_status; diff --git a/hotspot/src/share/vm/runtime/globals.hpp b/hotspot/src/share/vm/runtime/globals.hpp index e14b51baa1f..e74b9bbdf20 100644 --- a/hotspot/src/share/vm/runtime/globals.hpp +++ b/hotspot/src/share/vm/runtime/globals.hpp @@ -2066,9 +2066,6 @@ class CommandLineFlags { "Provide more detailed and expensive TLAB statistics " \ "(with PrintTLAB)") \ \ - EMBEDDED_ONLY(product(bool, LowMemoryProtection, true, \ - "Enable LowMemoryProtection")) \ - \ product_pd(bool, NeverActAsServerClassMachine, \ "Never act like a server-class machine") \ \ diff --git a/hotspot/src/share/vm/runtime/os.hpp b/hotspot/src/share/vm/runtime/os.hpp index 009e2f18c97..fa15d25b6c6 100644 --- a/hotspot/src/share/vm/runtime/os.hpp +++ b/hotspot/src/share/vm/runtime/os.hpp @@ -158,7 +158,6 @@ class os: AllStatic { static void init_globals(void) { // Called from init_globals() in init.cpp init_globals_ext(); } - static void init_3(void); // Called at the end of vm init // File names are case-insensitive on windows only // Override me as needed diff --git a/hotspot/src/share/vm/runtime/thread.cpp b/hotspot/src/share/vm/runtime/thread.cpp index 8266c545cf1..7fe6391da6f 100644 --- a/hotspot/src/share/vm/runtime/thread.cpp +++ b/hotspot/src/share/vm/runtime/thread.cpp @@ -3617,9 +3617,6 @@ jint Threads::create_vm(JavaVMInitArgs* args, bool* canTryAgain) { } } - // Give os specific code one last chance to start - os::init_3(); - create_vm_timer.end(); #ifdef ASSERT _vm_complete = true; From 54e9fee4d2d57693ecb0dbc8cf9400e4ec21f220 Mon Sep 17 00:00:00 2001 From: Jeremy Manson Date: Wed, 5 Nov 2014 16:47:37 -0800 Subject: [PATCH 56/61] 8062116: JVMTI GetClassMethods is Slow Allocate enough space for all jmethodids; make adding a jmethodid O(1) Reviewed-by: coleenp, rasbold, sspitsyn --- hotspot/src/share/vm/oops/instanceKlass.cpp | 19 +++ hotspot/src/share/vm/oops/instanceKlass.hpp | 1 + hotspot/src/share/vm/oops/method.cpp | 153 ++++++++++++++------ hotspot/src/share/vm/oops/method.hpp | 5 + hotspot/src/share/vm/prims/jvmtiEnv.cpp | 32 +++- 5 files changed, 166 insertions(+), 44 deletions(-) diff --git a/hotspot/src/share/vm/oops/instanceKlass.cpp b/hotspot/src/share/vm/oops/instanceKlass.cpp index 8414dbe2090..ab925e46acb 100644 --- a/hotspot/src/share/vm/oops/instanceKlass.cpp +++ b/hotspot/src/share/vm/oops/instanceKlass.cpp @@ -1730,6 +1730,25 @@ jmethodID InstanceKlass::get_jmethod_id(instanceKlassHandle ik_h, methodHandle m return id; } +// Figure out how many jmethodIDs haven't been allocated, and make +// sure space for them is pre-allocated. This makes getting all +// method ids much, much faster with classes with more than 8 +// methods, and has a *substantial* effect on performance with jvmti +// code that loads all jmethodIDs for all classes. +void InstanceKlass::ensure_space_for_methodids(int start_offset) { + int new_jmeths = 0; + int length = methods()->length(); + for (int index = start_offset; index < length; index++) { + Method* m = methods()->at(index); + jmethodID id = m->find_jmethod_id_or_null(); + if (id == NULL) { + new_jmeths++; + } + } + if (new_jmeths != 0) { + Method::ensure_jmethod_ids(class_loader_data(), new_jmeths); + } +} // Common code to fetch the jmethodID from the cache or update the // cache with the new jmethodID. This function should never do anything diff --git a/hotspot/src/share/vm/oops/instanceKlass.hpp b/hotspot/src/share/vm/oops/instanceKlass.hpp index 73ffe5eeb7a..a34a8dc5dbf 100644 --- a/hotspot/src/share/vm/oops/instanceKlass.hpp +++ b/hotspot/src/share/vm/oops/instanceKlass.hpp @@ -698,6 +698,7 @@ class InstanceKlass: public Klass { jmethodID** to_dealloc_jmeths_p); static void get_jmethod_id_length_value(jmethodID* cache, size_t idnum, size_t *length_p, jmethodID* id_p); + void ensure_space_for_methodids(int start_offset = 0); jmethodID jmethod_id_or_null(Method* method); // annotations support diff --git a/hotspot/src/share/vm/oops/method.cpp b/hotspot/src/share/vm/oops/method.cpp index dc26304685a..d46f8c4d92f 100644 --- a/hotspot/src/share/vm/oops/method.cpp +++ b/hotspot/src/share/vm/oops/method.cpp @@ -1727,59 +1727,98 @@ void BreakpointInfo::clear(Method* method) { // jmethodID handling // This is a block allocating object, sort of like JNIHandleBlock, only a -// lot simpler. There aren't many of these, they aren't long, they are rarely -// deleted and so we can do some suboptimal things. +// lot simpler. // It's allocated on the CHeap because once we allocate a jmethodID, we can // never get rid of it. -// It would be nice to be able to parameterize the number of methods for -// the null_class_loader but then we'd have to turn this and ClassLoaderData -// into templates. -// I feel like this brain dead class should exist somewhere in the STL +static const int min_block_size = 8; + +class JNIMethodBlockNode : public CHeapObj { + friend class JNIMethodBlock; + Method** _methods; + int _number_of_methods; + int _top; + JNIMethodBlockNode* _next; + + public: + + JNIMethodBlockNode(int num_methods = min_block_size); + + ~JNIMethodBlockNode() { FREE_C_HEAP_ARRAY(Method*, _methods, mtInternal); } + + void ensure_methods(int num_addl_methods) { + if (_top < _number_of_methods) { + num_addl_methods -= _number_of_methods - _top; + if (num_addl_methods <= 0) { + return; + } + } + if (_next == NULL) { + _next = new JNIMethodBlockNode(MAX2(num_addl_methods, min_block_size)); + } else { + _next->ensure_methods(num_addl_methods); + } + } +}; class JNIMethodBlock : public CHeapObj { - enum { number_of_methods = 8 }; - - Method* _methods[number_of_methods]; - int _top; - JNIMethodBlock* _next; + JNIMethodBlockNode _head; + JNIMethodBlockNode *_last_free; public: static Method* const _free_method; - JNIMethodBlock() : _next(NULL), _top(0) { - for (int i = 0; i< number_of_methods; i++) _methods[i] = _free_method; + JNIMethodBlock(int initial_capacity = min_block_size) + : _head(initial_capacity), _last_free(&_head) {} + + void ensure_methods(int num_addl_methods) { + _last_free->ensure_methods(num_addl_methods); } Method** add_method(Method* m) { - if (_top < number_of_methods) { - // top points to the next free entry. - int i = _top; - _methods[i] = m; - _top++; - return &_methods[i]; - } else if (_top == number_of_methods) { - // if the next free entry ran off the block see if there's a free entry - for (int i = 0; i< number_of_methods; i++) { - if (_methods[i] == _free_method) { - _methods[i] = m; - return &_methods[i]; + for (JNIMethodBlockNode* b = _last_free; b != NULL; b = b->_next) { + if (b->_top < b->_number_of_methods) { + // top points to the next free entry. + int i = b->_top; + b->_methods[i] = m; + b->_top++; + _last_free = b; + return &(b->_methods[i]); + } else if (b->_top == b->_number_of_methods) { + // if the next free entry ran off the block see if there's a free entry + for (int i = 0; i < b->_number_of_methods; i++) { + if (b->_methods[i] == _free_method) { + b->_methods[i] = m; + _last_free = b; + return &(b->_methods[i]); + } } + // Only check each block once for frees. They're very unlikely. + // Increment top past the end of the block. + b->_top++; + } + // need to allocate a next block. + if (b->_next == NULL) { + b->_next = _last_free = new JNIMethodBlockNode(); } - // Only check each block once for frees. They're very unlikely. - // Increment top past the end of the block. - _top++; } - // need to allocate a next block. - if (_next == NULL) { - _next = new JNIMethodBlock(); - } - return _next->add_method(m); + guarantee(false, "Should always allocate a free block"); + return NULL; } bool contains(Method** m) { - for (JNIMethodBlock* b = this; b != NULL; b = b->_next) { - for (int i = 0; i< number_of_methods; i++) { - if (&(b->_methods[i]) == m) { + if (m == NULL) return false; + for (JNIMethodBlockNode* b = &_head; b != NULL; b = b->_next) { + if (b->_methods <= m && m < b->_methods + b->_number_of_methods) { + // This is a bit of extra checking, for two reasons. One is + // that contains() deals with pointers that are passed in by + // JNI code, so making sure that the pointer is aligned + // correctly is valuable. The other is that <= and > are + // technically not defined on pointers, so the if guard can + // pass spuriously; no modern compiler is likely to make that + // a problem, though (and if one did, the guard could also + // fail spuriously, which would be bad). + ptrdiff_t idx = m - b->_methods; + if (b->_methods + idx == m) { return true; } } @@ -1798,9 +1837,9 @@ class JNIMethodBlock : public CHeapObj { // During class unloading the methods are cleared, which is different // than freed. void clear_all_methods() { - for (JNIMethodBlock* b = this; b != NULL; b = b->_next) { - for (int i = 0; i< number_of_methods; i++) { - _methods[i] = NULL; + for (JNIMethodBlockNode* b = &_head; b != NULL; b = b->_next) { + for (int i = 0; i< b->_number_of_methods; i++) { + b->_methods[i] = NULL; } } } @@ -1808,9 +1847,9 @@ class JNIMethodBlock : public CHeapObj { int count_methods() { // count all allocated methods int count = 0; - for (JNIMethodBlock* b = this; b != NULL; b = b->_next) { - for (int i = 0; i< number_of_methods; i++) { - if (_methods[i] != _free_method) count++; + for (JNIMethodBlockNode* b = &_head; b != NULL; b = b->_next) { + for (int i = 0; i< b->_number_of_methods; i++) { + if (b->_methods[i] != _free_method) count++; } } return count; @@ -1821,6 +1860,36 @@ class JNIMethodBlock : public CHeapObj { // Something that can't be mistaken for an address or a markOop Method* const JNIMethodBlock::_free_method = (Method*)55; +JNIMethodBlockNode::JNIMethodBlockNode(int num_methods) : _next(NULL), _top(0) { + _number_of_methods = MAX2(num_methods, min_block_size); + _methods = NEW_C_HEAP_ARRAY(Method*, _number_of_methods, mtInternal); + for (int i = 0; i < _number_of_methods; i++) { + _methods[i] = JNIMethodBlock::_free_method; + } +} + +void Method::ensure_jmethod_ids(ClassLoaderData* loader_data, int capacity) { + ClassLoaderData* cld = loader_data; + if (!SafepointSynchronize::is_at_safepoint()) { + // Have to add jmethod_ids() to class loader data thread-safely. + // Also have to add the method to the list safely, which the cld lock + // protects as well. + MutexLockerEx ml(cld->metaspace_lock(), Mutex::_no_safepoint_check_flag); + if (cld->jmethod_ids() == NULL) { + cld->set_jmethod_ids(new JNIMethodBlock(capacity)); + } else { + cld->jmethod_ids()->ensure_methods(capacity); + } + } else { + // At safepoint, we are single threaded and can set this. + if (cld->jmethod_ids() == NULL) { + cld->set_jmethod_ids(new JNIMethodBlock(capacity)); + } else { + cld->jmethod_ids()->ensure_methods(capacity); + } + } +} + // Add a method id to the jmethod_ids jmethodID Method::make_jmethod_id(ClassLoaderData* loader_data, Method* m) { ClassLoaderData* cld = loader_data; diff --git a/hotspot/src/share/vm/oops/method.hpp b/hotspot/src/share/vm/oops/method.hpp index 89a5916e944..b2b4d791fc9 100644 --- a/hotspot/src/share/vm/oops/method.hpp +++ b/hotspot/src/share/vm/oops/method.hpp @@ -729,6 +729,11 @@ class Method : public Metadata { static jmethodID make_jmethod_id(ClassLoaderData* loader_data, Method* mh); static void destroy_jmethod_id(ClassLoaderData* loader_data, jmethodID mid); + // Ensure there is enough capacity in the internal tracking data + // structures to hold the number of jmethodIDs you plan to generate. + // This saves substantial time doing allocations. + static void ensure_jmethod_ids(ClassLoaderData* loader_data, int capacity); + // Use resolve_jmethod_id() in situations where the caller is expected // to provide a valid jmethodID; the only sanity checks are in asserts; // result guaranteed not to be NULL. diff --git a/hotspot/src/share/vm/prims/jvmtiEnv.cpp b/hotspot/src/share/vm/prims/jvmtiEnv.cpp index 7d6b121e5fa..840fd65cc85 100644 --- a/hotspot/src/share/vm/prims/jvmtiEnv.cpp +++ b/hotspot/src/share/vm/prims/jvmtiEnv.cpp @@ -2263,6 +2263,8 @@ JvmtiEnv::GetClassMethods(oop k_mirror, jint* method_count_ptr, jmethodID** meth int result_length = instanceK_h->methods()->length(); jmethodID* result_list = (jmethodID*)jvmtiMalloc(result_length * sizeof(jmethodID)); int index; + bool jmethodids_found = true; + if (JvmtiExport::can_maintain_original_method_order()) { // Use the original method ordering indices stored in the class, so we can emit // jmethodIDs in the order they appeared in the class file @@ -2270,14 +2272,40 @@ JvmtiEnv::GetClassMethods(oop k_mirror, jint* method_count_ptr, jmethodID** meth Method* m = instanceK_h->methods()->at(index); int original_index = instanceK_h->method_ordering()->at(index); assert(original_index >= 0 && original_index < result_length, "invalid original method index"); - jmethodID id = m->jmethod_id(); + jmethodID id; + if (jmethodids_found) { + id = m->find_jmethod_id_or_null(); + if (id == NULL) { + // If we find an uninitialized value, make sure there is + // enough space for all the uninitialized values we might + // find. + instanceK_h->ensure_space_for_methodids(index); + jmethodids_found = false; + id = m->jmethod_id(); + } + } else { + id = m->jmethod_id(); + } result_list[original_index] = id; } } else { // otherwise just copy in any order for (index = 0; index < result_length; index++) { Method* m = instanceK_h->methods()->at(index); - jmethodID id = m->jmethod_id(); + jmethodID id; + if (jmethodids_found) { + id = m->find_jmethod_id_or_null(); + if (id == NULL) { + // If we find an uninitialized value, make sure there is + // enough space for all the uninitialized values we might + // find. + instanceK_h->ensure_space_for_methodids(index); + jmethodids_found = false; + id = m->jmethod_id(); + } + } else { + id = m->jmethod_id(); + } result_list[index] = id; } } From 4af87513d4908f0c3f85ae077284ddb6ff71e446 Mon Sep 17 00:00:00 2001 From: Albert Noll Date: Thu, 6 Nov 2014 07:27:25 +0100 Subject: [PATCH 57/61] 8062735: CodeCacheSweeperThread missing from SA Make SA aware of the code cache sweeper thread Reviewed-by: kvn, coleenp, sspitsyn --- .../runtime/CodeCacheSweeperThread.java | 41 +++++++++++++++++++ .../sun/jvm/hotspot/runtime/JavaThread.java | 7 ++-- .../sun/jvm/hotspot/runtime/Thread.java | 15 +++---- .../sun/jvm/hotspot/runtime/Threads.java | 5 ++- .../sun/jvm/hotspot/utilities/soql/sa.js | 1 + hotspot/src/share/vm/runtime/vmStructs.cpp | 1 + 6 files changed, 58 insertions(+), 12 deletions(-) create mode 100644 hotspot/agent/src/share/classes/sun/jvm/hotspot/runtime/CodeCacheSweeperThread.java diff --git a/hotspot/agent/src/share/classes/sun/jvm/hotspot/runtime/CodeCacheSweeperThread.java b/hotspot/agent/src/share/classes/sun/jvm/hotspot/runtime/CodeCacheSweeperThread.java new file mode 100644 index 00000000000..72877516b65 --- /dev/null +++ b/hotspot/agent/src/share/classes/sun/jvm/hotspot/runtime/CodeCacheSweeperThread.java @@ -0,0 +1,41 @@ +/* + * Copyright (c) 2000, 2014, Oracle and/or its affiliates. All rights reserved. + * DO NOT ALTER OR REMOVE COPYRIGHT NOTICES OR THIS FILE HEADER. + * + * This code is free software; you can redistribute it and/or modify it + * under the terms of the GNU General Public License version 2 only, as + * published by the Free Software Foundation. + * + * This code is distributed in the hope that it will be useful, but WITHOUT + * ANY WARRANTY; without even the implied warranty of MERCHANTABILITY or + * FITNESS FOR A PARTICULAR PURPOSE. See the GNU General Public License + * version 2 for more details (a copy is included in the LICENSE file that + * accompanied this code). + * + * You should have received a copy of the GNU General Public License version + * 2 along with this work; if not, write to the Free Software Foundation, + * Inc., 51 Franklin St, Fifth Floor, Boston, MA 02110-1301 USA. + * + * Please contact Oracle, 500 Oracle Parkway, Redwood Shores, CA 94065 USA + * or visit www.oracle.com if you need additional information or have any + * questions. + * + */ + +package sun.jvm.hotspot.runtime; + +import java.io.*; +import java.util.*; +import sun.jvm.hotspot.debugger.*; +import sun.jvm.hotspot.types.*; + +public class CodeCacheSweeperThread extends JavaThread { + public CodeCacheSweeperThread(Address addr) { + super(addr); + } + + public boolean isJavaThread() { return false; } + public boolean isHiddenFromExternalView() { return true; } + public boolean isCodeCacheSweeperThread() { return true; } + +} diff --git a/hotspot/agent/src/share/classes/sun/jvm/hotspot/runtime/JavaThread.java b/hotspot/agent/src/share/classes/sun/jvm/hotspot/runtime/JavaThread.java index 926c11c4bad..a6f04042184 100644 --- a/hotspot/agent/src/share/classes/sun/jvm/hotspot/runtime/JavaThread.java +++ b/hotspot/agent/src/share/classes/sun/jvm/hotspot/runtime/JavaThread.java @@ -118,9 +118,10 @@ public class JavaThread extends Thread { return VM.getVM().getThreads().createJavaThreadWrapper(threadAddr); } - /** NOTE: for convenience, this differs in definition from the - underlying VM. Only "pure" JavaThreads return true; - CompilerThreads and JVMDIDebuggerThreads return false. FIXME: + /** NOTE: for convenience, this differs in definition from the underlying VM. + Only "pure" JavaThreads return true; CompilerThreads, the CodeCacheSweeperThread, + JVMDIDebuggerThreads return false. + FIXME: consider encapsulating platform-specific functionality in an object instead of using inheritance (which is the primary reason we can't traverse CompilerThreads, etc; didn't want to have, for diff --git a/hotspot/agent/src/share/classes/sun/jvm/hotspot/runtime/Thread.java b/hotspot/agent/src/share/classes/sun/jvm/hotspot/runtime/Thread.java index 03c426ba84a..5b47b2a40e2 100644 --- a/hotspot/agent/src/share/classes/sun/jvm/hotspot/runtime/Thread.java +++ b/hotspot/agent/src/share/classes/sun/jvm/hotspot/runtime/Thread.java @@ -111,14 +111,15 @@ public class Thread extends VMObject { return allocatedBytesField.getValue(addr); } - public boolean isVMThread() { return false; } - public boolean isJavaThread() { return false; } - public boolean isCompilerThread() { return false; } - public boolean isHiddenFromExternalView() { return false; } - public boolean isJvmtiAgentThread() { return false; } - public boolean isWatcherThread() { return false; } + public boolean isVMThread() { return false; } + public boolean isJavaThread() { return false; } + public boolean isCompilerThread() { return false; } + public boolean isCodeCacheSweeperThread() { return false; } + public boolean isHiddenFromExternalView() { return false; } + public boolean isJvmtiAgentThread() { return false; } + public boolean isWatcherThread() { return false; } public boolean isConcurrentMarkSweepThread() { return false; } - public boolean isServiceThread() { return false; } + public boolean isServiceThread() { return false; } /** Memory operations */ public void oopsDo(AddressVisitor oopVisitor) { diff --git a/hotspot/agent/src/share/classes/sun/jvm/hotspot/runtime/Threads.java b/hotspot/agent/src/share/classes/sun/jvm/hotspot/runtime/Threads.java index b4b5903d139..3b6a53c5302 100644 --- a/hotspot/agent/src/share/classes/sun/jvm/hotspot/runtime/Threads.java +++ b/hotspot/agent/src/share/classes/sun/jvm/hotspot/runtime/Threads.java @@ -120,6 +120,7 @@ public class Threads { virtualConstructor.addMapping("JavaThread", JavaThread.class); if (!VM.getVM().isCore()) { virtualConstructor.addMapping("CompilerThread", CompilerThread.class); + virtualConstructor.addMapping("CodeCacheSweeperThread", CodeCacheSweeperThread.class); } // for now, use JavaThread itself. fix it later with appropriate class if needed virtualConstructor.addMapping("SurrogateLockerThread", JavaThread.class); @@ -164,7 +165,7 @@ public class Threads { return thread; } catch (Exception e) { throw new RuntimeException("Unable to deduce type of thread from address " + threadAddr + - " (expected type JavaThread, CompilerThread, ServiceThread, JvmtiAgentThread, or SurrogateLockerThread)", e); + " (expected type JavaThread, CompilerThread, ServiceThread, JvmtiAgentThread, SurrogateLockerThread, or CodeCacheSweeperThread)", e); } } @@ -201,7 +202,7 @@ public class Threads { public List getPendingThreads(ObjectMonitor monitor) { List pendingThreads = new ArrayList(); for (JavaThread thread = first(); thread != null; thread = thread.next()) { - if (thread.isCompilerThread()) { + if (thread.isCompilerThread() || thread.isCodeCacheSweeperThread()) { continue; } ObjectMonitor pending = thread.getCurrentPendingMonitor(); diff --git a/hotspot/agent/src/share/classes/sun/jvm/hotspot/utilities/soql/sa.js b/hotspot/agent/src/share/classes/sun/jvm/hotspot/utilities/soql/sa.js index 14a8e9aa137..58515933a3e 100644 --- a/hotspot/agent/src/share/classes/sun/jvm/hotspot/utilities/soql/sa.js +++ b/hotspot/agent/src/share/classes/sun/jvm/hotspot/utilities/soql/sa.js @@ -836,6 +836,7 @@ vmType2Class["InterpreterCodelet"] = sapkg.interpreter.InterpreterCodelet; // Java Threads vmType2Class["JavaThread"] = sapkg.runtime.JavaThread; vmType2Class["CompilerThread"] = sapkg.runtime.CompilerThread; +vmType2Class["CodeCacheSweeperThread"] = sapkg.runtime.CodeCacheSweeperThread; vmType2Class["SurrogateLockerThread"] = sapkg.runtime.JavaThread; vmType2Class["DebuggerThread"] = sapkg.runtime.DebuggerThread; diff --git a/hotspot/src/share/vm/runtime/vmStructs.cpp b/hotspot/src/share/vm/runtime/vmStructs.cpp index c81cd8a2c9a..6bb6394841b 100644 --- a/hotspot/src/share/vm/runtime/vmStructs.cpp +++ b/hotspot/src/share/vm/runtime/vmStructs.cpp @@ -1594,6 +1594,7 @@ typedef TwoOopHashtable SymbolTwoOopHashtable; declare_type(JvmtiAgentThread, JavaThread) \ declare_type(ServiceThread, JavaThread) \ declare_type(CompilerThread, JavaThread) \ + declare_type(CodeCacheSweeperThread, JavaThread) \ declare_toplevel_type(OSThread) \ declare_toplevel_type(JavaFrameAnchor) \ \ From af50fa526b598e1042408ecad97be3a3f6ef9d0a Mon Sep 17 00:00:00 2001 From: David Buck Date: Wed, 5 Nov 2014 23:37:17 -0800 Subject: [PATCH 58/61] 8058715: stability issues when being launched as an embedded JVM via JNI Use mmap call without MAP_FIXED so we avoid corrupting already allocated memory Reviewed-by: coleenp, dsimms --- hotspot/src/os_cpu/linux_x86/vm/os_linux_x86.cpp | 2 +- 1 file changed, 1 insertion(+), 1 deletion(-) diff --git a/hotspot/src/os_cpu/linux_x86/vm/os_linux_x86.cpp b/hotspot/src/os_cpu/linux_x86/vm/os_linux_x86.cpp index 136d8066dd4..4f69c6ad43a 100644 --- a/hotspot/src/os_cpu/linux_x86/vm/os_linux_x86.cpp +++ b/hotspot/src/os_cpu/linux_x86/vm/os_linux_x86.cpp @@ -910,7 +910,7 @@ void os::workaround_expand_exec_shield_cs_limit() { */ char* hint = (char*) (Linux::initial_thread_stack_bottom() - ((StackYellowPages + StackRedPages + 1) * page_size)); - char* codebuf = os::reserve_memory(page_size, hint); + char* codebuf = os::attempt_reserve_memory_at(page_size, hint); if ( (codebuf == NULL) || (!os::commit_memory(codebuf, page_size, true)) ) { return; // No matter, we tried, best effort. } From 6553ede9c3f1e9c1e204918cf5ecc273babc88ff Mon Sep 17 00:00:00 2001 From: Roger Riggs Date: Mon, 10 Nov 2014 09:58:12 -0500 Subject: [PATCH 59/61] 8064372: CompileJavaModules overwrites settings from custom Reviewed-by: mchung, erikj --- make/CompileJavaModules.gmk | 13 ++++++------- 1 file changed, 6 insertions(+), 7 deletions(-) diff --git a/make/CompileJavaModules.gmk b/make/CompileJavaModules.gmk index 3ef60a4fc04..20ae9c9f073 100644 --- a/make/CompileJavaModules.gmk +++ b/make/CompileJavaModules.gmk @@ -245,7 +245,6 @@ java.sql.rowset_CLEAN_FILES := $(wildcard \ ################################################################################ # Exclude building of IIOP transport for RMI Connector -java.management_EXCLUDES := com/sun/jmx/remote/protocol/iiop ifeq ($(RMICONNECTOR_IIOP), false) java.management_EXCLUDES += com/sun/jmx/remote/protocol/iiop @@ -264,11 +263,11 @@ java.corba_SETUP := GENERATE_JDKBYTECODE_NOWARNINGS java.corba_COPY := .prp java.corba_CLEAN := .properties -java.corba_EXCLUDES := \ +java.corba_EXCLUDES += \ com/sun/corba/se/PortableActivationIDL \ com/sun/tools/corba/se/logutil \ # -java.corba_EXCLUDE_FILES := \ +java.corba_EXCLUDE_FILES += \ com/sun/corba/se/impl/presentation/rmi/JNDIStateFactoryImpl.java \ com/sun/corba/se/spi/presentation/rmi/StubWrapper.java \ com/sun/org/omg/CORBA/IDLTypeOperations.java \ @@ -350,12 +349,12 @@ SCTP_IMPL_CLASSES = \ $(JDK_TOPDIR)/src/jdk.sctp/unix/classes/sun/nio/ch/sctp/Shutdown.java ifeq ($(OPENJDK_TARGET_OS), macosx) - jdk.sctp_EXCLUDE_FILES := $(SCTP_IMPL_CLASSES) + jdk.sctp_EXCLUDE_FILES += $(SCTP_IMPL_CLASSES) endif ifeq ($(OPENJDK_TARGET_OS),aix) # These files are duplicated in AIX_SRC_DIRS - jdk.sctp_EXCLUDE_FILES := $(SCTP_IMPL_CLASSES) + jdk.sctp_EXCLUDE_FILES += $(SCTP_IMPL_CLASSES) endif ################################################################################ @@ -373,7 +372,7 @@ jdk.compiler_CLEAN_FILES := $(wildcard \ ################################################################################ -jdk.jdi_EXCLUDES := \ +jdk.jdi_EXCLUDES += \ com/sun/tools/example/debug/bdi \ com/sun/tools/example/debug/event \ com/sun/tools/example/debug/gui \ @@ -414,7 +413,7 @@ sun.charsets_COPY := .dat jdk.localedata_COPY := _dict _th # Exclude BreakIterator classes that are just used in compile process to generate # data files and shouldn't go in the product -jdk.localedata_EXCLUDE_FILES := sun/text/resources/th/BreakIteratorRules_th.java +jdk.localedata_EXCLUDE_FILES += sun/text/resources/th/BreakIteratorRules_th.java ################################################################################ # Setup the compilation of each module From ba04eee49ba8a19e1b74b72a66e621eea9c700fb Mon Sep 17 00:00:00 2001 From: David Katleman Date: Wed, 12 Nov 2014 20:32:22 -0800 Subject: [PATCH 60/61] Added tag jdk9-b39 for changeset 940ac2683a10 --- .hgtags-top-repo | 1 + 1 file changed, 1 insertion(+) diff --git a/.hgtags-top-repo b/.hgtags-top-repo index 72d6aa0a02b..a5f58b034a6 100644 --- a/.hgtags-top-repo +++ b/.hgtags-top-repo @@ -281,3 +281,4 @@ c173ba994245380fb11ef077d1e59823386840eb jdk9-b35 201d4e235d597a25a2d3ee1404394789ba386119 jdk9-b36 723a67b0c442391447b1d8aad8b249d06d1032e8 jdk9-b37 d42c0a90afc3c66ca87543076ec9aafd4b4680de jdk9-b38 +512dbbeb1730edcebfec873fc3f1455660b32000 jdk9-b39 From e6c564c97f0410549d3968d7538c5c72a1028867 Mon Sep 17 00:00:00 2001 From: David Katleman Date: Wed, 12 Nov 2014 20:32:23 -0800 Subject: [PATCH 61/61] Added tag jdk9-b39 for changeset 4d506c3aaee1 --- hotspot/.hgtags | 1 + 1 file changed, 1 insertion(+) diff --git a/hotspot/.hgtags b/hotspot/.hgtags index 4d511d872c6..ec88eae37e7 100644 --- a/hotspot/.hgtags +++ b/hotspot/.hgtags @@ -441,3 +441,4 @@ af46576a8d7cb4003028b8ee8bf408cfe227315b jdk9-b32 464ab653fbb17eb518d8ef60f8df301de7ef00d0 jdk9-b36 b1c2dd843f247a1db19e1e85eb62ca405f72dc26 jdk9-b37 c363a8b87e477ee45d6d3cb2a36cb365141bc596 jdk9-b38 +9cb75e5e394827ccbaf2e15524108a412dc4ddc5 jdk9-b39